instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2266>.
The molecule contains the following groups: Aldehyde, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2266>.
**Token:** <BB_2266> **SMILES:** COc1ccc(C=O)cc1CO **Molecular Formula:** C9H10O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2267>.
CC(C)NC(=O)Nc1ccc(O)c(C(=O)O)c1
What is the building block token for the following molecule?
CC(C)NC(=O)Nc1ccc(O)c(C(=O)O)c1
<BB_2267>
What is the molecular formula for <BB_2267>?
The molecular formula for <BB_2267> (CC(C)NC(=O)Nc1ccc(O)c(C(=O)O)c1) is C11H14N2O4.
Describe the ring structures in building block <BB_2267>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2267>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2267>.
**Token:** <BB_2267> **SMILES:** CC(C)NC(=O)Nc1ccc(O)c(C(=O)O)c1 **Molecular Formula:** C11H14N2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2268>.
Cl.NC(=O)NC1CC(N)C1
What is the building block token for the following molecule?
Cl.NC(=O)NC1CC(N)C1
<BB_2268>
What is the molecular formula for <BB_2268>?
The molecular formula for <BB_2268> (Cl.NC(=O)NC1CC(N)C1) is C5H12ClN3O.
Describe the ring structures in building block <BB_2268>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2268>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2268>.
**Token:** <BB_2268> **SMILES:** Cl.NC(=O)NC1CC(N)C1 **Molecular Formula:** C5H12ClN3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2269>.
O=C1CSC(N2CCCCC2)=N1
What is the building block token for the following molecule?
O=C1CSC(N2CCCCC2)=N1
<BB_2269>
What is the molecular formula for <BB_2269>?
The molecular formula for <BB_2269> (O=C1CSC(N2CCCCC2)=N1) is C8H12N2OS.
Describe the ring structures in building block <BB_2269>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2269>.
The molecule contains the following groups: Tertiary Amine, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2269>.
**Token:** <BB_2269> **SMILES:** O=C1CSC(N2CCCCC2)=N1 **Molecular Formula:** C8H12N2OS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_2270>.
CCCNCC1CCCCC1.Cl
What is the building block token for the following molecule?
CCCNCC1CCCCC1.Cl
<BB_2270>
What is the molecular formula for <BB_2270>?
The molecular formula for <BB_2270> (CCCNCC1CCCCC1.Cl) is C10H22ClN.
Describe the ring structures in building block <BB_2270>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2270>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2270>.
**Token:** <BB_2270> **SMILES:** CCCNCC1CCCCC1.Cl **Molecular Formula:** C10H22ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2271>.
N#CCCO
What is the building block token for the following molecule?
N#CCCO
<BB_2271>
What is the molecular formula for <BB_2271>?
The molecular formula for <BB_2271> (N#CCCO) is C3H5NO.
Describe the ring structures in building block <BB_2271>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2271>.
The molecule contains the following groups: Alcohol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2271>.
**Token:** <BB_2271> **SMILES:** N#CCCO **Molecular Formula:** C3H5NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Nitrile
Provide the SMILES representation for the building block token <BB_2272>.
O=C(O)c1ccccc1-c1cccs1
What is the building block token for the following molecule?
O=C(O)c1ccccc1-c1cccs1
<BB_2272>
What is the molecular formula for <BB_2272>?
The molecular formula for <BB_2272> (O=C(O)c1ccccc1-c1cccs1) is C11H8O2S.
Describe the ring structures in building block <BB_2272>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2272>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2272>.
**Token:** <BB_2272> **SMILES:** O=C(O)c1ccccc1-c1cccs1 **Molecular Formula:** C11H8O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2273>.
CCCS(=N)(=O)c1cc(Br)ccc1OC
What is the building block token for the following molecule?
CCCS(=N)(=O)c1cc(Br)ccc1OC
<BB_2273>
What is the molecular formula for <BB_2273>?
The molecular formula for <BB_2273> (CCCS(=N)(=O)c1cc(Br)ccc1OC) is C10H14BrNO2S.
Describe the ring structures in building block <BB_2273>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2273>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2273>.
**Token:** <BB_2273> **SMILES:** CCCS(=N)(=O)c1cc(Br)ccc1OC **Molecular Formula:** C10H14BrNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2274>.
C=CC(=O)Nc1cncc(C(=O)O)c1
What is the building block token for the following molecule?
C=CC(=O)Nc1cncc(C(=O)O)c1
<BB_2274>
What is the molecular formula for <BB_2274>?
The molecular formula for <BB_2274> (C=CC(=O)Nc1cncc(C(=O)O)c1) is C9H8N2O3.
Describe the ring structures in building block <BB_2274>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2274>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2274>.
**Token:** <BB_2274> **SMILES:** C=CC(=O)Nc1cncc(C(=O)O)c1 **Molecular Formula:** C9H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2275>.
O=C(O)c1ccc(-c2ccsc2)nn1
What is the building block token for the following molecule?
O=C(O)c1ccc(-c2ccsc2)nn1
<BB_2275>
What is the molecular formula for <BB_2275>?
The molecular formula for <BB_2275> (O=C(O)c1ccc(-c2ccsc2)nn1) is C9H6N2O2S.
Describe the ring structures in building block <BB_2275>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2275>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2275>.
**Token:** <BB_2275> **SMILES:** O=C(O)c1ccc(-c2ccsc2)nn1 **Molecular Formula:** C9H6N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2276>.
CC(C)c1cc(Cl)cnc1N
What is the building block token for the following molecule?
CC(C)c1cc(Cl)cnc1N
<BB_2276>
What is the molecular formula for <BB_2276>?
The molecular formula for <BB_2276> (CC(C)c1cc(Cl)cnc1N) is C8H11ClN2.
Describe the ring structures in building block <BB_2276>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2276>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2276>.
**Token:** <BB_2276> **SMILES:** CC(C)c1cc(Cl)cnc1N **Molecular Formula:** C8H11ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2277>.
COC(=O)c1nc2cc(Br)ccc2s1
What is the building block token for the following molecule?
COC(=O)c1nc2cc(Br)ccc2s1
<BB_2277>
What is the molecular formula for <BB_2277>?
The molecular formula for <BB_2277> (COC(=O)c1nc2cc(Br)ccc2s1) is C9H6BrNO2S.
Describe the ring structures in building block <BB_2277>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2277>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2277>.
**Token:** <BB_2277> **SMILES:** COC(=O)c1nc2cc(Br)ccc2s1 **Molecular Formula:** C9H6BrNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2278>.
O=C(O)Cc1cccc(O)c1
What is the building block token for the following molecule?
O=C(O)Cc1cccc(O)c1
<BB_2278>
What is the molecular formula for <BB_2278>?
The molecular formula for <BB_2278> (O=C(O)Cc1cccc(O)c1) is C8H8O3.
Describe the ring structures in building block <BB_2278>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2278>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2278>.
**Token:** <BB_2278> **SMILES:** O=C(O)Cc1cccc(O)c1 **Molecular Formula:** C8H8O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2279>.
COC(=O)[C@@H]1CNC[C@H]1c1ccc(OC)cc1.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1CNC[C@H]1c1ccc(OC)cc1.Cl
<BB_2279>
What is the molecular formula for <BB_2279>?
The molecular formula for <BB_2279> (COC(=O)[C@@H]1CNC[C@H]1c1ccc(OC)cc1.Cl) is C13H18ClNO3.
Describe the ring structures in building block <BB_2279>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2279>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2279>.
**Token:** <BB_2279> **SMILES:** COC(=O)[C@@H]1CNC[C@H]1c1ccc(OC)cc1.Cl **Molecular Formula:** C13H18ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2280>.
Cl.Cl.Nc1ccc2[nH]c(-c3ccco3)nc2c1
What is the building block token for the following molecule?
Cl.Cl.Nc1ccc2[nH]c(-c3ccco3)nc2c1
<BB_2280>
What is the molecular formula for <BB_2280>?
The molecular formula for <BB_2280> (Cl.Cl.Nc1ccc2[nH]c(-c3ccco3)nc2c1) is C11H11Cl2N3O.
Describe the ring structures in building block <BB_2280>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_2280>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2280>.
**Token:** <BB_2280> **SMILES:** Cl.Cl.Nc1ccc2[nH]c(-c3ccco3)nc2c1 **Molecular Formula:** C11H11Cl2N3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2281>.
Cl.NCCNC(=O)Cc1c[nH]c2ccc(O)cc12
What is the building block token for the following molecule?
Cl.NCCNC(=O)Cc1c[nH]c2ccc(O)cc12
<BB_2281>
What is the molecular formula for <BB_2281>?
The molecular formula for <BB_2281> (Cl.NCCNC(=O)Cc1c[nH]c2ccc(O)cc12) is C12H16ClN3O2.
Describe the ring structures in building block <BB_2281>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2281>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2281>.
**Token:** <BB_2281> **SMILES:** Cl.NCCNC(=O)Cc1c[nH]c2ccc(O)cc12 **Molecular Formula:** C12H16ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2282>.
Cn1c(=O)[nH]c(=O)c2ccc(C(F)(F)F)nc21
What is the building block token for the following molecule?
Cn1c(=O)[nH]c(=O)c2ccc(C(F)(F)F)nc21
<BB_2282>
What is the molecular formula for <BB_2282>?
The molecular formula for <BB_2282> (Cn1c(=O)[nH]c(=O)c2ccc(C(F)(F)F)nc21) is C9H6F3N3O2.
Describe the ring structures in building block <BB_2282>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2282>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2282>.
**Token:** <BB_2282> **SMILES:** Cn1c(=O)[nH]c(=O)c2ccc(C(F)(F)F)nc21 **Molecular Formula:** C9H6F3N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2283>.
c1cnn(C2CC2)c1
What is the building block token for the following molecule?
c1cnn(C2CC2)c1
<BB_2283>