instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2250>.
NC1CCc2nc(-c3ccc(F)cc3F)cn2C1
What is the building block token for the following molecule?
NC1CCc2nc(-c3ccc(F)cc3F)cn2C1
<BB_2250>
What is the molecular formula for <BB_2250>?
The molecular formula for <BB_2250> (NC1CCc2nc(-c3ccc(F)cc3F)cn2C1) is C13H13F2N3.
Describe the ring structures in building block <BB_2250>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2250>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2250>.
**Token:** <BB_2250> **SMILES:** NC1CCc2nc(-c3ccc(F)cc3F)cn2C1 **Molecular Formula:** C13H13F2N3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2251>.
CC(C)(C)OC(=O)Nc1ccc(OC(F)(F)F)cc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1ccc(OC(F)(F)F)cc1
<BB_2251>
What is the molecular formula for <BB_2251>?
The molecular formula for <BB_2251> (CC(C)(C)OC(=O)Nc1ccc(OC(F)(F)F)cc1) is C12H14F3NO3.
Describe the ring structures in building block <BB_2251>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2251>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2251>.
**Token:** <BB_2251> **SMILES:** CC(C)(C)OC(=O)Nc1ccc(OC(F)(F)F)cc1 **Molecular Formula:** C12H14F3NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2252>.
CC1(C)COC(CO)CO1
What is the building block token for the following molecule?
CC1(C)COC(CO)CO1
<BB_2252>
What is the molecular formula for <BB_2252>?
The molecular formula for <BB_2252> (CC1(C)COC(CO)CO1) is C7H14O3.
Describe the ring structures in building block <BB_2252>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2252>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2252>.
**Token:** <BB_2252> **SMILES:** CC1(C)COC(CO)CO1 **Molecular Formula:** C7H14O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2253>.
Oc1c(Cl)cnc2c(Br)cccc12
What is the building block token for the following molecule?
Oc1c(Cl)cnc2c(Br)cccc12
<BB_2253>
What is the molecular formula for <BB_2253>?
The molecular formula for <BB_2253> (Oc1c(Cl)cnc2c(Br)cccc12) is C9H5BrClNO.
Describe the ring structures in building block <BB_2253>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2253>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2253>.
**Token:** <BB_2253> **SMILES:** Oc1c(Cl)cnc2c(Br)cccc12 **Molecular Formula:** C9H5BrClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2254>.
C[C@H]1[C@@H](C(=O)O)CCN1C.Cl
What is the building block token for the following molecule?
C[C@H]1[C@@H](C(=O)O)CCN1C.Cl
<BB_2254>
What is the molecular formula for <BB_2254>?
The molecular formula for <BB_2254> (C[C@H]1[C@@H](C(=O)O)CCN1C.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_2254>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2254>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2254>.
**Token:** <BB_2254> **SMILES:** C[C@H]1[C@@H](C(=O)O)CCN1C.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2255>.
O=c1[nH]cc(I)c2cccnc12
What is the building block token for the following molecule?
O=c1[nH]cc(I)c2cccnc12
<BB_2255>
What is the molecular formula for <BB_2255>?
The molecular formula for <BB_2255> (O=c1[nH]cc(I)c2cccnc12) is C8H5IN2O.
Describe the ring structures in building block <BB_2255>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2255>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2255>.
**Token:** <BB_2255> **SMILES:** O=c1[nH]cc(I)c2cccnc12 **Molecular Formula:** C8H5IN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2256>.
Cl.NCc1ccc(Cn2ccccc2=O)cc1
What is the building block token for the following molecule?
Cl.NCc1ccc(Cn2ccccc2=O)cc1
<BB_2256>
What is the molecular formula for <BB_2256>?
The molecular formula for <BB_2256> (Cl.NCc1ccc(Cn2ccccc2=O)cc1) is C13H15ClN2O.
Describe the ring structures in building block <BB_2256>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2256>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2256>.
**Token:** <BB_2256> **SMILES:** Cl.NCc1ccc(Cn2ccccc2=O)cc1 **Molecular Formula:** C13H15ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2257>.
NS(=O)(=O)c1cncc2ccccc12
What is the building block token for the following molecule?
NS(=O)(=O)c1cncc2ccccc12
<BB_2257>
What is the molecular formula for <BB_2257>?
The molecular formula for <BB_2257> (NS(=O)(=O)c1cncc2ccccc12) is C9H8N2O2S.
Describe the ring structures in building block <BB_2257>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2257>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2257>.
**Token:** <BB_2257> **SMILES:** NS(=O)(=O)c1cncc2ccccc12 **Molecular Formula:** C9H8N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2258>.
Cl.NCC1CCC2COCCC2O1
What is the building block token for the following molecule?
Cl.NCC1CCC2COCCC2O1
<BB_2258>
What is the molecular formula for <BB_2258>?
The molecular formula for <BB_2258> (Cl.NCC1CCC2COCCC2O1) is C9H18ClNO2.
Describe the ring structures in building block <BB_2258>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2258>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2258>.
**Token:** <BB_2258> **SMILES:** Cl.NCC1CCC2COCCC2O1 **Molecular Formula:** C9H18ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2259>.
[N-]=[N+]=NCC1=NO[C@@H]2CCCC[C@H]12
What is the building block token for the following molecule?
[N-]=[N+]=NCC1=NO[C@@H]2CCCC[C@H]12
<BB_2259>
What is the molecular formula for <BB_2259>?
The molecular formula for <BB_2259> ([N-]=[N+]=NCC1=NO[C@@H]2CCCC[C@H]12) is C8H12N4O.
Describe the ring structures in building block <BB_2259>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2259>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2259>.
**Token:** <BB_2259> **SMILES:** [N-]=[N+]=NCC1=NO[C@@H]2CCCC[C@H]12 **Molecular Formula:** C8H12N4O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2260>.
CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1CC(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1CC(=O)O
<BB_2260>
What is the molecular formula for <BB_2260>?
The molecular formula for <BB_2260> (CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1CC(=O)O) is C11H19NO5.
Describe the ring structures in building block <BB_2260>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2260>.
The molecule contains the following groups: Carboxylic Acid, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2260>.
**Token:** <BB_2260> **SMILES:** CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1CC(=O)O **Molecular Formula:** C11H19NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2261>.
Cc1c(I)sc2nc[nH]c(=O)c12
What is the building block token for the following molecule?
Cc1c(I)sc2nc[nH]c(=O)c12
<BB_2261>
What is the molecular formula for <BB_2261>?
The molecular formula for <BB_2261> (Cc1c(I)sc2nc[nH]c(=O)c12) is C7H5IN2OS.
Describe the ring structures in building block <BB_2261>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2261>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2261>.
**Token:** <BB_2261> **SMILES:** Cc1c(I)sc2nc[nH]c(=O)c12 **Molecular Formula:** C7H5IN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2262>.
Cc1nccc2ccccc12
What is the building block token for the following molecule?
Cc1nccc2ccccc12
<BB_2262>
What is the molecular formula for <BB_2262>?
The molecular formula for <BB_2262> (Cc1nccc2ccccc12) is C10H9N.
Describe the ring structures in building block <BB_2262>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2262>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2262>.
**Token:** <BB_2262> **SMILES:** Cc1nccc2ccccc12 **Molecular Formula:** C10H9N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2263>.
Cl.NCCC1CCC(=O)O1
What is the building block token for the following molecule?
Cl.NCCC1CCC(=O)O1
<BB_2263>
What is the molecular formula for <BB_2263>?
The molecular formula for <BB_2263> (Cl.NCCC1CCC(=O)O1) is C6H12ClNO2.
Describe the ring structures in building block <BB_2263>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2263>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2263>.
**Token:** <BB_2263> **SMILES:** Cl.NCCC1CCC(=O)O1 **Molecular Formula:** C6H12ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2264>.
C[C@@H]1C[C@H](CS(=O)(=O)Cl)C[C@H](C)O1
What is the building block token for the following molecule?
C[C@@H]1C[C@H](CS(=O)(=O)Cl)C[C@H](C)O1
<BB_2264>
What is the molecular formula for <BB_2264>?
The molecular formula for <BB_2264> (C[C@@H]1C[C@H](CS(=O)(=O)Cl)C[C@H](C)O1) is C8H15ClO3S.
Describe the ring structures in building block <BB_2264>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2264>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2264>.
**Token:** <BB_2264> **SMILES:** C[C@@H]1C[C@H](CS(=O)(=O)Cl)C[C@H](C)O1 **Molecular Formula:** C8H15ClO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2265>.
Cl.O=c1[nH]ccnc1NCCN1CCOCC1
What is the building block token for the following molecule?
Cl.O=c1[nH]ccnc1NCCN1CCOCC1
<BB_2265>
What is the molecular formula for <BB_2265>?
The molecular formula for <BB_2265> (Cl.O=c1[nH]ccnc1NCCN1CCOCC1) is C10H17ClN4O2.
Describe the ring structures in building block <BB_2265>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2265>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2265>.
**Token:** <BB_2265> **SMILES:** Cl.O=c1[nH]ccnc1NCCN1CCOCC1 **Molecular Formula:** C10H17ClN4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2266>.
COc1ccc(C=O)cc1CO
What is the building block token for the following molecule?
COc1ccc(C=O)cc1CO
<BB_2266>
What is the molecular formula for <BB_2266>?
The molecular formula for <BB_2266> (COc1ccc(C=O)cc1CO) is C9H10O3.
Describe the ring structures in building block <BB_2266>.
The molecule contains 1 ring(s): an aromatic ring of size 6.