instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2316>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2316>.
**Token:** <BB_2316> **SMILES:** Cc1cc(C)c2c(=O)[nH]sc2n1 **Molecular Formula:** C8H8N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2317>.
CC(C)(C)OC(=O)C12CCC(CO)(CC1)CC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C12CCC(CO)(CC1)CC2
<BB_2317>
What is the molecular formula for <BB_2317>?
The molecular formula for <BB_2317> (CC(C)(C)OC(=O)C12CCC(CO)(CC1)CC2) is C14H24O3.
Describe the ring structures in building block <BB_2317>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2317>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2317>.
**Token:** <BB_2317> **SMILES:** CC(C)(C)OC(=O)C12CCC(CO)(CC1)CC2 **Molecular Formula:** C14H24O3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2318>.
ClCc1cn(-c2ccc(Cl)cc2)nn1
What is the building block token for the following molecule?
ClCc1cn(-c2ccc(Cl)cc2)nn1
<BB_2318>
What is the molecular formula for <BB_2318>?
The molecular formula for <BB_2318> (ClCc1cn(-c2ccc(Cl)cc2)nn1) is C9H7Cl2N3.
Describe the ring structures in building block <BB_2318>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2318>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2318>.
**Token:** <BB_2318> **SMILES:** ClCc1cn(-c2ccc(Cl)cc2)nn1 **Molecular Formula:** C9H7Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2319>.
CC(C)(C)OC(=O)N1CCC(C23CC(I)(C2)C3)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(C23CC(I)(C2)C3)C1
<BB_2319>
What is the molecular formula for <BB_2319>?
The molecular formula for <BB_2319> (CC(C)(C)OC(=O)N1CCC(C23CC(I)(C2)C3)C1) is C14H22INO2.
Describe the ring structures in building block <BB_2319>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2319>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2319>.
**Token:** <BB_2319> **SMILES:** CC(C)(C)OC(=O)N1CCC(C23CC(I)(C2)C3)C1 **Molecular Formula:** C14H22INO2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2320>.
C#CC(C)(C)NC.Cl
What is the building block token for the following molecule?
C#CC(C)(C)NC.Cl
<BB_2320>
What is the molecular formula for <BB_2320>?
The molecular formula for <BB_2320> (C#CC(C)(C)NC.Cl) is C6H12ClN.
Describe the ring structures in building block <BB_2320>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2320>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2320>.
**Token:** <BB_2320> **SMILES:** C#CC(C)(C)NC.Cl **Molecular Formula:** C6H12ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2321>.
CC(C)(C)OC(=O)N1CCc2c(ccc(O)c2Cl)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCc2c(ccc(O)c2Cl)C1
<BB_2321>
What is the molecular formula for <BB_2321>?
The molecular formula for <BB_2321> (CC(C)(C)OC(=O)N1CCc2c(ccc(O)c2Cl)C1) is C14H18ClNO3.
Describe the ring structures in building block <BB_2321>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2321>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2321>.
**Token:** <BB_2321> **SMILES:** CC(C)(C)OC(=O)N1CCc2c(ccc(O)c2Cl)C1 **Molecular Formula:** C14H18ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2322>.
Cl.NCc1sc(Cl)nc1Cl
What is the building block token for the following molecule?
Cl.NCc1sc(Cl)nc1Cl
<BB_2322>
What is the molecular formula for <BB_2322>?
The molecular formula for <BB_2322> (Cl.NCc1sc(Cl)nc1Cl) is C4H5Cl3N2S.
Describe the ring structures in building block <BB_2322>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2322>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2322>.
**Token:** <BB_2322> **SMILES:** Cl.NCc1sc(Cl)nc1Cl **Molecular Formula:** C4H5Cl3N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2323>.
CCC1CC(C)CN1.Cl
What is the building block token for the following molecule?
CCC1CC(C)CN1.Cl
<BB_2323>
What is the molecular formula for <BB_2323>?
The molecular formula for <BB_2323> (CCC1CC(C)CN1.Cl) is C7H16ClN.
Describe the ring structures in building block <BB_2323>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2323>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2323>.
**Token:** <BB_2323> **SMILES:** CCC1CC(C)CN1.Cl **Molecular Formula:** C7H16ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2324>.
COC(=O)c1cccc(CCO)c1
What is the building block token for the following molecule?
COC(=O)c1cccc(CCO)c1
<BB_2324>
What is the molecular formula for <BB_2324>?
The molecular formula for <BB_2324> (COC(=O)c1cccc(CCO)c1) is C10H12O3.
Describe the ring structures in building block <BB_2324>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2324>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2324>.
**Token:** <BB_2324> **SMILES:** COC(=O)c1cccc(CCO)c1 **Molecular Formula:** C10H12O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2325>.
Cn1cc(S(N)(=O)=O)c2c(Br)cccc21
What is the building block token for the following molecule?
Cn1cc(S(N)(=O)=O)c2c(Br)cccc21
<BB_2325>
What is the molecular formula for <BB_2325>?
The molecular formula for <BB_2325> (Cn1cc(S(N)(=O)=O)c2c(Br)cccc21) is C9H9BrN2O2S.
Describe the ring structures in building block <BB_2325>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2325>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2325>.
**Token:** <BB_2325> **SMILES:** Cn1cc(S(N)(=O)=O)c2c(Br)cccc21 **Molecular Formula:** C9H9BrN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2326>.
NNC(=O)COc1ccc(Cl)cc1
What is the building block token for the following molecule?
NNC(=O)COc1ccc(Cl)cc1
<BB_2326>
What is the molecular formula for <BB_2326>?
The molecular formula for <BB_2326> (NNC(=O)COc1ccc(Cl)cc1) is C8H9ClN2O2.
Describe the ring structures in building block <BB_2326>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2326>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2326>.
**Token:** <BB_2326> **SMILES:** NNC(=O)COc1ccc(Cl)cc1 **Molecular Formula:** C8H9ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2327>.
CC(C)(C)OC(=O)N1CCO[C@]2(C1)C[C@@H](N)C2.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCO[C@]2(C1)C[C@@H](N)C2.Cl
<BB_2327>
What is the molecular formula for <BB_2327>?
The molecular formula for <BB_2327> (CC(C)(C)OC(=O)N1CCO[C@]2(C1)C[C@@H](N)C2.Cl) is C12H23ClN2O3.
Describe the ring structures in building block <BB_2327>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2327>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2327>.
**Token:** <BB_2327> **SMILES:** CC(C)(C)OC(=O)N1CCO[C@]2(C1)C[C@@H](N)C2.Cl **Molecular Formula:** C12H23ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2328>.
C=C(CBr)C(=O)OC
What is the building block token for the following molecule?
C=C(CBr)C(=O)OC
<BB_2328>
What is the molecular formula for <BB_2328>?
The molecular formula for <BB_2328> (C=C(CBr)C(=O)OC) is C5H7BrO2.
Describe the ring structures in building block <BB_2328>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2328>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2328>.
**Token:** <BB_2328> **SMILES:** C=C(CBr)C(=O)OC **Molecular Formula:** C5H7BrO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2329>.
Cn1cnn(CCC(=O)O)c1=O
What is the building block token for the following molecule?
Cn1cnn(CCC(=O)O)c1=O
<BB_2329>
What is the molecular formula for <BB_2329>?
The molecular formula for <BB_2329> (Cn1cnn(CCC(=O)O)c1=O) is C6H9N3O3.
Describe the ring structures in building block <BB_2329>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2329>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2329>.
**Token:** <BB_2329> **SMILES:** Cn1cnn(CCC(=O)O)c1=O **Molecular Formula:** C6H9N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2330>.
C[C@H](O)c1ccc(F)cc1Br
What is the building block token for the following molecule?
C[C@H](O)c1ccc(F)cc1Br
<BB_2330>
What is the molecular formula for <BB_2330>?
The molecular formula for <BB_2330> (C[C@H](O)c1ccc(F)cc1Br) is C8H8BrFO.
Describe the ring structures in building block <BB_2330>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2330>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2330>.
**Token:** <BB_2330> **SMILES:** C[C@H](O)c1ccc(F)cc1Br **Molecular Formula:** C8H8BrFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2331>.
[N-]=[N+]=Nc1ccc(OCCOCCO)cc1
What is the building block token for the following molecule?
[N-]=[N+]=Nc1ccc(OCCOCCO)cc1
<BB_2331>
What is the molecular formula for <BB_2331>?
The molecular formula for <BB_2331> ([N-]=[N+]=Nc1ccc(OCCOCCO)cc1) is C10H13N3O3.
Describe the ring structures in building block <BB_2331>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2331>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2331>.
**Token:** <BB_2331> **SMILES:** [N-]=[N+]=Nc1ccc(OCCOCCO)cc1 **Molecular Formula:** C10H13N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2332>.
O=[N+]([O-])c1ccc(CCO)c(F)c1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc(CCO)c(F)c1
<BB_2332>
What is the molecular formula for <BB_2332>?
The molecular formula for <BB_2332> (O=[N+]([O-])c1ccc(CCO)c(F)c1) is C8H8FNO3.
Describe the ring structures in building block <BB_2332>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2332>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2332>.
**Token:** <BB_2332> **SMILES:** O=[N+]([O-])c1ccc(CCO)c(F)c1 **Molecular Formula:** C8H8FNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2333>.
Nc1nc2c(Br)cc(F)cc2s1
What is the building block token for the following molecule?
Nc1nc2c(Br)cc(F)cc2s1
<BB_2333>