instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2100>.
C=C(CC1CC1)C(=O)OC
What is the building block token for the following molecule?
C=C(CC1CC1)C(=O)OC
<BB_2100>
What is the molecular formula for <BB_2100>?
The molecular formula for <BB_2100> (C=C(CC1CC1)C(=O)OC) is C8H12O2.
Describe the ring structures in building block <BB_2100>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2100>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2100>.
**Token:** <BB_2100> **SMILES:** C=C(CC1CC1)C(=O)OC **Molecular Formula:** C8H12O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2101>.
O=Cc1ccc(-c2ccccc2)cc1O
What is the building block token for the following molecule?
O=Cc1ccc(-c2ccccc2)cc1O
<BB_2101>
What is the molecular formula for <BB_2101>?
The molecular formula for <BB_2101> (O=Cc1ccc(-c2ccccc2)cc1O) is C13H10O2.
Describe the ring structures in building block <BB_2101>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2101>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2101>.
**Token:** <BB_2101> **SMILES:** O=Cc1ccc(-c2ccccc2)cc1O **Molecular Formula:** C13H10O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2102>.
Cl.O=C1CC2(CCNCC2)C1
What is the building block token for the following molecule?
Cl.O=C1CC2(CCNCC2)C1
<BB_2102>
What is the molecular formula for <BB_2102>?
The molecular formula for <BB_2102> (Cl.O=C1CC2(CCNCC2)C1) is C8H14ClNO.
Describe the ring structures in building block <BB_2102>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2102>.
The molecule contains the following groups: Secondary Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2102>.
**Token:** <BB_2102> **SMILES:** Cl.O=C1CC2(CCNCC2)C1 **Molecular Formula:** C8H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2103>.
CC(C)(C)[C@@H]1C[C@H](Cl)C(=O)N1
What is the building block token for the following molecule?
CC(C)(C)[C@@H]1C[C@H](Cl)C(=O)N1
<BB_2103>
What is the molecular formula for <BB_2103>?
The molecular formula for <BB_2103> (CC(C)(C)[C@@H]1C[C@H](Cl)C(=O)N1) is C8H14ClNO.
Describe the ring structures in building block <BB_2103>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2103>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2103>.
**Token:** <BB_2103> **SMILES:** CC(C)(C)[C@@H]1C[C@H](Cl)C(=O)N1 **Molecular Formula:** C8H14ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2104>.
C#CCC(C)Br
What is the building block token for the following molecule?
C#CCC(C)Br
<BB_2104>
What is the molecular formula for <BB_2104>?
The molecular formula for <BB_2104> (C#CCC(C)Br) is C5H7Br.
Describe the ring structures in building block <BB_2104>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2104>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2104>.
**Token:** <BB_2104> **SMILES:** C#CCC(C)Br **Molecular Formula:** C5H7Br **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2105>.
Cc1cc(C#N)cc(C)c1CO
What is the building block token for the following molecule?
Cc1cc(C#N)cc(C)c1CO
<BB_2105>
What is the molecular formula for <BB_2105>?
The molecular formula for <BB_2105> (Cc1cc(C#N)cc(C)c1CO) is C10H11NO.
Describe the ring structures in building block <BB_2105>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2105>.
The molecule contains the following groups: Alcohol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2105>.
**Token:** <BB_2105> **SMILES:** Cc1cc(C#N)cc(C)c1CO **Molecular Formula:** C10H11NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Nitrile
Provide the SMILES representation for the building block token <BB_2106>.
CNC(=O)C1(CN)CC1.Cl
What is the building block token for the following molecule?
CNC(=O)C1(CN)CC1.Cl
<BB_2106>
What is the molecular formula for <BB_2106>?
The molecular formula for <BB_2106> (CNC(=O)C1(CN)CC1.Cl) is C6H13ClN2O.
Describe the ring structures in building block <BB_2106>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2106>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2106>.
**Token:** <BB_2106> **SMILES:** CNC(=O)C1(CN)CC1.Cl **Molecular Formula:** C6H13ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2107>.
CC(N)(C(=O)O)c1cccnc1.Cl.Cl
What is the building block token for the following molecule?
CC(N)(C(=O)O)c1cccnc1.Cl.Cl
<BB_2107>
What is the molecular formula for <BB_2107>?
The molecular formula for <BB_2107> (CC(N)(C(=O)O)c1cccnc1.Cl.Cl) is C8H12Cl2N2O2.
Describe the ring structures in building block <BB_2107>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2107>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2107>.
**Token:** <BB_2107> **SMILES:** CC(N)(C(=O)O)c1cccnc1.Cl.Cl **Molecular Formula:** C8H12Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2108>.
Nc1ccsc1-c1cccnc1
What is the building block token for the following molecule?
Nc1ccsc1-c1cccnc1
<BB_2108>
What is the molecular formula for <BB_2108>?
The molecular formula for <BB_2108> (Nc1ccsc1-c1cccnc1) is C9H8N2S.
Describe the ring structures in building block <BB_2108>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2108>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2108>.
**Token:** <BB_2108> **SMILES:** Nc1ccsc1-c1cccnc1 **Molecular Formula:** C9H8N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2109>.
N#Cc1c(N)ccc2ncccc12
What is the building block token for the following molecule?
N#Cc1c(N)ccc2ncccc12
<BB_2109>
What is the molecular formula for <BB_2109>?
The molecular formula for <BB_2109> (N#Cc1c(N)ccc2ncccc12) is C10H7N3.
Describe the ring structures in building block <BB_2109>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2109>.
The molecule contains the following groups: Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2109>.
**Token:** <BB_2109> **SMILES:** N#Cc1c(N)ccc2ncccc12 **Molecular Formula:** C10H7N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Nitrile
Provide the SMILES representation for the building block token <BB_2110>.
COc1ccc(CC2(N)CC2)cc1OC.Cl
What is the building block token for the following molecule?
COc1ccc(CC2(N)CC2)cc1OC.Cl
<BB_2110>
What is the molecular formula for <BB_2110>?
The molecular formula for <BB_2110> (COc1ccc(CC2(N)CC2)cc1OC.Cl) is C12H18ClNO2.
Describe the ring structures in building block <BB_2110>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2110>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2110>.
**Token:** <BB_2110> **SMILES:** COc1ccc(CC2(N)CC2)cc1OC.Cl **Molecular Formula:** C12H18ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2111>.
NCCOc1cc(Cl)ccn1
What is the building block token for the following molecule?
NCCOc1cc(Cl)ccn1
<BB_2111>
What is the molecular formula for <BB_2111>?
The molecular formula for <BB_2111> (NCCOc1cc(Cl)ccn1) is C7H9ClN2O.
Describe the ring structures in building block <BB_2111>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2111>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2111>.
**Token:** <BB_2111> **SMILES:** NCCOc1cc(Cl)ccn1 **Molecular Formula:** C7H9ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2112>.
CC(C)c1cc(I)ccn1
What is the building block token for the following molecule?
CC(C)c1cc(I)ccn1
<BB_2112>
What is the molecular formula for <BB_2112>?
The molecular formula for <BB_2112> (CC(C)c1cc(I)ccn1) is C8H10IN.
Describe the ring structures in building block <BB_2112>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2112>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2112>.
**Token:** <BB_2112> **SMILES:** CC(C)c1cc(I)ccn1 **Molecular Formula:** C8H10IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2113>.
CC(=O)c1ccc(Cl)c(N)c1
What is the building block token for the following molecule?
CC(=O)c1ccc(Cl)c(N)c1
<BB_2113>
What is the molecular formula for <BB_2113>?
The molecular formula for <BB_2113> (CC(=O)c1ccc(Cl)c(N)c1) is C8H8ClNO.
Describe the ring structures in building block <BB_2113>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2113>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2113>.
**Token:** <BB_2113> **SMILES:** CC(=O)c1ccc(Cl)c(N)c1 **Molecular Formula:** C8H8ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2114>.
CC(=O)OCC(C)(C)CC(=O)O
What is the building block token for the following molecule?
CC(=O)OCC(C)(C)CC(=O)O
<BB_2114>
What is the molecular formula for <BB_2114>?
The molecular formula for <BB_2114> (CC(=O)OCC(C)(C)CC(=O)O) is C8H14O4.
Describe the ring structures in building block <BB_2114>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2114>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2114>.
**Token:** <BB_2114> **SMILES:** CC(=O)OCC(C)(C)CC(=O)O **Molecular Formula:** C8H14O4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_2115>.
Fc1nc(F)c(F)c(F)c1F
What is the building block token for the following molecule?
Fc1nc(F)c(F)c(F)c1F
<BB_2115>
What is the molecular formula for <BB_2115>?
The molecular formula for <BB_2115> (Fc1nc(F)c(F)c(F)c1F) is C5F5N.
Describe the ring structures in building block <BB_2115>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2115>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2115>.
**Token:** <BB_2115> **SMILES:** Fc1nc(F)c(F)c(F)c1F **Molecular Formula:** C5F5N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2116>.
CC1C(CO)CCCN1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CC1C(CO)CCCN1C(=O)OC(C)(C)C
<BB_2116>
What is the molecular formula for <BB_2116>?
The molecular formula for <BB_2116> (CC1C(CO)CCCN1C(=O)OC(C)(C)C) is C12H23NO3.
Describe the ring structures in building block <BB_2116>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.