instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2433>?
The molecular formula for <BB_2433> (Nc1cc(C2CCOCC2)ccc1F) is C11H14FNO.
Describe the ring structures in building block <BB_2433>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2433>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2433>.
**Token:** <BB_2433> **SMILES:** Nc1cc(C2CCOCC2)ccc1F **Molecular Formula:** C11H14FNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2434>.
N=C(c1ccccc1)c1ccc(Cl)cc1
What is the building block token for the following molecule?
N=C(c1ccccc1)c1ccc(Cl)cc1
<BB_2434>
What is the molecular formula for <BB_2434>?
The molecular formula for <BB_2434> (N=C(c1ccccc1)c1ccc(Cl)cc1) is C13H10ClN.
Describe the ring structures in building block <BB_2434>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2434>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2434>.
**Token:** <BB_2434> **SMILES:** N=C(c1ccccc1)c1ccc(Cl)cc1 **Molecular Formula:** C13H10ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2435>.
CC1(c2ccccc2)CC(O)CCO1
What is the building block token for the following molecule?
CC1(c2ccccc2)CC(O)CCO1
<BB_2435>
What is the molecular formula for <BB_2435>?
The molecular formula for <BB_2435> (CC1(c2ccccc2)CC(O)CCO1) is C12H16O2.
Describe the ring structures in building block <BB_2435>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2435>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2435>.
**Token:** <BB_2435> **SMILES:** CC1(c2ccccc2)CC(O)CCO1 **Molecular Formula:** C12H16O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2436>.
O=C(CCl)c1cccc(Cl)n1
What is the building block token for the following molecule?
O=C(CCl)c1cccc(Cl)n1
<BB_2436>
What is the molecular formula for <BB_2436>?
The molecular formula for <BB_2436> (O=C(CCl)c1cccc(Cl)n1) is C7H5Cl2NO.
Describe the ring structures in building block <BB_2436>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2436>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2436>.
**Token:** <BB_2436> **SMILES:** O=C(CCl)c1cccc(Cl)n1 **Molecular Formula:** C7H5Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2437>.
COC(C)(CN)C1CCC(C(C)C)CC1.Cl
What is the building block token for the following molecule?
COC(C)(CN)C1CCC(C(C)C)CC1.Cl
<BB_2437>
What is the molecular formula for <BB_2437>?
The molecular formula for <BB_2437> (COC(C)(CN)C1CCC(C(C)C)CC1.Cl) is C13H28ClNO.
Describe the ring structures in building block <BB_2437>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2437>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2437>.
**Token:** <BB_2437> **SMILES:** COC(C)(CN)C1CCC(C(C)C)CC1.Cl **Molecular Formula:** C13H28ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2438>.
CC(=O)OC1C=CC2C3CCC(C3)C12
What is the building block token for the following molecule?
CC(=O)OC1C=CC2C3CCC(C3)C12
<BB_2438>
What is the molecular formula for <BB_2438>?
The molecular formula for <BB_2438> (CC(=O)OC1C=CC2C3CCC(C3)C12) is C12H16O2.
Describe the ring structures in building block <BB_2438>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2438>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2438>.
**Token:** <BB_2438> **SMILES:** CC(=O)OC1C=CC2C3CCC(C3)C12 **Molecular Formula:** C12H16O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2439>.
COC(=O)c1nc(Cl)c2cnn(C)c2n1
What is the building block token for the following molecule?
COC(=O)c1nc(Cl)c2cnn(C)c2n1
<BB_2439>
What is the molecular formula for <BB_2439>?
The molecular formula for <BB_2439> (COC(=O)c1nc(Cl)c2cnn(C)c2n1) is C8H7ClN4O2.
Describe the ring structures in building block <BB_2439>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2439>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2439>.
**Token:** <BB_2439> **SMILES:** COC(=O)c1nc(Cl)c2cnn(C)c2n1 **Molecular Formula:** C8H7ClN4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2440>.
ON=Cc1ccc(OCc2ccccc2)cc1
What is the building block token for the following molecule?
ON=Cc1ccc(OCc2ccccc2)cc1
<BB_2440>
What is the molecular formula for <BB_2440>?
The molecular formula for <BB_2440> (ON=Cc1ccc(OCc2ccccc2)cc1) is C14H13NO2.
Describe the ring structures in building block <BB_2440>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2440>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2440>.
**Token:** <BB_2440> **SMILES:** ON=Cc1ccc(OCc2ccccc2)cc1 **Molecular Formula:** C14H13NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2441>.
O=C(O)Cc1cc(Br)cc(OS(=O)(=O)F)c1
What is the building block token for the following molecule?
O=C(O)Cc1cc(Br)cc(OS(=O)(=O)F)c1
<BB_2441>
What is the molecular formula for <BB_2441>?
The molecular formula for <BB_2441> (O=C(O)Cc1cc(Br)cc(OS(=O)(=O)F)c1) is C8H6BrFO5S.
Describe the ring structures in building block <BB_2441>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2441>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2441>.
**Token:** <BB_2441> **SMILES:** O=C(O)Cc1cc(Br)cc(OS(=O)(=O)F)c1 **Molecular Formula:** C8H6BrFO5S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2442>.
CC(C)(C)OC(=O)N1CC(C)(C)C(=O)C1(C)C
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(C)(C)C(=O)C1(C)C
<BB_2442>
What is the molecular formula for <BB_2442>?
The molecular formula for <BB_2442> (CC(C)(C)OC(=O)N1CC(C)(C)C(=O)C1(C)C) is C13H23NO3.
Describe the ring structures in building block <BB_2442>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2442>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_2442>.
**Token:** <BB_2442> **SMILES:** CC(C)(C)OC(=O)N1CC(C)(C)C(=O)C1(C)C **Molecular Formula:** C13H23NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_2443>.
c1ccc2c(SCc3ccon3)nccc2c1
What is the building block token for the following molecule?
c1ccc2c(SCc3ccon3)nccc2c1
<BB_2443>
What is the molecular formula for <BB_2443>?
The molecular formula for <BB_2443> (c1ccc2c(SCc3ccon3)nccc2c1) is C13H10N2OS.
Describe the ring structures in building block <BB_2443>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2443>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2443>.
**Token:** <BB_2443> **SMILES:** c1ccc2c(SCc3ccon3)nccc2c1 **Molecular Formula:** C13H10N2OS **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_2444>.
Cl.N#Cc1ccc(N2CCNCC2)c(F)c1
What is the building block token for the following molecule?
Cl.N#Cc1ccc(N2CCNCC2)c(F)c1
<BB_2444>
What is the molecular formula for <BB_2444>?
The molecular formula for <BB_2444> (Cl.N#Cc1ccc(N2CCNCC2)c(F)c1) is C11H13ClFN3.
Describe the ring structures in building block <BB_2444>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2444>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2444>.
**Token:** <BB_2444> **SMILES:** Cl.N#Cc1ccc(N2CCNCC2)c(F)c1 **Molecular Formula:** C11H13ClFN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2445>.
CC(C)(C)OC(=O)c1c(-c2ccccc2)csc1N
What is the building block token for the following molecule?
CC(C)(C)OC(=O)c1c(-c2ccccc2)csc1N
<BB_2445>
What is the molecular formula for <BB_2445>?
The molecular formula for <BB_2445> (CC(C)(C)OC(=O)c1c(-c2ccccc2)csc1N) is C15H17NO2S.
Describe the ring structures in building block <BB_2445>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2445>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2445>.
**Token:** <BB_2445> **SMILES:** CC(C)(C)OC(=O)c1c(-c2ccccc2)csc1N **Molecular Formula:** C15H17NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2446>.
CC(=O)Nc1cccc(Br)c1
What is the building block token for the following molecule?
CC(=O)Nc1cccc(Br)c1
<BB_2446>
What is the molecular formula for <BB_2446>?
The molecular formula for <BB_2446> (CC(=O)Nc1cccc(Br)c1) is C8H8BrNO.
Describe the ring structures in building block <BB_2446>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2446>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2446>.
**Token:** <BB_2446> **SMILES:** CC(=O)Nc1cccc(Br)c1 **Molecular Formula:** C8H8BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2447>.
CC(=O)OCCCCN=[N+]=[N-]
What is the building block token for the following molecule?
CC(=O)OCCCCN=[N+]=[N-]
<BB_2447>
What is the molecular formula for <BB_2447>?
The molecular formula for <BB_2447> (CC(=O)OCCCCN=[N+]=[N-]) is C6H11N3O2.
Describe the ring structures in building block <BB_2447>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2447>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2447>.
**Token:** <BB_2447> **SMILES:** CC(=O)OCCCCN=[N+]=[N-] **Molecular Formula:** C6H11N3O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2448>.
CN(Cc1ccccc1)C(=O)NCCC(=O)O
What is the building block token for the following molecule?
CN(Cc1ccccc1)C(=O)NCCC(=O)O
<BB_2448>
What is the molecular formula for <BB_2448>?
The molecular formula for <BB_2448> (CN(Cc1ccccc1)C(=O)NCCC(=O)O) is C12H16N2O3.
Describe the ring structures in building block <BB_2448>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2448>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2448>.
**Token:** <BB_2448> **SMILES:** CN(Cc1ccccc1)C(=O)NCCC(=O)O **Molecular Formula:** C12H16N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2449>.
O=C(O)c1cccn(-c2ccccc2)c1=O
What is the building block token for the following molecule?
O=C(O)c1cccn(-c2ccccc2)c1=O
<BB_2449>
What is the molecular formula for <BB_2449>?
The molecular formula for <BB_2449> (O=C(O)c1cccn(-c2ccccc2)c1=O) is C12H9NO3.
Describe the ring structures in building block <BB_2449>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2449>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2449>.
**Token:** <BB_2449> **SMILES:** O=C(O)c1cccn(-c2ccccc2)c1=O **Molecular Formula:** C12H9NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid