instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_266>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_266>.
**Token:** <BB_266> **SMILES:** CC(C)(C)OC(=O)NC[C@@H]1C[C@H](O)C1(C)C **Molecular Formula:** C12H23NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_267>.
NC(CC1CCCO1)C(=O)O
What is the building block token for the following molecule?
NC(CC1CCCO1)C(=O)O
<BB_267>
What is the molecular formula for <BB_267>?
The molecular formula for <BB_267> (NC(CC1CCCO1)C(=O)O) is C7H13NO3.
Describe the ring structures in building block <BB_267>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_267>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_267>.
**Token:** <BB_267> **SMILES:** NC(CC1CCCO1)C(=O)O **Molecular Formula:** C7H13NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Ether
Provide the SMILES representation for the building block token <BB_268>.
CC1(CC=O)CN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
CC1(CC=O)CN(C(=O)OC(C)(C)C)C1
<BB_268>
What is the molecular formula for <BB_268>?
The molecular formula for <BB_268> (CC1(CC=O)CN(C(=O)OC(C)(C)C)C1) is C11H19NO3.
Describe the ring structures in building block <BB_268>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_268>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_268>.
**Token:** <BB_268> **SMILES:** CC1(CC=O)CN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C11H19NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_269>.
CCOc1ncc[nH]c1=O
What is the building block token for the following molecule?
CCOc1ncc[nH]c1=O
<BB_269>
What is the molecular formula for <BB_269>?
The molecular formula for <BB_269> (CCOc1ncc[nH]c1=O) is C6H8N2O2.
Describe the ring structures in building block <BB_269>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_269>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_269>.
**Token:** <BB_269> **SMILES:** CCOc1ncc[nH]c1=O **Molecular Formula:** C6H8N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_270>.
CN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccnn1C
What is the building block token for the following molecule?
CN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccnn1C
<BB_270>
What is the molecular formula for <BB_270>?
The molecular formula for <BB_270> (CN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccnn1C) is C11H15N3O3.
Describe the ring structures in building block <BB_270>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_270>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_270>.
**Token:** <BB_270> **SMILES:** CN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccnn1C **Molecular Formula:** C11H15N3O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_271>.
COC(OC)C(=O)C(C)C
What is the building block token for the following molecule?
COC(OC)C(=O)C(C)C
<BB_271>
What is the molecular formula for <BB_271>?
The molecular formula for <BB_271> (COC(OC)C(=O)C(C)C) is C7H14O3.
Describe the ring structures in building block <BB_271>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_271>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_271>.
**Token:** <BB_271> **SMILES:** COC(OC)C(=O)C(C)C **Molecular Formula:** C7H14O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_272>.
O=C1NCCC1Cl
What is the building block token for the following molecule?
O=C1NCCC1Cl
<BB_272>
What is the molecular formula for <BB_272>?
The molecular formula for <BB_272> (O=C1NCCC1Cl) is C4H6ClNO.
Describe the ring structures in building block <BB_272>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_272>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_272>.
**Token:** <BB_272> **SMILES:** O=C1NCCC1Cl **Molecular Formula:** C4H6ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_273>.
CC(C)c1nsc(=O)o1
What is the building block token for the following molecule?
CC(C)c1nsc(=O)o1
<BB_273>
What is the molecular formula for <BB_273>?
The molecular formula for <BB_273> (CC(C)c1nsc(=O)o1) is C5H7NO2S.
Describe the ring structures in building block <BB_273>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_273>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_273>.
**Token:** <BB_273> **SMILES:** CC(C)c1nsc(=O)o1 **Molecular Formula:** C5H7NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_274>.
CCn1nc(C)c(S(=O)(=O)Cl)c1C
What is the building block token for the following molecule?
CCn1nc(C)c(S(=O)(=O)Cl)c1C
<BB_274>
What is the molecular formula for <BB_274>?
The molecular formula for <BB_274> (CCn1nc(C)c(S(=O)(=O)Cl)c1C) is C7H11ClN2O2S.
Describe the ring structures in building block <BB_274>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_274>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_274>.
**Token:** <BB_274> **SMILES:** CCn1nc(C)c(S(=O)(=O)Cl)c1C **Molecular Formula:** C7H11ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_275>.
CC(C)(C)C(=O)Nc1ncccc1Cl
What is the building block token for the following molecule?
CC(C)(C)C(=O)Nc1ncccc1Cl
<BB_275>
What is the molecular formula for <BB_275>?
The molecular formula for <BB_275> (CC(C)(C)C(=O)Nc1ncccc1Cl) is C10H13ClN2O.
Describe the ring structures in building block <BB_275>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_275>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_275>.
**Token:** <BB_275> **SMILES:** CC(C)(C)C(=O)Nc1ncccc1Cl **Molecular Formula:** C10H13ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_276>.
COCCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
COCCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)C1
<BB_276>
What is the molecular formula for <BB_276>?
The molecular formula for <BB_276> (COCCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)C1) is C13H23NO5.
Describe the ring structures in building block <BB_276>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_276>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_276>.
**Token:** <BB_276> **SMILES:** COCCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C13H23NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_277>.
OCCOC1CC1
What is the building block token for the following molecule?
OCCOC1CC1
<BB_277>
What is the molecular formula for <BB_277>?
The molecular formula for <BB_277> (OCCOC1CC1) is C5H10O2.
Describe the ring structures in building block <BB_277>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_277>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_277>.
**Token:** <BB_277> **SMILES:** OCCOC1CC1 **Molecular Formula:** C5H10O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_278>.
O=CC(C1CC1)C1CC1
What is the building block token for the following molecule?
O=CC(C1CC1)C1CC1
<BB_278>
What is the molecular formula for <BB_278>?
The molecular formula for <BB_278> (O=CC(C1CC1)C1CC1) is C8H12O.
Describe the ring structures in building block <BB_278>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_278>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_278>.
**Token:** <BB_278> **SMILES:** O=CC(C1CC1)C1CC1 **Molecular Formula:** C8H12O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_279>.
CC(N)CI.I
What is the building block token for the following molecule?
CC(N)CI.I
<BB_279>
What is the molecular formula for <BB_279>?
The molecular formula for <BB_279> (CC(N)CI.I) is C3H9I2N.
Describe the ring structures in building block <BB_279>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_279>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_279>.
**Token:** <BB_279> **SMILES:** CC(N)CI.I **Molecular Formula:** C3H9I2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_280>.
O=C(O)c1nnn(-c2ccccc2)c1C(F)(F)F
What is the building block token for the following molecule?
O=C(O)c1nnn(-c2ccccc2)c1C(F)(F)F
<BB_280>
What is the molecular formula for <BB_280>?
The molecular formula for <BB_280> (O=C(O)c1nnn(-c2ccccc2)c1C(F)(F)F) is C10H6F3N3O2.
Describe the ring structures in building block <BB_280>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_280>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_280>.
**Token:** <BB_280> **SMILES:** O=C(O)c1nnn(-c2ccccc2)c1C(F)(F)F **Molecular Formula:** C10H6F3N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_281>.
OC[C@@H]1CN(Cc2ccccc2)C[C@H]1CO
What is the building block token for the following molecule?
OC[C@@H]1CN(Cc2ccccc2)C[C@H]1CO
<BB_281>
What is the molecular formula for <BB_281>?
The molecular formula for <BB_281> (OC[C@@H]1CN(Cc2ccccc2)C[C@H]1CO) is C13H19NO2.
Describe the ring structures in building block <BB_281>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_281>.
The molecule contains the following groups: Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_281>.
**Token:** <BB_281> **SMILES:** OC[C@@H]1CN(Cc2ccccc2)C[C@H]1CO **Molecular Formula:** C13H19NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_282>.
O=Cc1cnn(CC(F)F)c1
What is the building block token for the following molecule?
O=Cc1cnn(CC(F)F)c1
<BB_282>
What is the molecular formula for <BB_282>?
The molecular formula for <BB_282> (O=Cc1cnn(CC(F)F)c1) is C6H6F2N2O.
Describe the ring structures in building block <BB_282>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_282>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_282>.
**Token:** <BB_282> **SMILES:** O=Cc1cnn(CC(F)F)c1 **Molecular Formula:** C6H6F2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_283>.
CC(C)(C)OC(=O)NCCCCCCCCCBr
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCCCCCCCCBr
<BB_283>