instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2483>?
The molecular formula for <BB_2483> (Nc1cc(Br)cc2c1OCO2) is C7H6BrNO2.
Describe the ring structures in building block <BB_2483>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2483>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2483>.
**Token:** <BB_2483> **SMILES:** Nc1cc(Br)cc2c1OCO2 **Molecular Formula:** C7H6BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2484>.
OC[C@H](O)Cc1ccccc1
What is the building block token for the following molecule?
OC[C@H](O)Cc1ccccc1
<BB_2484>
What is the molecular formula for <BB_2484>?
The molecular formula for <BB_2484> (OC[C@H](O)Cc1ccccc1) is C9H12O2.
Describe the ring structures in building block <BB_2484>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2484>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2484>.
**Token:** <BB_2484> **SMILES:** OC[C@H](O)Cc1ccccc1 **Molecular Formula:** C9H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2485>.
CC(=O)c1c(C2CC2)cnn1C
What is the building block token for the following molecule?
CC(=O)c1c(C2CC2)cnn1C
<BB_2485>
What is the molecular formula for <BB_2485>?
The molecular formula for <BB_2485> (CC(=O)c1c(C2CC2)cnn1C) is C9H12N2O.
Describe the ring structures in building block <BB_2485>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2485>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2485>.
**Token:** <BB_2485> **SMILES:** CC(=O)c1c(C2CC2)cnn1C **Molecular Formula:** C9H12N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2486>.
Cn1ccnc(Cl)c1=O
What is the building block token for the following molecule?
Cn1ccnc(Cl)c1=O
<BB_2486>
What is the molecular formula for <BB_2486>?
The molecular formula for <BB_2486> (Cn1ccnc(Cl)c1=O) is C5H5ClN2O.
Describe the ring structures in building block <BB_2486>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2486>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2486>.
**Token:** <BB_2486> **SMILES:** Cn1ccnc(Cl)c1=O **Molecular Formula:** C5H5ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2487>.
CC(C)(N)c1nnn[nH]1.Cl
What is the building block token for the following molecule?
CC(C)(N)c1nnn[nH]1.Cl
<BB_2487>
What is the molecular formula for <BB_2487>?
The molecular formula for <BB_2487> (CC(C)(N)c1nnn[nH]1.Cl) is C4H10ClN5.
Describe the ring structures in building block <BB_2487>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2487>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2487>.
**Token:** <BB_2487> **SMILES:** CC(C)(N)c1nnn[nH]1.Cl **Molecular Formula:** C4H10ClN5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2488>.
Cc1cnc2c(C(=O)O)cccc2c1
What is the building block token for the following molecule?
Cc1cnc2c(C(=O)O)cccc2c1
<BB_2488>
What is the molecular formula for <BB_2488>?
The molecular formula for <BB_2488> (Cc1cnc2c(C(=O)O)cccc2c1) is C11H9NO2.
Describe the ring structures in building block <BB_2488>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2488>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2488>.
**Token:** <BB_2488> **SMILES:** Cc1cnc2c(C(=O)O)cccc2c1 **Molecular Formula:** C11H9NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2489>.
O=C(O)c1cnccc1Br
What is the building block token for the following molecule?
O=C(O)c1cnccc1Br
<BB_2489>
What is the molecular formula for <BB_2489>?
The molecular formula for <BB_2489> (O=C(O)c1cnccc1Br) is C6H4BrNO2.
Describe the ring structures in building block <BB_2489>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2489>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2489>.
**Token:** <BB_2489> **SMILES:** O=C(O)c1cnccc1Br **Molecular Formula:** C6H4BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2490>.
CC1(C)CCC1CBr
What is the building block token for the following molecule?
CC1(C)CCC1CBr
<BB_2490>
What is the molecular formula for <BB_2490>?
The molecular formula for <BB_2490> (CC1(C)CCC1CBr) is C7H13Br.
Describe the ring structures in building block <BB_2490>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2490>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2490>.
**Token:** <BB_2490> **SMILES:** CC1(C)CCC1CBr **Molecular Formula:** C7H13Br **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2491>.
CC(CN)CC1CCC1.Cl
What is the building block token for the following molecule?
CC(CN)CC1CCC1.Cl
<BB_2491>
What is the molecular formula for <BB_2491>?
The molecular formula for <BB_2491> (CC(CN)CC1CCC1.Cl) is C8H18ClN.
Describe the ring structures in building block <BB_2491>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2491>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2491>.
**Token:** <BB_2491> **SMILES:** CC(CN)CC1CCC1.Cl **Molecular Formula:** C8H18ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2492>.
Cl.Cl.c1ccn2c(CC3CCCNC3)nnc2c1
What is the building block token for the following molecule?
Cl.Cl.c1ccn2c(CC3CCCNC3)nnc2c1
<BB_2492>
What is the molecular formula for <BB_2492>?
The molecular formula for <BB_2492> (Cl.Cl.c1ccn2c(CC3CCCNC3)nnc2c1) is C12H18Cl2N4.
Describe the ring structures in building block <BB_2492>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2492>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2492>.
**Token:** <BB_2492> **SMILES:** Cl.Cl.c1ccn2c(CC3CCCNC3)nnc2c1 **Molecular Formula:** C12H18Cl2N4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2493>.
CC(C)(C)OC(=O)CCOCC=O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)CCOCC=O
<BB_2493>
What is the molecular formula for <BB_2493>?
The molecular formula for <BB_2493> (CC(C)(C)OC(=O)CCOCC=O) is C9H16O4.
Describe the ring structures in building block <BB_2493>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2493>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2493>.
**Token:** <BB_2493> **SMILES:** CC(C)(C)OC(=O)CCOCC=O **Molecular Formula:** C9H16O4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2494>.
Cc1ccc(F)cc1C
What is the building block token for the following molecule?
Cc1ccc(F)cc1C
<BB_2494>
What is the molecular formula for <BB_2494>?
The molecular formula for <BB_2494> (Cc1ccc(F)cc1C) is C8H9F.
Describe the ring structures in building block <BB_2494>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2494>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2494>.
**Token:** <BB_2494> **SMILES:** Cc1ccc(F)cc1C **Molecular Formula:** C8H9F **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2495>.
CN(C)c1cc(C(F)(F)F)ccc1C=O
What is the building block token for the following molecule?
CN(C)c1cc(C(F)(F)F)ccc1C=O
<BB_2495>
What is the molecular formula for <BB_2495>?
The molecular formula for <BB_2495> (CN(C)c1cc(C(F)(F)F)ccc1C=O) is C10H10F3NO.
Describe the ring structures in building block <BB_2495>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2495>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2495>.
**Token:** <BB_2495> **SMILES:** CN(C)c1cc(C(F)(F)F)ccc1C=O **Molecular Formula:** C10H10F3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2496>.
CC(C)(C)OC(=O)NC(C)(C)C1CCNC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(C)(C)C1CCNC1
<BB_2496>
What is the molecular formula for <BB_2496>?
The molecular formula for <BB_2496> (CC(C)(C)OC(=O)NC(C)(C)C1CCNC1) is C12H24N2O2.
Describe the ring structures in building block <BB_2496>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2496>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2496>.
**Token:** <BB_2496> **SMILES:** CC(C)(C)OC(=O)NC(C)(C)C1CCNC1 **Molecular Formula:** C12H24N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2497>.
N#Cc1ccc(-c2cccc(CO)c2)s1
What is the building block token for the following molecule?
N#Cc1ccc(-c2cccc(CO)c2)s1
<BB_2497>
What is the molecular formula for <BB_2497>?
The molecular formula for <BB_2497> (N#Cc1ccc(-c2cccc(CO)c2)s1) is C12H9NOS.
Describe the ring structures in building block <BB_2497>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2497>.
The molecule contains the following groups: Alcohol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2497>.
**Token:** <BB_2497> **SMILES:** N#Cc1ccc(-c2cccc(CO)c2)s1 **Molecular Formula:** C12H9NOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Nitrile
Provide the SMILES representation for the building block token <BB_2498>.
Cc1ncc(F)cc1C(=O)O.Cl
What is the building block token for the following molecule?
Cc1ncc(F)cc1C(=O)O.Cl
<BB_2498>
What is the molecular formula for <BB_2498>?
The molecular formula for <BB_2498> (Cc1ncc(F)cc1C(=O)O.Cl) is C7H7ClFNO2.
Describe the ring structures in building block <BB_2498>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2498>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2498>.
**Token:** <BB_2498> **SMILES:** Cc1ncc(F)cc1C(=O)O.Cl **Molecular Formula:** C7H7ClFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2499>.
N#CC1(c2ccc(C=O)cc2)CC1
What is the building block token for the following molecule?
N#CC1(c2ccc(C=O)cc2)CC1
<BB_2499>
What is the molecular formula for <BB_2499>?
The molecular formula for <BB_2499> (N#CC1(c2ccc(C=O)cc2)CC1) is C11H9NO.
Describe the ring structures in building block <BB_2499>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2499>.
The molecule contains the following groups: Aldehyde, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2499>.
**Token:** <BB_2499> **SMILES:** N#CC1(c2ccc(C=O)cc2)CC1 **Molecular Formula:** C11H9NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Aldehyde, Nitrile