instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2383>?
The molecular formula for <BB_2383> (CS(=N)(=O)c1cccc(C(F)(F)F)c1.Cl) is C8H9ClF3NOS.
Describe the ring structures in building block <BB_2383>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2383>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2383>.
**Token:** <BB_2383> **SMILES:** CS(=N)(=O)c1cccc(C(F)(F)F)c1.Cl **Molecular Formula:** C8H9ClF3NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2384>.
CC1CN(S(C)(=O)=O)CCC1N.Cl
What is the building block token for the following molecule?
CC1CN(S(C)(=O)=O)CCC1N.Cl
<BB_2384>
What is the molecular formula for <BB_2384>?
The molecular formula for <BB_2384> (CC1CN(S(C)(=O)=O)CCC1N.Cl) is C7H17ClN2O2S.
Describe the ring structures in building block <BB_2384>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2384>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2384>.
**Token:** <BB_2384> **SMILES:** CC1CN(S(C)(=O)=O)CCC1N.Cl **Molecular Formula:** C7H17ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2385>.
O=C1C=CC(=O)N1c1ccc([N+](=O)[O-])cc1
What is the building block token for the following molecule?
O=C1C=CC(=O)N1c1ccc([N+](=O)[O-])cc1
<BB_2385>
What is the molecular formula for <BB_2385>?
The molecular formula for <BB_2385> (O=C1C=CC(=O)N1c1ccc([N+](=O)[O-])cc1) is C10H6N2O4.
Describe the ring structures in building block <BB_2385>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2385>.
The molecule contains the following groups: Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2385>.
**Token:** <BB_2385> **SMILES:** O=C1C=CC(=O)N1c1ccc([N+](=O)[O-])cc1 **Molecular Formula:** C10H6N2O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_2386>.
CCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1
What is the building block token for the following molecule?
CCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1
<BB_2386>
What is the molecular formula for <BB_2386>?
The molecular formula for <BB_2386> (CCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1) is C15H23BO2.
Describe the ring structures in building block <BB_2386>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2386>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2386>.
**Token:** <BB_2386> **SMILES:** CCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1 **Molecular Formula:** C15H23BO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2387>.
CC(C)=CC[Si](C)(C)C
What is the building block token for the following molecule?
CC(C)=CC[Si](C)(C)C
<BB_2387>
What is the molecular formula for <BB_2387>?
The molecular formula for <BB_2387> (CC(C)=CC[Si](C)(C)C) is C8H18Si.
Describe the ring structures in building block <BB_2387>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2387>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2387>.
**Token:** <BB_2387> **SMILES:** CC(C)=CC[Si](C)(C)C **Molecular Formula:** C8H18Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2388>.
CC(C)(C)n1nccc1N
What is the building block token for the following molecule?
CC(C)(C)n1nccc1N
<BB_2388>
What is the molecular formula for <BB_2388>?
The molecular formula for <BB_2388> (CC(C)(C)n1nccc1N) is C7H13N3.
Describe the ring structures in building block <BB_2388>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2388>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2388>.
**Token:** <BB_2388> **SMILES:** CC(C)(C)n1nccc1N **Molecular Formula:** C7H13N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2389>.
Nc1cccc(-c2nnc3ccccn23)n1
What is the building block token for the following molecule?
Nc1cccc(-c2nnc3ccccn23)n1
<BB_2389>
What is the molecular formula for <BB_2389>?
The molecular formula for <BB_2389> (Nc1cccc(-c2nnc3ccccn23)n1) is C11H9N5.
Describe the ring structures in building block <BB_2389>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2389>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2389>.
**Token:** <BB_2389> **SMILES:** Nc1cccc(-c2nnc3ccccn23)n1 **Molecular Formula:** C11H9N5 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2390>.
O=S(=O)(NC1CCNCC1)c1ccccc1
What is the building block token for the following molecule?
O=S(=O)(NC1CCNCC1)c1ccccc1
<BB_2390>
What is the molecular formula for <BB_2390>?
The molecular formula for <BB_2390> (O=S(=O)(NC1CCNCC1)c1ccccc1) is C11H16N2O2S.
Describe the ring structures in building block <BB_2390>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2390>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2390>.
**Token:** <BB_2390> **SMILES:** O=S(=O)(NC1CCNCC1)c1ccccc1 **Molecular Formula:** C11H16N2O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2391>.
N#CCCS(N)(=O)=O
What is the building block token for the following molecule?
N#CCCS(N)(=O)=O
<BB_2391>
What is the molecular formula for <BB_2391>?
The molecular formula for <BB_2391> (N#CCCS(N)(=O)=O) is C3H6N2O2S.
Describe the ring structures in building block <BB_2391>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2391>.
The molecule contains the following groups: Amine, Nitrile, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2391>.
**Token:** <BB_2391> **SMILES:** N#CCCS(N)(=O)=O **Molecular Formula:** C3H6N2O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Nitrile, Sulfonamide
Provide the SMILES representation for the building block token <BB_2392>.
O=C(O)CNC(=O)c1ccccc1
What is the building block token for the following molecule?
O=C(O)CNC(=O)c1ccccc1
<BB_2392>
What is the molecular formula for <BB_2392>?
The molecular formula for <BB_2392> (O=C(O)CNC(=O)c1ccccc1) is C9H9NO3.
Describe the ring structures in building block <BB_2392>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2392>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2392>.
**Token:** <BB_2392> **SMILES:** O=C(O)CNC(=O)c1ccccc1 **Molecular Formula:** C9H9NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2393>.
COC(=O)c1cc(OC)ncc1N
What is the building block token for the following molecule?
COC(=O)c1cc(OC)ncc1N
<BB_2393>
What is the molecular formula for <BB_2393>?
The molecular formula for <BB_2393> (COC(=O)c1cc(OC)ncc1N) is C8H10N2O3.
Describe the ring structures in building block <BB_2393>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2393>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2393>.
**Token:** <BB_2393> **SMILES:** COC(=O)c1cc(OC)ncc1N **Molecular Formula:** C8H10N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2394>.
NCC1CCCC1c1ccccc1
What is the building block token for the following molecule?
NCC1CCCC1c1ccccc1
<BB_2394>
What is the molecular formula for <BB_2394>?
The molecular formula for <BB_2394> (NCC1CCCC1c1ccccc1) is C12H17N.
Describe the ring structures in building block <BB_2394>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2394>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2394>.
**Token:** <BB_2394> **SMILES:** NCC1CCCC1c1ccccc1 **Molecular Formula:** C12H17N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2395>.
NS(=O)(=O)c1ccccc1-n1cc(I)cn1
What is the building block token for the following molecule?
NS(=O)(=O)c1ccccc1-n1cc(I)cn1
<BB_2395>
What is the molecular formula for <BB_2395>?
The molecular formula for <BB_2395> (NS(=O)(=O)c1ccccc1-n1cc(I)cn1) is C9H8IN3O2S.
Describe the ring structures in building block <BB_2395>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2395>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2395>.
**Token:** <BB_2395> **SMILES:** NS(=O)(=O)c1ccccc1-n1cc(I)cn1 **Molecular Formula:** C9H8IN3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2396>.
Cc1nccnc1N1CCNCC1
What is the building block token for the following molecule?
Cc1nccnc1N1CCNCC1
<BB_2396>
What is the molecular formula for <BB_2396>?
The molecular formula for <BB_2396> (Cc1nccnc1N1CCNCC1) is C9H14N4.
Describe the ring structures in building block <BB_2396>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2396>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2396>.
**Token:** <BB_2396> **SMILES:** Cc1nccnc1N1CCNCC1 **Molecular Formula:** C9H14N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2397>.
COc1cc(C)c(C(C)NC(=O)CCl)cc1OC
What is the building block token for the following molecule?
COc1cc(C)c(C(C)NC(=O)CCl)cc1OC
<BB_2397>
What is the molecular formula for <BB_2397>?
The molecular formula for <BB_2397> (COc1cc(C)c(C(C)NC(=O)CCl)cc1OC) is C13H18ClNO3.
Describe the ring structures in building block <BB_2397>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2397>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2397>.
**Token:** <BB_2397> **SMILES:** COc1cc(C)c(C(C)NC(=O)CCl)cc1OC **Molecular Formula:** C13H18ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2398>.
CC(=O)C1(N)CCC1.Cl
What is the building block token for the following molecule?
CC(=O)C1(N)CCC1.Cl
<BB_2398>
What is the molecular formula for <BB_2398>?
The molecular formula for <BB_2398> (CC(=O)C1(N)CCC1.Cl) is C6H12ClNO.
Describe the ring structures in building block <BB_2398>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2398>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2398>.
**Token:** <BB_2398> **SMILES:** CC(=O)C1(N)CCC1.Cl **Molecular Formula:** C6H12ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2399>.
CN(C)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1
What is the building block token for the following molecule?
CN(C)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1
<BB_2399>
What is the molecular formula for <BB_2399>?
The molecular formula for <BB_2399> (CN(C)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1) is C13H26N2O2.
Describe the ring structures in building block <BB_2399>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2399>.
The molecule contains the following groups: Tertiary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2399>.
**Token:** <BB_2399> **SMILES:** CN(C)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1 **Molecular Formula:** C13H26N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Ether