instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2283>?
The molecular formula for <BB_2283> (c1cnn(C2CC2)c1) is C6H8N2.
Describe the ring structures in building block <BB_2283>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2283>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2283>.
**Token:** <BB_2283> **SMILES:** c1cnn(C2CC2)c1 **Molecular Formula:** C6H8N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2284>.
CC1(C)[C@H](O)[C@H]2CCN[C@H]21
What is the building block token for the following molecule?
CC1(C)[C@H](O)[C@H]2CCN[C@H]21
<BB_2284>
What is the molecular formula for <BB_2284>?
The molecular formula for <BB_2284> (CC1(C)[C@H](O)[C@H]2CCN[C@H]21) is C8H15NO.
Describe the ring structures in building block <BB_2284>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2284>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2284>.
**Token:** <BB_2284> **SMILES:** CC1(C)[C@H](O)[C@H]2CCN[C@H]21 **Molecular Formula:** C8H15NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2285>.
COCC1CCCN1N
What is the building block token for the following molecule?
COCC1CCCN1N
<BB_2285>
What is the molecular formula for <BB_2285>?
The molecular formula for <BB_2285> (COCC1CCCN1N) is C6H14N2O.
Describe the ring structures in building block <BB_2285>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2285>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2285>.
**Token:** <BB_2285> **SMILES:** COCC1CCCN1N **Molecular Formula:** C6H14N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2286>.
NCCCC1CCCO1
What is the building block token for the following molecule?
NCCCC1CCCO1
<BB_2286>
What is the molecular formula for <BB_2286>?
The molecular formula for <BB_2286> (NCCCC1CCCO1) is C7H15NO.
Describe the ring structures in building block <BB_2286>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2286>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2286>.
**Token:** <BB_2286> **SMILES:** NCCCC1CCCO1 **Molecular Formula:** C7H15NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2287>.
CCOC(=O)C(CN)Cc1ccccc1.Cl
What is the building block token for the following molecule?
CCOC(=O)C(CN)Cc1ccccc1.Cl
<BB_2287>
What is the molecular formula for <BB_2287>?
The molecular formula for <BB_2287> (CCOC(=O)C(CN)Cc1ccccc1.Cl) is C12H18ClNO2.
Describe the ring structures in building block <BB_2287>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2287>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2287>.
**Token:** <BB_2287> **SMILES:** CCOC(=O)C(CN)Cc1ccccc1.Cl **Molecular Formula:** C12H18ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2288>.
Cc1cccc(Cn2cc(Br)c([N+](=O)[O-])n2)c1
What is the building block token for the following molecule?
Cc1cccc(Cn2cc(Br)c([N+](=O)[O-])n2)c1
<BB_2288>
What is the molecular formula for <BB_2288>?
The molecular formula for <BB_2288> (Cc1cccc(Cn2cc(Br)c([N+](=O)[O-])n2)c1) is C11H10BrN3O2.
Describe the ring structures in building block <BB_2288>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2288>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2288>.
**Token:** <BB_2288> **SMILES:** Cc1cccc(Cn2cc(Br)c([N+](=O)[O-])n2)c1 **Molecular Formula:** C11H10BrN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2289>.
COc1ccc(-n2c(C)cc(C=O)c2C)cc1OC
What is the building block token for the following molecule?
COc1ccc(-n2c(C)cc(C=O)c2C)cc1OC
<BB_2289>
What is the molecular formula for <BB_2289>?
The molecular formula for <BB_2289> (COc1ccc(-n2c(C)cc(C=O)c2C)cc1OC) is C15H17NO3.
Describe the ring structures in building block <BB_2289>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2289>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2289>.
**Token:** <BB_2289> **SMILES:** COc1ccc(-n2c(C)cc(C=O)c2C)cc1OC **Molecular Formula:** C15H17NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2290>.
CC1Cn2nc(C(=O)O)cc2CN1.Cl
What is the building block token for the following molecule?
CC1Cn2nc(C(=O)O)cc2CN1.Cl
<BB_2290>
What is the molecular formula for <BB_2290>?
The molecular formula for <BB_2290> (CC1Cn2nc(C(=O)O)cc2CN1.Cl) is C8H12ClN3O2.
Describe the ring structures in building block <BB_2290>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2290>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2290>.
**Token:** <BB_2290> **SMILES:** CC1Cn2nc(C(=O)O)cc2CN1.Cl **Molecular Formula:** C8H12ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2291>.
COc1ccc(C(N)C2CC2)cc1Cl.Cl
What is the building block token for the following molecule?
COc1ccc(C(N)C2CC2)cc1Cl.Cl
<BB_2291>
What is the molecular formula for <BB_2291>?
The molecular formula for <BB_2291> (COc1ccc(C(N)C2CC2)cc1Cl.Cl) is C11H15Cl2NO.
Describe the ring structures in building block <BB_2291>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2291>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2291>.
**Token:** <BB_2291> **SMILES:** COc1ccc(C(N)C2CC2)cc1Cl.Cl **Molecular Formula:** C11H15Cl2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2292>.
C#CC1(C(=O)OC)CC1
What is the building block token for the following molecule?
C#CC1(C(=O)OC)CC1
<BB_2292>
What is the molecular formula for <BB_2292>?
The molecular formula for <BB_2292> (C#CC1(C(=O)OC)CC1) is C7H8O2.
Describe the ring structures in building block <BB_2292>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2292>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2292>.
**Token:** <BB_2292> **SMILES:** C#CC1(C(=O)OC)CC1 **Molecular Formula:** C7H8O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2293>.
O=C(O)C1CC2C=CC1C2
What is the building block token for the following molecule?
O=C(O)C1CC2C=CC1C2
<BB_2293>
What is the molecular formula for <BB_2293>?
The molecular formula for <BB_2293> (O=C(O)C1CC2C=CC1C2) is C8H10O2.
Describe the ring structures in building block <BB_2293>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2293>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2293>.
**Token:** <BB_2293> **SMILES:** O=C(O)C1CC2C=CC1C2 **Molecular Formula:** C8H10O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2294>.
NCC1CCC2(CC2)C1
What is the building block token for the following molecule?
NCC1CCC2(CC2)C1
<BB_2294>
What is the molecular formula for <BB_2294>?
The molecular formula for <BB_2294> (NCC1CCC2(CC2)C1) is C8H15N.
Describe the ring structures in building block <BB_2294>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2294>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2294>.
**Token:** <BB_2294> **SMILES:** NCC1CCC2(CC2)C1 **Molecular Formula:** C8H15N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2295>.
Cc1cccc([N+](=O)[O-])c1N=[N+]=[N-]
What is the building block token for the following molecule?
Cc1cccc([N+](=O)[O-])c1N=[N+]=[N-]
<BB_2295>
What is the molecular formula for <BB_2295>?
The molecular formula for <BB_2295> (Cc1cccc([N+](=O)[O-])c1N=[N+]=[N-]) is C7H6N4O2.
Describe the ring structures in building block <BB_2295>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2295>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2295>.
**Token:** <BB_2295> **SMILES:** Cc1cccc([N+](=O)[O-])c1N=[N+]=[N-] **Molecular Formula:** C7H6N4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_2296>.
Cn1cc(C=O)c(C(=O)O)n1
What is the building block token for the following molecule?
Cn1cc(C=O)c(C(=O)O)n1
<BB_2296>
What is the molecular formula for <BB_2296>?
The molecular formula for <BB_2296> (Cn1cc(C=O)c(C(=O)O)n1) is C6H6N2O3.
Describe the ring structures in building block <BB_2296>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2296>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2296>.
**Token:** <BB_2296> **SMILES:** Cn1cc(C=O)c(C(=O)O)n1 **Molecular Formula:** C6H6N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Aldehyde
Provide the SMILES representation for the building block token <BB_2297>.
CC1(N)CC(N)C1.Cl.Cl
What is the building block token for the following molecule?
CC1(N)CC(N)C1.Cl.Cl
<BB_2297>
What is the molecular formula for <BB_2297>?
The molecular formula for <BB_2297> (CC1(N)CC(N)C1.Cl.Cl) is C5H14Cl2N2.
Describe the ring structures in building block <BB_2297>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2297>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2297>.
**Token:** <BB_2297> **SMILES:** CC1(N)CC(N)C1.Cl.Cl **Molecular Formula:** C5H14Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2298>.
O=C(O)c1csc(C(=O)O)c1Br
What is the building block token for the following molecule?
O=C(O)c1csc(C(=O)O)c1Br
<BB_2298>
What is the molecular formula for <BB_2298>?
The molecular formula for <BB_2298> (O=C(O)c1csc(C(=O)O)c1Br) is C6H3BrO4S.
Describe the ring structures in building block <BB_2298>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2298>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2298>.
**Token:** <BB_2298> **SMILES:** O=C(O)c1csc(C(=O)O)c1Br **Molecular Formula:** C6H3BrO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2299>.
CC1CNC2CCCCC2C1.Cl
What is the building block token for the following molecule?
CC1CNC2CCCCC2C1.Cl
<BB_2299>
What is the molecular formula for <BB_2299>?
The molecular formula for <BB_2299> (CC1CNC2CCCCC2C1.Cl) is C10H20ClN.
Describe the ring structures in building block <BB_2299>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2299>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2299>.
**Token:** <BB_2299> **SMILES:** CC1CNC2CCCCC2C1.Cl **Molecular Formula:** C10H20ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)