instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2050>.
O=C(O)Cc1c[nH]c2cc(F)ccc12
What is the building block token for the following molecule?
O=C(O)Cc1c[nH]c2cc(F)ccc12
<BB_2050>
What is the molecular formula for <BB_2050>?
The molecular formula for <BB_2050> (O=C(O)Cc1c[nH]c2cc(F)ccc12) is C10H8FNO2.
Describe the ring structures in building block <BB_2050>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2050>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2050>.
**Token:** <BB_2050> **SMILES:** O=C(O)Cc1c[nH]c2cc(F)ccc12 **Molecular Formula:** C10H8FNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2051>.
O=Cc1ccc(OC(F)F)cc1
What is the building block token for the following molecule?
O=Cc1ccc(OC(F)F)cc1
<BB_2051>
What is the molecular formula for <BB_2051>?
The molecular formula for <BB_2051> (O=Cc1ccc(OC(F)F)cc1) is C8H6F2O2.
Describe the ring structures in building block <BB_2051>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2051>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2051>.
**Token:** <BB_2051> **SMILES:** O=Cc1ccc(OC(F)F)cc1 **Molecular Formula:** C8H6F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2052>.
Clc1nnc(Cl)c2cc(Br)ccc12
What is the building block token for the following molecule?
Clc1nnc(Cl)c2cc(Br)ccc12
<BB_2052>
What is the molecular formula for <BB_2052>?
The molecular formula for <BB_2052> (Clc1nnc(Cl)c2cc(Br)ccc12) is C8H3BrCl2N2.
Describe the ring structures in building block <BB_2052>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2052>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2052>.
**Token:** <BB_2052> **SMILES:** Clc1nnc(Cl)c2cc(Br)ccc12 **Molecular Formula:** C8H3BrCl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2053>.
Cc1nc(Br)oc1CO
What is the building block token for the following molecule?
Cc1nc(Br)oc1CO
<BB_2053>
What is the molecular formula for <BB_2053>?
The molecular formula for <BB_2053> (Cc1nc(Br)oc1CO) is C5H6BrNO2.
Describe the ring structures in building block <BB_2053>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2053>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2053>.
**Token:** <BB_2053> **SMILES:** Cc1nc(Br)oc1CO **Molecular Formula:** C5H6BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2054>.
Cl.NCCc1ccc(F)c(Cl)c1
What is the building block token for the following molecule?
Cl.NCCc1ccc(F)c(Cl)c1
<BB_2054>
What is the molecular formula for <BB_2054>?
The molecular formula for <BB_2054> (Cl.NCCc1ccc(F)c(Cl)c1) is C8H10Cl2FN.
Describe the ring structures in building block <BB_2054>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2054>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2054>.
**Token:** <BB_2054> **SMILES:** Cl.NCCc1ccc(F)c(Cl)c1 **Molecular Formula:** C8H10Cl2FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2055>.
CC(C)(C)OC(=O)CCCCCCCO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)CCCCCCCO
<BB_2055>
What is the molecular formula for <BB_2055>?
The molecular formula for <BB_2055> (CC(C)(C)OC(=O)CCCCCCCO) is C12H24O3.
Describe the ring structures in building block <BB_2055>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2055>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2055>.
**Token:** <BB_2055> **SMILES:** CC(C)(C)OC(=O)CCCCCCCO **Molecular Formula:** C12H24O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2056>.
Cl.FC(F)(F)c1cccc(CC2CCNC2)c1
What is the building block token for the following molecule?
Cl.FC(F)(F)c1cccc(CC2CCNC2)c1
<BB_2056>
What is the molecular formula for <BB_2056>?
The molecular formula for <BB_2056> (Cl.FC(F)(F)c1cccc(CC2CCNC2)c1) is C12H15ClF3N.
Describe the ring structures in building block <BB_2056>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2056>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2056>.
**Token:** <BB_2056> **SMILES:** Cl.FC(F)(F)c1cccc(CC2CCNC2)c1 **Molecular Formula:** C12H15ClF3N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2057>.
NC(=O)c1nccc(Cl)n1
What is the building block token for the following molecule?
NC(=O)c1nccc(Cl)n1
<BB_2057>
What is the molecular formula for <BB_2057>?
The molecular formula for <BB_2057> (NC(=O)c1nccc(Cl)n1) is C5H4ClN3O.
Describe the ring structures in building block <BB_2057>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2057>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2057>.
**Token:** <BB_2057> **SMILES:** NC(=O)c1nccc(Cl)n1 **Molecular Formula:** C5H4ClN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2058>.
CCn1c(C)cc(C(=O)CN=[N+]=[N-])c1C
What is the building block token for the following molecule?
CCn1c(C)cc(C(=O)CN=[N+]=[N-])c1C
<BB_2058>
What is the molecular formula for <BB_2058>?
The molecular formula for <BB_2058> (CCn1c(C)cc(C(=O)CN=[N+]=[N-])c1C) is C10H14N4O.
Describe the ring structures in building block <BB_2058>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2058>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2058>.
**Token:** <BB_2058> **SMILES:** CCn1c(C)cc(C(=O)CN=[N+]=[N-])c1C **Molecular Formula:** C10H14N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2059>.
COc1ccccc1CCC=O
What is the building block token for the following molecule?
COc1ccccc1CCC=O
<BB_2059>
What is the molecular formula for <BB_2059>?
The molecular formula for <BB_2059> (COc1ccccc1CCC=O) is C10H12O2.
Describe the ring structures in building block <BB_2059>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2059>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2059>.
**Token:** <BB_2059> **SMILES:** COc1ccccc1CCC=O **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2060>.
Cc1cn(CCCC(=O)O)nc1C(F)(F)F
What is the building block token for the following molecule?
Cc1cn(CCCC(=O)O)nc1C(F)(F)F
<BB_2060>
What is the molecular formula for <BB_2060>?
The molecular formula for <BB_2060> (Cc1cn(CCCC(=O)O)nc1C(F)(F)F) is C9H11F3N2O2.
Describe the ring structures in building block <BB_2060>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2060>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2060>.
**Token:** <BB_2060> **SMILES:** Cc1cn(CCCC(=O)O)nc1C(F)(F)F **Molecular Formula:** C9H11F3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2061>.
CCCS(=O)(=O)N1CCC(N)CC1.Cl
What is the building block token for the following molecule?
CCCS(=O)(=O)N1CCC(N)CC1.Cl
<BB_2061>
What is the molecular formula for <BB_2061>?
The molecular formula for <BB_2061> (CCCS(=O)(=O)N1CCC(N)CC1.Cl) is C8H19ClN2O2S.
Describe the ring structures in building block <BB_2061>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2061>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2061>.
**Token:** <BB_2061> **SMILES:** CCCS(=O)(=O)N1CCC(N)CC1.Cl **Molecular Formula:** C8H19ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2062>.
O=C(O)c1ccc2nnc(-c3ccccc3)n2c1
What is the building block token for the following molecule?
O=C(O)c1ccc2nnc(-c3ccccc3)n2c1
<BB_2062>
What is the molecular formula for <BB_2062>?
The molecular formula for <BB_2062> (O=C(O)c1ccc2nnc(-c3ccccc3)n2c1) is C13H9N3O2.
Describe the ring structures in building block <BB_2062>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2062>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2062>.
**Token:** <BB_2062> **SMILES:** O=C(O)c1ccc2nnc(-c3ccccc3)n2c1 **Molecular Formula:** C13H9N3O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2063>.
Cl.NCc1nccc(Cl)n1
What is the building block token for the following molecule?
Cl.NCc1nccc(Cl)n1
<BB_2063>
What is the molecular formula for <BB_2063>?
The molecular formula for <BB_2063> (Cl.NCc1nccc(Cl)n1) is C5H7Cl2N3.
Describe the ring structures in building block <BB_2063>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2063>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2063>.
**Token:** <BB_2063> **SMILES:** Cl.NCc1nccc(Cl)n1 **Molecular Formula:** C5H7Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2064>.
Oc1cnc2c(F)c(F)ccc2c1
What is the building block token for the following molecule?
Oc1cnc2c(F)c(F)ccc2c1
<BB_2064>
What is the molecular formula for <BB_2064>?
The molecular formula for <BB_2064> (Oc1cnc2c(F)c(F)ccc2c1) is C9H5F2NO.
Describe the ring structures in building block <BB_2064>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2064>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2064>.
**Token:** <BB_2064> **SMILES:** Oc1cnc2c(F)c(F)ccc2c1 **Molecular Formula:** C9H5F2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2065>.
CC(N)Cc1ccc2cnoc2c1.Cl
What is the building block token for the following molecule?
CC(N)Cc1ccc2cnoc2c1.Cl
<BB_2065>
What is the molecular formula for <BB_2065>?
The molecular formula for <BB_2065> (CC(N)Cc1ccc2cnoc2c1.Cl) is C10H13ClN2O.
Describe the ring structures in building block <BB_2065>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2065>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2065>.
**Token:** <BB_2065> **SMILES:** CC(N)Cc1ccc2cnoc2c1.Cl **Molecular Formula:** C10H13ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2066>.
O=C(O)CCn1cc(Br)c(C(F)(F)F)n1
What is the building block token for the following molecule?
O=C(O)CCn1cc(Br)c(C(F)(F)F)n1
<BB_2066>
What is the molecular formula for <BB_2066>?
The molecular formula for <BB_2066> (O=C(O)CCn1cc(Br)c(C(F)(F)F)n1) is C7H6BrF3N2O2.
Describe the ring structures in building block <BB_2066>.
The molecule contains 1 ring(s): an aromatic ring of size 5.