instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_283>?
The molecular formula for <BB_283> (CC(C)(C)OC(=O)NCCCCCCCCCBr) is C14H28BrNO2.
Describe the ring structures in building block <BB_283>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_283>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_283>.
**Token:** <BB_283> **SMILES:** CC(C)(C)OC(=O)NCCCCCCCCCBr **Molecular Formula:** C14H28BrNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_284>.
O=C1COc2c1ccc(Cl)c2Cl
What is the building block token for the following molecule?
O=C1COc2c1ccc(Cl)c2Cl
<BB_284>
What is the molecular formula for <BB_284>?
The molecular formula for <BB_284> (O=C1COc2c1ccc(Cl)c2Cl) is C8H4Cl2O2.
Describe the ring structures in building block <BB_284>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_284>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_284>.
**Token:** <BB_284> **SMILES:** O=C1COc2c1ccc(Cl)c2Cl **Molecular Formula:** C8H4Cl2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_285>.
N#CC1CCCCC(O)C1
What is the building block token for the following molecule?
N#CC1CCCCC(O)C1
<BB_285>
What is the molecular formula for <BB_285>?
The molecular formula for <BB_285> (N#CC1CCCCC(O)C1) is C8H13NO.
Describe the ring structures in building block <BB_285>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_285>.
The molecule contains the following groups: Alcohol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_285>.
**Token:** <BB_285> **SMILES:** N#CC1CCCCC(O)C1 **Molecular Formula:** C8H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Alcohol, Nitrile
Provide the SMILES representation for the building block token <BB_286>.
Oc1ccc(Br)c2cnoc12
What is the building block token for the following molecule?
Oc1ccc(Br)c2cnoc12
<BB_286>
What is the molecular formula for <BB_286>?
The molecular formula for <BB_286> (Oc1ccc(Br)c2cnoc12) is C7H4BrNO2.
Describe the ring structures in building block <BB_286>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_286>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_286>.
**Token:** <BB_286> **SMILES:** Oc1ccc(Br)c2cnoc12 **Molecular Formula:** C7H4BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_287>.
Cc1nn(Cc2ccccc2)c(Cl)c1CCl
What is the building block token for the following molecule?
Cc1nn(Cc2ccccc2)c(Cl)c1CCl
<BB_287>
What is the molecular formula for <BB_287>?
The molecular formula for <BB_287> (Cc1nn(Cc2ccccc2)c(Cl)c1CCl) is C12H12Cl2N2.
Describe the ring structures in building block <BB_287>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_287>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_287>.
**Token:** <BB_287> **SMILES:** Cc1nn(Cc2ccccc2)c(Cl)c1CCl **Molecular Formula:** C12H12Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_288>.
Cc1cc(SC#N)cc(C)c1NC(=O)CCl
What is the building block token for the following molecule?
Cc1cc(SC#N)cc(C)c1NC(=O)CCl
<BB_288>
What is the molecular formula for <BB_288>?
The molecular formula for <BB_288> (Cc1cc(SC#N)cc(C)c1NC(=O)CCl) is C11H11ClN2OS.
Describe the ring structures in building block <BB_288>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_288>.
The molecule contains the following groups: Amide, Sulfide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_288>.
**Token:** <BB_288> **SMILES:** Cc1cc(SC#N)cc(C)c1NC(=O)CCl **Molecular Formula:** C11H11ClN2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Sulfide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_289>.
COCCCC(N)c1cccnc1
What is the building block token for the following molecule?
COCCCC(N)c1cccnc1
<BB_289>
What is the molecular formula for <BB_289>?
The molecular formula for <BB_289> (COCCCC(N)c1cccnc1) is C10H16N2O.
Describe the ring structures in building block <BB_289>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_289>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_289>.
**Token:** <BB_289> **SMILES:** COCCCC(N)c1cccnc1 **Molecular Formula:** C10H16N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_290>.
CC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1
What is the building block token for the following molecule?
CC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1
<BB_290>
What is the molecular formula for <BB_290>?
The molecular formula for <BB_290> (CC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1) is C10H8N2O3.
Describe the ring structures in building block <BB_290>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_290>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_290>.
**Token:** <BB_290> **SMILES:** CC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 **Molecular Formula:** C10H8N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_291>.
Cc1nn(C)c(C)c1C=O
What is the building block token for the following molecule?
Cc1nn(C)c(C)c1C=O
<BB_291>
What is the molecular formula for <BB_291>?
The molecular formula for <BB_291> (Cc1nn(C)c(C)c1C=O) is C7H10N2O.
Describe the ring structures in building block <BB_291>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_291>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_291>.
**Token:** <BB_291> **SMILES:** Cc1nn(C)c(C)c1C=O **Molecular Formula:** C7H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_292>.
COc1nccnc1CC(=O)[O-].[Na+]
What is the building block token for the following molecule?
COc1nccnc1CC(=O)[O-].[Na+]
<BB_292>
What is the molecular formula for <BB_292>?
The molecular formula for <BB_292> (COc1nccnc1CC(=O)[O-].[Na+]) is C7H7N2NaO3.
Describe the ring structures in building block <BB_292>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_292>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_292>.
**Token:** <BB_292> **SMILES:** COc1nccnc1CC(=O)[O-].[Na+] **Molecular Formula:** C7H7N2NaO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_293>.
CS(=O)(=O)Nc1ccc(N2CCNCC2)cc1.Cl
What is the building block token for the following molecule?
CS(=O)(=O)Nc1ccc(N2CCNCC2)cc1.Cl
<BB_293>
What is the molecular formula for <BB_293>?
The molecular formula for <BB_293> (CS(=O)(=O)Nc1ccc(N2CCNCC2)cc1.Cl) is C11H18ClN3O2S.
Describe the ring structures in building block <BB_293>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_293>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_293>.
**Token:** <BB_293> **SMILES:** CS(=O)(=O)Nc1ccc(N2CCNCC2)cc1.Cl **Molecular Formula:** C11H18ClN3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_294>.
CC(C)(C)OC(=O)Nc1cccc(CCCN)c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1cccc(CCCN)c1
<BB_294>
What is the molecular formula for <BB_294>?
The molecular formula for <BB_294> (CC(C)(C)OC(=O)Nc1cccc(CCCN)c1) is C14H22N2O2.
Describe the ring structures in building block <BB_294>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_294>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_294>.
**Token:** <BB_294> **SMILES:** CC(C)(C)OC(=O)Nc1cccc(CCCN)c1 **Molecular Formula:** C14H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_295>.
CCOC(=O)C1(C(=O)O)CC1(C)C
What is the building block token for the following molecule?
CCOC(=O)C1(C(=O)O)CC1(C)C
<BB_295>
What is the molecular formula for <BB_295>?
The molecular formula for <BB_295> (CCOC(=O)C1(C(=O)O)CC1(C)C) is C9H14O4.
Describe the ring structures in building block <BB_295>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_295>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_295>.
**Token:** <BB_295> **SMILES:** CCOC(=O)C1(C(=O)O)CC1(C)C **Molecular Formula:** C9H14O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_296>.
Nc1ccn(C[C@H](O)CO)c(=O)n1
What is the building block token for the following molecule?
Nc1ccn(C[C@H](O)CO)c(=O)n1
<BB_296>
What is the molecular formula for <BB_296>?
The molecular formula for <BB_296> (Nc1ccn(C[C@H](O)CO)c(=O)n1) is C7H11N3O3.
Describe the ring structures in building block <BB_296>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_296>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_296>.
**Token:** <BB_296> **SMILES:** Nc1ccn(C[C@H](O)CO)c(=O)n1 **Molecular Formula:** C7H11N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_297>.
CCc1cc(N)c(C(=O)O)c(F)c1
What is the building block token for the following molecule?
CCc1cc(N)c(C(=O)O)c(F)c1
<BB_297>
What is the molecular formula for <BB_297>?
The molecular formula for <BB_297> (CCc1cc(N)c(C(=O)O)c(F)c1) is C9H10FNO2.
Describe the ring structures in building block <BB_297>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_297>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_297>.
**Token:** <BB_297> **SMILES:** CCc1cc(N)c(C(=O)O)c(F)c1 **Molecular Formula:** C9H10FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_298>.
COC1(C(F)F)CC2(CNC2)C1.Cl
What is the building block token for the following molecule?
COC1(C(F)F)CC2(CNC2)C1.Cl
<BB_298>
What is the molecular formula for <BB_298>?
The molecular formula for <BB_298> (COC1(C(F)F)CC2(CNC2)C1.Cl) is C8H14ClF2NO.
Describe the ring structures in building block <BB_298>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_298>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_298>.
**Token:** <BB_298> **SMILES:** COC1(C(F)F)CC2(CNC2)C1.Cl **Molecular Formula:** C8H14ClF2NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_299>.
Cl.OC[C@]12CNC[C@H]1C2
What is the building block token for the following molecule?
Cl.OC[C@]12CNC[C@H]1C2
<BB_299>
What is the molecular formula for <BB_299>?
The molecular formula for <BB_299> (Cl.OC[C@]12CNC[C@H]1C2) is C6H12ClNO.
Describe the ring structures in building block <BB_299>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_299>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_299>.
**Token:** <BB_299> **SMILES:** Cl.OC[C@]12CNC[C@H]1C2 **Molecular Formula:** C6H12ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)