instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2300>.
CC1CCNC1(C)C.Cl
What is the building block token for the following molecule?
CC1CCNC1(C)C.Cl
<BB_2300>
What is the molecular formula for <BB_2300>?
The molecular formula for <BB_2300> (CC1CCNC1(C)C.Cl) is C7H16ClN.
Describe the ring structures in building block <BB_2300>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2300>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2300>.
**Token:** <BB_2300> **SMILES:** CC1CCNC1(C)C.Cl **Molecular Formula:** C7H16ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2301>.
Cl.NCCc1ccccc1I
What is the building block token for the following molecule?
Cl.NCCc1ccccc1I
<BB_2301>
What is the molecular formula for <BB_2301>?
The molecular formula for <BB_2301> (Cl.NCCc1ccccc1I) is C8H11ClIN.
Describe the ring structures in building block <BB_2301>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2301>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2301>.
**Token:** <BB_2301> **SMILES:** Cl.NCCc1ccccc1I **Molecular Formula:** C8H11ClIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2302>.
COCCOc1ccc(F)cc1N
What is the building block token for the following molecule?
COCCOc1ccc(F)cc1N
<BB_2302>
What is the molecular formula for <BB_2302>?
The molecular formula for <BB_2302> (COCCOc1ccc(F)cc1N) is C9H12FNO2.
Describe the ring structures in building block <BB_2302>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2302>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2302>.
**Token:** <BB_2302> **SMILES:** COCCOc1ccc(F)cc1N **Molecular Formula:** C9H12FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2303>.
COC[C@H]1CC[C@@H](COC)N1.Cl
What is the building block token for the following molecule?
COC[C@H]1CC[C@@H](COC)N1.Cl
<BB_2303>
What is the molecular formula for <BB_2303>?
The molecular formula for <BB_2303> (COC[C@H]1CC[C@@H](COC)N1.Cl) is C8H18ClNO2.
Describe the ring structures in building block <BB_2303>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2303>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2303>.
**Token:** <BB_2303> **SMILES:** COC[C@H]1CC[C@@H](COC)N1.Cl **Molecular Formula:** C8H18ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2304>.
O=C(O)CCc1nc2ccncc2[nH]1
What is the building block token for the following molecule?
O=C(O)CCc1nc2ccncc2[nH]1
<BB_2304>
What is the molecular formula for <BB_2304>?
The molecular formula for <BB_2304> (O=C(O)CCc1nc2ccncc2[nH]1) is C9H9N3O2.
Describe the ring structures in building block <BB_2304>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2304>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2304>.
**Token:** <BB_2304> **SMILES:** O=C(O)CCc1nc2ccncc2[nH]1 **Molecular Formula:** C9H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2305>.
COC(=O)c1ccn(COc2ccc(OC)cc2)n1
What is the building block token for the following molecule?
COC(=O)c1ccn(COc2ccc(OC)cc2)n1
<BB_2305>
What is the molecular formula for <BB_2305>?
The molecular formula for <BB_2305> (COC(=O)c1ccn(COc2ccc(OC)cc2)n1) is C13H14N2O4.
Describe the ring structures in building block <BB_2305>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2305>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2305>.
**Token:** <BB_2305> **SMILES:** COC(=O)c1ccn(COc2ccc(OC)cc2)n1 **Molecular Formula:** C13H14N2O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2306>.
O=C(O)COc1ccc2cc(Br)ccc2c1
What is the building block token for the following molecule?
O=C(O)COc1ccc2cc(Br)ccc2c1
<BB_2306>
What is the molecular formula for <BB_2306>?
The molecular formula for <BB_2306> (O=C(O)COc1ccc2cc(Br)ccc2c1) is C12H9BrO3.
Describe the ring structures in building block <BB_2306>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2306>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2306>.
**Token:** <BB_2306> **SMILES:** O=C(O)COc1ccc2cc(Br)ccc2c1 **Molecular Formula:** C12H9BrO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2307>.
CNC1CCN(C(=O)C2CC2)CC1.Cl
What is the building block token for the following molecule?
CNC1CCN(C(=O)C2CC2)CC1.Cl
<BB_2307>
What is the molecular formula for <BB_2307>?
The molecular formula for <BB_2307> (CNC1CCN(C(=O)C2CC2)CC1.Cl) is C10H19ClN2O.
Describe the ring structures in building block <BB_2307>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2307>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2307>.
**Token:** <BB_2307> **SMILES:** CNC1CCN(C(=O)C2CC2)CC1.Cl **Molecular Formula:** C10H19ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2308>.
CCOC(=O)C1(C)CCNCC1(F)F
What is the building block token for the following molecule?
CCOC(=O)C1(C)CCNCC1(F)F
<BB_2308>
What is the molecular formula for <BB_2308>?
The molecular formula for <BB_2308> (CCOC(=O)C1(C)CCNCC1(F)F) is C9H15F2NO2.
Describe the ring structures in building block <BB_2308>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2308>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2308>.
**Token:** <BB_2308> **SMILES:** CCOC(=O)C1(C)CCNCC1(F)F **Molecular Formula:** C9H15F2NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2309>.
Cn1cc(Br)cc(C(F)(F)F)c1=O
What is the building block token for the following molecule?
Cn1cc(Br)cc(C(F)(F)F)c1=O
<BB_2309>
What is the molecular formula for <BB_2309>?
The molecular formula for <BB_2309> (Cn1cc(Br)cc(C(F)(F)F)c1=O) is C7H5BrF3NO.
Describe the ring structures in building block <BB_2309>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2309>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2309>.
**Token:** <BB_2309> **SMILES:** Cn1cc(Br)cc(C(F)(F)F)c1=O **Molecular Formula:** C7H5BrF3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2310>.
COC(=O)C(O)Cc1ccncc1.Cl
What is the building block token for the following molecule?
COC(=O)C(O)Cc1ccncc1.Cl
<BB_2310>
What is the molecular formula for <BB_2310>?
The molecular formula for <BB_2310> (COC(=O)C(O)Cc1ccncc1.Cl) is C9H12ClNO3.
Describe the ring structures in building block <BB_2310>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2310>.
The molecule contains the following groups: Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2310>.
**Token:** <BB_2310> **SMILES:** COC(=O)C(O)Cc1ccncc1.Cl **Molecular Formula:** C9H12ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2311>.
Cl.NC[C@H]1C[C@H]1CC(=O)O
What is the building block token for the following molecule?
Cl.NC[C@H]1C[C@H]1CC(=O)O
<BB_2311>
What is the molecular formula for <BB_2311>?
The molecular formula for <BB_2311> (Cl.NC[C@H]1C[C@H]1CC(=O)O) is C6H12ClNO2.
Describe the ring structures in building block <BB_2311>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2311>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2311>.
**Token:** <BB_2311> **SMILES:** Cl.NC[C@H]1C[C@H]1CC(=O)O **Molecular Formula:** C6H12ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2312>.
Cl.O=C1CNCC2(CCC2)C1
What is the building block token for the following molecule?
Cl.O=C1CNCC2(CCC2)C1
<BB_2312>
What is the molecular formula for <BB_2312>?
The molecular formula for <BB_2312> (Cl.O=C1CNCC2(CCC2)C1) is C8H14ClNO.
Describe the ring structures in building block <BB_2312>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2312>.
The molecule contains the following groups: Secondary Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2312>.
**Token:** <BB_2312> **SMILES:** Cl.O=C1CNCC2(CCC2)C1 **Molecular Formula:** C8H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2313>.
NCC(O)c1c(Cl)cccc1Cl
What is the building block token for the following molecule?
NCC(O)c1c(Cl)cccc1Cl
<BB_2313>
What is the molecular formula for <BB_2313>?
The molecular formula for <BB_2313> (NCC(O)c1c(Cl)cccc1Cl) is C8H9Cl2NO.
Describe the ring structures in building block <BB_2313>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2313>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2313>.
**Token:** <BB_2313> **SMILES:** NCC(O)c1c(Cl)cccc1Cl **Molecular Formula:** C8H9Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2314>.
OCC1CC12CCC1(CC2)OCCO1
What is the building block token for the following molecule?
OCC1CC12CCC1(CC2)OCCO1
<BB_2314>
What is the molecular formula for <BB_2314>?
The molecular formula for <BB_2314> (OCC1CC12CCC1(CC2)OCCO1) is C11H18O3.
Describe the ring structures in building block <BB_2314>.
The molecule contains 3 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2314>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2314>.
**Token:** <BB_2314> **SMILES:** OCC1CC12CCC1(CC2)OCCO1 **Molecular Formula:** C11H18O3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2315>.
O=C(c1ccccc1)N1CC2COCC(C1)C2(F)F
What is the building block token for the following molecule?
O=C(c1ccccc1)N1CC2COCC(C1)C2(F)F
<BB_2315>
What is the molecular formula for <BB_2315>?
The molecular formula for <BB_2315> (O=C(c1ccccc1)N1CC2COCC(C1)C2(F)F) is C14H15F2NO2.
Describe the ring structures in building block <BB_2315>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2315>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2315>.
**Token:** <BB_2315> **SMILES:** O=C(c1ccccc1)N1CC2COCC(C1)C2(F)F **Molecular Formula:** C14H15F2NO2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2316>.
Cc1cc(C)c2c(=O)[nH]sc2n1
What is the building block token for the following molecule?
Cc1cc(C)c2c(=O)[nH]sc2n1
<BB_2316>
What is the molecular formula for <BB_2316>?
The molecular formula for <BB_2316> (Cc1cc(C)c2c(=O)[nH]sc2n1) is C8H8N2OS.
Describe the ring structures in building block <BB_2316>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.