instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2200>.
Cc1nccn1CCN1C(=O)c2ccccc2C1=O
What is the building block token for the following molecule?
Cc1nccn1CCN1C(=O)c2ccccc2C1=O
<BB_2200>
What is the molecular formula for <BB_2200>?
The molecular formula for <BB_2200> (Cc1nccn1CCN1C(=O)c2ccccc2C1=O) is C14H13N3O2.
Describe the ring structures in building block <BB_2200>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2200>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2200>.
**Token:** <BB_2200> **SMILES:** Cc1nccn1CCN1C(=O)c2ccccc2C1=O **Molecular Formula:** C14H13N3O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2201>.
CC(C)(C)OC(=O)N1CC1CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC1CO
<BB_2201>
What is the molecular formula for <BB_2201>?
The molecular formula for <BB_2201> (CC(C)(C)OC(=O)N1CC1CO) is C8H15NO3.
Describe the ring structures in building block <BB_2201>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2201>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2201>.
**Token:** <BB_2201> **SMILES:** CC(C)(C)OC(=O)N1CC1CO **Molecular Formula:** C8H15NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2202>.
CC[C@]12C[C@H]1C(=O)OC2=O
What is the building block token for the following molecule?
CC[C@]12C[C@H]1C(=O)OC2=O
<BB_2202>
What is the molecular formula for <BB_2202>?
The molecular formula for <BB_2202> (CC[C@]12C[C@H]1C(=O)OC2=O) is C7H8O3.
Describe the ring structures in building block <BB_2202>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2202>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2202>.
**Token:** <BB_2202> **SMILES:** CC[C@]12C[C@H]1C(=O)OC2=O **Molecular Formula:** C7H8O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2203>.
Cc1[nH]c(=O)c(C)nc1Br
What is the building block token for the following molecule?
Cc1[nH]c(=O)c(C)nc1Br
<BB_2203>
What is the molecular formula for <BB_2203>?
The molecular formula for <BB_2203> (Cc1[nH]c(=O)c(C)nc1Br) is C6H7BrN2O.
Describe the ring structures in building block <BB_2203>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2203>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2203>.
**Token:** <BB_2203> **SMILES:** Cc1[nH]c(=O)c(C)nc1Br **Molecular Formula:** C6H7BrN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2204>.
COCCOc1cccc(C#CCCl)c1
What is the building block token for the following molecule?
COCCOc1cccc(C#CCCl)c1
<BB_2204>
What is the molecular formula for <BB_2204>?
The molecular formula for <BB_2204> (COCCOc1cccc(C#CCCl)c1) is C12H13ClO2.
Describe the ring structures in building block <BB_2204>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2204>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2204>.
**Token:** <BB_2204> **SMILES:** COCCOc1cccc(C#CCCl)c1 **Molecular Formula:** C12H13ClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2205>.
Cl.O=C(Nc1cccc(F)c1)C1CCNCC1
What is the building block token for the following molecule?
Cl.O=C(Nc1cccc(F)c1)C1CCNCC1
<BB_2205>
What is the molecular formula for <BB_2205>?
The molecular formula for <BB_2205> (Cl.O=C(Nc1cccc(F)c1)C1CCNCC1) is C12H16ClFN2O.
Describe the ring structures in building block <BB_2205>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2205>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2205>.
**Token:** <BB_2205> **SMILES:** Cl.O=C(Nc1cccc(F)c1)C1CCNCC1 **Molecular Formula:** C12H16ClFN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2206>.
CCNC(=O)c1ccccc1O
What is the building block token for the following molecule?
CCNC(=O)c1ccccc1O
<BB_2206>
What is the molecular formula for <BB_2206>?
The molecular formula for <BB_2206> (CCNC(=O)c1ccccc1O) is C9H11NO2.
Describe the ring structures in building block <BB_2206>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2206>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2206>.
**Token:** <BB_2206> **SMILES:** CCNC(=O)c1ccccc1O **Molecular Formula:** C9H11NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2207>.
NS(=O)(=O)C1CCCCC1
What is the building block token for the following molecule?
NS(=O)(=O)C1CCCCC1
<BB_2207>
What is the molecular formula for <BB_2207>?
The molecular formula for <BB_2207> (NS(=O)(=O)C1CCCCC1) is C6H13NO2S.
Describe the ring structures in building block <BB_2207>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2207>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2207>.
**Token:** <BB_2207> **SMILES:** NS(=O)(=O)C1CCCCC1 **Molecular Formula:** C6H13NO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2208>.
O=C(O)CNc1nc(Cl)nc2ccccc12
What is the building block token for the following molecule?
O=C(O)CNc1nc(Cl)nc2ccccc12
<BB_2208>
What is the molecular formula for <BB_2208>?
The molecular formula for <BB_2208> (O=C(O)CNc1nc(Cl)nc2ccccc12) is C10H8ClN3O2.
Describe the ring structures in building block <BB_2208>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2208>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2208>.
**Token:** <BB_2208> **SMILES:** O=C(O)CNc1nc(Cl)nc2ccccc12 **Molecular Formula:** C10H8ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2209>.
Ic1cn2ccccc2n1
What is the building block token for the following molecule?
Ic1cn2ccccc2n1
<BB_2209>
What is the molecular formula for <BB_2209>?
The molecular formula for <BB_2209> (Ic1cn2ccccc2n1) is C7H5IN2.
Describe the ring structures in building block <BB_2209>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2209>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2209>.
**Token:** <BB_2209> **SMILES:** Ic1cn2ccccc2n1 **Molecular Formula:** C7H5IN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2210>.
COC(=O)/C=C1/CCN(C(=O)OC(C)(C)C)CCN1
What is the building block token for the following molecule?
COC(=O)/C=C1/CCN(C(=O)OC(C)(C)C)CCN1
<BB_2210>
What is the molecular formula for <BB_2210>?
The molecular formula for <BB_2210> (COC(=O)/C=C1/CCN(C(=O)OC(C)(C)C)CCN1) is C13H22N2O4.
Describe the ring structures in building block <BB_2210>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_2210>.
The molecule contains the following groups: Secondary Amine, Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2210>.
**Token:** <BB_2210> **SMILES:** COC(=O)/C=C1/CCN(C(=O)OC(C)(C)C)CCN1 **Molecular Formula:** C13H22N2O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_2211>.
CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C(=O)O)CCC1(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C(=O)O)CCC1(F)F
<BB_2211>
What is the molecular formula for <BB_2211>?
The molecular formula for <BB_2211> (CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C(=O)O)CCC1(F)F) is C12H19F2NO4.
Describe the ring structures in building block <BB_2211>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2211>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2211>.
**Token:** <BB_2211> **SMILES:** CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C(=O)O)CCC1(F)F **Molecular Formula:** C12H19F2NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2212>.
OCC1(F)COCCC1(F)F
What is the building block token for the following molecule?
OCC1(F)COCCC1(F)F
<BB_2212>
What is the molecular formula for <BB_2212>?
The molecular formula for <BB_2212> (OCC1(F)COCCC1(F)F) is C6H9F3O2.
Describe the ring structures in building block <BB_2212>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2212>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2212>.
**Token:** <BB_2212> **SMILES:** OCC1(F)COCCC1(F)F **Molecular Formula:** C6H9F3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2213>.
CCNCC1CCOC1
What is the building block token for the following molecule?
CCNCC1CCOC1
<BB_2213>
What is the molecular formula for <BB_2213>?
The molecular formula for <BB_2213> (CCNCC1CCOC1) is C7H15NO.
Describe the ring structures in building block <BB_2213>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2213>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2213>.
**Token:** <BB_2213> **SMILES:** CCNCC1CCOC1 **Molecular Formula:** C7H15NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2214>.
Clc1ccnc2[nH]nc(I)c12
What is the building block token for the following molecule?
Clc1ccnc2[nH]nc(I)c12
<BB_2214>
What is the molecular formula for <BB_2214>?
The molecular formula for <BB_2214> (Clc1ccnc2[nH]nc(I)c12) is C6H3ClIN3.
Describe the ring structures in building block <BB_2214>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2214>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2214>.
**Token:** <BB_2214> **SMILES:** Clc1ccnc2[nH]nc(I)c12 **Molecular Formula:** C6H3ClIN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2215>.
CCC(N)COCC1CC1
What is the building block token for the following molecule?
CCC(N)COCC1CC1
<BB_2215>
What is the molecular formula for <BB_2215>?
The molecular formula for <BB_2215> (CCC(N)COCC1CC1) is C8H17NO.
Describe the ring structures in building block <BB_2215>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2215>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2215>.
**Token:** <BB_2215> **SMILES:** CCC(N)COCC1CC1 **Molecular Formula:** C8H17NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2216>.
CC1(C)CC(N)CC(C)(C)O1
What is the building block token for the following molecule?
CC1(C)CC(N)CC(C)(C)O1
<BB_2216>
What is the molecular formula for <BB_2216>?
The molecular formula for <BB_2216> (CC1(C)CC(N)CC(C)(C)O1) is C9H19NO.
Describe the ring structures in building block <BB_2216>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.