instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2450>.
Brc1ccn2ccnc2n1
What is the building block token for the following molecule?
Brc1ccn2ccnc2n1
<BB_2450>
What is the molecular formula for <BB_2450>?
The molecular formula for <BB_2450> (Brc1ccn2ccnc2n1) is C6H4BrN3.
Describe the ring structures in building block <BB_2450>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2450>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2450>.
**Token:** <BB_2450> **SMILES:** Brc1ccn2ccnc2n1 **Molecular Formula:** C6H4BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2451>.
Cc1cc(CCN)no1.Cl
What is the building block token for the following molecule?
Cc1cc(CCN)no1.Cl
<BB_2451>
What is the molecular formula for <BB_2451>?
The molecular formula for <BB_2451> (Cc1cc(CCN)no1.Cl) is C6H11ClN2O.
Describe the ring structures in building block <BB_2451>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2451>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2451>.
**Token:** <BB_2451> **SMILES:** Cc1cc(CCN)no1.Cl **Molecular Formula:** C6H11ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2452>.
O=C(Nc1ccccn1)C1CCCNC1
What is the building block token for the following molecule?
O=C(Nc1ccccn1)C1CCCNC1
<BB_2452>
What is the molecular formula for <BB_2452>?
The molecular formula for <BB_2452> (O=C(Nc1ccccn1)C1CCCNC1) is C11H15N3O.
Describe the ring structures in building block <BB_2452>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2452>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2452>.
**Token:** <BB_2452> **SMILES:** O=C(Nc1ccccn1)C1CCCNC1 **Molecular Formula:** C11H15N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_2453>.
Fc1ccc(Br)c(F)c1OC(F)(F)F
What is the building block token for the following molecule?
Fc1ccc(Br)c(F)c1OC(F)(F)F
<BB_2453>
What is the molecular formula for <BB_2453>?
The molecular formula for <BB_2453> (Fc1ccc(Br)c(F)c1OC(F)(F)F) is C7H2BrF5O.
Describe the ring structures in building block <BB_2453>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2453>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2453>.
**Token:** <BB_2453> **SMILES:** Fc1ccc(Br)c(F)c1OC(F)(F)F **Molecular Formula:** C7H2BrF5O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2454>.
NC(c1ccccc1)c1ccccc1
What is the building block token for the following molecule?
NC(c1ccccc1)c1ccccc1
<BB_2454>
What is the molecular formula for <BB_2454>?
The molecular formula for <BB_2454> (NC(c1ccccc1)c1ccccc1) is C13H13N.
Describe the ring structures in building block <BB_2454>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2454>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2454>.
**Token:** <BB_2454> **SMILES:** NC(c1ccccc1)c1ccccc1 **Molecular Formula:** C13H13N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2455>.
N#Cc1ccc(N2CCSCC2)cc1
What is the building block token for the following molecule?
N#Cc1ccc(N2CCSCC2)cc1
<BB_2455>
What is the molecular formula for <BB_2455>?
The molecular formula for <BB_2455> (N#Cc1ccc(N2CCSCC2)cc1) is C11H12N2S.
Describe the ring structures in building block <BB_2455>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2455>.
The molecule contains the following groups: Tertiary Amine, Sulfide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2455>.
**Token:** <BB_2455> **SMILES:** N#Cc1ccc(N2CCSCC2)cc1 **Molecular Formula:** C11H12N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Sulfide, Nitrile
Provide the SMILES representation for the building block token <BB_2456>.
CCCC1(C(=O)O)CCCCC1
What is the building block token for the following molecule?
CCCC1(C(=O)O)CCCCC1
<BB_2456>
What is the molecular formula for <BB_2456>?
The molecular formula for <BB_2456> (CCCC1(C(=O)O)CCCCC1) is C10H18O2.
Describe the ring structures in building block <BB_2456>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2456>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2456>.
**Token:** <BB_2456> **SMILES:** CCCC1(C(=O)O)CCCCC1 **Molecular Formula:** C10H18O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2457>.
CC1=C(C)C(=O)c2cc(C)ccc2C1=O
What is the building block token for the following molecule?
CC1=C(C)C(=O)c2cc(C)ccc2C1=O
<BB_2457>
What is the molecular formula for <BB_2457>?
The molecular formula for <BB_2457> (CC1=C(C)C(=O)c2cc(C)ccc2C1=O) is C13H12O2.
Describe the ring structures in building block <BB_2457>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2457>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2457>.
**Token:** <BB_2457> **SMILES:** CC1=C(C)C(=O)c2cc(C)ccc2C1=O **Molecular Formula:** C13H12O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2458>.
COC(=O)c1n[nH]c2c1CCCC2
What is the building block token for the following molecule?
COC(=O)c1n[nH]c2c1CCCC2
<BB_2458>
What is the molecular formula for <BB_2458>?
The molecular formula for <BB_2458> (COC(=O)c1n[nH]c2c1CCCC2) is C9H12N2O2.
Describe the ring structures in building block <BB_2458>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2458>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2458>.
**Token:** <BB_2458> **SMILES:** COC(=O)c1n[nH]c2c1CCCC2 **Molecular Formula:** C9H12N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2459>.
CS(=O)(=O)c1ccc(Cc2nnc(N)o2)cc1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(Cc2nnc(N)o2)cc1
<BB_2459>
What is the molecular formula for <BB_2459>?
The molecular formula for <BB_2459> (CS(=O)(=O)c1ccc(Cc2nnc(N)o2)cc1) is C10H11N3O3S.
Describe the ring structures in building block <BB_2459>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2459>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2459>.
**Token:** <BB_2459> **SMILES:** CS(=O)(=O)c1ccc(Cc2nnc(N)o2)cc1 **Molecular Formula:** C10H11N3O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2460>.
CCc1cc(C)nc(C2CCNCC2)n1.Cl.Cl
What is the building block token for the following molecule?
CCc1cc(C)nc(C2CCNCC2)n1.Cl.Cl
<BB_2460>
What is the molecular formula for <BB_2460>?
The molecular formula for <BB_2460> (CCc1cc(C)nc(C2CCNCC2)n1.Cl.Cl) is C12H21Cl2N3.
Describe the ring structures in building block <BB_2460>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2460>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2460>.
**Token:** <BB_2460> **SMILES:** CCc1cc(C)nc(C2CCNCC2)n1.Cl.Cl **Molecular Formula:** C12H21Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2461>.
O=c1cc(-c2ccccc2)c2ccccc2[nH]1
What is the building block token for the following molecule?
O=c1cc(-c2ccccc2)c2ccccc2[nH]1
<BB_2461>
What is the molecular formula for <BB_2461>?
The molecular formula for <BB_2461> (O=c1cc(-c2ccccc2)c2ccccc2[nH]1) is C15H11NO.
Describe the ring structures in building block <BB_2461>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2461>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2461>.
**Token:** <BB_2461> **SMILES:** O=c1cc(-c2ccccc2)c2ccccc2[nH]1 **Molecular Formula:** C15H11NO **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2462>.
O=C1NCC(O)CC12CCCC2
What is the building block token for the following molecule?
O=C1NCC(O)CC12CCCC2
<BB_2462>
What is the molecular formula for <BB_2462>?
The molecular formula for <BB_2462> (O=C1NCC(O)CC12CCCC2) is C9H15NO2.
Describe the ring structures in building block <BB_2462>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2462>.
The molecule contains the following groups: Amide, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2462>.
**Token:** <BB_2462> **SMILES:** O=C1NCC(O)CC12CCCC2 **Molecular Formula:** C9H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Alcohol
Provide the SMILES representation for the building block token <BB_2463>.
Cl.N[C@@H]1C[C@H]1c1cccc2c1OCCO2
What is the building block token for the following molecule?
Cl.N[C@@H]1C[C@H]1c1cccc2c1OCCO2
<BB_2463>
What is the molecular formula for <BB_2463>?
The molecular formula for <BB_2463> (Cl.N[C@@H]1C[C@H]1c1cccc2c1OCCO2) is C11H14ClNO2.
Describe the ring structures in building block <BB_2463>.
The molecule contains 3 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2463>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2463>.
**Token:** <BB_2463> **SMILES:** Cl.N[C@@H]1C[C@H]1c1cccc2c1OCCO2 **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2464>.
COc1cccc(-c2cc(C(=O)O)on2)c1
What is the building block token for the following molecule?
COc1cccc(-c2cc(C(=O)O)on2)c1
<BB_2464>
What is the molecular formula for <BB_2464>?
The molecular formula for <BB_2464> (COc1cccc(-c2cc(C(=O)O)on2)c1) is C11H9NO4.
Describe the ring structures in building block <BB_2464>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2464>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2464>.
**Token:** <BB_2464> **SMILES:** COc1cccc(-c2cc(C(=O)O)on2)c1 **Molecular Formula:** C11H9NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2465>.
CO[C@H]1C[C@@H](N)C[C@H]1O.Cl
What is the building block token for the following molecule?
CO[C@H]1C[C@@H](N)C[C@H]1O.Cl
<BB_2465>
What is the molecular formula for <BB_2465>?
The molecular formula for <BB_2465> (CO[C@H]1C[C@@H](N)C[C@H]1O.Cl) is C6H14ClNO2.
Describe the ring structures in building block <BB_2465>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2465>.
The molecule contains the following groups: Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2465>.
**Token:** <BB_2465> **SMILES:** CO[C@H]1C[C@@H](N)C[C@H]1O.Cl **Molecular Formula:** C6H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2466>.
CN(C)NC1CCS(=O)(=O)C1.Cl
What is the building block token for the following molecule?
CN(C)NC1CCS(=O)(=O)C1.Cl
<BB_2466>
What is the molecular formula for <BB_2466>?
The molecular formula for <BB_2466> (CN(C)NC1CCS(=O)(=O)C1.Cl) is C6H15ClN2O2S.
Describe the ring structures in building block <BB_2466>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.