instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2150>.
O=Cc1ccc(CC(F)(F)F)cc1F
What is the building block token for the following molecule?
O=Cc1ccc(CC(F)(F)F)cc1F
<BB_2150>
What is the molecular formula for <BB_2150>?
The molecular formula for <BB_2150> (O=Cc1ccc(CC(F)(F)F)cc1F) is C9H6F4O.
Describe the ring structures in building block <BB_2150>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2150>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2150>.
**Token:** <BB_2150> **SMILES:** O=Cc1ccc(CC(F)(F)F)cc1F **Molecular Formula:** C9H6F4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2151>.
Cc1conc1CS
What is the building block token for the following molecule?
Cc1conc1CS
<BB_2151>
What is the molecular formula for <BB_2151>?
The molecular formula for <BB_2151> (Cc1conc1CS) is C5H7NOS.
Describe the ring structures in building block <BB_2151>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2151>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_2151>.
**Token:** <BB_2151> **SMILES:** Cc1conc1CS **Molecular Formula:** C5H7NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_2152>.
CNCc1ccc(-c2ccc(F)cc2)o1
What is the building block token for the following molecule?
CNCc1ccc(-c2ccc(F)cc2)o1
<BB_2152>
What is the molecular formula for <BB_2152>?
The molecular formula for <BB_2152> (CNCc1ccc(-c2ccc(F)cc2)o1) is C12H12FNO.
Describe the ring structures in building block <BB_2152>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2152>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2152>.
**Token:** <BB_2152> **SMILES:** CNCc1ccc(-c2ccc(F)cc2)o1 **Molecular Formula:** C12H12FNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2153>.
O=C([O-])C(O)c1ncccn1.[Li+]
What is the building block token for the following molecule?
O=C([O-])C(O)c1ncccn1.[Li+]
<BB_2153>
What is the molecular formula for <BB_2153>?
The molecular formula for <BB_2153> (O=C([O-])C(O)c1ncccn1.[Li+]) is C6H5LiN2O3.
Describe the ring structures in building block <BB_2153>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2153>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2153>.
**Token:** <BB_2153> **SMILES:** O=C([O-])C(O)c1ncccn1.[Li+] **Molecular Formula:** C6H5LiN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2154>.
O=C([O-])CSc1cc(Cl)ccc1Cl.[K+]
What is the building block token for the following molecule?
O=C([O-])CSc1cc(Cl)ccc1Cl.[K+]
<BB_2154>
What is the molecular formula for <BB_2154>?
The molecular formula for <BB_2154> (O=C([O-])CSc1cc(Cl)ccc1Cl.[K+]) is C8H5Cl2KO2S.
Describe the ring structures in building block <BB_2154>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2154>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2154>.
**Token:** <BB_2154> **SMILES:** O=C([O-])CSc1cc(Cl)ccc1Cl.[K+] **Molecular Formula:** C8H5Cl2KO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2155>.
O=C(O)CC1(c2ccccc2)CCOCC1
What is the building block token for the following molecule?
O=C(O)CC1(c2ccccc2)CCOCC1
<BB_2155>
What is the molecular formula for <BB_2155>?
The molecular formula for <BB_2155> (O=C(O)CC1(c2ccccc2)CCOCC1) is C13H16O3.
Describe the ring structures in building block <BB_2155>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2155>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2155>.
**Token:** <BB_2155> **SMILES:** O=C(O)CC1(c2ccccc2)CCOCC1 **Molecular Formula:** C13H16O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2156>.
COc1cc(C(C)(C)C)c2oc(C(=O)O)c(C)c2c1
What is the building block token for the following molecule?
COc1cc(C(C)(C)C)c2oc(C(=O)O)c(C)c2c1
<BB_2156>
What is the molecular formula for <BB_2156>?
The molecular formula for <BB_2156> (COc1cc(C(C)(C)C)c2oc(C(=O)O)c(C)c2c1) is C15H18O4.
Describe the ring structures in building block <BB_2156>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2156>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2156>.
**Token:** <BB_2156> **SMILES:** COc1cc(C(C)(C)C)c2oc(C(=O)O)c(C)c2c1 **Molecular Formula:** C15H18O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2157>.
Cc1cnnn1CC(=O)O
What is the building block token for the following molecule?
Cc1cnnn1CC(=O)O
<BB_2157>
What is the molecular formula for <BB_2157>?
The molecular formula for <BB_2157> (Cc1cnnn1CC(=O)O) is C5H7N3O2.
Describe the ring structures in building block <BB_2157>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2157>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2157>.
**Token:** <BB_2157> **SMILES:** Cc1cnnn1CC(=O)O **Molecular Formula:** C5H7N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2158>.
FC1(F)COCC1CBr
What is the building block token for the following molecule?
FC1(F)COCC1CBr
<BB_2158>
What is the molecular formula for <BB_2158>?
The molecular formula for <BB_2158> (FC1(F)COCC1CBr) is C5H7BrF2O.
Describe the ring structures in building block <BB_2158>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2158>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2158>.
**Token:** <BB_2158> **SMILES:** FC1(F)COCC1CBr **Molecular Formula:** C5H7BrF2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2159>.
CC(C)(C)OC(=O)[C@@H]1CC[C@H](N)C1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)[C@@H]1CC[C@H](N)C1.Cl
<BB_2159>
What is the molecular formula for <BB_2159>?
The molecular formula for <BB_2159> (CC(C)(C)OC(=O)[C@@H]1CC[C@H](N)C1.Cl) is C10H20ClNO2.
Describe the ring structures in building block <BB_2159>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2159>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2159>.
**Token:** <BB_2159> **SMILES:** CC(C)(C)OC(=O)[C@@H]1CC[C@H](N)C1.Cl **Molecular Formula:** C10H20ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2160>.
CN(CCC(F)(F)F)c1ccc(N)nc1
What is the building block token for the following molecule?
CN(CCC(F)(F)F)c1ccc(N)nc1
<BB_2160>
What is the molecular formula for <BB_2160>?
The molecular formula for <BB_2160> (CN(CCC(F)(F)F)c1ccc(N)nc1) is C9H12F3N3.
Describe the ring structures in building block <BB_2160>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2160>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2160>.
**Token:** <BB_2160> **SMILES:** CN(CCC(F)(F)F)c1ccc(N)nc1 **Molecular Formula:** C9H12F3N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2161>.
O=C(O)CS(=O)(=O)c1ccc(F)cc1
What is the building block token for the following molecule?
O=C(O)CS(=O)(=O)c1ccc(F)cc1
<BB_2161>
What is the molecular formula for <BB_2161>?
The molecular formula for <BB_2161> (O=C(O)CS(=O)(=O)c1ccc(F)cc1) is C8H7FO4S.
Describe the ring structures in building block <BB_2161>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2161>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2161>.
**Token:** <BB_2161> **SMILES:** O=C(O)CS(=O)(=O)c1ccc(F)cc1 **Molecular Formula:** C8H7FO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2162>.
O=S(=O)(Cl)c1cc(F)c(Br)c(F)c1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cc(F)c(Br)c(F)c1
<BB_2162>
What is the molecular formula for <BB_2162>?
The molecular formula for <BB_2162> (O=S(=O)(Cl)c1cc(F)c(Br)c(F)c1) is C6H2BrClF2O2S.
Describe the ring structures in building block <BB_2162>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2162>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2162>.
**Token:** <BB_2162> **SMILES:** O=S(=O)(Cl)c1cc(F)c(Br)c(F)c1 **Molecular Formula:** C6H2BrClF2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2163>.
CC(C)[C@@H]1NS(=O)(=O)NC1=O
What is the building block token for the following molecule?
CC(C)[C@@H]1NS(=O)(=O)NC1=O
<BB_2163>
What is the molecular formula for <BB_2163>?
The molecular formula for <BB_2163> (CC(C)[C@@H]1NS(=O)(=O)NC1=O) is C5H10N2O3S.
Describe the ring structures in building block <BB_2163>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2163>.
The molecule contains the following groups: Secondary Amine, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2163>.
**Token:** <BB_2163> **SMILES:** CC(C)[C@@H]1NS(=O)(=O)NC1=O **Molecular Formula:** C5H10N2O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Sulfonamide
Provide the SMILES representation for the building block token <BB_2164>.
Nc1cc2n(n1)CCCN(Cc1ccccc1)C2
What is the building block token for the following molecule?
Nc1cc2n(n1)CCCN(Cc1ccccc1)C2
<BB_2164>
What is the molecular formula for <BB_2164>?
The molecular formula for <BB_2164> (Nc1cc2n(n1)CCCN(Cc1ccccc1)C2) is C14H18N4.
Describe the ring structures in building block <BB_2164>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_2164>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2164>.
**Token:** <BB_2164> **SMILES:** Nc1cc2n(n1)CCCN(Cc1ccccc1)C2 **Molecular Formula:** C14H18N4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2165>.
COc1cc(OC)cc(C(N)c2nccn2C)c1
What is the building block token for the following molecule?
COc1cc(OC)cc(C(N)c2nccn2C)c1
<BB_2165>
What is the molecular formula for <BB_2165>?
The molecular formula for <BB_2165> (COc1cc(OC)cc(C(N)c2nccn2C)c1) is C13H17N3O2.
Describe the ring structures in building block <BB_2165>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2165>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2165>.
**Token:** <BB_2165> **SMILES:** COc1cc(OC)cc(C(N)c2nccn2C)c1 **Molecular Formula:** C13H17N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2166>.
CC(C)(C)OC(=O)N1CC2(C1)C(N)CC21CCC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2(C1)C(N)CC21CCC1
<BB_2166>
What is the molecular formula for <BB_2166>?
The molecular formula for <BB_2166> (CC(C)(C)OC(=O)N1CC2(C1)C(N)CC21CCC1) is C14H24N2O2.
Describe the ring structures in building block <BB_2166>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.