instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2116>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2116>.
**Token:** <BB_2116> **SMILES:** CC1C(CO)CCCN1C(=O)OC(C)(C)C **Molecular Formula:** C12H23NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2117>.
OC1(c2cccc(Br)c2)CCOC1
What is the building block token for the following molecule?
OC1(c2cccc(Br)c2)CCOC1
<BB_2117>
What is the molecular formula for <BB_2117>?
The molecular formula for <BB_2117> (OC1(c2cccc(Br)c2)CCOC1) is C10H11BrO2.
Describe the ring structures in building block <BB_2117>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2117>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2117>.
**Token:** <BB_2117> **SMILES:** OC1(c2cccc(Br)c2)CCOC1 **Molecular Formula:** C10H11BrO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2118>.
CN1CCn2ncc(CO)c2C1
What is the building block token for the following molecule?
CN1CCn2ncc(CO)c2C1
<BB_2118>
What is the molecular formula for <BB_2118>?
The molecular formula for <BB_2118> (CN1CCn2ncc(CO)c2C1) is C8H13N3O.
Describe the ring structures in building block <BB_2118>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2118>.
The molecule contains the following groups: Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2118>.
**Token:** <BB_2118> **SMILES:** CN1CCn2ncc(CO)c2C1 **Molecular Formula:** C8H13N3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2119>.
C1COC2(CCOCC2)CN1
What is the building block token for the following molecule?
C1COC2(CCOCC2)CN1
<BB_2119>
What is the molecular formula for <BB_2119>?
The molecular formula for <BB_2119> (C1COC2(CCOCC2)CN1) is C8H15NO2.
Describe the ring structures in building block <BB_2119>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2119>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2119>.
**Token:** <BB_2119> **SMILES:** C1COC2(CCOCC2)CN1 **Molecular Formula:** C8H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2120>.
Cc1ccc2oc(C(=O)O)cc2n1.Cl
What is the building block token for the following molecule?
Cc1ccc2oc(C(=O)O)cc2n1.Cl
<BB_2120>
What is the molecular formula for <BB_2120>?
The molecular formula for <BB_2120> (Cc1ccc2oc(C(=O)O)cc2n1.Cl) is C9H8ClNO3.
Describe the ring structures in building block <BB_2120>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2120>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2120>.
**Token:** <BB_2120> **SMILES:** Cc1ccc2oc(C(=O)O)cc2n1.Cl **Molecular Formula:** C9H8ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2121>.
CC(C)(C)OC(=O)N1CC2(C1)CC(O)(C(F)(F)F)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2(C1)CC(O)(C(F)(F)F)C2
<BB_2121>
What is the molecular formula for <BB_2121>?
The molecular formula for <BB_2121> (CC(C)(C)OC(=O)N1CC2(C1)CC(O)(C(F)(F)F)C2) is C12H18F3NO3.
Describe the ring structures in building block <BB_2121>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2121>.
The molecule contains the following groups: Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2121>.
**Token:** <BB_2121> **SMILES:** CC(C)(C)OC(=O)N1CC2(C1)CC(O)(C(F)(F)F)C2 **Molecular Formula:** C12H18F3NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2122>.
O=C1NC(C2CCNCC2)C12CCC2
What is the building block token for the following molecule?
O=C1NC(C2CCNCC2)C12CCC2
<BB_2122>
What is the molecular formula for <BB_2122>?
The molecular formula for <BB_2122> (O=C1NC(C2CCNCC2)C12CCC2) is C11H18N2O.
Describe the ring structures in building block <BB_2122>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2122>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2122>.
**Token:** <BB_2122> **SMILES:** O=C1NC(C2CCNCC2)C12CCC2 **Molecular Formula:** C11H18N2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_2123>.
C[C@H](N)c1ccnn1C.Cl
What is the building block token for the following molecule?
C[C@H](N)c1ccnn1C.Cl
<BB_2123>
What is the molecular formula for <BB_2123>?
The molecular formula for <BB_2123> (C[C@H](N)c1ccnn1C.Cl) is C6H12ClN3.
Describe the ring structures in building block <BB_2123>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2123>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2123>.
**Token:** <BB_2123> **SMILES:** C[C@H](N)c1ccnn1C.Cl **Molecular Formula:** C6H12ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2124>.
CCOC(=O)c1onc(Br)c1C
What is the building block token for the following molecule?
CCOC(=O)c1onc(Br)c1C
<BB_2124>
What is the molecular formula for <BB_2124>?
The molecular formula for <BB_2124> (CCOC(=O)c1onc(Br)c1C) is C7H8BrNO3.
Describe the ring structures in building block <BB_2124>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2124>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2124>.
**Token:** <BB_2124> **SMILES:** CCOC(=O)c1onc(Br)c1C **Molecular Formula:** C7H8BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2125>.
Nc1ccccc1NCCCc1ccccc1
What is the building block token for the following molecule?
Nc1ccccc1NCCCc1ccccc1
<BB_2125>
What is the molecular formula for <BB_2125>?
The molecular formula for <BB_2125> (Nc1ccccc1NCCCc1ccccc1) is C15H18N2.
Describe the ring structures in building block <BB_2125>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2125>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2125>.
**Token:** <BB_2125> **SMILES:** Nc1ccccc1NCCCc1ccccc1 **Molecular Formula:** C15H18N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_2126>.
COc1c(C)nc(C2CC2)nc1O
What is the building block token for the following molecule?
COc1c(C)nc(C2CC2)nc1O
<BB_2126>
What is the molecular formula for <BB_2126>?
The molecular formula for <BB_2126> (COc1c(C)nc(C2CC2)nc1O) is C9H12N2O2.
Describe the ring structures in building block <BB_2126>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2126>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2126>.
**Token:** <BB_2126> **SMILES:** COc1c(C)nc(C2CC2)nc1O **Molecular Formula:** C9H12N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2127>.
CCOC(=O)c1csc(Nc2ccc(Cl)cc2)n1
What is the building block token for the following molecule?
CCOC(=O)c1csc(Nc2ccc(Cl)cc2)n1
<BB_2127>
What is the molecular formula for <BB_2127>?
The molecular formula for <BB_2127> (CCOC(=O)c1csc(Nc2ccc(Cl)cc2)n1) is C12H11ClN2O2S.
Describe the ring structures in building block <BB_2127>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2127>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2127>.
**Token:** <BB_2127> **SMILES:** CCOC(=O)c1csc(Nc2ccc(Cl)cc2)n1 **Molecular Formula:** C12H11ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2128>.
Cc1cc(C(=O)O)n(CCNC(=O)OC(C)(C)C)n1
What is the building block token for the following molecule?
Cc1cc(C(=O)O)n(CCNC(=O)OC(C)(C)C)n1
<BB_2128>
What is the molecular formula for <BB_2128>?
The molecular formula for <BB_2128> (Cc1cc(C(=O)O)n(CCNC(=O)OC(C)(C)C)n1) is C12H19N3O4.
Describe the ring structures in building block <BB_2128>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2128>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2128>.
**Token:** <BB_2128> **SMILES:** Cc1cc(C(=O)O)n(CCNC(=O)OC(C)(C)C)n1 **Molecular Formula:** C12H19N3O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2129>.
Cl.NC(=O)c1ccc(S(=O)(=O)N2CCNCC2)cc1
What is the building block token for the following molecule?
Cl.NC(=O)c1ccc(S(=O)(=O)N2CCNCC2)cc1
<BB_2129>
What is the molecular formula for <BB_2129>?
The molecular formula for <BB_2129> (Cl.NC(=O)c1ccc(S(=O)(=O)N2CCNCC2)cc1) is C11H16ClN3O3S.
Describe the ring structures in building block <BB_2129>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2129>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2129>.
**Token:** <BB_2129> **SMILES:** Cl.NC(=O)c1ccc(S(=O)(=O)N2CCNCC2)cc1 **Molecular Formula:** C11H16ClN3O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2130>.
C=CC(=O)Nc1ccc([N+](=O)[O-])cc1
What is the building block token for the following molecule?
C=CC(=O)Nc1ccc([N+](=O)[O-])cc1
<BB_2130>
What is the molecular formula for <BB_2130>?
The molecular formula for <BB_2130> (C=CC(=O)Nc1ccc([N+](=O)[O-])cc1) is C9H8N2O3.
Describe the ring structures in building block <BB_2130>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2130>.
The molecule contains the following groups: Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2130>.
**Token:** <BB_2130> **SMILES:** C=CC(=O)Nc1ccc([N+](=O)[O-])cc1 **Molecular Formula:** C9H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_2131>.
COC(=O)c1nc(Cl)sc1C
What is the building block token for the following molecule?
COC(=O)c1nc(Cl)sc1C
<BB_2131>
What is the molecular formula for <BB_2131>?
The molecular formula for <BB_2131> (COC(=O)c1nc(Cl)sc1C) is C6H6ClNO2S.
Describe the ring structures in building block <BB_2131>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2131>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2131>.
**Token:** <BB_2131> **SMILES:** COC(=O)c1nc(Cl)sc1C **Molecular Formula:** C6H6ClNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2132>.
N#Cc1cccc(C#N)c1
What is the building block token for the following molecule?
N#Cc1cccc(C#N)c1
<BB_2132>
What is the molecular formula for <BB_2132>?
The molecular formula for <BB_2132> (N#Cc1cccc(C#N)c1) is C8H4N2.
Describe the ring structures in building block <BB_2132>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2132>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2132>.
**Token:** <BB_2132> **SMILES:** N#Cc1cccc(C#N)c1 **Molecular Formula:** C8H4N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_2133>.
CC(CCO)CC(=O)[O-].[Na+]
What is the building block token for the following molecule?
CC(CCO)CC(=O)[O-].[Na+]
<BB_2133>