instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2400>.
CC(C)(C)OC(=O)NC(CN)C1CCOC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CN)C1CCOC1
<BB_2400>
What is the molecular formula for <BB_2400>?
The molecular formula for <BB_2400> (CC(C)(C)OC(=O)NC(CN)C1CCOC1) is C11H22N2O3.
Describe the ring structures in building block <BB_2400>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2400>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2400>.
**Token:** <BB_2400> **SMILES:** CC(C)(C)OC(=O)NC(CN)C1CCOC1 **Molecular Formula:** C11H22N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2401>.
Cc1cc(=O)n2[nH]c(-c3ccccc3)cc2n1
What is the building block token for the following molecule?
Cc1cc(=O)n2[nH]c(-c3ccccc3)cc2n1
<BB_2401>
What is the molecular formula for <BB_2401>?
The molecular formula for <BB_2401> (Cc1cc(=O)n2[nH]c(-c3ccccc3)cc2n1) is C13H11N3O.
Describe the ring structures in building block <BB_2401>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2401>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2401>.
**Token:** <BB_2401> **SMILES:** Cc1cc(=O)n2[nH]c(-c3ccccc3)cc2n1 **Molecular Formula:** C13H11N3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2402>.
CC1C(N)CC1c1ccccc1.Cl
What is the building block token for the following molecule?
CC1C(N)CC1c1ccccc1.Cl
<BB_2402>
What is the molecular formula for <BB_2402>?
The molecular formula for <BB_2402> (CC1C(N)CC1c1ccccc1.Cl) is C11H16ClN.
Describe the ring structures in building block <BB_2402>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_2402>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2402>.
**Token:** <BB_2402> **SMILES:** CC1C(N)CC1c1ccccc1.Cl **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2403>.
FC(F)CNc1ccccc1I
What is the building block token for the following molecule?
FC(F)CNc1ccccc1I
<BB_2403>
What is the molecular formula for <BB_2403>?
The molecular formula for <BB_2403> (FC(F)CNc1ccccc1I) is C8H8F2IN.
Describe the ring structures in building block <BB_2403>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2403>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2403>.
**Token:** <BB_2403> **SMILES:** FC(F)CNc1ccccc1I **Molecular Formula:** C8H8F2IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2404>.
COC(=O)c1cc(C(=O)O)cc2[nH]ccc12
What is the building block token for the following molecule?
COC(=O)c1cc(C(=O)O)cc2[nH]ccc12
<BB_2404>
What is the molecular formula for <BB_2404>?
The molecular formula for <BB_2404> (COC(=O)c1cc(C(=O)O)cc2[nH]ccc12) is C11H9NO4.
Describe the ring structures in building block <BB_2404>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2404>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2404>.
**Token:** <BB_2404> **SMILES:** COC(=O)c1cc(C(=O)O)cc2[nH]ccc12 **Molecular Formula:** C11H9NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_2405>.
Cl.OC(c1ccccc1)C12CC(CN1)C2
What is the building block token for the following molecule?
Cl.OC(c1ccccc1)C12CC(CN1)C2
<BB_2405>
What is the molecular formula for <BB_2405>?
The molecular formula for <BB_2405> (Cl.OC(c1ccccc1)C12CC(CN1)C2) is C12H16ClNO.
Describe the ring structures in building block <BB_2405>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2405>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2405>.
**Token:** <BB_2405> **SMILES:** Cl.OC(c1ccccc1)C12CC(CN1)C2 **Molecular Formula:** C12H16ClNO **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2406>.
C=CN(C=O)CC(=C)c1cccc(OC(F)(F)F)c1
What is the building block token for the following molecule?
C=CN(C=O)CC(=C)c1cccc(OC(F)(F)F)c1
<BB_2406>
What is the molecular formula for <BB_2406>?
The molecular formula for <BB_2406> (C=CN(C=O)CC(=C)c1cccc(OC(F)(F)F)c1) is C13H12F3NO2.
Describe the ring structures in building block <BB_2406>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2406>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2406>.
**Token:** <BB_2406> **SMILES:** C=CN(C=O)CC(=C)c1cccc(OC(F)(F)F)c1 **Molecular Formula:** C13H12F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2407>.
CCCC1COCCN1.Cl
What is the building block token for the following molecule?
CCCC1COCCN1.Cl
<BB_2407>
What is the molecular formula for <BB_2407>?
The molecular formula for <BB_2407> (CCCC1COCCN1.Cl) is C7H16ClNO.
Describe the ring structures in building block <BB_2407>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2407>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2407>.
**Token:** <BB_2407> **SMILES:** CCCC1COCCN1.Cl **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2408>.
Cl.Cn1cnc2nc(Cl)cc(C(=O)O)c21
What is the building block token for the following molecule?
Cl.Cn1cnc2nc(Cl)cc(C(=O)O)c21
<BB_2408>
What is the molecular formula for <BB_2408>?
The molecular formula for <BB_2408> (Cl.Cn1cnc2nc(Cl)cc(C(=O)O)c21) is C8H7Cl2N3O2.
Describe the ring structures in building block <BB_2408>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2408>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2408>.
**Token:** <BB_2408> **SMILES:** Cl.Cn1cnc2nc(Cl)cc(C(=O)O)c21 **Molecular Formula:** C8H7Cl2N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2409>.
CC(F)(F)CCO
What is the building block token for the following molecule?
CC(F)(F)CCO
<BB_2409>
What is the molecular formula for <BB_2409>?
The molecular formula for <BB_2409> (CC(F)(F)CCO) is C4H8F2O.
Describe the ring structures in building block <BB_2409>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2409>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2409>.
**Token:** <BB_2409> **SMILES:** CC(F)(F)CCO **Molecular Formula:** C4H8F2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2410>.
O=Cc1ccc(Br)cc1Oc1cc(Cl)cc(Cl)c1
What is the building block token for the following molecule?
O=Cc1ccc(Br)cc1Oc1cc(Cl)cc(Cl)c1
<BB_2410>
What is the molecular formula for <BB_2410>?
The molecular formula for <BB_2410> (O=Cc1ccc(Br)cc1Oc1cc(Cl)cc(Cl)c1) is C13H7BrCl2O2.
Describe the ring structures in building block <BB_2410>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2410>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2410>.
**Token:** <BB_2410> **SMILES:** O=Cc1ccc(Br)cc1Oc1cc(Cl)cc(Cl)c1 **Molecular Formula:** C13H7BrCl2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2411>.
Cc1ccc(S(=O)(=O)N(C)CC(=O)NN)cc1
What is the building block token for the following molecule?
Cc1ccc(S(=O)(=O)N(C)CC(=O)NN)cc1
<BB_2411>
What is the molecular formula for <BB_2411>?
The molecular formula for <BB_2411> (Cc1ccc(S(=O)(=O)N(C)CC(=O)NN)cc1) is C10H15N3O3S.
Describe the ring structures in building block <BB_2411>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2411>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2411>.
**Token:** <BB_2411> **SMILES:** Cc1ccc(S(=O)(=O)N(C)CC(=O)NN)cc1 **Molecular Formula:** C10H15N3O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Amide, Sulfonamide
Provide the SMILES representation for the building block token <BB_2412>.
NS(=O)(=O)Cc1ccc(C(F)(F)F)cc1
What is the building block token for the following molecule?
NS(=O)(=O)Cc1ccc(C(F)(F)F)cc1
<BB_2412>
What is the molecular formula for <BB_2412>?
The molecular formula for <BB_2412> (NS(=O)(=O)Cc1ccc(C(F)(F)F)cc1) is C8H8F3NO2S.
Describe the ring structures in building block <BB_2412>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2412>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2412>.
**Token:** <BB_2412> **SMILES:** NS(=O)(=O)Cc1ccc(C(F)(F)F)cc1 **Molecular Formula:** C8H8F3NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2413>.
CCC([O-])=CC#N.[Li+]
What is the building block token for the following molecule?
CCC([O-])=CC#N.[Li+]
<BB_2413>
What is the molecular formula for <BB_2413>?
The molecular formula for <BB_2413> (CCC([O-])=CC#N.[Li+]) is C5H6LiNO.
Describe the ring structures in building block <BB_2413>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2413>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2413>.
**Token:** <BB_2413> **SMILES:** CCC([O-])=CC#N.[Li+] **Molecular Formula:** C5H6LiNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_2414>.
NCc1ccc(C(=O)N2CCCC2)cc1
What is the building block token for the following molecule?
NCc1ccc(C(=O)N2CCCC2)cc1
<BB_2414>
What is the molecular formula for <BB_2414>?
The molecular formula for <BB_2414> (NCc1ccc(C(=O)N2CCCC2)cc1) is C12H16N2O.
Describe the ring structures in building block <BB_2414>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2414>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2414>.
**Token:** <BB_2414> **SMILES:** NCc1ccc(C(=O)N2CCCC2)cc1 **Molecular Formula:** C12H16N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_2415>.
Cl.NC(C(=O)Cc1ccccc1)c1ccccc1
What is the building block token for the following molecule?
Cl.NC(C(=O)Cc1ccccc1)c1ccccc1
<BB_2415>
What is the molecular formula for <BB_2415>?
The molecular formula for <BB_2415> (Cl.NC(C(=O)Cc1ccccc1)c1ccccc1) is C15H16ClNO.
Describe the ring structures in building block <BB_2415>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2415>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2415>.
**Token:** <BB_2415> **SMILES:** Cl.NC(C(=O)Cc1ccccc1)c1ccccc1 **Molecular Formula:** C15H16ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2416>.
CC(C)(C)OC(=O)[C@@H]1CCCC[C@H]1CN=[N+]=[N-]
What is the building block token for the following molecule?
CC(C)(C)OC(=O)[C@@H]1CCCC[C@H]1CN=[N+]=[N-]
<BB_2416>
What is the molecular formula for <BB_2416>?
The molecular formula for <BB_2416> (CC(C)(C)OC(=O)[C@@H]1CCCC[C@H]1CN=[N+]=[N-]) is C12H21N3O2.
Describe the ring structures in building block <BB_2416>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.