instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2183>?
The molecular formula for <BB_2183> (Cl.O=C(O)C(c1ccncc1)C1CCCCC1) is C13H18ClNO2.
Describe the ring structures in building block <BB_2183>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2183>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2183>.
**Token:** <BB_2183> **SMILES:** Cl.O=C(O)C(c1ccncc1)C1CCCCC1 **Molecular Formula:** C13H18ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2184>.
CCOC(=O)C(C)(N)Cc1ccccc1.Cl
What is the building block token for the following molecule?
CCOC(=O)C(C)(N)Cc1ccccc1.Cl
<BB_2184>
What is the molecular formula for <BB_2184>?
The molecular formula for <BB_2184> (CCOC(=O)C(C)(N)Cc1ccccc1.Cl) is C12H18ClNO2.
Describe the ring structures in building block <BB_2184>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2184>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2184>.
**Token:** <BB_2184> **SMILES:** CCOC(=O)C(C)(N)Cc1ccccc1.Cl **Molecular Formula:** C12H18ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2185>.
O=c1[nH]c2cc(Br)c(Cl)nc2[nH]1
What is the building block token for the following molecule?
O=c1[nH]c2cc(Br)c(Cl)nc2[nH]1
<BB_2185>
What is the molecular formula for <BB_2185>?
The molecular formula for <BB_2185> (O=c1[nH]c2cc(Br)c(Cl)nc2[nH]1) is C6H3BrClN3O.
Describe the ring structures in building block <BB_2185>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2185>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2185>.
**Token:** <BB_2185> **SMILES:** O=c1[nH]c2cc(Br)c(Cl)nc2[nH]1 **Molecular Formula:** C6H3BrClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2186>.
CC(=O)c1ccc(B(O)O)cc1F
What is the building block token for the following molecule?
CC(=O)c1ccc(B(O)O)cc1F
<BB_2186>
What is the molecular formula for <BB_2186>?
The molecular formula for <BB_2186> (CC(=O)c1ccc(B(O)O)cc1F) is C8H8BFO3.
Describe the ring structures in building block <BB_2186>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2186>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2186>.
**Token:** <BB_2186> **SMILES:** CC(=O)c1ccc(B(O)O)cc1F **Molecular Formula:** C8H8BFO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2187>.
Cn1cc(S(=O)(=O)Cl)c(Br)n1
What is the building block token for the following molecule?
Cn1cc(S(=O)(=O)Cl)c(Br)n1
<BB_2187>
What is the molecular formula for <BB_2187>?
The molecular formula for <BB_2187> (Cn1cc(S(=O)(=O)Cl)c(Br)n1) is C4H4BrClN2O2S.
Describe the ring structures in building block <BB_2187>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2187>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2187>.
**Token:** <BB_2187> **SMILES:** Cn1cc(S(=O)(=O)Cl)c(Br)n1 **Molecular Formula:** C4H4BrClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2188>.
CC(O)C1CCC1
What is the building block token for the following molecule?
CC(O)C1CCC1
<BB_2188>
What is the molecular formula for <BB_2188>?
The molecular formula for <BB_2188> (CC(O)C1CCC1) is C6H12O.
Describe the ring structures in building block <BB_2188>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2188>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2188>.
**Token:** <BB_2188> **SMILES:** CC(O)C1CCC1 **Molecular Formula:** C6H12O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2189>.
CNCC(COC)C(F)(F)F.Cl
What is the building block token for the following molecule?
CNCC(COC)C(F)(F)F.Cl
<BB_2189>
What is the molecular formula for <BB_2189>?
The molecular formula for <BB_2189> (CNCC(COC)C(F)(F)F.Cl) is C6H13ClF3NO.
Describe the ring structures in building block <BB_2189>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2189>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2189>.
**Token:** <BB_2189> **SMILES:** CNCC(COC)C(F)(F)F.Cl **Molecular Formula:** C6H13ClF3NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2190>.
Cc1cc(CCl)ccc1C(C)C
What is the building block token for the following molecule?
Cc1cc(CCl)ccc1C(C)C
<BB_2190>
What is the molecular formula for <BB_2190>?
The molecular formula for <BB_2190> (Cc1cc(CCl)ccc1C(C)C) is C11H15Cl.
Describe the ring structures in building block <BB_2190>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2190>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2190>.
**Token:** <BB_2190> **SMILES:** Cc1cc(CCl)ccc1C(C)C **Molecular Formula:** C11H15Cl **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2191>.
Cc1cccc2c1OC(C)(C)CCN2.Cl
What is the building block token for the following molecule?
Cc1cccc2c1OC(C)(C)CCN2.Cl
<BB_2191>
What is the molecular formula for <BB_2191>?
The molecular formula for <BB_2191> (Cc1cccc2c1OC(C)(C)CCN2.Cl) is C12H18ClNO.
Describe the ring structures in building block <BB_2191>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_2191>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2191>.
**Token:** <BB_2191> **SMILES:** Cc1cccc2c1OC(C)(C)CCN2.Cl **Molecular Formula:** C12H18ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2192>.
[N-]=[N+]=Nc1ccc(OC(F)(F)F)cc1Br
What is the building block token for the following molecule?
[N-]=[N+]=Nc1ccc(OC(F)(F)F)cc1Br
<BB_2192>
What is the molecular formula for <BB_2192>?
The molecular formula for <BB_2192> ([N-]=[N+]=Nc1ccc(OC(F)(F)F)cc1Br) is C7H3BrF3N3O.
Describe the ring structures in building block <BB_2192>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2192>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2192>.
**Token:** <BB_2192> **SMILES:** [N-]=[N+]=Nc1ccc(OC(F)(F)F)cc1Br **Molecular Formula:** C7H3BrF3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2193>.
C#CCNC1CCNC1.Cl.Cl
What is the building block token for the following molecule?
C#CCNC1CCNC1.Cl.Cl
<BB_2193>
What is the molecular formula for <BB_2193>?
The molecular formula for <BB_2193> (C#CCNC1CCNC1.Cl.Cl) is C7H14Cl2N2.
Describe the ring structures in building block <BB_2193>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2193>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2193>.
**Token:** <BB_2193> **SMILES:** C#CCNC1CCNC1.Cl.Cl **Molecular Formula:** C7H14Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2194>.
O=C(O)c1ccc2c(c1)S(=O)(=O)N=CN2
What is the building block token for the following molecule?
O=C(O)c1ccc2c(c1)S(=O)(=O)N=CN2
<BB_2194>
What is the molecular formula for <BB_2194>?
The molecular formula for <BB_2194> (O=C(O)c1ccc2c(c1)S(=O)(=O)N=CN2) is C8H6N2O4S.
Describe the ring structures in building block <BB_2194>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2194>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2194>.
**Token:** <BB_2194> **SMILES:** O=C(O)c1ccc2c(c1)S(=O)(=O)N=CN2 **Molecular Formula:** C8H6N2O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2195>.
Cc1cc2c(cc1C)C(NC1CC1)CCCO2
What is the building block token for the following molecule?
Cc1cc2c(cc1C)C(NC1CC1)CCCO2
<BB_2195>
What is the molecular formula for <BB_2195>?
The molecular formula for <BB_2195> (Cc1cc2c(cc1C)C(NC1CC1)CCCO2) is C15H21NO.
Describe the ring structures in building block <BB_2195>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 7.
List the primary functional groups present in <BB_2195>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2195>.
**Token:** <BB_2195> **SMILES:** Cc1cc2c(cc1C)C(NC1CC1)CCCO2 **Molecular Formula:** C15H21NO **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2196>.
Cc1cncc(Br)c1N
What is the building block token for the following molecule?
Cc1cncc(Br)c1N
<BB_2196>
What is the molecular formula for <BB_2196>?
The molecular formula for <BB_2196> (Cc1cncc(Br)c1N) is C6H7BrN2.
Describe the ring structures in building block <BB_2196>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2196>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2196>.
**Token:** <BB_2196> **SMILES:** Cc1cncc(Br)c1N **Molecular Formula:** C6H7BrN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2197>.
CN1C(=O)Cc2cc(Cl)ccc21
What is the building block token for the following molecule?
CN1C(=O)Cc2cc(Cl)ccc21
<BB_2197>
What is the molecular formula for <BB_2197>?
The molecular formula for <BB_2197> (CN1C(=O)Cc2cc(Cl)ccc21) is C9H8ClNO.
Describe the ring structures in building block <BB_2197>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2197>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2197>.
**Token:** <BB_2197> **SMILES:** CN1C(=O)Cc2cc(Cl)ccc21 **Molecular Formula:** C9H8ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2198>.
CC(CO)CC(F)(F)F
What is the building block token for the following molecule?
CC(CO)CC(F)(F)F
<BB_2198>
What is the molecular formula for <BB_2198>?
The molecular formula for <BB_2198> (CC(CO)CC(F)(F)F) is C5H9F3O.
Describe the ring structures in building block <BB_2198>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2198>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2198>.
**Token:** <BB_2198> **SMILES:** CC(CO)CC(F)(F)F **Molecular Formula:** C5H9F3O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2199>.
O=C(O)Cc1ccc(O)c(F)c1
What is the building block token for the following molecule?
O=C(O)Cc1ccc(O)c(F)c1
<BB_2199>
What is the molecular formula for <BB_2199>?
The molecular formula for <BB_2199> (O=C(O)Cc1ccc(O)c(F)c1) is C8H7FO3.
Describe the ring structures in building block <BB_2199>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2199>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2199>.
**Token:** <BB_2199> **SMILES:** O=C(O)Cc1ccc(O)c(F)c1 **Molecular Formula:** C8H7FO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)