instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2133>?
The molecular formula for <BB_2133> (CC(CCO)CC(=O)[O-].[Na+]) is C6H11NaO3.
Describe the ring structures in building block <BB_2133>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2133>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2133>.
**Token:** <BB_2133> **SMILES:** CC(CCO)CC(=O)[O-].[Na+] **Molecular Formula:** C6H11NaO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2134>.
O=C1COC(C2CCC2)CN1
What is the building block token for the following molecule?
O=C1COC(C2CCC2)CN1
<BB_2134>
What is the molecular formula for <BB_2134>?
The molecular formula for <BB_2134> (O=C1COC(C2CCC2)CN1) is C8H13NO2.
Describe the ring structures in building block <BB_2134>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2134>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2134>.
**Token:** <BB_2134> **SMILES:** O=C1COC(C2CCC2)CN1 **Molecular Formula:** C8H13NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2135>.
CC(=O)c1cccc(OCC(=O)N(C)C)c1
What is the building block token for the following molecule?
CC(=O)c1cccc(OCC(=O)N(C)C)c1
<BB_2135>
What is the molecular formula for <BB_2135>?
The molecular formula for <BB_2135> (CC(=O)c1cccc(OCC(=O)N(C)C)c1) is C12H15NO3.
Describe the ring structures in building block <BB_2135>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2135>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_2135>.
**Token:** <BB_2135> **SMILES:** CC(=O)c1cccc(OCC(=O)N(C)C)c1 **Molecular Formula:** C12H15NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_2136>.
NC1CCCc2c1cnn2Cc1ccccc1
What is the building block token for the following molecule?
NC1CCCc2c1cnn2Cc1ccccc1
<BB_2136>
What is the molecular formula for <BB_2136>?
The molecular formula for <BB_2136> (NC1CCCc2c1cnn2Cc1ccccc1) is C14H17N3.
Describe the ring structures in building block <BB_2136>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2136>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2136>.
**Token:** <BB_2136> **SMILES:** NC1CCCc2c1cnn2Cc1ccccc1 **Molecular Formula:** C14H17N3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2137>.
COC(=O)C(C)(O)C(C)C
What is the building block token for the following molecule?
COC(=O)C(C)(O)C(C)C
<BB_2137>
What is the molecular formula for <BB_2137>?
The molecular formula for <BB_2137> (COC(=O)C(C)(O)C(C)C) is C7H14O3.
Describe the ring structures in building block <BB_2137>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2137>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2137>.
**Token:** <BB_2137> **SMILES:** COC(=O)C(C)(O)C(C)C **Molecular Formula:** C7H14O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2138>.
O=C([O-])C1(c2ncccc2Br)CCC1.[Li+]
What is the building block token for the following molecule?
O=C([O-])C1(c2ncccc2Br)CCC1.[Li+]
<BB_2138>
What is the molecular formula for <BB_2138>?
The molecular formula for <BB_2138> (O=C([O-])C1(c2ncccc2Br)CCC1.[Li+]) is C10H9BrLiNO2.
Describe the ring structures in building block <BB_2138>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2138>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2138>.
**Token:** <BB_2138> **SMILES:** O=C([O-])C1(c2ncccc2Br)CCC1.[Li+] **Molecular Formula:** C10H9BrLiNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2139>.
Clc1cccc(SCCBr)c1
What is the building block token for the following molecule?
Clc1cccc(SCCBr)c1
<BB_2139>
What is the molecular formula for <BB_2139>?
The molecular formula for <BB_2139> (Clc1cccc(SCCBr)c1) is C8H8BrClS.
Describe the ring structures in building block <BB_2139>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2139>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2139>.
**Token:** <BB_2139> **SMILES:** Clc1cccc(SCCBr)c1 **Molecular Formula:** C8H8BrClS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2140>.
O=C1COCc2c(Br)cncc21
What is the building block token for the following molecule?
O=C1COCc2c(Br)cncc21
<BB_2140>
What is the molecular formula for <BB_2140>?
The molecular formula for <BB_2140> (O=C1COCc2c(Br)cncc21) is C8H6BrNO2.
Describe the ring structures in building block <BB_2140>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2140>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2140>.
**Token:** <BB_2140> **SMILES:** O=C1COCc2c(Br)cncc21 **Molecular Formula:** C8H6BrNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2141>.
Cl.Nc1cc2c(cc1Cl)OCCO2
What is the building block token for the following molecule?
Cl.Nc1cc2c(cc1Cl)OCCO2
<BB_2141>
What is the molecular formula for <BB_2141>?
The molecular formula for <BB_2141> (Cl.Nc1cc2c(cc1Cl)OCCO2) is C8H9Cl2NO2.
Describe the ring structures in building block <BB_2141>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2141>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2141>.
**Token:** <BB_2141> **SMILES:** Cl.Nc1cc2c(cc1Cl)OCCO2 **Molecular Formula:** C8H9Cl2NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2142>.
COc1ccc(C=NO)c(OC)c1
What is the building block token for the following molecule?
COc1ccc(C=NO)c(OC)c1
<BB_2142>
What is the molecular formula for <BB_2142>?
The molecular formula for <BB_2142> (COc1ccc(C=NO)c(OC)c1) is C9H11NO3.
Describe the ring structures in building block <BB_2142>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2142>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2142>.
**Token:** <BB_2142> **SMILES:** COc1ccc(C=NO)c(OC)c1 **Molecular Formula:** C9H11NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2143>.
CC(=O)O[Pb]OC(C)=O
What is the building block token for the following molecule?
CC(=O)O[Pb]OC(C)=O
<BB_2143>
What is the molecular formula for <BB_2143>?
The molecular formula for <BB_2143> (CC(=O)O[Pb]OC(C)=O) is C4H6O4Pb.
Describe the ring structures in building block <BB_2143>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2143>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2143>.
**Token:** <BB_2143> **SMILES:** CC(=O)O[Pb]OC(C)=O **Molecular Formula:** C4H6O4Pb **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2144>.
NS(=O)(=O)C1CCC(c2ccccc2)CC1
What is the building block token for the following molecule?
NS(=O)(=O)C1CCC(c2ccccc2)CC1
<BB_2144>
What is the molecular formula for <BB_2144>?
The molecular formula for <BB_2144> (NS(=O)(=O)C1CCC(c2ccccc2)CC1) is C12H17NO2S.
Describe the ring structures in building block <BB_2144>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2144>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2144>.
**Token:** <BB_2144> **SMILES:** NS(=O)(=O)C1CCC(c2ccccc2)CC1 **Molecular Formula:** C12H17NO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2145>.
C[C@@H](N)c1ccc(Cl)cc1Cl.Cl
What is the building block token for the following molecule?
C[C@@H](N)c1ccc(Cl)cc1Cl.Cl
<BB_2145>
What is the molecular formula for <BB_2145>?
The molecular formula for <BB_2145> (C[C@@H](N)c1ccc(Cl)cc1Cl.Cl) is C8H10Cl3N.
Describe the ring structures in building block <BB_2145>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2145>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2145>.
**Token:** <BB_2145> **SMILES:** C[C@@H](N)c1ccc(Cl)cc1Cl.Cl **Molecular Formula:** C8H10Cl3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2146>.
c1cnc2c(c1)CCCN2
What is the building block token for the following molecule?
c1cnc2c(c1)CCCN2
<BB_2146>
What is the molecular formula for <BB_2146>?
The molecular formula for <BB_2146> (c1cnc2c(c1)CCCN2) is C8H10N2.
Describe the ring structures in building block <BB_2146>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2146>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2146>.
**Token:** <BB_2146> **SMILES:** c1cnc2c(c1)CCCN2 **Molecular Formula:** C8H10N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2147>.
Cl.Clc1ccc2c(c1Br)CNCC2
What is the building block token for the following molecule?
Cl.Clc1ccc2c(c1Br)CNCC2
<BB_2147>
What is the molecular formula for <BB_2147>?
The molecular formula for <BB_2147> (Cl.Clc1ccc2c(c1Br)CNCC2) is C9H10BrCl2N.
Describe the ring structures in building block <BB_2147>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2147>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2147>.
**Token:** <BB_2147> **SMILES:** Cl.Clc1ccc2c(c1Br)CNCC2 **Molecular Formula:** C9H10BrCl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2148>.
NS(=O)(=O)N1CCCCC1
What is the building block token for the following molecule?
NS(=O)(=O)N1CCCCC1
<BB_2148>
What is the molecular formula for <BB_2148>?
The molecular formula for <BB_2148> (NS(=O)(=O)N1CCCCC1) is C5H12N2O2S.
Describe the ring structures in building block <BB_2148>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2148>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2148>.
**Token:** <BB_2148> **SMILES:** NS(=O)(=O)N1CCCCC1 **Molecular Formula:** C5H12N2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2149>.
CC(C#N)CS(=O)(=O)Cl
What is the building block token for the following molecule?
CC(C#N)CS(=O)(=O)Cl
<BB_2149>
What is the molecular formula for <BB_2149>?
The molecular formula for <BB_2149> (CC(C#N)CS(=O)(=O)Cl) is C4H6ClNO2S.
Describe the ring structures in building block <BB_2149>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2149>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2149>.
**Token:** <BB_2149> **SMILES:** CC(C#N)CS(=O)(=O)Cl **Molecular Formula:** C4H6ClNO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile