instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2033>?
The molecular formula for <BB_2033> (CCc1csc(B(O)O)c1) is C6H9BO2S.
Describe the ring structures in building block <BB_2033>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2033>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2033>.
**Token:** <BB_2033> **SMILES:** CCc1csc(B(O)O)c1 **Molecular Formula:** C6H9BO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2034>.
CC(C)n1cc(N)c(OCCC(F)(F)F)n1.Cl
What is the building block token for the following molecule?
CC(C)n1cc(N)c(OCCC(F)(F)F)n1.Cl
<BB_2034>
What is the molecular formula for <BB_2034>?
The molecular formula for <BB_2034> (CC(C)n1cc(N)c(OCCC(F)(F)F)n1.Cl) is C9H15ClF3N3O.
Describe the ring structures in building block <BB_2034>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2034>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2034>.
**Token:** <BB_2034> **SMILES:** CC(C)n1cc(N)c(OCCC(F)(F)F)n1.Cl **Molecular Formula:** C9H15ClF3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2035>.
Cc1cc(CCN)no1
What is the building block token for the following molecule?
Cc1cc(CCN)no1
<BB_2035>
What is the molecular formula for <BB_2035>?
The molecular formula for <BB_2035> (Cc1cc(CCN)no1) is C6H10N2O.
Describe the ring structures in building block <BB_2035>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2035>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2035>.
**Token:** <BB_2035> **SMILES:** Cc1cc(CCN)no1 **Molecular Formula:** C6H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2036>.
Cc1ccc(S(=O)(=O)[C@@H]2CCCC[C@H]2N)cc1.Cl
What is the building block token for the following molecule?
Cc1ccc(S(=O)(=O)[C@@H]2CCCC[C@H]2N)cc1.Cl
<BB_2036>
What is the molecular formula for <BB_2036>?
The molecular formula for <BB_2036> (Cc1ccc(S(=O)(=O)[C@@H]2CCCC[C@H]2N)cc1.Cl) is C13H20ClNO2S.
Describe the ring structures in building block <BB_2036>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2036>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2036>.
**Token:** <BB_2036> **SMILES:** Cc1ccc(S(=O)(=O)[C@@H]2CCCC[C@H]2N)cc1.Cl **Molecular Formula:** C13H20ClNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2037>.
CC1CCNCC1NC(=O)C(F)(F)F
What is the building block token for the following molecule?
CC1CCNCC1NC(=O)C(F)(F)F
<BB_2037>
What is the molecular formula for <BB_2037>?
The molecular formula for <BB_2037> (CC1CCNCC1NC(=O)C(F)(F)F) is C8H13F3N2O.
Describe the ring structures in building block <BB_2037>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2037>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2037>.
**Token:** <BB_2037> **SMILES:** CC1CCNCC1NC(=O)C(F)(F)F **Molecular Formula:** C8H13F3N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2038>.
CCOC(=O)c1cc2cc(Cl)ccc2[nH]c1=O
What is the building block token for the following molecule?
CCOC(=O)c1cc2cc(Cl)ccc2[nH]c1=O
<BB_2038>
What is the molecular formula for <BB_2038>?
The molecular formula for <BB_2038> (CCOC(=O)c1cc2cc(Cl)ccc2[nH]c1=O) is C12H10ClNO3.
Describe the ring structures in building block <BB_2038>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2038>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2038>.
**Token:** <BB_2038> **SMILES:** CCOC(=O)c1cc2cc(Cl)ccc2[nH]c1=O **Molecular Formula:** C12H10ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2039>.
COC(=O)c1cnn(CCN)c1.Cl
What is the building block token for the following molecule?
COC(=O)c1cnn(CCN)c1.Cl
<BB_2039>
What is the molecular formula for <BB_2039>?
The molecular formula for <BB_2039> (COC(=O)c1cnn(CCN)c1.Cl) is C7H12ClN3O2.
Describe the ring structures in building block <BB_2039>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2039>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2039>.
**Token:** <BB_2039> **SMILES:** COC(=O)c1cnn(CCN)c1.Cl **Molecular Formula:** C7H12ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2040>.
CC1(C)OB(c2ccc(F)cc2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2ccc(F)cc2)OC1(C)C
<BB_2040>
What is the molecular formula for <BB_2040>?
The molecular formula for <BB_2040> (CC1(C)OB(c2ccc(F)cc2)OC1(C)C) is C12H16BFO2.
Describe the ring structures in building block <BB_2040>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2040>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2040>.
**Token:** <BB_2040> **SMILES:** CC1(C)OB(c2ccc(F)cc2)OC1(C)C **Molecular Formula:** C12H16BFO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2041>.
NC(=O)c1ccnc(Cl)c1
What is the building block token for the following molecule?
NC(=O)c1ccnc(Cl)c1
<BB_2041>
What is the molecular formula for <BB_2041>?
The molecular formula for <BB_2041> (NC(=O)c1ccnc(Cl)c1) is C6H5ClN2O.
Describe the ring structures in building block <BB_2041>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2041>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2041>.
**Token:** <BB_2041> **SMILES:** NC(=O)c1ccnc(Cl)c1 **Molecular Formula:** C6H5ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2042>.
CC(C)(C)OC(=O)N1CC(C=O)C2(COC2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(C=O)C2(COC2)C1
<BB_2042>
What is the molecular formula for <BB_2042>?
The molecular formula for <BB_2042> (CC(C)(C)OC(=O)N1CC(C=O)C2(COC2)C1) is C12H19NO4.
Describe the ring structures in building block <BB_2042>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2042>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2042>.
**Token:** <BB_2042> **SMILES:** CC(C)(C)OC(=O)N1CC(C=O)C2(COC2)C1 **Molecular Formula:** C12H19NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2043>.
CC(C)(C)OC(=O)N1CCC(C)([B-](F)(F)F)CC1.[K+]
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(C)([B-](F)(F)F)CC1.[K+]
<BB_2043>
What is the molecular formula for <BB_2043>?
The molecular formula for <BB_2043> (CC(C)(C)OC(=O)N1CCC(C)([B-](F)(F)F)CC1.[K+]) is C11H20BF3KNO2.
Describe the ring structures in building block <BB_2043>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2043>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2043>.
**Token:** <BB_2043> **SMILES:** CC(C)(C)OC(=O)N1CCC(C)([B-](F)(F)F)CC1.[K+] **Molecular Formula:** C11H20BF3KNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2044>.
Cc1ccc(CN)nc1.Cl.Cl
What is the building block token for the following molecule?
Cc1ccc(CN)nc1.Cl.Cl
<BB_2044>
What is the molecular formula for <BB_2044>?
The molecular formula for <BB_2044> (Cc1ccc(CN)nc1.Cl.Cl) is C7H12Cl2N2.
Describe the ring structures in building block <BB_2044>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2044>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2044>.
**Token:** <BB_2044> **SMILES:** Cc1ccc(CN)nc1.Cl.Cl **Molecular Formula:** C7H12Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2045>.
O=S(=O)(Cl)c1cnc2c(F)cccc2c1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cnc2c(F)cccc2c1
<BB_2045>
What is the molecular formula for <BB_2045>?
The molecular formula for <BB_2045> (O=S(=O)(Cl)c1cnc2c(F)cccc2c1) is C9H5ClFNO2S.
Describe the ring structures in building block <BB_2045>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2045>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2045>.
**Token:** <BB_2045> **SMILES:** O=S(=O)(Cl)c1cnc2c(F)cccc2c1 **Molecular Formula:** C9H5ClFNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2046>.
FC(F)(F)c1cc2nc(Cl)ccn2n1
What is the building block token for the following molecule?
FC(F)(F)c1cc2nc(Cl)ccn2n1
<BB_2046>
What is the molecular formula for <BB_2046>?
The molecular formula for <BB_2046> (FC(F)(F)c1cc2nc(Cl)ccn2n1) is C7H3ClF3N3.
Describe the ring structures in building block <BB_2046>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2046>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2046>.
**Token:** <BB_2046> **SMILES:** FC(F)(F)c1cc2nc(Cl)ccn2n1 **Molecular Formula:** C7H3ClF3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2047>.
CC1(C2CCC2)CNC1.Cl
What is the building block token for the following molecule?
CC1(C2CCC2)CNC1.Cl
<BB_2047>
What is the molecular formula for <BB_2047>?
The molecular formula for <BB_2047> (CC1(C2CCC2)CNC1.Cl) is C8H16ClN.
Describe the ring structures in building block <BB_2047>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2047>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2047>.
**Token:** <BB_2047> **SMILES:** CC1(C2CCC2)CNC1.Cl **Molecular Formula:** C8H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2048>.
FC1(Br)CC1
What is the building block token for the following molecule?
FC1(Br)CC1
<BB_2048>
What is the molecular formula for <BB_2048>?
The molecular formula for <BB_2048> (FC1(Br)CC1) is C3H4BrF.
Describe the ring structures in building block <BB_2048>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2048>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2048>.
**Token:** <BB_2048> **SMILES:** FC1(Br)CC1 **Molecular Formula:** C3H4BrF **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2049>.
COC(=O)C1CCCCCCN1
What is the building block token for the following molecule?
COC(=O)C1CCCCCCN1
<BB_2049>
What is the molecular formula for <BB_2049>?
The molecular formula for <BB_2049> (COC(=O)C1CCCCCCN1) is C9H17NO2.
Describe the ring structures in building block <BB_2049>.
The molecule contains 1 ring(s): an aliphatic ring of size 8.
List the primary functional groups present in <BB_2049>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2049>.
**Token:** <BB_2049> **SMILES:** COC(=O)C1CCCCCCN1 **Molecular Formula:** C9H17NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 8. **Functional Groups:** Secondary Amine, Ester, Ether