instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2366>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2366>.
**Token:** <BB_2366> **SMILES:** CN(C)S(=O)(=O)N1CCNCC1.Cl **Molecular Formula:** C6H16ClN3O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2367>.
CC(C)(C)OC(=O)N1CCCC1c1nccc(N)n1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC1c1nccc(N)n1
<BB_2367>
What is the molecular formula for <BB_2367>?
The molecular formula for <BB_2367> (CC(C)(C)OC(=O)N1CCCC1c1nccc(N)n1) is C13H20N4O2.
Describe the ring structures in building block <BB_2367>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2367>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2367>.
**Token:** <BB_2367> **SMILES:** CC(C)(C)OC(=O)N1CCCC1c1nccc(N)n1 **Molecular Formula:** C13H20N4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2368>.
CC1(C)CCCC2(CO2)C1
What is the building block token for the following molecule?
CC1(C)CCCC2(CO2)C1
<BB_2368>
What is the molecular formula for <BB_2368>?
The molecular formula for <BB_2368> (CC1(C)CCCC2(CO2)C1) is C9H16O.
Describe the ring structures in building block <BB_2368>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2368>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2368>.
**Token:** <BB_2368> **SMILES:** CC1(C)CCCC2(CO2)C1 **Molecular Formula:** C9H16O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2369>.
O=C(CCl)NCCCCNC(=O)CCl
What is the building block token for the following molecule?
O=C(CCl)NCCCCNC(=O)CCl
<BB_2369>
What is the molecular formula for <BB_2369>?
The molecular formula for <BB_2369> (O=C(CCl)NCCCCNC(=O)CCl) is C8H14Cl2N2O2.
Describe the ring structures in building block <BB_2369>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2369>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2369>.
**Token:** <BB_2369> **SMILES:** O=C(CCl)NCCCCNC(=O)CCl **Molecular Formula:** C8H14Cl2N2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2370>.
CC(C)(C)OC(=O)N1C2CCC1c1cn[nH]c1C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C2CCC1c1cn[nH]c1C2
<BB_2370>
What is the molecular formula for <BB_2370>?
The molecular formula for <BB_2370> (CC(C)(C)OC(=O)N1C2CCC1c1cn[nH]c1C2) is C13H19N3O2.
Describe the ring structures in building block <BB_2370>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2370>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2370>.
**Token:** <BB_2370> **SMILES:** CC(C)(C)OC(=O)N1C2CCC1c1cn[nH]c1C2 **Molecular Formula:** C13H19N3O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2371>.
COC(=O)c1nc(Br)n2c1CCC2
What is the building block token for the following molecule?
COC(=O)c1nc(Br)n2c1CCC2
<BB_2371>
What is the molecular formula for <BB_2371>?
The molecular formula for <BB_2371> (COC(=O)c1nc(Br)n2c1CCC2) is C8H9BrN2O2.
Describe the ring structures in building block <BB_2371>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2371>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2371>.
**Token:** <BB_2371> **SMILES:** COC(=O)c1nc(Br)n2c1CCC2 **Molecular Formula:** C8H9BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2372>.
N#CCCn1cc(C=O)c(-c2ccccc2Br)n1
What is the building block token for the following molecule?
N#CCCn1cc(C=O)c(-c2ccccc2Br)n1
<BB_2372>
What is the molecular formula for <BB_2372>?
The molecular formula for <BB_2372> (N#CCCn1cc(C=O)c(-c2ccccc2Br)n1) is C13H10BrN3O.
Describe the ring structures in building block <BB_2372>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2372>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2372>.
**Token:** <BB_2372> **SMILES:** N#CCCn1cc(C=O)c(-c2ccccc2Br)n1 **Molecular Formula:** C13H10BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2373>.
O=C(O)c1ccc(-n2cnnn2)c(Cl)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(-n2cnnn2)c(Cl)c1
<BB_2373>
What is the molecular formula for <BB_2373>?
The molecular formula for <BB_2373> (O=C(O)c1ccc(-n2cnnn2)c(Cl)c1) is C8H5ClN4O2.
Describe the ring structures in building block <BB_2373>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2373>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2373>.
**Token:** <BB_2373> **SMILES:** O=C(O)c1ccc(-n2cnnn2)c(Cl)c1 **Molecular Formula:** C8H5ClN4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2374>.
O=Cc1ccc(OCC2CC2)cc1
What is the building block token for the following molecule?
O=Cc1ccc(OCC2CC2)cc1
<BB_2374>
What is the molecular formula for <BB_2374>?
The molecular formula for <BB_2374> (O=Cc1ccc(OCC2CC2)cc1) is C11H12O2.
Describe the ring structures in building block <BB_2374>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2374>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2374>.
**Token:** <BB_2374> **SMILES:** O=Cc1ccc(OCC2CC2)cc1 **Molecular Formula:** C11H12O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2375>.
Cl.N[C@H]1CCCc2c(C(=O)O)cccc21
What is the building block token for the following molecule?
Cl.N[C@H]1CCCc2c(C(=O)O)cccc21
<BB_2375>
What is the molecular formula for <BB_2375>?
The molecular formula for <BB_2375> (Cl.N[C@H]1CCCc2c(C(=O)O)cccc21) is C11H14ClNO2.
Describe the ring structures in building block <BB_2375>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2375>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2375>.
**Token:** <BB_2375> **SMILES:** Cl.N[C@H]1CCCc2c(C(=O)O)cccc21 **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2376>.
COc1cc(CN)ccc1C#N
What is the building block token for the following molecule?
COc1cc(CN)ccc1C#N
<BB_2376>
What is the molecular formula for <BB_2376>?
The molecular formula for <BB_2376> (COc1cc(CN)ccc1C#N) is C9H10N2O.
Describe the ring structures in building block <BB_2376>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2376>.
The molecule contains the following groups: Amine, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2376>.
**Token:** <BB_2376> **SMILES:** COc1cc(CN)ccc1C#N **Molecular Formula:** C9H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2377>.
COC(=O)c1cc(Br)cc(Br)c1
What is the building block token for the following molecule?
COC(=O)c1cc(Br)cc(Br)c1
<BB_2377>
What is the molecular formula for <BB_2377>?
The molecular formula for <BB_2377> (COC(=O)c1cc(Br)cc(Br)c1) is C8H6Br2O2.
Describe the ring structures in building block <BB_2377>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2377>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2377>.
**Token:** <BB_2377> **SMILES:** COC(=O)c1cc(Br)cc(Br)c1 **Molecular Formula:** C8H6Br2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2378>.
CC(O)c1ccno1
What is the building block token for the following molecule?
CC(O)c1ccno1
<BB_2378>
What is the molecular formula for <BB_2378>?
The molecular formula for <BB_2378> (CC(O)c1ccno1) is C5H7NO2.
Describe the ring structures in building block <BB_2378>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2378>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2378>.
**Token:** <BB_2378> **SMILES:** CC(O)c1ccno1 **Molecular Formula:** C5H7NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2379>.
CC(=CCO)C(C)C
What is the building block token for the following molecule?
CC(=CCO)C(C)C
<BB_2379>
What is the molecular formula for <BB_2379>?
The molecular formula for <BB_2379> (CC(=CCO)C(C)C) is C7H14O.
Describe the ring structures in building block <BB_2379>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2379>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2379>.
**Token:** <BB_2379> **SMILES:** CC(=CCO)C(C)C **Molecular Formula:** C7H14O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2380>.
CC1(C)CCCN1C(=O)CCl
What is the building block token for the following molecule?
CC1(C)CCCN1C(=O)CCl
<BB_2380>
What is the molecular formula for <BB_2380>?
The molecular formula for <BB_2380> (CC1(C)CCCN1C(=O)CCl) is C8H14ClNO.
Describe the ring structures in building block <BB_2380>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2380>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2380>.
**Token:** <BB_2380> **SMILES:** CC1(C)CCCN1C(=O)CCl **Molecular Formula:** C8H14ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2381>.
CC(C)(C)OC(=O)NC(CC(=O)O)c1ccccc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CC(=O)O)c1ccccc1
<BB_2381>
What is the molecular formula for <BB_2381>?
The molecular formula for <BB_2381> (CC(C)(C)OC(=O)NC(CC(=O)O)c1ccccc1) is C14H19NO4.
Describe the ring structures in building block <BB_2381>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2381>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2381>.
**Token:** <BB_2381> **SMILES:** CC(C)(C)OC(=O)NC(CC(=O)O)c1ccccc1 **Molecular Formula:** C14H19NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2382>.
O=C1CSCc2occc21
What is the building block token for the following molecule?
O=C1CSCc2occc21
<BB_2382>
What is the molecular formula for <BB_2382>?
The molecular formula for <BB_2382> (O=C1CSCc2occc21) is C7H6O2S.
Describe the ring structures in building block <BB_2382>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2382>.
The molecule contains the following groups: Ketone, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2382>.
**Token:** <BB_2382> **SMILES:** O=C1CSCc2occc21 **Molecular Formula:** C7H6O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ketone, Sulfide
Provide the SMILES representation for the building block token <BB_2383>.
CS(=N)(=O)c1cccc(C(F)(F)F)c1.Cl
What is the building block token for the following molecule?
CS(=N)(=O)c1cccc(C(F)(F)F)c1.Cl
<BB_2383>