instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2066>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2066>.
**Token:** <BB_2066> **SMILES:** O=C(O)CCn1cc(Br)c(C(F)(F)F)n1 **Molecular Formula:** C7H6BrF3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2067>.
NC(=S)C1CN(C(=O)OCc2ccccc2)CCO1
What is the building block token for the following molecule?
NC(=S)C1CN(C(=O)OCc2ccccc2)CCO1
<BB_2067>
What is the molecular formula for <BB_2067>?
The molecular formula for <BB_2067> (NC(=S)C1CN(C(=O)OCc2ccccc2)CCO1) is C13H16N2O3S.
Describe the ring structures in building block <BB_2067>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2067>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2067>.
**Token:** <BB_2067> **SMILES:** NC(=S)C1CN(C(=O)OCc2ccccc2)CCO1 **Molecular Formula:** C13H16N2O3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2068>.
CS(=O)(=O)N1CCCC(C=O)C1
What is the building block token for the following molecule?
CS(=O)(=O)N1CCCC(C=O)C1
<BB_2068>
What is the molecular formula for <BB_2068>?
The molecular formula for <BB_2068> (CS(=O)(=O)N1CCCC(C=O)C1) is C7H13NO3S.
Describe the ring structures in building block <BB_2068>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2068>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2068>.
**Token:** <BB_2068> **SMILES:** CS(=O)(=O)N1CCCC(C=O)C1 **Molecular Formula:** C7H13NO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Aldehyde, Sulfonamide
Provide the SMILES representation for the building block token <BB_2069>.
Cn1c(=O)oc2cc(CN)ccc21
What is the building block token for the following molecule?
Cn1c(=O)oc2cc(CN)ccc21
<BB_2069>
What is the molecular formula for <BB_2069>?
The molecular formula for <BB_2069> (Cn1c(=O)oc2cc(CN)ccc21) is C9H10N2O2.
Describe the ring structures in building block <BB_2069>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2069>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2069>.
**Token:** <BB_2069> **SMILES:** Cn1c(=O)oc2cc(CN)ccc21 **Molecular Formula:** C9H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2070>.
c1ccc2c3c([nH]c2c1)CCC3
What is the building block token for the following molecule?
c1ccc2c3c([nH]c2c1)CCC3
<BB_2070>
What is the molecular formula for <BB_2070>?
The molecular formula for <BB_2070> (c1ccc2c3c([nH]c2c1)CCC3) is C11H11N.
Describe the ring structures in building block <BB_2070>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2070>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2070>.
**Token:** <BB_2070> **SMILES:** c1ccc2c3c([nH]c2c1)CCC3 **Molecular Formula:** C11H11N **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2071>.
OCCc1ccc(O)c(O)c1
What is the building block token for the following molecule?
OCCc1ccc(O)c(O)c1
<BB_2071>
What is the molecular formula for <BB_2071>?
The molecular formula for <BB_2071> (OCCc1ccc(O)c(O)c1) is C8H10O3.
Describe the ring structures in building block <BB_2071>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2071>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2071>.
**Token:** <BB_2071> **SMILES:** OCCc1ccc(O)c(O)c1 **Molecular Formula:** C8H10O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2072>.
CC(C)(CS(=O)(=O)Cl)NC(=O)OCc1ccccc1
What is the building block token for the following molecule?
CC(C)(CS(=O)(=O)Cl)NC(=O)OCc1ccccc1
<BB_2072>
What is the molecular formula for <BB_2072>?
The molecular formula for <BB_2072> (CC(C)(CS(=O)(=O)Cl)NC(=O)OCc1ccccc1) is C12H16ClNO4S.
Describe the ring structures in building block <BB_2072>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2072>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2072>.
**Token:** <BB_2072> **SMILES:** CC(C)(CS(=O)(=O)Cl)NC(=O)OCc1ccccc1 **Molecular Formula:** C12H16ClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2073>.
CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C#N)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C#N)CC1
<BB_2073>
What is the molecular formula for <BB_2073>?
The molecular formula for <BB_2073> (CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C#N)CC1) is C12H20N2O2.
Describe the ring structures in building block <BB_2073>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2073>.
The molecule contains the following groups: Amide, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2073>.
**Token:** <BB_2073> **SMILES:** CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C#N)CC1 **Molecular Formula:** C12H20N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2074>.
CC(C)c1nc(CC(=O)O)n(C)n1
What is the building block token for the following molecule?
CC(C)c1nc(CC(=O)O)n(C)n1
<BB_2074>
What is the molecular formula for <BB_2074>?
The molecular formula for <BB_2074> (CC(C)c1nc(CC(=O)O)n(C)n1) is C8H13N3O2.
Describe the ring structures in building block <BB_2074>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2074>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2074>.
**Token:** <BB_2074> **SMILES:** CC(C)c1nc(CC(=O)O)n(C)n1 **Molecular Formula:** C8H13N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2075>.
Cc1scc(C(=O)O)c1C
What is the building block token for the following molecule?
Cc1scc(C(=O)O)c1C
<BB_2075>
What is the molecular formula for <BB_2075>?
The molecular formula for <BB_2075> (Cc1scc(C(=O)O)c1C) is C7H8O2S.
Describe the ring structures in building block <BB_2075>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2075>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2075>.
**Token:** <BB_2075> **SMILES:** Cc1scc(C(=O)O)c1C **Molecular Formula:** C7H8O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2076>.
CCCCOc1ccc(Br)cc1C=O
What is the building block token for the following molecule?
CCCCOc1ccc(Br)cc1C=O
<BB_2076>
What is the molecular formula for <BB_2076>?
The molecular formula for <BB_2076> (CCCCOc1ccc(Br)cc1C=O) is C11H13BrO2.
Describe the ring structures in building block <BB_2076>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2076>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2076>.
**Token:** <BB_2076> **SMILES:** CCCCOc1ccc(Br)cc1C=O **Molecular Formula:** C11H13BrO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2077>.
O=C(Cc1ccccn1)c1ccc(Br)cc1
What is the building block token for the following molecule?
O=C(Cc1ccccn1)c1ccc(Br)cc1
<BB_2077>
What is the molecular formula for <BB_2077>?
The molecular formula for <BB_2077> (O=C(Cc1ccccn1)c1ccc(Br)cc1) is C13H10BrNO.
Describe the ring structures in building block <BB_2077>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2077>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2077>.
**Token:** <BB_2077> **SMILES:** O=C(Cc1ccccn1)c1ccc(Br)cc1 **Molecular Formula:** C13H10BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2078>.
OC[C@@H]1CC[C@H]1C(F)(F)F
What is the building block token for the following molecule?
OC[C@@H]1CC[C@H]1C(F)(F)F
<BB_2078>
What is the molecular formula for <BB_2078>?
The molecular formula for <BB_2078> (OC[C@@H]1CC[C@H]1C(F)(F)F) is C6H9F3O.
Describe the ring structures in building block <BB_2078>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2078>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2078>.
**Token:** <BB_2078> **SMILES:** OC[C@@H]1CC[C@H]1C(F)(F)F **Molecular Formula:** C6H9F3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2079>.
COc1cc(C#N)ccc1O
What is the building block token for the following molecule?
COc1cc(C#N)ccc1O
<BB_2079>
What is the molecular formula for <BB_2079>?
The molecular formula for <BB_2079> (COc1cc(C#N)ccc1O) is C8H7NO2.
Describe the ring structures in building block <BB_2079>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2079>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2079>.
**Token:** <BB_2079> **SMILES:** COc1cc(C#N)ccc1O **Molecular Formula:** C8H7NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2080>.
CNC1CCCC1C#N
What is the building block token for the following molecule?
CNC1CCCC1C#N
<BB_2080>
What is the molecular formula for <BB_2080>?
The molecular formula for <BB_2080> (CNC1CCCC1C#N) is C7H12N2.
Describe the ring structures in building block <BB_2080>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2080>.
The molecule contains the following groups: Secondary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2080>.
**Token:** <BB_2080> **SMILES:** CNC1CCCC1C#N **Molecular Formula:** C7H12N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_2081>.
CC(C)(C)OC(=O)N1CC2CCC1(C(=O)O)CC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2CCC1(C(=O)O)CC2
<BB_2081>
What is the molecular formula for <BB_2081>?
The molecular formula for <BB_2081> (CC(C)(C)OC(=O)N1CC2CCC1(C(=O)O)CC2) is C13H21NO4.
Describe the ring structures in building block <BB_2081>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2081>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2081>.
**Token:** <BB_2081> **SMILES:** CC(C)(C)OC(=O)N1CC2CCC1(C(=O)O)CC2 **Molecular Formula:** C13H21NO4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2082>.
CCCC1CCCNC1.Cl
What is the building block token for the following molecule?
CCCC1CCCNC1.Cl
<BB_2082>
What is the molecular formula for <BB_2082>?
The molecular formula for <BB_2082> (CCCC1CCCNC1.Cl) is C8H18ClN.
Describe the ring structures in building block <BB_2082>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2082>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2082>.
**Token:** <BB_2082> **SMILES:** CCCC1CCCNC1.Cl **Molecular Formula:** C8H18ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2083>.
O=C(O)c1coc(-c2cccs2)n1
What is the building block token for the following molecule?
O=C(O)c1coc(-c2cccs2)n1
<BB_2083>