instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2166>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2166>.
**Token:** <BB_2166> **SMILES:** CC(C)(C)OC(=O)N1CC2(C1)C(N)CC21CCC1 **Molecular Formula:** C14H24N2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2167>.
CN1C(=O)C[C@@H](C(=O)O)[C@@H]1c1cccnc1
What is the building block token for the following molecule?
CN1C(=O)C[C@@H](C(=O)O)[C@@H]1c1cccnc1
<BB_2167>
What is the molecular formula for <BB_2167>?
The molecular formula for <BB_2167> (CN1C(=O)C[C@@H](C(=O)O)[C@@H]1c1cccnc1) is C11H12N2O3.
Describe the ring structures in building block <BB_2167>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2167>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2167>.
**Token:** <BB_2167> **SMILES:** CN1C(=O)C[C@@H](C(=O)O)[C@@H]1c1cccnc1 **Molecular Formula:** C11H12N2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2168>.
C#CCS(=O)(=O)CCNC(=O)OC(C)(C)C
What is the building block token for the following molecule?
C#CCS(=O)(=O)CCNC(=O)OC(C)(C)C
<BB_2168>
What is the molecular formula for <BB_2168>?
The molecular formula for <BB_2168> (C#CCS(=O)(=O)CCNC(=O)OC(C)(C)C) is C10H17NO4S.
Describe the ring structures in building block <BB_2168>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2168>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2168>.
**Token:** <BB_2168> **SMILES:** C#CCS(=O)(=O)CCNC(=O)OC(C)(C)C **Molecular Formula:** C10H17NO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2169>.
OCC1CC2(C1)OCCO2
What is the building block token for the following molecule?
OCC1CC2(C1)OCCO2
<BB_2169>
What is the molecular formula for <BB_2169>?
The molecular formula for <BB_2169> (OCC1CC2(C1)OCCO2) is C7H12O3.
Describe the ring structures in building block <BB_2169>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2169>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2169>.
**Token:** <BB_2169> **SMILES:** OCC1CC2(C1)OCCO2 **Molecular Formula:** C7H12O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2170>.
CNCC1(C)COC1
What is the building block token for the following molecule?
CNCC1(C)COC1
<BB_2170>
What is the molecular formula for <BB_2170>?
The molecular formula for <BB_2170> (CNCC1(C)COC1) is C6H13NO.
Describe the ring structures in building block <BB_2170>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2170>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2170>.
**Token:** <BB_2170> **SMILES:** CNCC1(C)COC1 **Molecular Formula:** C6H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2171>.
Nc1cc(N2C(=O)CCC2=O)ccc1F
What is the building block token for the following molecule?
Nc1cc(N2C(=O)CCC2=O)ccc1F
<BB_2171>
What is the molecular formula for <BB_2171>?
The molecular formula for <BB_2171> (Nc1cc(N2C(=O)CCC2=O)ccc1F) is C10H9FN2O2.
Describe the ring structures in building block <BB_2171>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2171>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2171>.
**Token:** <BB_2171> **SMILES:** Nc1cc(N2C(=O)CCC2=O)ccc1F **Molecular Formula:** C10H9FN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2172>.
NC(=O)CNS(=O)(=O)c1cccc(C(=O)O)c1
What is the building block token for the following molecule?
NC(=O)CNS(=O)(=O)c1cccc(C(=O)O)c1
<BB_2172>
What is the molecular formula for <BB_2172>?
The molecular formula for <BB_2172> (NC(=O)CNS(=O)(=O)c1cccc(C(=O)O)c1) is C9H10N2O5S.
Describe the ring structures in building block <BB_2172>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2172>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2172>.
**Token:** <BB_2172> **SMILES:** NC(=O)CNS(=O)(=O)c1cccc(C(=O)O)c1 **Molecular Formula:** C9H10N2O5S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Amide, Sulfonamide
Provide the SMILES representation for the building block token <BB_2173>.
CCOS(=O)(=O)C=CC(C)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
CCOS(=O)(=O)C=CC(C)NC(=O)OC(C)(C)C
<BB_2173>
What is the molecular formula for <BB_2173>?
The molecular formula for <BB_2173> (CCOS(=O)(=O)C=CC(C)NC(=O)OC(C)(C)C) is C11H21NO5S.
Describe the ring structures in building block <BB_2173>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2173>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2173>.
**Token:** <BB_2173> **SMILES:** CCOS(=O)(=O)C=CC(C)NC(=O)OC(C)(C)C **Molecular Formula:** C11H21NO5S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2174>.
N#CCCCS(=O)(=O)Cl
What is the building block token for the following molecule?
N#CCCCS(=O)(=O)Cl
<BB_2174>
What is the molecular formula for <BB_2174>?
The molecular formula for <BB_2174> (N#CCCCS(=O)(=O)Cl) is C4H6ClNO2S.
Describe the ring structures in building block <BB_2174>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2174>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2174>.
**Token:** <BB_2174> **SMILES:** N#CCCCS(=O)(=O)Cl **Molecular Formula:** C4H6ClNO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2175>.
Cl.OC[C@@H]1C[C@@H](F)CN1
What is the building block token for the following molecule?
Cl.OC[C@@H]1C[C@@H](F)CN1
<BB_2175>
What is the molecular formula for <BB_2175>?
The molecular formula for <BB_2175> (Cl.OC[C@@H]1C[C@@H](F)CN1) is C5H11ClFNO.
Describe the ring structures in building block <BB_2175>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2175>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2175>.
**Token:** <BB_2175> **SMILES:** Cl.OC[C@@H]1C[C@@H](F)CN1 **Molecular Formula:** C5H11ClFNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2176>.
C#Cc1cnn(C)c1C(=O)O
What is the building block token for the following molecule?
C#Cc1cnn(C)c1C(=O)O
<BB_2176>
What is the molecular formula for <BB_2176>?
The molecular formula for <BB_2176> (C#Cc1cnn(C)c1C(=O)O) is C7H6N2O2.
Describe the ring structures in building block <BB_2176>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2176>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2176>.
**Token:** <BB_2176> **SMILES:** C#Cc1cnn(C)c1C(=O)O **Molecular Formula:** C7H6N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2177>.
CC(C)(C)c1cc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1
What is the building block token for the following molecule?
CC(C)(C)c1cc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1
<BB_2177>
What is the molecular formula for <BB_2177>?
The molecular formula for <BB_2177> (CC(C)(C)c1cc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1) is C10H11F7N2.
Describe the ring structures in building block <BB_2177>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2177>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2177>.
**Token:** <BB_2177> **SMILES:** CC(C)(C)c1cc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 **Molecular Formula:** C10H11F7N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2178>.
Cc1nc2ccccc2c2ncccc12
What is the building block token for the following molecule?
Cc1nc2ccccc2c2ncccc12
<BB_2178>
What is the molecular formula for <BB_2178>?
The molecular formula for <BB_2178> (Cc1nc2ccccc2c2ncccc12) is C13H10N2.
Describe the ring structures in building block <BB_2178>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2178>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2178>.
**Token:** <BB_2178> **SMILES:** Cc1nc2ccccc2c2ncccc12 **Molecular Formula:** C13H10N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2179>.
CC(C)(C)OC(=O)N1CC2(CC(C(=O)O)C2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2(CC(C(=O)O)C2)C1
<BB_2179>
What is the molecular formula for <BB_2179>?
The molecular formula for <BB_2179> (CC(C)(C)OC(=O)N1CC2(CC(C(=O)O)C2)C1) is C12H19NO4.
Describe the ring structures in building block <BB_2179>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2179>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2179>.
**Token:** <BB_2179> **SMILES:** CC(C)(C)OC(=O)N1CC2(CC(C(=O)O)C2)C1 **Molecular Formula:** C12H19NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2180>.
CC(C)C(=O)Nc1ccc(C#N)cc1
What is the building block token for the following molecule?
CC(C)C(=O)Nc1ccc(C#N)cc1
<BB_2180>
What is the molecular formula for <BB_2180>?
The molecular formula for <BB_2180> (CC(C)C(=O)Nc1ccc(C#N)cc1) is C11H12N2O.
Describe the ring structures in building block <BB_2180>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2180>.
The molecule contains the following groups: Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2180>.
**Token:** <BB_2180> **SMILES:** CC(C)C(=O)Nc1ccc(C#N)cc1 **Molecular Formula:** C11H12N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Nitrile
Provide the SMILES representation for the building block token <BB_2181>.
CNC(=S)N(C)N
What is the building block token for the following molecule?
CNC(=S)N(C)N
<BB_2181>
What is the molecular formula for <BB_2181>?
The molecular formula for <BB_2181> (CNC(=S)N(C)N) is C3H9N3S.
Describe the ring structures in building block <BB_2181>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2181>.
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2181>.
**Token:** <BB_2181> **SMILES:** CNC(=S)N(C)N **Molecular Formula:** C3H9N3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2182>.
COC(=O)C(F)(F)CN.Cl
What is the building block token for the following molecule?
COC(=O)C(F)(F)CN.Cl
<BB_2182>
What is the molecular formula for <BB_2182>?
The molecular formula for <BB_2182> (COC(=O)C(F)(F)CN.Cl) is C4H8ClF2NO2.
Describe the ring structures in building block <BB_2182>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2182>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2182>.
**Token:** <BB_2182> **SMILES:** COC(=O)C(F)(F)CN.Cl **Molecular Formula:** C4H8ClF2NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2183>.
Cl.O=C(O)C(c1ccncc1)C1CCCCC1
What is the building block token for the following molecule?
Cl.O=C(O)C(c1ccncc1)C1CCCCC1
<BB_2183>