instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2350>.
O=C1CCc2cc(Cl)ccc21
What is the building block token for the following molecule?
O=C1CCc2cc(Cl)ccc21
<BB_2350>
What is the molecular formula for <BB_2350>?
The molecular formula for <BB_2350> (O=C1CCc2cc(Cl)ccc21) is C9H7ClO.
Describe the ring structures in building block <BB_2350>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2350>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2350>.
**Token:** <BB_2350> **SMILES:** O=C1CCc2cc(Cl)ccc21 **Molecular Formula:** C9H7ClO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2351>.
CCCNC(=O)C(C)Cl
What is the building block token for the following molecule?
CCCNC(=O)C(C)Cl
<BB_2351>
What is the molecular formula for <BB_2351>?
The molecular formula for <BB_2351> (CCCNC(=O)C(C)Cl) is C6H12ClNO.
Describe the ring structures in building block <BB_2351>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2351>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2351>.
**Token:** <BB_2351> **SMILES:** CCCNC(=O)C(C)Cl **Molecular Formula:** C6H12ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2352>.
Cc1cc(C(=O)O)c(C2CC2)s1
What is the building block token for the following molecule?
Cc1cc(C(=O)O)c(C2CC2)s1
<BB_2352>
What is the molecular formula for <BB_2352>?
The molecular formula for <BB_2352> (Cc1cc(C(=O)O)c(C2CC2)s1) is C9H10O2S.
Describe the ring structures in building block <BB_2352>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2352>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2352>.
**Token:** <BB_2352> **SMILES:** Cc1cc(C(=O)O)c(C2CC2)s1 **Molecular Formula:** C9H10O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2353>.
O=c1[nH]ncc2ccoc12
What is the building block token for the following molecule?
O=c1[nH]ncc2ccoc12
<BB_2353>
What is the molecular formula for <BB_2353>?
The molecular formula for <BB_2353> (O=c1[nH]ncc2ccoc12) is C6H4N2O2.
Describe the ring structures in building block <BB_2353>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2353>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2353>.
**Token:** <BB_2353> **SMILES:** O=c1[nH]ncc2ccoc12 **Molecular Formula:** C6H4N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2354>.
NS(=O)(=O)c1cccc2c(O)cccc12
What is the building block token for the following molecule?
NS(=O)(=O)c1cccc2c(O)cccc12
<BB_2354>
What is the molecular formula for <BB_2354>?
The molecular formula for <BB_2354> (NS(=O)(=O)c1cccc2c(O)cccc12) is C10H9NO3S.
Describe the ring structures in building block <BB_2354>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2354>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2354>.
**Token:** <BB_2354> **SMILES:** NS(=O)(=O)c1cccc2c(O)cccc12 **Molecular Formula:** C10H9NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2355>.
Cl.NCCCCc1c[nH]c2ccccc12
What is the building block token for the following molecule?
Cl.NCCCCc1c[nH]c2ccccc12
<BB_2355>
What is the molecular formula for <BB_2355>?
The molecular formula for <BB_2355> (Cl.NCCCCc1c[nH]c2ccccc12) is C12H17ClN2.
Describe the ring structures in building block <BB_2355>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2355>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2355>.
**Token:** <BB_2355> **SMILES:** Cl.NCCCCc1c[nH]c2ccccc12 **Molecular Formula:** C12H17ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2356>.
COC(=O)C1CC2NC(C)CCC2O1.Cl
What is the building block token for the following molecule?
COC(=O)C1CC2NC(C)CCC2O1.Cl
<BB_2356>
What is the molecular formula for <BB_2356>?
The molecular formula for <BB_2356> (COC(=O)C1CC2NC(C)CCC2O1.Cl) is C10H18ClNO3.
Describe the ring structures in building block <BB_2356>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2356>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2356>.
**Token:** <BB_2356> **SMILES:** COC(=O)C1CC2NC(C)CCC2O1.Cl **Molecular Formula:** C10H18ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2357>.
Brc1cnccn1.Cl
What is the building block token for the following molecule?
Brc1cnccn1.Cl
<BB_2357>
What is the molecular formula for <BB_2357>?
The molecular formula for <BB_2357> (Brc1cnccn1.Cl) is C4H4BrClN2.
Describe the ring structures in building block <BB_2357>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2357>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2357>.
**Token:** <BB_2357> **SMILES:** Brc1cnccn1.Cl **Molecular Formula:** C4H4BrClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2358>.
Cc1cc(O)cc2oc(=O)[nH]c12
What is the building block token for the following molecule?
Cc1cc(O)cc2oc(=O)[nH]c12
<BB_2358>
What is the molecular formula for <BB_2358>?
The molecular formula for <BB_2358> (Cc1cc(O)cc2oc(=O)[nH]c12) is C8H7NO3.
Describe the ring structures in building block <BB_2358>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2358>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2358>.
**Token:** <BB_2358> **SMILES:** Cc1cc(O)cc2oc(=O)[nH]c12 **Molecular Formula:** C8H7NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2359>.
COC(=O)CC(F)(F)F
What is the building block token for the following molecule?
COC(=O)CC(F)(F)F
<BB_2359>
What is the molecular formula for <BB_2359>?
The molecular formula for <BB_2359> (COC(=O)CC(F)(F)F) is C4H5F3O2.
Describe the ring structures in building block <BB_2359>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2359>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2359>.
**Token:** <BB_2359> **SMILES:** COC(=O)CC(F)(F)F **Molecular Formula:** C4H5F3O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2360>.
CS(=O)(=O)c1ccc(S(N)(=O)=O)cc1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(S(N)(=O)=O)cc1
<BB_2360>
What is the molecular formula for <BB_2360>?
The molecular formula for <BB_2360> (CS(=O)(=O)c1ccc(S(N)(=O)=O)cc1) is C7H9NO4S2.
Describe the ring structures in building block <BB_2360>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2360>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2360>.
**Token:** <BB_2360> **SMILES:** CS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 **Molecular Formula:** C7H9NO4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2361>.
CC/C(C)=C/CO
What is the building block token for the following molecule?
CC/C(C)=C/CO
<BB_2361>
What is the molecular formula for <BB_2361>?
The molecular formula for <BB_2361> (CC/C(C)=C/CO) is C6H12O.
Describe the ring structures in building block <BB_2361>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2361>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2361>.
**Token:** <BB_2361> **SMILES:** CC/C(C)=C/CO **Molecular Formula:** C6H12O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2362>.
N=c1c(C(N)=O)c[nH]c2c(Br)cccc12
What is the building block token for the following molecule?
N=c1c(C(N)=O)c[nH]c2c(Br)cccc12
<BB_2362>
What is the molecular formula for <BB_2362>?
The molecular formula for <BB_2362> (N=c1c(C(N)=O)c[nH]c2c(Br)cccc12) is C10H8BrN3O.
Describe the ring structures in building block <BB_2362>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2362>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2362>.
**Token:** <BB_2362> **SMILES:** N=c1c(C(N)=O)c[nH]c2c(Br)cccc12 **Molecular Formula:** C10H8BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2363>.
Cc1cc(C)c2nc(O)cc(C)c2c1
What is the building block token for the following molecule?
Cc1cc(C)c2nc(O)cc(C)c2c1
<BB_2363>
What is the molecular formula for <BB_2363>?
The molecular formula for <BB_2363> (Cc1cc(C)c2nc(O)cc(C)c2c1) is C12H13NO.
Describe the ring structures in building block <BB_2363>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2363>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2363>.
**Token:** <BB_2363> **SMILES:** Cc1cc(C)c2nc(O)cc(C)c2c1 **Molecular Formula:** C12H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2364>.
O=CCc1cccc(Br)c1
What is the building block token for the following molecule?
O=CCc1cccc(Br)c1
<BB_2364>
What is the molecular formula for <BB_2364>?
The molecular formula for <BB_2364> (O=CCc1cccc(Br)c1) is C8H7BrO.
Describe the ring structures in building block <BB_2364>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2364>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2364>.
**Token:** <BB_2364> **SMILES:** O=CCc1cccc(Br)c1 **Molecular Formula:** C8H7BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2365>.
COc1ccc(N)c(Br)n1
What is the building block token for the following molecule?
COc1ccc(N)c(Br)n1
<BB_2365>
What is the molecular formula for <BB_2365>?
The molecular formula for <BB_2365> (COc1ccc(N)c(Br)n1) is C6H7BrN2O.
Describe the ring structures in building block <BB_2365>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2365>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2365>.
**Token:** <BB_2365> **SMILES:** COc1ccc(N)c(Br)n1 **Molecular Formula:** C6H7BrN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2366>.
CN(C)S(=O)(=O)N1CCNCC1.Cl
What is the building block token for the following molecule?
CN(C)S(=O)(=O)N1CCNCC1.Cl
<BB_2366>
What is the molecular formula for <BB_2366>?
The molecular formula for <BB_2366> (CN(C)S(=O)(=O)N1CCNCC1.Cl) is C6H16ClN3O2S.
Describe the ring structures in building block <BB_2366>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.