instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2333>?
The molecular formula for <BB_2333> (Nc1nc2c(Br)cc(F)cc2s1) is C7H4BrFN2S.
Describe the ring structures in building block <BB_2333>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2333>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2333>.
**Token:** <BB_2333> **SMILES:** Nc1nc2c(Br)cc(F)cc2s1 **Molecular Formula:** C7H4BrFN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2334>.
O=C1OCC2C=CCCN12
What is the building block token for the following molecule?
O=C1OCC2C=CCCN12
<BB_2334>
What is the molecular formula for <BB_2334>?
The molecular formula for <BB_2334> (O=C1OCC2C=CCCN12) is C7H9NO2.
Describe the ring structures in building block <BB_2334>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2334>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2334>.
**Token:** <BB_2334> **SMILES:** O=C1OCC2C=CCCN12 **Molecular Formula:** C7H9NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2335>.
CC(C)(C)OC(=O)NC1(C#CC(=O)O)CCCC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1(C#CC(=O)O)CCCC1
<BB_2335>
What is the molecular formula for <BB_2335>?
The molecular formula for <BB_2335> (CC(C)(C)OC(=O)NC1(C#CC(=O)O)CCCC1) is C13H19NO4.
Describe the ring structures in building block <BB_2335>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2335>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2335>.
**Token:** <BB_2335> **SMILES:** CC(C)(C)OC(=O)NC1(C#CC(=O)O)CCCC1 **Molecular Formula:** C13H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2336>.
Cn1c(S)nnc1-c1ccccc1
What is the building block token for the following molecule?
Cn1c(S)nnc1-c1ccccc1
<BB_2336>
What is the molecular formula for <BB_2336>?
The molecular formula for <BB_2336> (Cn1c(S)nnc1-c1ccccc1) is C9H9N3S.
Describe the ring structures in building block <BB_2336>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2336>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_2336>.
**Token:** <BB_2336> **SMILES:** Cn1c(S)nnc1-c1ccccc1 **Molecular Formula:** C9H9N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_2337>.
COC(=O)C1CN(c2cc(Cl)ncn2)C1
What is the building block token for the following molecule?
COC(=O)C1CN(c2cc(Cl)ncn2)C1
<BB_2337>
What is the molecular formula for <BB_2337>?
The molecular formula for <BB_2337> (COC(=O)C1CN(c2cc(Cl)ncn2)C1) is C9H10ClN3O2.
Describe the ring structures in building block <BB_2337>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_2337>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2337>.
**Token:** <BB_2337> **SMILES:** COC(=O)C1CN(c2cc(Cl)ncn2)C1 **Molecular Formula:** C9H10ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2338>.
CC1(C)CC(O)CCN1.Cl
What is the building block token for the following molecule?
CC1(C)CC(O)CCN1.Cl
<BB_2338>
What is the molecular formula for <BB_2338>?
The molecular formula for <BB_2338> (CC1(C)CC(O)CCN1.Cl) is C7H16ClNO.
Describe the ring structures in building block <BB_2338>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2338>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2338>.
**Token:** <BB_2338> **SMILES:** CC1(C)CC(O)CCN1.Cl **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2339>.
Oc1ncnc(Cl)c1Cl
What is the building block token for the following molecule?
Oc1ncnc(Cl)c1Cl
<BB_2339>
What is the molecular formula for <BB_2339>?
The molecular formula for <BB_2339> (Oc1ncnc(Cl)c1Cl) is C4H2Cl2N2O.
Describe the ring structures in building block <BB_2339>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2339>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2339>.
**Token:** <BB_2339> **SMILES:** Oc1ncnc(Cl)c1Cl **Molecular Formula:** C4H2Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2340>.
Cc1cc(NC(=O)CCl)n(C(C)(C)C)n1
What is the building block token for the following molecule?
Cc1cc(NC(=O)CCl)n(C(C)(C)C)n1
<BB_2340>
What is the molecular formula for <BB_2340>?
The molecular formula for <BB_2340> (Cc1cc(NC(=O)CCl)n(C(C)(C)C)n1) is C10H16ClN3O.
Describe the ring structures in building block <BB_2340>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2340>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2340>.
**Token:** <BB_2340> **SMILES:** Cc1cc(NC(=O)CCl)n(C(C)(C)C)n1 **Molecular Formula:** C10H16ClN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2341>.
CCOC(=O)C(Cl)c1ccc(Br)cc1F
What is the building block token for the following molecule?
CCOC(=O)C(Cl)c1ccc(Br)cc1F
<BB_2341>
What is the molecular formula for <BB_2341>?
The molecular formula for <BB_2341> (CCOC(=O)C(Cl)c1ccc(Br)cc1F) is C10H9BrClFO2.
Describe the ring structures in building block <BB_2341>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2341>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2341>.
**Token:** <BB_2341> **SMILES:** CCOC(=O)C(Cl)c1ccc(Br)cc1F **Molecular Formula:** C10H9BrClFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2342>.
CCNCC(=O)c1cccc(Cl)c1.Cl
What is the building block token for the following molecule?
CCNCC(=O)c1cccc(Cl)c1.Cl
<BB_2342>
What is the molecular formula for <BB_2342>?
The molecular formula for <BB_2342> (CCNCC(=O)c1cccc(Cl)c1.Cl) is C10H13Cl2NO.
Describe the ring structures in building block <BB_2342>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2342>.
The molecule contains the following groups: Secondary Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2342>.
**Token:** <BB_2342> **SMILES:** CCNCC(=O)c1cccc(Cl)c1.Cl **Molecular Formula:** C10H13Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2343>.
Clc1ncnc2nc[nH]c12
What is the building block token for the following molecule?
Clc1ncnc2nc[nH]c12
<BB_2343>
What is the molecular formula for <BB_2343>?
The molecular formula for <BB_2343> (Clc1ncnc2nc[nH]c12) is C5H3ClN4.
Describe the ring structures in building block <BB_2343>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2343>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2343>.
**Token:** <BB_2343> **SMILES:** Clc1ncnc2nc[nH]c12 **Molecular Formula:** C5H3ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2344>.
CC(C)Cc1ccc(CCC(=O)O)cc1
What is the building block token for the following molecule?
CC(C)Cc1ccc(CCC(=O)O)cc1
<BB_2344>
What is the molecular formula for <BB_2344>?
The molecular formula for <BB_2344> (CC(C)Cc1ccc(CCC(=O)O)cc1) is C13H18O2.
Describe the ring structures in building block <BB_2344>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2344>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2344>.
**Token:** <BB_2344> **SMILES:** CC(C)Cc1ccc(CCC(=O)O)cc1 **Molecular Formula:** C13H18O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2345>.
Nc1ccc(S(=O)(=O)CCN2CCOCC2)cc1
What is the building block token for the following molecule?
Nc1ccc(S(=O)(=O)CCN2CCOCC2)cc1
<BB_2345>
What is the molecular formula for <BB_2345>?
The molecular formula for <BB_2345> (Nc1ccc(S(=O)(=O)CCN2CCOCC2)cc1) is C12H18N2O3S.
Describe the ring structures in building block <BB_2345>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2345>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2345>.
**Token:** <BB_2345> **SMILES:** Nc1ccc(S(=O)(=O)CCN2CCOCC2)cc1 **Molecular Formula:** C12H18N2O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2346>.
O=Cc1cccn1-c1cc(C(F)(F)F)ccc1Cl
What is the building block token for the following molecule?
O=Cc1cccn1-c1cc(C(F)(F)F)ccc1Cl
<BB_2346>
What is the molecular formula for <BB_2346>?
The molecular formula for <BB_2346> (O=Cc1cccn1-c1cc(C(F)(F)F)ccc1Cl) is C12H7ClF3NO.
Describe the ring structures in building block <BB_2346>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2346>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2346>.
**Token:** <BB_2346> **SMILES:** O=Cc1cccn1-c1cc(C(F)(F)F)ccc1Cl **Molecular Formula:** C12H7ClF3NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2347>.
FC(F)(F)Oc1ncccc1CBr
What is the building block token for the following molecule?
FC(F)(F)Oc1ncccc1CBr
<BB_2347>
What is the molecular formula for <BB_2347>?
The molecular formula for <BB_2347> (FC(F)(F)Oc1ncccc1CBr) is C7H5BrF3NO.
Describe the ring structures in building block <BB_2347>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2347>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2347>.
**Token:** <BB_2347> **SMILES:** FC(F)(F)Oc1ncccc1CBr **Molecular Formula:** C7H5BrF3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2348>.
N#Cc1occc1S(=O)(=O)Cl
What is the building block token for the following molecule?
N#Cc1occc1S(=O)(=O)Cl
<BB_2348>
What is the molecular formula for <BB_2348>?
The molecular formula for <BB_2348> (N#Cc1occc1S(=O)(=O)Cl) is C5H2ClNO3S.
Describe the ring structures in building block <BB_2348>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2348>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2348>.
**Token:** <BB_2348> **SMILES:** N#Cc1occc1S(=O)(=O)Cl **Molecular Formula:** C5H2ClNO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2349>.
Cc1cccc(O)c1C(F)(F)F
What is the building block token for the following molecule?
Cc1cccc(O)c1C(F)(F)F
<BB_2349>
What is the molecular formula for <BB_2349>?
The molecular formula for <BB_2349> (Cc1cccc(O)c1C(F)(F)F) is C8H7F3O.
Describe the ring structures in building block <BB_2349>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2349>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2349>.
**Token:** <BB_2349> **SMILES:** Cc1cccc(O)c1C(F)(F)F **Molecular Formula:** C8H7F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)