instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_250>.
Cc1ccc(CCC(C)N)cc1
What is the building block token for the following molecule?
Cc1ccc(CCC(C)N)cc1
<BB_250>
What is the molecular formula for <BB_250>?
The molecular formula for <BB_250> (Cc1ccc(CCC(C)N)cc1) is C11H17N.
Describe the ring structures in building block <BB_250>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_250>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_250>.
**Token:** <BB_250> **SMILES:** Cc1ccc(CCC(C)N)cc1 **Molecular Formula:** C11H17N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_251>.
O=[N+]([O-])CC(O)C(F)(F)F
What is the building block token for the following molecule?
O=[N+]([O-])CC(O)C(F)(F)F
<BB_251>
What is the molecular formula for <BB_251>?
The molecular formula for <BB_251> (O=[N+]([O-])CC(O)C(F)(F)F) is C3H4F3NO3.
Describe the ring structures in building block <BB_251>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_251>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_251>.
**Token:** <BB_251> **SMILES:** O=[N+]([O-])CC(O)C(F)(F)F **Molecular Formula:** C3H4F3NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_252>.
Cl.O=[N+]([O-])c1ccccc1OC1CCNC1
What is the building block token for the following molecule?
Cl.O=[N+]([O-])c1ccccc1OC1CCNC1
<BB_252>
What is the molecular formula for <BB_252>?
The molecular formula for <BB_252> (Cl.O=[N+]([O-])c1ccccc1OC1CCNC1) is C10H13ClN2O3.
Describe the ring structures in building block <BB_252>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_252>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_252>.
**Token:** <BB_252> **SMILES:** Cl.O=[N+]([O-])c1ccccc1OC1CCNC1 **Molecular Formula:** C10H13ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_253>.
CC1(C)OB(C=C2CCS(=O)(=O)CC2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C=C2CCS(=O)(=O)CC2)OC1(C)C
<BB_253>
What is the molecular formula for <BB_253>?
The molecular formula for <BB_253> (CC1(C)OB(C=C2CCS(=O)(=O)CC2)OC1(C)C) is C12H21BO4S.
Describe the ring structures in building block <BB_253>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_253>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_253>.
**Token:** <BB_253> **SMILES:** CC1(C)OB(C=C2CCS(=O)(=O)CC2)OC1(C)C **Molecular Formula:** C12H21BO4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_254>.
N#CCCNC(=S)NN
What is the building block token for the following molecule?
N#CCCNC(=S)NN
<BB_254>
What is the molecular formula for <BB_254>?
The molecular formula for <BB_254> (N#CCCNC(=S)NN) is C4H8N4S.
Describe the ring structures in building block <BB_254>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_254>.
The molecule contains the following groups: Amine, Secondary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_254>.
**Token:** <BB_254> **SMILES:** N#CCCNC(=S)NN **Molecular Formula:** C4H8N4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Secondary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_255>.
Cc1cccc(F)c1OCCN.Cl
What is the building block token for the following molecule?
Cc1cccc(F)c1OCCN.Cl
<BB_255>
What is the molecular formula for <BB_255>?
The molecular formula for <BB_255> (Cc1cccc(F)c1OCCN.Cl) is C9H13ClFNO.
Describe the ring structures in building block <BB_255>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_255>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_255>.
**Token:** <BB_255> **SMILES:** Cc1cccc(F)c1OCCN.Cl **Molecular Formula:** C9H13ClFNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_256>.
NCc1ccc2cnccc2c1
What is the building block token for the following molecule?
NCc1ccc2cnccc2c1
<BB_256>
What is the molecular formula for <BB_256>?
The molecular formula for <BB_256> (NCc1ccc2cnccc2c1) is C10H10N2.
Describe the ring structures in building block <BB_256>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_256>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_256>.
**Token:** <BB_256> **SMILES:** NCc1ccc2cnccc2c1 **Molecular Formula:** C10H10N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_257>.
Cl.O=C(O)[C@H]1CC[C@H]2CNCC[C@H]21
What is the building block token for the following molecule?
Cl.O=C(O)[C@H]1CC[C@H]2CNCC[C@H]21
<BB_257>
What is the molecular formula for <BB_257>?
The molecular formula for <BB_257> (Cl.O=C(O)[C@H]1CC[C@H]2CNCC[C@H]21) is C9H16ClNO2.
Describe the ring structures in building block <BB_257>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_257>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_257>.
**Token:** <BB_257> **SMILES:** Cl.O=C(O)[C@H]1CC[C@H]2CNCC[C@H]21 **Molecular Formula:** C9H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_258>.
CC(C)(C)OC(=O)N1CC[C@H]2CCNC[C@H]21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC[C@H]2CCNC[C@H]21
<BB_258>
What is the molecular formula for <BB_258>?
The molecular formula for <BB_258> (CC(C)(C)OC(=O)N1CC[C@H]2CCNC[C@H]21) is C12H22N2O2.
Describe the ring structures in building block <BB_258>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_258>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_258>.
**Token:** <BB_258> **SMILES:** CC(C)(C)OC(=O)N1CC[C@H]2CCNC[C@H]21 **Molecular Formula:** C12H22N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_259>.
C#Cc1c(C)cccc1C
What is the building block token for the following molecule?
C#Cc1c(C)cccc1C
<BB_259>
What is the molecular formula for <BB_259>?
The molecular formula for <BB_259> (C#Cc1c(C)cccc1C) is C10H10.
Describe the ring structures in building block <BB_259>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_259>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_259>.
**Token:** <BB_259> **SMILES:** C#Cc1c(C)cccc1C **Molecular Formula:** C10H10 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_260>.
Cc1ccc(Br)c(F)c1CN.Cl
What is the building block token for the following molecule?
Cc1ccc(Br)c(F)c1CN.Cl
<BB_260>
What is the molecular formula for <BB_260>?
The molecular formula for <BB_260> (Cc1ccc(Br)c(F)c1CN.Cl) is C8H10BrClFN.
Describe the ring structures in building block <BB_260>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_260>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_260>.
**Token:** <BB_260> **SMILES:** Cc1ccc(Br)c(F)c1CN.Cl **Molecular Formula:** C8H10BrClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_261>.
CCC1CC(Br)C(=O)O1
What is the building block token for the following molecule?
CCC1CC(Br)C(=O)O1
<BB_261>
What is the molecular formula for <BB_261>?
The molecular formula for <BB_261> (CCC1CC(Br)C(=O)O1) is C6H9BrO2.
Describe the ring structures in building block <BB_261>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_261>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_261>.
**Token:** <BB_261> **SMILES:** CCC1CC(Br)C(=O)O1 **Molecular Formula:** C6H9BrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_262>.
Cc1ccc(CN)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
Cc1ccc(CN)cc1[N+](=O)[O-]
<BB_262>
What is the molecular formula for <BB_262>?
The molecular formula for <BB_262> (Cc1ccc(CN)cc1[N+](=O)[O-]) is C8H10N2O2.
Describe the ring structures in building block <BB_262>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_262>.
The molecule contains the following groups: Amine, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_262>.
**Token:** <BB_262> **SMILES:** Cc1ccc(CN)cc1[N+](=O)[O-] **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_263>.
O=C(O)c1cccc(-c2ccc(F)cc2)n1
What is the building block token for the following molecule?
O=C(O)c1cccc(-c2ccc(F)cc2)n1
<BB_263>
What is the molecular formula for <BB_263>?
The molecular formula for <BB_263> (O=C(O)c1cccc(-c2ccc(F)cc2)n1) is C12H8FNO2.
Describe the ring structures in building block <BB_263>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_263>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_263>.
**Token:** <BB_263> **SMILES:** O=C(O)c1cccc(-c2ccc(F)cc2)n1 **Molecular Formula:** C12H8FNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_264>.
CC1CC(O)c2nccn21
What is the building block token for the following molecule?
CC1CC(O)c2nccn21
<BB_264>
What is the molecular formula for <BB_264>?
The molecular formula for <BB_264> (CC1CC(O)c2nccn21) is C7H10N2O.
Describe the ring structures in building block <BB_264>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_264>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_264>.
**Token:** <BB_264> **SMILES:** CC1CC(O)c2nccn21 **Molecular Formula:** C7H10N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_265>.
Cl.O=C(CCl)N1CCN(Cc2cccs2)CC1
What is the building block token for the following molecule?
Cl.O=C(CCl)N1CCN(Cc2cccs2)CC1
<BB_265>
What is the molecular formula for <BB_265>?
The molecular formula for <BB_265> (Cl.O=C(CCl)N1CCN(Cc2cccs2)CC1) is C11H16Cl2N2OS.
Describe the ring structures in building block <BB_265>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_265>.
The molecule contains the following groups: Tertiary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_265>.
**Token:** <BB_265> **SMILES:** Cl.O=C(CCl)N1CCN(Cc2cccs2)CC1 **Molecular Formula:** C11H16Cl2N2OS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_266>.
CC(C)(C)OC(=O)NC[C@@H]1C[C@H](O)C1(C)C
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC[C@@H]1C[C@H](O)C1(C)C
<BB_266>
What is the molecular formula for <BB_266>?
The molecular formula for <BB_266> (CC(C)(C)OC(=O)NC[C@@H]1C[C@H](O)C1(C)C) is C12H23NO3.
Describe the ring structures in building block <BB_266>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.