instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2466>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2466>.
**Token:** <BB_2466> **SMILES:** CN(C)NC1CCS(=O)(=O)C1.Cl **Molecular Formula:** C6H15ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2467>.
COc1ccc(O)cn1
What is the building block token for the following molecule?
COc1ccc(O)cn1
<BB_2467>
What is the molecular formula for <BB_2467>?
The molecular formula for <BB_2467> (COc1ccc(O)cn1) is C6H7NO2.
Describe the ring structures in building block <BB_2467>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2467>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2467>.
**Token:** <BB_2467> **SMILES:** COc1ccc(O)cn1 **Molecular Formula:** C6H7NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2468>.
Cl.NCC1=NO[C@@H]2COC[C@H]12
What is the building block token for the following molecule?
Cl.NCC1=NO[C@@H]2COC[C@H]12
<BB_2468>
What is the molecular formula for <BB_2468>?
The molecular formula for <BB_2468> (Cl.NCC1=NO[C@@H]2COC[C@H]12) is C6H11ClN2O2.
Describe the ring structures in building block <BB_2468>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2468>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2468>.
**Token:** <BB_2468> **SMILES:** Cl.NCC1=NO[C@@H]2COC[C@H]12 **Molecular Formula:** C6H11ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2469>.
[C-]#[N+]c1c(C)cc(Br)cc1C
What is the building block token for the following molecule?
[C-]#[N+]c1c(C)cc(Br)cc1C
<BB_2469>
What is the molecular formula for <BB_2469>?
The molecular formula for <BB_2469> ([C-]#[N+]c1c(C)cc(Br)cc1C) is C9H8BrN.
Describe the ring structures in building block <BB_2469>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2469>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2469>.
**Token:** <BB_2469> **SMILES:** [C-]#[N+]c1c(C)cc(Br)cc1C **Molecular Formula:** C9H8BrN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2470>.
CC(C)(C)OC(=O)N1CCC(CON)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(CON)C1
<BB_2470>
What is the molecular formula for <BB_2470>?
The molecular formula for <BB_2470> (CC(C)(C)OC(=O)N1CCC(CON)C1) is C10H20N2O3.
Describe the ring structures in building block <BB_2470>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2470>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2470>.
**Token:** <BB_2470> **SMILES:** CC(C)(C)OC(=O)N1CCC(CON)C1 **Molecular Formula:** C10H20N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2471>.
N#CCc1cccc(OC(F)F)c1
What is the building block token for the following molecule?
N#CCc1cccc(OC(F)F)c1
<BB_2471>
What is the molecular formula for <BB_2471>?
The molecular formula for <BB_2471> (N#CCc1cccc(OC(F)F)c1) is C9H7F2NO.
Describe the ring structures in building block <BB_2471>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2471>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2471>.
**Token:** <BB_2471> **SMILES:** N#CCc1cccc(OC(F)F)c1 **Molecular Formula:** C9H7F2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2472>.
O=C(O)c1cn(C(F)(F)F)ccc1=O
What is the building block token for the following molecule?
O=C(O)c1cn(C(F)(F)F)ccc1=O
<BB_2472>
What is the molecular formula for <BB_2472>?
The molecular formula for <BB_2472> (O=C(O)c1cn(C(F)(F)F)ccc1=O) is C7H4F3NO3.
Describe the ring structures in building block <BB_2472>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2472>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2472>.
**Token:** <BB_2472> **SMILES:** O=C(O)c1cn(C(F)(F)F)ccc1=O **Molecular Formula:** C7H4F3NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2473>.
CCOC(=O)C1CCC(=O)C(C(F)(F)F)CC1
What is the building block token for the following molecule?
CCOC(=O)C1CCC(=O)C(C(F)(F)F)CC1
<BB_2473>
What is the molecular formula for <BB_2473>?
The molecular formula for <BB_2473> (CCOC(=O)C1CCC(=O)C(C(F)(F)F)CC1) is C11H15F3O3.
Describe the ring structures in building block <BB_2473>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_2473>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2473>.
**Token:** <BB_2473> **SMILES:** CCOC(=O)C1CCC(=O)C(C(F)(F)F)CC1 **Molecular Formula:** C11H15F3O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2474>.
CCOC(=O)CNCP(C)(C)=O.Cl
What is the building block token for the following molecule?
CCOC(=O)CNCP(C)(C)=O.Cl
<BB_2474>
What is the molecular formula for <BB_2474>?
The molecular formula for <BB_2474> (CCOC(=O)CNCP(C)(C)=O.Cl) is C7H17ClNO3P.
Describe the ring structures in building block <BB_2474>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2474>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2474>.
**Token:** <BB_2474> **SMILES:** CCOC(=O)CNCP(C)(C)=O.Cl **Molecular Formula:** C7H17ClNO3P **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2475>.
Cc1cc(=O)[nH]c(N2CCC(N)C2)n1.Cl.Cl
What is the building block token for the following molecule?
Cc1cc(=O)[nH]c(N2CCC(N)C2)n1.Cl.Cl
<BB_2475>
What is the molecular formula for <BB_2475>?
The molecular formula for <BB_2475> (Cc1cc(=O)[nH]c(N2CCC(N)C2)n1.Cl.Cl) is C9H16Cl2N4O.
Describe the ring structures in building block <BB_2475>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2475>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2475>.
**Token:** <BB_2475> **SMILES:** Cc1cc(=O)[nH]c(N2CCC(N)C2)n1.Cl.Cl **Molecular Formula:** C9H16Cl2N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2476>.
C#Cc1c(F)cc(Cl)cc1F
What is the building block token for the following molecule?
C#Cc1c(F)cc(Cl)cc1F
<BB_2476>
What is the molecular formula for <BB_2476>?
The molecular formula for <BB_2476> (C#Cc1c(F)cc(Cl)cc1F) is C8H3ClF2.
Describe the ring structures in building block <BB_2476>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2476>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2476>.
**Token:** <BB_2476> **SMILES:** C#Cc1c(F)cc(Cl)cc1F **Molecular Formula:** C8H3ClF2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2477>.
CC(C)Cn1ccc(B2OC(C)(C)C(C)(C)O2)n1
What is the building block token for the following molecule?
CC(C)Cn1ccc(B2OC(C)(C)C(C)(C)O2)n1
<BB_2477>
What is the molecular formula for <BB_2477>?
The molecular formula for <BB_2477> (CC(C)Cn1ccc(B2OC(C)(C)C(C)(C)O2)n1) is C13H23BN2O2.
Describe the ring structures in building block <BB_2477>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2477>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2477>.
**Token:** <BB_2477> **SMILES:** CC(C)Cn1ccc(B2OC(C)(C)C(C)(C)O2)n1 **Molecular Formula:** C13H23BN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2478>.
CC(C)(C#N)CN
What is the building block token for the following molecule?
CC(C)(C#N)CN
<BB_2478>
What is the molecular formula for <BB_2478>?
The molecular formula for <BB_2478> (CC(C)(C#N)CN) is C5H10N2.
Describe the ring structures in building block <BB_2478>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2478>.
The molecule contains the following groups: Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2478>.
**Token:** <BB_2478> **SMILES:** CC(C)(C#N)CN **Molecular Formula:** C5H10N2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Nitrile
Provide the SMILES representation for the building block token <BB_2479>.
CC(C)(C(=O)O)N1CCOCC1=O
What is the building block token for the following molecule?
CC(C)(C(=O)O)N1CCOCC1=O
<BB_2479>
What is the molecular formula for <BB_2479>?
The molecular formula for <BB_2479> (CC(C)(C(=O)O)N1CCOCC1=O) is C8H13NO4.
Describe the ring structures in building block <BB_2479>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2479>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2479>.
**Token:** <BB_2479> **SMILES:** CC(C)(C(=O)O)N1CCOCC1=O **Molecular Formula:** C8H13NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2480>.
CS(=O)(=O)CCCCCO
What is the building block token for the following molecule?
CS(=O)(=O)CCCCCO
<BB_2480>
What is the molecular formula for <BB_2480>?
The molecular formula for <BB_2480> (CS(=O)(=O)CCCCCO) is C6H14O3S.
Describe the ring structures in building block <BB_2480>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2480>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2480>.
**Token:** <BB_2480> **SMILES:** CS(=O)(=O)CCCCCO **Molecular Formula:** C6H14O3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2481>.
O=C(O)c1cccc2nccnc12
What is the building block token for the following molecule?
O=C(O)c1cccc2nccnc12
<BB_2481>
What is the molecular formula for <BB_2481>?
The molecular formula for <BB_2481> (O=C(O)c1cccc2nccnc12) is C9H6N2O2.
Describe the ring structures in building block <BB_2481>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2481>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2481>.
**Token:** <BB_2481> **SMILES:** O=C(O)c1cccc2nccnc12 **Molecular Formula:** C9H6N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2482>.
CC(O)CCl
What is the building block token for the following molecule?
CC(O)CCl
<BB_2482>
What is the molecular formula for <BB_2482>?
The molecular formula for <BB_2482> (CC(O)CCl) is C3H7ClO.
Describe the ring structures in building block <BB_2482>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2482>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2482>.
**Token:** <BB_2482> **SMILES:** CC(O)CCl **Molecular Formula:** C3H7ClO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2483>.
Nc1cc(Br)cc2c1OCO2
What is the building block token for the following molecule?
Nc1cc(Br)cc2c1OCO2
<BB_2483>