instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2233>?
The molecular formula for <BB_2233> (CCOC(C#N)OCC) is C6H11NO2.
Describe the ring structures in building block <BB_2233>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2233>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2233>.
**Token:** <BB_2233> **SMILES:** CCOC(C#N)OCC **Molecular Formula:** C6H11NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2234>.
[N-]=[N+]=NC1CN(C(=O)OCc2ccccc2)C1
What is the building block token for the following molecule?
[N-]=[N+]=NC1CN(C(=O)OCc2ccccc2)C1
<BB_2234>
What is the molecular formula for <BB_2234>?
The molecular formula for <BB_2234> ([N-]=[N+]=NC1CN(C(=O)OCc2ccccc2)C1) is C11H12N4O2.
Describe the ring structures in building block <BB_2234>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_2234>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2234>.
**Token:** <BB_2234> **SMILES:** [N-]=[N+]=NC1CN(C(=O)OCc2ccccc2)C1 **Molecular Formula:** C11H12N4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2235>.
O=c1cnc(-c2ccc(Cl)cc2)n[nH]1
What is the building block token for the following molecule?
O=c1cnc(-c2ccc(Cl)cc2)n[nH]1
<BB_2235>
What is the molecular formula for <BB_2235>?
The molecular formula for <BB_2235> (O=c1cnc(-c2ccc(Cl)cc2)n[nH]1) is C9H6ClN3O.
Describe the ring structures in building block <BB_2235>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2235>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2235>.
**Token:** <BB_2235> **SMILES:** O=c1cnc(-c2ccc(Cl)cc2)n[nH]1 **Molecular Formula:** C9H6ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2236>.
Cl.c1nc2c(n1C1CC1)CCOC2
What is the building block token for the following molecule?
Cl.c1nc2c(n1C1CC1)CCOC2
<BB_2236>
What is the molecular formula for <BB_2236>?
The molecular formula for <BB_2236> (Cl.c1nc2c(n1C1CC1)CCOC2) is C9H13ClN2O.
Describe the ring structures in building block <BB_2236>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2236>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2236>.
**Token:** <BB_2236> **SMILES:** Cl.c1nc2c(n1C1CC1)CCOC2 **Molecular Formula:** C9H13ClN2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2237>.
CNC(=O)c1cc(N)ccc1F
What is the building block token for the following molecule?
CNC(=O)c1cc(N)ccc1F
<BB_2237>
What is the molecular formula for <BB_2237>?
The molecular formula for <BB_2237> (CNC(=O)c1cc(N)ccc1F) is C8H9FN2O.
Describe the ring structures in building block <BB_2237>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2237>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2237>.
**Token:** <BB_2237> **SMILES:** CNC(=O)c1cc(N)ccc1F **Molecular Formula:** C8H9FN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2238>.
CCOC(=O)c1cc(=O)[nH]c2nn(CC3CC3)cc12
What is the building block token for the following molecule?
CCOC(=O)c1cc(=O)[nH]c2nn(CC3CC3)cc12
<BB_2238>
What is the molecular formula for <BB_2238>?
The molecular formula for <BB_2238> (CCOC(=O)c1cc(=O)[nH]c2nn(CC3CC3)cc12) is C13H15N3O3.
Describe the ring structures in building block <BB_2238>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2238>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2238>.
**Token:** <BB_2238> **SMILES:** CCOC(=O)c1cc(=O)[nH]c2nn(CC3CC3)cc12 **Molecular Formula:** C13H15N3O3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2239>.
COCC(=O)NCC1CNCC12CCCCC2
What is the building block token for the following molecule?
COCC(=O)NCC1CNCC12CCCCC2
<BB_2239>
What is the molecular formula for <BB_2239>?
The molecular formula for <BB_2239> (COCC(=O)NCC1CNCC12CCCCC2) is C13H24N2O2.
Describe the ring structures in building block <BB_2239>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2239>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2239>.
**Token:** <BB_2239> **SMILES:** COCC(=O)NCC1CNCC12CCCCC2 **Molecular Formula:** C13H24N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2240>.
CC(C)(C#N)c1ccccc1O
What is the building block token for the following molecule?
CC(C)(C#N)c1ccccc1O
<BB_2240>
What is the molecular formula for <BB_2240>?
The molecular formula for <BB_2240> (CC(C)(C#N)c1ccccc1O) is C10H11NO.
Describe the ring structures in building block <BB_2240>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2240>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2240>.
**Token:** <BB_2240> **SMILES:** CC(C)(C#N)c1ccccc1O **Molecular Formula:** C10H11NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_2241>.
CC(=O)Cc1ccc(Cl)c(Cl)c1
What is the building block token for the following molecule?
CC(=O)Cc1ccc(Cl)c(Cl)c1
<BB_2241>
What is the molecular formula for <BB_2241>?
The molecular formula for <BB_2241> (CC(=O)Cc1ccc(Cl)c(Cl)c1) is C9H8Cl2O.
Describe the ring structures in building block <BB_2241>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2241>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2241>.
**Token:** <BB_2241> **SMILES:** CC(=O)Cc1ccc(Cl)c(Cl)c1 **Molecular Formula:** C9H8Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2242>.
Cc1cccc(C)c1-n1nnnc1S
What is the building block token for the following molecule?
Cc1cccc(C)c1-n1nnnc1S
<BB_2242>
What is the molecular formula for <BB_2242>?
The molecular formula for <BB_2242> (Cc1cccc(C)c1-n1nnnc1S) is C9H10N4S.
Describe the ring structures in building block <BB_2242>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2242>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_2242>.
**Token:** <BB_2242> **SMILES:** Cc1cccc(C)c1-n1nnnc1S **Molecular Formula:** C9H10N4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_2243>.
CCOC(=O)/C=C/C(F)F
What is the building block token for the following molecule?
CCOC(=O)/C=C/C(F)F
<BB_2243>
What is the molecular formula for <BB_2243>?
The molecular formula for <BB_2243> (CCOC(=O)/C=C/C(F)F) is C6H8F2O2.
Describe the ring structures in building block <BB_2243>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2243>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2243>.
**Token:** <BB_2243> **SMILES:** CCOC(=O)/C=C/C(F)F **Molecular Formula:** C6H8F2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2244>.
Fc1cc(F)c2ccccc2n1
What is the building block token for the following molecule?
Fc1cc(F)c2ccccc2n1
<BB_2244>
What is the molecular formula for <BB_2244>?
The molecular formula for <BB_2244> (Fc1cc(F)c2ccccc2n1) is C9H5F2N.
Describe the ring structures in building block <BB_2244>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2244>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2244>.
**Token:** <BB_2244> **SMILES:** Fc1cc(F)c2ccccc2n1 **Molecular Formula:** C9H5F2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2245>.
O=S(=O)(Cl)c1cccc2c(Cl)ccnc12
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cccc2c(Cl)ccnc12
<BB_2245>
What is the molecular formula for <BB_2245>?
The molecular formula for <BB_2245> (O=S(=O)(Cl)c1cccc2c(Cl)ccnc12) is C9H5Cl2NO2S.
Describe the ring structures in building block <BB_2245>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2245>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2245>.
**Token:** <BB_2245> **SMILES:** O=S(=O)(Cl)c1cccc2c(Cl)ccnc12 **Molecular Formula:** C9H5Cl2NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2246>.
Cc1cc2[nH]c(=O)[nH]c2cc1S(=O)(=O)Cl
What is the building block token for the following molecule?
Cc1cc2[nH]c(=O)[nH]c2cc1S(=O)(=O)Cl
<BB_2246>
What is the molecular formula for <BB_2246>?
The molecular formula for <BB_2246> (Cc1cc2[nH]c(=O)[nH]c2cc1S(=O)(=O)Cl) is C8H7ClN2O3S.
Describe the ring structures in building block <BB_2246>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2246>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2246>.
**Token:** <BB_2246> **SMILES:** Cc1cc2[nH]c(=O)[nH]c2cc1S(=O)(=O)Cl **Molecular Formula:** C8H7ClN2O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2247>.
O=c1[nH]c(-c2ccsc2)nc2ccccc12
What is the building block token for the following molecule?
O=c1[nH]c(-c2ccsc2)nc2ccccc12
<BB_2247>
What is the molecular formula for <BB_2247>?
The molecular formula for <BB_2247> (O=c1[nH]c(-c2ccsc2)nc2ccccc12) is C12H8N2OS.
Describe the ring structures in building block <BB_2247>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2247>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2247>.
**Token:** <BB_2247> **SMILES:** O=c1[nH]c(-c2ccsc2)nc2ccccc12 **Molecular Formula:** C12H8N2OS **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2248>.
O=C(O)c1ccn(-c2ccc([N+](=O)[O-])cn2)n1
What is the building block token for the following molecule?
O=C(O)c1ccn(-c2ccc([N+](=O)[O-])cn2)n1
<BB_2248>
What is the molecular formula for <BB_2248>?
The molecular formula for <BB_2248> (O=C(O)c1ccn(-c2ccc([N+](=O)[O-])cn2)n1) is C9H6N4O4.
Describe the ring structures in building block <BB_2248>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2248>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2248>.
**Token:** <BB_2248> **SMILES:** O=C(O)c1ccn(-c2ccc([N+](=O)[O-])cn2)n1 **Molecular Formula:** C9H6N4O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_2249>.
Nc1ccccc1CN1CCC(O)CC1
What is the building block token for the following molecule?
Nc1ccccc1CN1CCC(O)CC1
<BB_2249>
What is the molecular formula for <BB_2249>?
The molecular formula for <BB_2249> (Nc1ccccc1CN1CCC(O)CC1) is C12H18N2O.
Describe the ring structures in building block <BB_2249>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2249>.
The molecule contains the following groups: Amine, Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2249>.
**Token:** <BB_2249> **SMILES:** Nc1ccccc1CN1CCC(O)CC1 **Molecular Formula:** C12H18N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Alcohol