instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2500>.
CCc1nc(C2(N)CCCC2)no1.Cl
What is the building block token for the following molecule?
CCc1nc(C2(N)CCCC2)no1.Cl
<BB_2500>
What is the molecular formula for <BB_2500>?
The molecular formula for <BB_2500> (CCc1nc(C2(N)CCCC2)no1.Cl) is C9H16ClN3O.
Describe the ring structures in building block <BB_2500>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2500>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2500>.
**Token:** <BB_2500> **SMILES:** CCc1nc(C2(N)CCCC2)no1.Cl **Molecular Formula:** C9H16ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2501>.
CC(C)c1n[nH]c(C(F)F)n1
What is the building block token for the following molecule?
CC(C)c1n[nH]c(C(F)F)n1
<BB_2501>
What is the molecular formula for <BB_2501>?
The molecular formula for <BB_2501> (CC(C)c1n[nH]c(C(F)F)n1) is C6H9F2N3.
Describe the ring structures in building block <BB_2501>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2501>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2501>.
**Token:** <BB_2501> **SMILES:** CC(C)c1n[nH]c(C(F)F)n1 **Molecular Formula:** C6H9F2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2502>.
CC(C)(C)OC(=O)NCc1ccc(C#N)s1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCc1ccc(C#N)s1
<BB_2502>
What is the molecular formula for <BB_2502>?
The molecular formula for <BB_2502> (CC(C)(C)OC(=O)NCc1ccc(C#N)s1) is C11H14N2O2S.
Describe the ring structures in building block <BB_2502>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2502>.
The molecule contains the following groups: Amide, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2502>.
**Token:** <BB_2502> **SMILES:** CC(C)(C)OC(=O)NCc1ccc(C#N)s1 **Molecular Formula:** C11H14N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2503>.
CCC(CN)N(C)C.Cl.Cl
What is the building block token for the following molecule?
CCC(CN)N(C)C.Cl.Cl
<BB_2503>
What is the molecular formula for <BB_2503>?
The molecular formula for <BB_2503> (CCC(CN)N(C)C.Cl.Cl) is C6H18Cl2N2.
Describe the ring structures in building block <BB_2503>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2503>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2503>.
**Token:** <BB_2503> **SMILES:** CCC(CN)N(C)C.Cl.Cl **Molecular Formula:** C6H18Cl2N2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2504>.
CNc1ccc2c(c1)OC(F)(F)O2.Cl
What is the building block token for the following molecule?
CNc1ccc2c(c1)OC(F)(F)O2.Cl
<BB_2504>
What is the molecular formula for <BB_2504>?
The molecular formula for <BB_2504> (CNc1ccc2c(c1)OC(F)(F)O2.Cl) is C8H8ClF2NO2.
Describe the ring structures in building block <BB_2504>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2504>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2504>.
**Token:** <BB_2504> **SMILES:** CNc1ccc2c(c1)OC(F)(F)O2.Cl **Molecular Formula:** C8H8ClF2NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2505>.
NCc1cc(Br)cc(Cl)c1F
What is the building block token for the following molecule?
NCc1cc(Br)cc(Cl)c1F
<BB_2505>
What is the molecular formula for <BB_2505>?
The molecular formula for <BB_2505> (NCc1cc(Br)cc(Cl)c1F) is C7H6BrClFN.
Describe the ring structures in building block <BB_2505>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2505>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2505>.
**Token:** <BB_2505> **SMILES:** NCc1cc(Br)cc(Cl)c1F **Molecular Formula:** C7H6BrClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2506>.
Cl.Cl.NCC12CCCC(CN1)C2
What is the building block token for the following molecule?
Cl.Cl.NCC12CCCC(CN1)C2
<BB_2506>
What is the molecular formula for <BB_2506>?
The molecular formula for <BB_2506> (Cl.Cl.NCC12CCCC(CN1)C2) is C8H18Cl2N2.
Describe the ring structures in building block <BB_2506>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2506>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2506>.
**Token:** <BB_2506> **SMILES:** Cl.Cl.NCC12CCCC(CN1)C2 **Molecular Formula:** C8H18Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2507>.
BrCCCC1CC1
What is the building block token for the following molecule?
BrCCCC1CC1
<BB_2507>
What is the molecular formula for <BB_2507>?
The molecular formula for <BB_2507> (BrCCCC1CC1) is C6H11Br.
Describe the ring structures in building block <BB_2507>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2507>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2507>.
**Token:** <BB_2507> **SMILES:** BrCCCC1CC1 **Molecular Formula:** C6H11Br **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2508>.
CC(C)(C)OC(=O)N1C[C@@H](F)CC1C#N
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C[C@@H](F)CC1C#N
<BB_2508>
What is the molecular formula for <BB_2508>?
The molecular formula for <BB_2508> (CC(C)(C)OC(=O)N1C[C@@H](F)CC1C#N) is C10H15FN2O2.
Describe the ring structures in building block <BB_2508>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2508>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2508>.
**Token:** <BB_2508> **SMILES:** CC(C)(C)OC(=O)N1C[C@@H](F)CC1C#N **Molecular Formula:** C10H15FN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2509>.
CCC(CNC)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
CCC(CNC)NC(=O)OC(C)(C)C
<BB_2509>
What is the molecular formula for <BB_2509>?
The molecular formula for <BB_2509> (CCC(CNC)NC(=O)OC(C)(C)C) is C10H22N2O2.
Describe the ring structures in building block <BB_2509>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2509>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2509>.
**Token:** <BB_2509> **SMILES:** CCC(CNC)NC(=O)OC(C)(C)C **Molecular Formula:** C10H22N2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2510>.
CCC1(C(=O)O)CCC(F)(F)C1
What is the building block token for the following molecule?
CCC1(C(=O)O)CCC(F)(F)C1
<BB_2510>
What is the molecular formula for <BB_2510>?
The molecular formula for <BB_2510> (CCC1(C(=O)O)CCC(F)(F)C1) is C8H12F2O2.
Describe the ring structures in building block <BB_2510>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2510>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2510>.
**Token:** <BB_2510> **SMILES:** CCC1(C(=O)O)CCC(F)(F)C1 **Molecular Formula:** C8H12F2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2511>.
O=C(O)c1cnn2c1COCC2
What is the building block token for the following molecule?
O=C(O)c1cnn2c1COCC2
<BB_2511>
What is the molecular formula for <BB_2511>?
The molecular formula for <BB_2511> (O=C(O)c1cnn2c1COCC2) is C7H8N2O3.
Describe the ring structures in building block <BB_2511>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2511>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2511>.
**Token:** <BB_2511> **SMILES:** O=C(O)c1cnn2c1COCC2 **Molecular Formula:** C7H8N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2512>.
CC(C)CC1OCCCC1N.Cl
What is the building block token for the following molecule?
CC(C)CC1OCCCC1N.Cl
<BB_2512>
What is the molecular formula for <BB_2512>?
The molecular formula for <BB_2512> (CC(C)CC1OCCCC1N.Cl) is C9H20ClNO.
Describe the ring structures in building block <BB_2512>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2512>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2512>.
**Token:** <BB_2512> **SMILES:** CC(C)CC1OCCCC1N.Cl **Molecular Formula:** C9H20ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2513>.
Nc1cccc(OCC2CC2)c1
What is the building block token for the following molecule?
Nc1cccc(OCC2CC2)c1
<BB_2513>
What is the molecular formula for <BB_2513>?
The molecular formula for <BB_2513> (Nc1cccc(OCC2CC2)c1) is C10H13NO.
Describe the ring structures in building block <BB_2513>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2513>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2513>.
**Token:** <BB_2513> **SMILES:** Nc1cccc(OCC2CC2)c1 **Molecular Formula:** C10H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2514>.
O=C(O)c1ncc(Cl)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
O=C(O)c1ncc(Cl)cc1[N+](=O)[O-]
<BB_2514>
What is the molecular formula for <BB_2514>?
The molecular formula for <BB_2514> (O=C(O)c1ncc(Cl)cc1[N+](=O)[O-]) is C6H3ClN2O4.
Describe the ring structures in building block <BB_2514>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2514>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2514>.
**Token:** <BB_2514> **SMILES:** O=C(O)c1ncc(Cl)cc1[N+](=O)[O-] **Molecular Formula:** C6H3ClN2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2515>.
O=C(O)[C@@H]1Cc2ccccc2O[C@H]1C(F)F
What is the building block token for the following molecule?
O=C(O)[C@@H]1Cc2ccccc2O[C@H]1C(F)F
<BB_2515>
What is the molecular formula for <BB_2515>?
The molecular formula for <BB_2515> (O=C(O)[C@@H]1Cc2ccccc2O[C@H]1C(F)F) is C11H10F2O3.
Describe the ring structures in building block <BB_2515>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2515>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2515>.
**Token:** <BB_2515> **SMILES:** O=C(O)[C@@H]1Cc2ccccc2O[C@H]1C(F)F **Molecular Formula:** C11H10F2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2516>.
CC(N)c1cc2c(s1)CCCC2.Cl
What is the building block token for the following molecule?
CC(N)c1cc2c(s1)CCCC2.Cl
<BB_2516>
What is the molecular formula for <BB_2516>?
The molecular formula for <BB_2516> (CC(N)c1cc2c(s1)CCCC2.Cl) is C10H16ClNS.
Describe the ring structures in building block <BB_2516>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.