instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2083>?
The molecular formula for <BB_2083> (O=C(O)c1coc(-c2cccs2)n1) is C8H5NO3S.
Describe the ring structures in building block <BB_2083>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_2083>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2083>.
**Token:** <BB_2083> **SMILES:** O=C(O)c1coc(-c2cccs2)n1 **Molecular Formula:** C8H5NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2084>.
Cl.Nc1ccc(Cl)nc1C(F)(F)F
What is the building block token for the following molecule?
Cl.Nc1ccc(Cl)nc1C(F)(F)F
<BB_2084>
What is the molecular formula for <BB_2084>?
The molecular formula for <BB_2084> (Cl.Nc1ccc(Cl)nc1C(F)(F)F) is C6H5Cl2F3N2.
Describe the ring structures in building block <BB_2084>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2084>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2084>.
**Token:** <BB_2084> **SMILES:** Cl.Nc1ccc(Cl)nc1C(F)(F)F **Molecular Formula:** C6H5Cl2F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2085>.
OC(c1ccc(Cl)cc1)c1cccnc1
What is the building block token for the following molecule?
OC(c1ccc(Cl)cc1)c1cccnc1
<BB_2085>
What is the molecular formula for <BB_2085>?
The molecular formula for <BB_2085> (OC(c1ccc(Cl)cc1)c1cccnc1) is C12H10ClNO.
Describe the ring structures in building block <BB_2085>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2085>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2085>.
**Token:** <BB_2085> **SMILES:** OC(c1ccc(Cl)cc1)c1cccnc1 **Molecular Formula:** C12H10ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2086>.
CC1(CCCN)CC1
What is the building block token for the following molecule?
CC1(CCCN)CC1
<BB_2086>
What is the molecular formula for <BB_2086>?
The molecular formula for <BB_2086> (CC1(CCCN)CC1) is C7H15N.
Describe the ring structures in building block <BB_2086>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2086>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2086>.
**Token:** <BB_2086> **SMILES:** CC1(CCCN)CC1 **Molecular Formula:** C7H15N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2087>.
COc1ccc(C(O)c2ccc(Cl)cc2)cc1
What is the building block token for the following molecule?
COc1ccc(C(O)c2ccc(Cl)cc2)cc1
<BB_2087>
What is the molecular formula for <BB_2087>?
The molecular formula for <BB_2087> (COc1ccc(C(O)c2ccc(Cl)cc2)cc1) is C14H13ClO2.
Describe the ring structures in building block <BB_2087>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2087>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2087>.
**Token:** <BB_2087> **SMILES:** COc1ccc(C(O)c2ccc(Cl)cc2)cc1 **Molecular Formula:** C14H13ClO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2088>.
CC(C)(C)n1cc(CN)c(=O)[nH]c1=O.Cl
What is the building block token for the following molecule?
CC(C)(C)n1cc(CN)c(=O)[nH]c1=O.Cl
<BB_2088>
What is the molecular formula for <BB_2088>?
The molecular formula for <BB_2088> (CC(C)(C)n1cc(CN)c(=O)[nH]c1=O.Cl) is C9H16ClN3O2.
Describe the ring structures in building block <BB_2088>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2088>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2088>.
**Token:** <BB_2088> **SMILES:** CC(C)(C)n1cc(CN)c(=O)[nH]c1=O.Cl **Molecular Formula:** C9H16ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2089>.
COC(=O)c1ccc(C)c(N)c1O
What is the building block token for the following molecule?
COC(=O)c1ccc(C)c(N)c1O
<BB_2089>
What is the molecular formula for <BB_2089>?
The molecular formula for <BB_2089> (COC(=O)c1ccc(C)c(N)c1O) is C9H11NO3.
Describe the ring structures in building block <BB_2089>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2089>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2089>.
**Token:** <BB_2089> **SMILES:** COC(=O)c1ccc(C)c(N)c1O **Molecular Formula:** C9H11NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2090>.
Cl.NCCNC(=O)CC1CCCCC1
What is the building block token for the following molecule?
Cl.NCCNC(=O)CC1CCCCC1
<BB_2090>
What is the molecular formula for <BB_2090>?
The molecular formula for <BB_2090> (Cl.NCCNC(=O)CC1CCCCC1) is C10H21ClN2O.
Describe the ring structures in building block <BB_2090>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2090>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2090>.
**Token:** <BB_2090> **SMILES:** Cl.NCCNC(=O)CC1CCCCC1 **Molecular Formula:** C10H21ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2091>.
O[C@H]1C[C@@H](C(F)F)Oc2ccccc21
What is the building block token for the following molecule?
O[C@H]1C[C@@H](C(F)F)Oc2ccccc21
<BB_2091>
What is the molecular formula for <BB_2091>?
The molecular formula for <BB_2091> (O[C@H]1C[C@@H](C(F)F)Oc2ccccc21) is C10H10F2O2.
Describe the ring structures in building block <BB_2091>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2091>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2091>.
**Token:** <BB_2091> **SMILES:** O[C@H]1C[C@@H](C(F)F)Oc2ccccc21 **Molecular Formula:** C10H10F2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2092>.
CCC(=NO)c1ccc(O)cc1
What is the building block token for the following molecule?
CCC(=NO)c1ccc(O)cc1
<BB_2092>
What is the molecular formula for <BB_2092>?
The molecular formula for <BB_2092> (CCC(=NO)c1ccc(O)cc1) is C9H11NO2.
Describe the ring structures in building block <BB_2092>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2092>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2092>.
**Token:** <BB_2092> **SMILES:** CCC(=NO)c1ccc(O)cc1 **Molecular Formula:** C9H11NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2093>.
CNNC(=O)OCc1ccccc1.Cl
What is the building block token for the following molecule?
CNNC(=O)OCc1ccccc1.Cl
<BB_2093>
What is the molecular formula for <BB_2093>?
The molecular formula for <BB_2093> (CNNC(=O)OCc1ccccc1.Cl) is C9H13ClN2O2.
Describe the ring structures in building block <BB_2093>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2093>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2093>.
**Token:** <BB_2093> **SMILES:** CNNC(=O)OCc1ccccc1.Cl **Molecular Formula:** C9H13ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2094>.
Cl.Clc1cc2c(cc1Br)NCCO2
What is the building block token for the following molecule?
Cl.Clc1cc2c(cc1Br)NCCO2
<BB_2094>
What is the molecular formula for <BB_2094>?
The molecular formula for <BB_2094> (Cl.Clc1cc2c(cc1Br)NCCO2) is C8H8BrCl2NO.
Describe the ring structures in building block <BB_2094>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2094>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2094>.
**Token:** <BB_2094> **SMILES:** Cl.Clc1cc2c(cc1Br)NCCO2 **Molecular Formula:** C8H8BrCl2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2095>.
CC(=O)c1cccc(-n2cnnn2)c1
What is the building block token for the following molecule?
CC(=O)c1cccc(-n2cnnn2)c1
<BB_2095>
What is the molecular formula for <BB_2095>?
The molecular formula for <BB_2095> (CC(=O)c1cccc(-n2cnnn2)c1) is C9H8N4O.
Describe the ring structures in building block <BB_2095>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2095>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2095>.
**Token:** <BB_2095> **SMILES:** CC(=O)c1cccc(-n2cnnn2)c1 **Molecular Formula:** C9H8N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2096>.
Cc1cccc2c1CS(=O)(=O)N2
What is the building block token for the following molecule?
Cc1cccc2c1CS(=O)(=O)N2
<BB_2096>
What is the molecular formula for <BB_2096>?
The molecular formula for <BB_2096> (Cc1cccc2c1CS(=O)(=O)N2) is C8H9NO2S.
Describe the ring structures in building block <BB_2096>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2096>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2096>.
**Token:** <BB_2096> **SMILES:** Cc1cccc2c1CS(=O)(=O)N2 **Molecular Formula:** C8H9NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2097>.
COc1cc(OC)c(OC)cc1C=O
What is the building block token for the following molecule?
COc1cc(OC)c(OC)cc1C=O
<BB_2097>
What is the molecular formula for <BB_2097>?
The molecular formula for <BB_2097> (COc1cc(OC)c(OC)cc1C=O) is C10H12O4.
Describe the ring structures in building block <BB_2097>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2097>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2097>.
**Token:** <BB_2097> **SMILES:** COc1cc(OC)c(OC)cc1C=O **Molecular Formula:** C10H12O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2098>.
Cl.NC1(c2nncs2)CC1
What is the building block token for the following molecule?
Cl.NC1(c2nncs2)CC1
<BB_2098>
What is the molecular formula for <BB_2098>?
The molecular formula for <BB_2098> (Cl.NC1(c2nncs2)CC1) is C5H8ClN3S.
Describe the ring structures in building block <BB_2098>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2098>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2098>.
**Token:** <BB_2098> **SMILES:** Cl.NC1(c2nncs2)CC1 **Molecular Formula:** C5H8ClN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2099>.
COC(=O)C1(CF)CC(F)(F)C1(F)F
What is the building block token for the following molecule?
COC(=O)C1(CF)CC(F)(F)C1(F)F
<BB_2099>
What is the molecular formula for <BB_2099>?
The molecular formula for <BB_2099> (COC(=O)C1(CF)CC(F)(F)C1(F)F) is C7H7F5O2.
Describe the ring structures in building block <BB_2099>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2099>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2099>.
**Token:** <BB_2099> **SMILES:** COC(=O)C1(CF)CC(F)(F)C1(F)F **Molecular Formula:** C7H7F5O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)