instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2216>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2216>.
**Token:** <BB_2216> **SMILES:** CC1(C)CC(N)CC(C)(C)O1 **Molecular Formula:** C9H19NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2217>.
N#CCN1CCCc2ccccc21
What is the building block token for the following molecule?
N#CCN1CCCc2ccccc21
<BB_2217>
What is the molecular formula for <BB_2217>?
The molecular formula for <BB_2217> (N#CCN1CCCc2ccccc21) is C11H12N2.
Describe the ring structures in building block <BB_2217>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2217>.
The molecule contains the following groups: Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2217>.
**Token:** <BB_2217> **SMILES:** N#CCN1CCCc2ccccc21 **Molecular Formula:** C11H12N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_2218>.
Cl.NCC1(c2ccc(Br)cc2)CCOCC1
What is the building block token for the following molecule?
Cl.NCC1(c2ccc(Br)cc2)CCOCC1
<BB_2218>
What is the molecular formula for <BB_2218>?
The molecular formula for <BB_2218> (Cl.NCC1(c2ccc(Br)cc2)CCOCC1) is C12H17BrClNO.
Describe the ring structures in building block <BB_2218>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2218>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2218>.
**Token:** <BB_2218> **SMILES:** Cl.NCC1(c2ccc(Br)cc2)CCOCC1 **Molecular Formula:** C12H17BrClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2219>.
CCc1cc(Oc2ccc(F)cc2C=O)ccc1Cl
What is the building block token for the following molecule?
CCc1cc(Oc2ccc(F)cc2C=O)ccc1Cl
<BB_2219>
What is the molecular formula for <BB_2219>?
The molecular formula for <BB_2219> (CCc1cc(Oc2ccc(F)cc2C=O)ccc1Cl) is C15H12ClFO2.
Describe the ring structures in building block <BB_2219>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2219>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2219>.
**Token:** <BB_2219> **SMILES:** CCc1cc(Oc2ccc(F)cc2C=O)ccc1Cl **Molecular Formula:** C15H12ClFO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2220>.
CC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1
What is the building block token for the following molecule?
CC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1
<BB_2220>
What is the molecular formula for <BB_2220>?
The molecular formula for <BB_2220> (CC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1) is C13H18BNO3.
Describe the ring structures in building block <BB_2220>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2220>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2220>.
**Token:** <BB_2220> **SMILES:** CC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1 **Molecular Formula:** C13H18BNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2221>.
CC1(C)CC2(CC(C(=O)O)C2)C1
What is the building block token for the following molecule?
CC1(C)CC2(CC(C(=O)O)C2)C1
<BB_2221>
What is the molecular formula for <BB_2221>?
The molecular formula for <BB_2221> (CC1(C)CC2(CC(C(=O)O)C2)C1) is C10H16O2.
Describe the ring structures in building block <BB_2221>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2221>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2221>.
**Token:** <BB_2221> **SMILES:** CC1(C)CC2(CC(C(=O)O)C2)C1 **Molecular Formula:** C10H16O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2222>.
Cc1c(C(=O)O)sc2ncnc(N)c12
What is the building block token for the following molecule?
Cc1c(C(=O)O)sc2ncnc(N)c12
<BB_2222>
What is the molecular formula for <BB_2222>?
The molecular formula for <BB_2222> (Cc1c(C(=O)O)sc2ncnc(N)c12) is C8H7N3O2S.
Describe the ring structures in building block <BB_2222>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2222>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_2222>.
**Token:** <BB_2222> **SMILES:** Cc1c(C(=O)O)sc2ncnc(N)c12 **Molecular Formula:** C8H7N3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_2223>.
O=CC(C=O)c1ccccc1
What is the building block token for the following molecule?
O=CC(C=O)c1ccccc1
<BB_2223>
What is the molecular formula for <BB_2223>?
The molecular formula for <BB_2223> (O=CC(C=O)c1ccccc1) is C9H8O2.
Describe the ring structures in building block <BB_2223>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2223>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2223>.
**Token:** <BB_2223> **SMILES:** O=CC(C=O)c1ccccc1 **Molecular Formula:** C9H8O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2224>.
NC1CCCN2CCCCC12
What is the building block token for the following molecule?
NC1CCCN2CCCCC12
<BB_2224>
What is the molecular formula for <BB_2224>?
The molecular formula for <BB_2224> (NC1CCCN2CCCCC12) is C9H18N2.
Describe the ring structures in building block <BB_2224>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2224>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2224>.
**Token:** <BB_2224> **SMILES:** NC1CCCN2CCCCC12 **Molecular Formula:** C9H18N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2225>.
COC(=O)C(C)(N)Cc1ccccc1
What is the building block token for the following molecule?
COC(=O)C(C)(N)Cc1ccccc1
<BB_2225>
What is the molecular formula for <BB_2225>?
The molecular formula for <BB_2225> (COC(=O)C(C)(N)Cc1ccccc1) is C11H15NO2.
Describe the ring structures in building block <BB_2225>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2225>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2225>.
**Token:** <BB_2225> **SMILES:** COC(=O)C(C)(N)Cc1ccccc1 **Molecular Formula:** C11H15NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2226>.
COC(=O)c1cc(S(=O)(=O)Cl)nn1C
What is the building block token for the following molecule?
COC(=O)c1cc(S(=O)(=O)Cl)nn1C
<BB_2226>
What is the molecular formula for <BB_2226>?
The molecular formula for <BB_2226> (COC(=O)c1cc(S(=O)(=O)Cl)nn1C) is C6H7ClN2O4S.
Describe the ring structures in building block <BB_2226>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2226>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2226>.
**Token:** <BB_2226> **SMILES:** COC(=O)c1cc(S(=O)(=O)Cl)nn1C **Molecular Formula:** C6H7ClN2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2227>.
Cl.Cl.NCc1cn2c(C(F)(F)F)cccc2n1
What is the building block token for the following molecule?
Cl.Cl.NCc1cn2c(C(F)(F)F)cccc2n1
<BB_2227>
What is the molecular formula for <BB_2227>?
The molecular formula for <BB_2227> (Cl.Cl.NCc1cn2c(C(F)(F)F)cccc2n1) is C9H10Cl2F3N3.
Describe the ring structures in building block <BB_2227>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2227>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2227>.
**Token:** <BB_2227> **SMILES:** Cl.Cl.NCc1cn2c(C(F)(F)F)cccc2n1 **Molecular Formula:** C9H10Cl2F3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2228>.
COc1cc(Cl)c(Cl)cn1
What is the building block token for the following molecule?
COc1cc(Cl)c(Cl)cn1
<BB_2228>
What is the molecular formula for <BB_2228>?
The molecular formula for <BB_2228> (COc1cc(Cl)c(Cl)cn1) is C6H5Cl2NO.
Describe the ring structures in building block <BB_2228>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2228>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2228>.
**Token:** <BB_2228> **SMILES:** COc1cc(Cl)c(Cl)cn1 **Molecular Formula:** C6H5Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2229>.
Cc1cc(-c2oncc2C)ccc1O
What is the building block token for the following molecule?
Cc1cc(-c2oncc2C)ccc1O
<BB_2229>
What is the molecular formula for <BB_2229>?
The molecular formula for <BB_2229> (Cc1cc(-c2oncc2C)ccc1O) is C11H11NO2.
Describe the ring structures in building block <BB_2229>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2229>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2229>.
**Token:** <BB_2229> **SMILES:** Cc1cc(-c2oncc2C)ccc1O **Molecular Formula:** C11H11NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2230>.
Oc1ccncc1
What is the building block token for the following molecule?
Oc1ccncc1
<BB_2230>
What is the molecular formula for <BB_2230>?
The molecular formula for <BB_2230> (Oc1ccncc1) is C5H5NO.
Describe the ring structures in building block <BB_2230>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2230>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2230>.
**Token:** <BB_2230> **SMILES:** Oc1ccncc1 **Molecular Formula:** C5H5NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2231>.
COC(=O)c1ccc(F)cc1OC
What is the building block token for the following molecule?
COC(=O)c1ccc(F)cc1OC
<BB_2231>
What is the molecular formula for <BB_2231>?
The molecular formula for <BB_2231> (COC(=O)c1ccc(F)cc1OC) is C9H9FO3.
Describe the ring structures in building block <BB_2231>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2231>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2231>.
**Token:** <BB_2231> **SMILES:** COC(=O)c1ccc(F)cc1OC **Molecular Formula:** C9H9FO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2232>.
C=C(CN)C1CCOCC1.Cl
What is the building block token for the following molecule?
C=C(CN)C1CCOCC1.Cl
<BB_2232>
What is the molecular formula for <BB_2232>?
The molecular formula for <BB_2232> (C=C(CN)C1CCOCC1.Cl) is C8H16ClNO.
Describe the ring structures in building block <BB_2232>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2232>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2232>.
**Token:** <BB_2232> **SMILES:** C=C(CN)C1CCOCC1.Cl **Molecular Formula:** C8H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2233>.
CCOC(C#N)OCC
What is the building block token for the following molecule?
CCOC(C#N)OCC
<BB_2233>