instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2416>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2416>.
**Token:** <BB_2416> **SMILES:** CC(C)(C)OC(=O)[C@@H]1CCCC[C@H]1CN=[N+]=[N-] **Molecular Formula:** C12H21N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2417>.
CC(C)(C)OC(=O)N1CCC2(CCCC2=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC2(CCCC2=O)C1
<BB_2417>
What is the molecular formula for <BB_2417>?
The molecular formula for <BB_2417> (CC(C)(C)OC(=O)N1CCC2(CCCC2=O)C1) is C13H21NO3.
Describe the ring structures in building block <BB_2417>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2417>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_2417>.
**Token:** <BB_2417> **SMILES:** CC(C)(C)OC(=O)N1CCC2(CCCC2=O)C1 **Molecular Formula:** C13H21NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_2418>.
O=c1nc(C=NO)cc[nH]1
What is the building block token for the following molecule?
O=c1nc(C=NO)cc[nH]1
<BB_2418>
What is the molecular formula for <BB_2418>?
The molecular formula for <BB_2418> (O=c1nc(C=NO)cc[nH]1) is C5H5N3O2.
Describe the ring structures in building block <BB_2418>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2418>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2418>.
**Token:** <BB_2418> **SMILES:** O=c1nc(C=NO)cc[nH]1 **Molecular Formula:** C5H5N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2419>.
C#CC1CC(C)(C)N1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
C#CC1CC(C)(C)N1C(=O)OC(C)(C)C
<BB_2419>
What is the molecular formula for <BB_2419>?
The molecular formula for <BB_2419> (C#CC1CC(C)(C)N1C(=O)OC(C)(C)C) is C12H19NO2.
Describe the ring structures in building block <BB_2419>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2419>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2419>.
**Token:** <BB_2419> **SMILES:** C#CC1CC(C)(C)N1C(=O)OC(C)(C)C **Molecular Formula:** C12H19NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2420>.
Nc1cc(Br)ccc1C1=NCCO1
What is the building block token for the following molecule?
Nc1cc(Br)ccc1C1=NCCO1
<BB_2420>
What is the molecular formula for <BB_2420>?
The molecular formula for <BB_2420> (Nc1cc(Br)ccc1C1=NCCO1) is C9H9BrN2O.
Describe the ring structures in building block <BB_2420>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2420>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2420>.
**Token:** <BB_2420> **SMILES:** Nc1cc(Br)ccc1C1=NCCO1 **Molecular Formula:** C9H9BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2421>.
CC(C)(C)OC(=O)N1Cc2c(N)n[nH]c2C12CCC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1Cc2c(N)n[nH]c2C12CCC2
<BB_2421>
What is the molecular formula for <BB_2421>?
The molecular formula for <BB_2421> (CC(C)(C)OC(=O)N1Cc2c(N)n[nH]c2C12CCC2) is C13H20N4O2.
Describe the ring structures in building block <BB_2421>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2421>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2421>.
**Token:** <BB_2421> **SMILES:** CC(C)(C)OC(=O)N1Cc2c(N)n[nH]c2C12CCC2 **Molecular Formula:** C13H20N4O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2422>.
Cc1cccc2[nH]cc(C(=O)O)c12
What is the building block token for the following molecule?
Cc1cccc2[nH]cc(C(=O)O)c12
<BB_2422>
What is the molecular formula for <BB_2422>?
The molecular formula for <BB_2422> (Cc1cccc2[nH]cc(C(=O)O)c12) is C10H9NO2.
Describe the ring structures in building block <BB_2422>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2422>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2422>.
**Token:** <BB_2422> **SMILES:** Cc1cccc2[nH]cc(C(=O)O)c12 **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2423>.
COC(=O)c1sccc1N1C(=O)C=CC1=O
What is the building block token for the following molecule?
COC(=O)c1sccc1N1C(=O)C=CC1=O
<BB_2423>
What is the molecular formula for <BB_2423>?
The molecular formula for <BB_2423> (COC(=O)c1sccc1N1C(=O)C=CC1=O) is C10H7NO4S.
Describe the ring structures in building block <BB_2423>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2423>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2423>.
**Token:** <BB_2423> **SMILES:** COC(=O)c1sccc1N1C(=O)C=CC1=O **Molecular Formula:** C10H7NO4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_2424>.
Cn1c(N)c(C=O)c(=O)[nH]c1=O
What is the building block token for the following molecule?
Cn1c(N)c(C=O)c(=O)[nH]c1=O
<BB_2424>
What is the molecular formula for <BB_2424>?
The molecular formula for <BB_2424> (Cn1c(N)c(C=O)c(=O)[nH]c1=O) is C6H7N3O3.
Describe the ring structures in building block <BB_2424>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2424>.
The molecule contains the following groups: Amine, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2424>.
**Token:** <BB_2424> **SMILES:** Cn1c(N)c(C=O)c(=O)[nH]c1=O **Molecular Formula:** C6H7N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Aldehyde
Provide the SMILES representation for the building block token <BB_2425>.
Cc1nc(O)cc(Cl)n1
What is the building block token for the following molecule?
Cc1nc(O)cc(Cl)n1
<BB_2425>
What is the molecular formula for <BB_2425>?
The molecular formula for <BB_2425> (Cc1nc(O)cc(Cl)n1) is C5H5ClN2O.
Describe the ring structures in building block <BB_2425>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2425>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2425>.
**Token:** <BB_2425> **SMILES:** Cc1nc(O)cc(Cl)n1 **Molecular Formula:** C5H5ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2426>.
Brc1ccc2ncccc2n1
What is the building block token for the following molecule?
Brc1ccc2ncccc2n1
<BB_2426>
What is the molecular formula for <BB_2426>?
The molecular formula for <BB_2426> (Brc1ccc2ncccc2n1) is C8H5BrN2.
Describe the ring structures in building block <BB_2426>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2426>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2426>.
**Token:** <BB_2426> **SMILES:** Brc1ccc2ncccc2n1 **Molecular Formula:** C8H5BrN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2427>.
OC1COc2ccc(Br)cc21
What is the building block token for the following molecule?
OC1COc2ccc(Br)cc21
<BB_2427>
What is the molecular formula for <BB_2427>?
The molecular formula for <BB_2427> (OC1COc2ccc(Br)cc21) is C8H7BrO2.
Describe the ring structures in building block <BB_2427>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2427>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2427>.
**Token:** <BB_2427> **SMILES:** OC1COc2ccc(Br)cc21 **Molecular Formula:** C8H7BrO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2428>.
C=CCC(F)(F)CO
What is the building block token for the following molecule?
C=CCC(F)(F)CO
<BB_2428>
What is the molecular formula for <BB_2428>?
The molecular formula for <BB_2428> (C=CCC(F)(F)CO) is C5H8F2O.
Describe the ring structures in building block <BB_2428>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2428>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2428>.
**Token:** <BB_2428> **SMILES:** C=CCC(F)(F)CO **Molecular Formula:** C5H8F2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2429>.
CCOC(=O)[C@@H]1C[C@H]1c1cnccc1C
What is the building block token for the following molecule?
CCOC(=O)[C@@H]1C[C@H]1c1cnccc1C
<BB_2429>
What is the molecular formula for <BB_2429>?
The molecular formula for <BB_2429> (CCOC(=O)[C@@H]1C[C@H]1c1cnccc1C) is C12H15NO2.
Describe the ring structures in building block <BB_2429>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_2429>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2429>.
**Token:** <BB_2429> **SMILES:** CCOC(=O)[C@@H]1C[C@H]1c1cnccc1C **Molecular Formula:** C12H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2430>.
CC(=O)N1CCC(C(=O)O)C1
What is the building block token for the following molecule?
CC(=O)N1CCC(C(=O)O)C1
<BB_2430>
What is the molecular formula for <BB_2430>?
The molecular formula for <BB_2430> (CC(=O)N1CCC(C(=O)O)C1) is C7H11NO3.
Describe the ring structures in building block <BB_2430>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2430>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2430>.
**Token:** <BB_2430> **SMILES:** CC(=O)N1CCC(C(=O)O)C1 **Molecular Formula:** C7H11NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2431>.
Cc1cnc(C=O)c(F)c1
What is the building block token for the following molecule?
Cc1cnc(C=O)c(F)c1
<BB_2431>
What is the molecular formula for <BB_2431>?
The molecular formula for <BB_2431> (Cc1cnc(C=O)c(F)c1) is C7H6FNO.
Describe the ring structures in building block <BB_2431>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2431>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2431>.
**Token:** <BB_2431> **SMILES:** Cc1cnc(C=O)c(F)c1 **Molecular Formula:** C7H6FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2432>.
CC(C)(C)OC(=O)N1C2CC(C(O)C2O)C1C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C2CC(C(O)C2O)C1C(=O)O
<BB_2432>
What is the molecular formula for <BB_2432>?
The molecular formula for <BB_2432> (CC(C)(C)OC(=O)N1C2CC(C(O)C2O)C1C(=O)O) is C12H19NO6.
Describe the ring structures in building block <BB_2432>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2432>.
The molecule contains the following groups: Carboxylic Acid, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2432>.
**Token:** <BB_2432> **SMILES:** CC(C)(C)OC(=O)N1C2CC(C(O)C2O)C1C(=O)O **Molecular Formula:** C12H19NO6 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2433>.
Nc1cc(C2CCOCC2)ccc1F
What is the building block token for the following molecule?
Nc1cc(C2CCOCC2)ccc1F
<BB_2433>