instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2516>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2516>.
**Token:** <BB_2516> **SMILES:** CC(N)c1cc2c(s1)CCCC2.Cl **Molecular Formula:** C10H16ClNS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2517>.
Cl.O=C(N1CCCCC1)N1CCNCC1
What is the building block token for the following molecule?
Cl.O=C(N1CCCCC1)N1CCNCC1
<BB_2517>
What is the molecular formula for <BB_2517>?
The molecular formula for <BB_2517> (Cl.O=C(N1CCCCC1)N1CCNCC1) is C10H20ClN3O.
Describe the ring structures in building block <BB_2517>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2517>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2517>.
**Token:** <BB_2517> **SMILES:** Cl.O=C(N1CCCCC1)N1CCNCC1 **Molecular Formula:** C10H20ClN3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2518>.
C#CCOC(C)CN.Cl
What is the building block token for the following molecule?
C#CCOC(C)CN.Cl
<BB_2518>
What is the molecular formula for <BB_2518>?
The molecular formula for <BB_2518> (C#CCOC(C)CN.Cl) is C6H12ClNO.
Describe the ring structures in building block <BB_2518>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2518>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2518>.
**Token:** <BB_2518> **SMILES:** C#CCOC(C)CN.Cl **Molecular Formula:** C6H12ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2519>.
CCOC(=O)CC1CCNC1(C)C.Cl
What is the building block token for the following molecule?
CCOC(=O)CC1CCNC1(C)C.Cl
<BB_2519>
What is the molecular formula for <BB_2519>?
The molecular formula for <BB_2519> (CCOC(=O)CC1CCNC1(C)C.Cl) is C10H20ClNO2.
Describe the ring structures in building block <BB_2519>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2519>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2519>.
**Token:** <BB_2519> **SMILES:** CCOC(=O)CC1CCNC1(C)C.Cl **Molecular Formula:** C10H20ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2520>.
Cc1cnncc1CN.Cl.Cl
What is the building block token for the following molecule?
Cc1cnncc1CN.Cl.Cl
<BB_2520>
What is the molecular formula for <BB_2520>?
The molecular formula for <BB_2520> (Cc1cnncc1CN.Cl.Cl) is C6H11Cl2N3.
Describe the ring structures in building block <BB_2520>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2520>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2520>.
**Token:** <BB_2520> **SMILES:** Cc1cnncc1CN.Cl.Cl **Molecular Formula:** C6H11Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2521>.
Cc1cc(CS(N)(=O)=O)ccc1Br
What is the building block token for the following molecule?
Cc1cc(CS(N)(=O)=O)ccc1Br
<BB_2521>
What is the molecular formula for <BB_2521>?
The molecular formula for <BB_2521> (Cc1cc(CS(N)(=O)=O)ccc1Br) is C8H10BrNO2S.
Describe the ring structures in building block <BB_2521>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2521>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2521>.
**Token:** <BB_2521> **SMILES:** Cc1cc(CS(N)(=O)=O)ccc1Br **Molecular Formula:** C8H10BrNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2522>.
CS(=O)(=O)c1ccc(=O)[nH]c1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(=O)[nH]c1
<BB_2522>
What is the molecular formula for <BB_2522>?
The molecular formula for <BB_2522> (CS(=O)(=O)c1ccc(=O)[nH]c1) is C6H7NO3S.
Describe the ring structures in building block <BB_2522>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2522>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2522>.
**Token:** <BB_2522> **SMILES:** CS(=O)(=O)c1ccc(=O)[nH]c1 **Molecular Formula:** C6H7NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2523>.
O=C(O)[C@H]1C[C@H](OC(F)(F)F)C1
What is the building block token for the following molecule?
O=C(O)[C@H]1C[C@H](OC(F)(F)F)C1
<BB_2523>
What is the molecular formula for <BB_2523>?
The molecular formula for <BB_2523> (O=C(O)[C@H]1C[C@H](OC(F)(F)F)C1) is C6H7F3O3.
Describe the ring structures in building block <BB_2523>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2523>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2523>.
**Token:** <BB_2523> **SMILES:** O=C(O)[C@H]1C[C@H](OC(F)(F)F)C1 **Molecular Formula:** C6H7F3O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2524>.
C[C@@H](CC(F)(F)F)C(=O)O
What is the building block token for the following molecule?
C[C@@H](CC(F)(F)F)C(=O)O
<BB_2524>
What is the molecular formula for <BB_2524>?
The molecular formula for <BB_2524> (C[C@@H](CC(F)(F)F)C(=O)O) is C5H7F3O2.
Describe the ring structures in building block <BB_2524>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2524>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2524>.
**Token:** <BB_2524> **SMILES:** C[C@@H](CC(F)(F)F)C(=O)O **Molecular Formula:** C5H7F3O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2525>.
Cc1cc(Br)cc([C@@H]2C[C@H]2C(=O)O)c1
What is the building block token for the following molecule?
Cc1cc(Br)cc([C@@H]2C[C@H]2C(=O)O)c1
<BB_2525>
What is the molecular formula for <BB_2525>?
The molecular formula for <BB_2525> (Cc1cc(Br)cc([C@@H]2C[C@H]2C(=O)O)c1) is C11H11BrO2.
Describe the ring structures in building block <BB_2525>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2525>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2525>.
**Token:** <BB_2525> **SMILES:** Cc1cc(Br)cc([C@@H]2C[C@H]2C(=O)O)c1 **Molecular Formula:** C11H11BrO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2526>.
O=C(O)c1cc(S(=O)(=O)CC2CC2)ccc1F
What is the building block token for the following molecule?
O=C(O)c1cc(S(=O)(=O)CC2CC2)ccc1F
<BB_2526>
What is the molecular formula for <BB_2526>?
The molecular formula for <BB_2526> (O=C(O)c1cc(S(=O)(=O)CC2CC2)ccc1F) is C11H11FO4S.
Describe the ring structures in building block <BB_2526>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2526>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2526>.
**Token:** <BB_2526> **SMILES:** O=C(O)c1cc(S(=O)(=O)CC2CC2)ccc1F **Molecular Formula:** C11H11FO4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2527>.
C[C@H](N)c1cc(Cl)cc(C(F)(F)F)c1.Cl
What is the building block token for the following molecule?
C[C@H](N)c1cc(Cl)cc(C(F)(F)F)c1.Cl
<BB_2527>
What is the molecular formula for <BB_2527>?
The molecular formula for <BB_2527> (C[C@H](N)c1cc(Cl)cc(C(F)(F)F)c1.Cl) is C9H10Cl2F3N.
Describe the ring structures in building block <BB_2527>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2527>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2527>.
**Token:** <BB_2527> **SMILES:** C[C@H](N)c1cc(Cl)cc(C(F)(F)F)c1.Cl **Molecular Formula:** C9H10Cl2F3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2528>.
FC(F)COc1ccnc(Cl)c1
What is the building block token for the following molecule?
FC(F)COc1ccnc(Cl)c1
<BB_2528>
What is the molecular formula for <BB_2528>?
The molecular formula for <BB_2528> (FC(F)COc1ccnc(Cl)c1) is C7H6ClF2NO.
Describe the ring structures in building block <BB_2528>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2528>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2528>.
**Token:** <BB_2528> **SMILES:** FC(F)COc1ccnc(Cl)c1 **Molecular Formula:** C7H6ClF2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2529>.
CCn1cc(CCl)nn1
What is the building block token for the following molecule?
CCn1cc(CCl)nn1
<BB_2529>
What is the molecular formula for <BB_2529>?
The molecular formula for <BB_2529> (CCn1cc(CCl)nn1) is C5H8ClN3.
Describe the ring structures in building block <BB_2529>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2529>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2529>.
**Token:** <BB_2529> **SMILES:** CCn1cc(CCl)nn1 **Molecular Formula:** C5H8ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2530>.
Cl.O=C(O)C1(C2CCNCC2)CCOCC1
What is the building block token for the following molecule?
Cl.O=C(O)C1(C2CCNCC2)CCOCC1
<BB_2530>
What is the molecular formula for <BB_2530>?
The molecular formula for <BB_2530> (Cl.O=C(O)C1(C2CCNCC2)CCOCC1) is C11H20ClNO3.
Describe the ring structures in building block <BB_2530>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2530>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2530>.
**Token:** <BB_2530> **SMILES:** Cl.O=C(O)C1(C2CCNCC2)CCOCC1 **Molecular Formula:** C11H20ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2531>.
N#CCCOc1ccccc1
What is the building block token for the following molecule?
N#CCCOc1ccccc1
<BB_2531>
What is the molecular formula for <BB_2531>?
The molecular formula for <BB_2531> (N#CCCOc1ccccc1) is C9H9NO.
Describe the ring structures in building block <BB_2531>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2531>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2531>.
**Token:** <BB_2531> **SMILES:** N#CCCOc1ccccc1 **Molecular Formula:** C9H9NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2532>.
C[C@@H]1O[C@@H]1P(=O)([O-])[O-].[Ca+2]
What is the building block token for the following molecule?
C[C@@H]1O[C@@H]1P(=O)([O-])[O-].[Ca+2]
<BB_2532>
What is the molecular formula for <BB_2532>?
The molecular formula for <BB_2532> (C[C@@H]1O[C@@H]1P(=O)([O-])[O-].[Ca+2]) is C3H5CaO4P.
Describe the ring structures in building block <BB_2532>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2532>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2532>.
**Token:** <BB_2532> **SMILES:** C[C@@H]1O[C@@H]1P(=O)([O-])[O-].[Ca+2] **Molecular Formula:** C3H5CaO4P **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2533>.
O=Cc1cccc(F)c1Br
What is the building block token for the following molecule?
O=Cc1cccc(F)c1Br
<BB_2533>