instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2533>?
The molecular formula for <BB_2533> (O=Cc1cccc(F)c1Br) is C7H4BrFO.
Describe the ring structures in building block <BB_2533>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2533>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2533>.
**Token:** <BB_2533> **SMILES:** O=Cc1cccc(F)c1Br **Molecular Formula:** C7H4BrFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2534>.
O=C1CCCN1c1ccc(O)cc1
What is the building block token for the following molecule?
O=C1CCCN1c1ccc(O)cc1
<BB_2534>
What is the molecular formula for <BB_2534>?
The molecular formula for <BB_2534> (O=C1CCCN1c1ccc(O)cc1) is C10H11NO2.
Describe the ring structures in building block <BB_2534>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2534>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2534>.
**Token:** <BB_2534> **SMILES:** O=C1CCCN1c1ccc(O)cc1 **Molecular Formula:** C10H11NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2535>.
Cl.NCc1ccc(OC(F)(F)F)nc1
What is the building block token for the following molecule?
Cl.NCc1ccc(OC(F)(F)F)nc1
<BB_2535>
What is the molecular formula for <BB_2535>?
The molecular formula for <BB_2535> (Cl.NCc1ccc(OC(F)(F)F)nc1) is C7H8ClF3N2O.
Describe the ring structures in building block <BB_2535>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2535>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2535>.
**Token:** <BB_2535> **SMILES:** Cl.NCc1ccc(OC(F)(F)F)nc1 **Molecular Formula:** C7H8ClF3N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2536>.
Cc1cnc(-c2ccoc2)nc1N
What is the building block token for the following molecule?
Cc1cnc(-c2ccoc2)nc1N
<BB_2536>
What is the molecular formula for <BB_2536>?
The molecular formula for <BB_2536> (Cc1cnc(-c2ccoc2)nc1N) is C9H9N3O.
Describe the ring structures in building block <BB_2536>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2536>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2536>.
**Token:** <BB_2536> **SMILES:** Cc1cnc(-c2ccoc2)nc1N **Molecular Formula:** C9H9N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2537>.
CN(CC(F)(F)F)C1CCC(CO)CC1
What is the building block token for the following molecule?
CN(CC(F)(F)F)C1CCC(CO)CC1
<BB_2537>
What is the molecular formula for <BB_2537>?
The molecular formula for <BB_2537> (CN(CC(F)(F)F)C1CCC(CO)CC1) is C10H18F3NO.
Describe the ring structures in building block <BB_2537>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2537>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2537>.
**Token:** <BB_2537> **SMILES:** CN(CC(F)(F)F)C1CCC(CO)CC1 **Molecular Formula:** C10H18F3NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2538>.
O=C1COCC(CC2CNc3ccccc32)N1
What is the building block token for the following molecule?
O=C1COCC(CC2CNc3ccccc32)N1
<BB_2538>
What is the molecular formula for <BB_2538>?
The molecular formula for <BB_2538> (O=C1COCC(CC2CNc3ccccc32)N1) is C13H16N2O2.
Describe the ring structures in building block <BB_2538>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2538>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2538>.
**Token:** <BB_2538> **SMILES:** O=C1COCC(CC2CNc3ccccc32)N1 **Molecular Formula:** C13H16N2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2539>.
COC(=O)C12CC(C=O)(CO1)C2
What is the building block token for the following molecule?
COC(=O)C12CC(C=O)(CO1)C2
<BB_2539>
What is the molecular formula for <BB_2539>?
The molecular formula for <BB_2539> (COC(=O)C12CC(C=O)(CO1)C2) is C8H10O4.
Describe the ring structures in building block <BB_2539>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2539>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2539>.
**Token:** <BB_2539> **SMILES:** COC(=O)C12CC(C=O)(CO1)C2 **Molecular Formula:** C8H10O4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2540>.
CCC1CCCN1c1cc(C(=O)O)ccn1
What is the building block token for the following molecule?
CCC1CCCN1c1cc(C(=O)O)ccn1
<BB_2540>
What is the molecular formula for <BB_2540>?
The molecular formula for <BB_2540> (CCC1CCCN1c1cc(C(=O)O)ccn1) is C12H16N2O2.
Describe the ring structures in building block <BB_2540>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2540>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2540>.
**Token:** <BB_2540> **SMILES:** CCC1CCCN1c1cc(C(=O)O)ccn1 **Molecular Formula:** C12H16N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2541>.
NC(=O)c1cccc(Oc2ccc(N)nc2)c1
What is the building block token for the following molecule?
NC(=O)c1cccc(Oc2ccc(N)nc2)c1
<BB_2541>
What is the molecular formula for <BB_2541>?
The molecular formula for <BB_2541> (NC(=O)c1cccc(Oc2ccc(N)nc2)c1) is C12H11N3O2.
Describe the ring structures in building block <BB_2541>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2541>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2541>.
**Token:** <BB_2541> **SMILES:** NC(=O)c1cccc(Oc2ccc(N)nc2)c1 **Molecular Formula:** C12H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2542>.
COc1cc2c(cc1OC)CC(=O)NCC2
What is the building block token for the following molecule?
COc1cc2c(cc1OC)CC(=O)NCC2
<BB_2542>
What is the molecular formula for <BB_2542>?
The molecular formula for <BB_2542> (COc1cc2c(cc1OC)CC(=O)NCC2) is C12H15NO3.
Describe the ring structures in building block <BB_2542>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_2542>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2542>.
**Token:** <BB_2542> **SMILES:** COc1cc2c(cc1OC)CC(=O)NCC2 **Molecular Formula:** C12H15NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2543>.
OCc1ccc2c(c1)CCCS2
What is the building block token for the following molecule?
OCc1ccc2c(c1)CCCS2
<BB_2543>
What is the molecular formula for <BB_2543>?
The molecular formula for <BB_2543> (OCc1ccc2c(c1)CCCS2) is C10H12OS.
Describe the ring structures in building block <BB_2543>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2543>.
The molecule contains the following groups: Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2543>.
**Token:** <BB_2543> **SMILES:** OCc1ccc2c(c1)CCCS2 **Molecular Formula:** C10H12OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_2544>.
CC(C)(C)OC(=O)NC[C@H]1C[C@H]2C[C@@H]1CN2.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC[C@H]1C[C@H]2C[C@@H]1CN2.Cl
<BB_2544>
What is the molecular formula for <BB_2544>?
The molecular formula for <BB_2544> (CC(C)(C)OC(=O)NC[C@H]1C[C@H]2C[C@@H]1CN2.Cl) is C12H23ClN2O2.
Describe the ring structures in building block <BB_2544>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2544>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2544>.
**Token:** <BB_2544> **SMILES:** CC(C)(C)OC(=O)NC[C@H]1C[C@H]2C[C@@H]1CN2.Cl **Molecular Formula:** C12H23ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2545>.
Fc1ccc(N2CCNCC2)c(Cl)c1
What is the building block token for the following molecule?
Fc1ccc(N2CCNCC2)c(Cl)c1
<BB_2545>
What is the molecular formula for <BB_2545>?
The molecular formula for <BB_2545> (Fc1ccc(N2CCNCC2)c(Cl)c1) is C10H12ClFN2.
Describe the ring structures in building block <BB_2545>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2545>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2545>.
**Token:** <BB_2545> **SMILES:** Fc1ccc(N2CCNCC2)c(Cl)c1 **Molecular Formula:** C10H12ClFN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2546>.
Clc1cc2c(Br)cccc2c(Cl)n1
What is the building block token for the following molecule?
Clc1cc2c(Br)cccc2c(Cl)n1
<BB_2546>
What is the molecular formula for <BB_2546>?
The molecular formula for <BB_2546> (Clc1cc2c(Br)cccc2c(Cl)n1) is C9H4BrCl2N.
Describe the ring structures in building block <BB_2546>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2546>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2546>.
**Token:** <BB_2546> **SMILES:** Clc1cc2c(Br)cccc2c(Cl)n1 **Molecular Formula:** C9H4BrCl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2547>.
O=c1[nH]c(CBr)nc2ccsc12
What is the building block token for the following molecule?
O=c1[nH]c(CBr)nc2ccsc12
<BB_2547>
What is the molecular formula for <BB_2547>?
The molecular formula for <BB_2547> (O=c1[nH]c(CBr)nc2ccsc12) is C7H5BrN2OS.
Describe the ring structures in building block <BB_2547>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2547>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2547>.
**Token:** <BB_2547> **SMILES:** O=c1[nH]c(CBr)nc2ccsc12 **Molecular Formula:** C7H5BrN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2548>.
CC(=O)CCc1ccc(OCCC(=O)O)cc1
What is the building block token for the following molecule?
CC(=O)CCc1ccc(OCCC(=O)O)cc1
<BB_2548>
What is the molecular formula for <BB_2548>?
The molecular formula for <BB_2548> (CC(=O)CCc1ccc(OCCC(=O)O)cc1) is C13H16O4.
Describe the ring structures in building block <BB_2548>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2548>.
The molecule contains the following groups: Carboxylic Acid, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_2548>.
**Token:** <BB_2548> **SMILES:** CC(=O)CCc1ccc(OCCC(=O)O)cc1 **Molecular Formula:** C13H16O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone, Ether
Provide the SMILES representation for the building block token <BB_2549>.
Cc1cnc(C=O)c(Br)c1
What is the building block token for the following molecule?
Cc1cnc(C=O)c(Br)c1
<BB_2549>
What is the molecular formula for <BB_2549>?
The molecular formula for <BB_2549> (Cc1cnc(C=O)c(Br)c1) is C7H6BrNO.
Describe the ring structures in building block <BB_2549>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2549>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2549>.
**Token:** <BB_2549> **SMILES:** Cc1cnc(C=O)c(Br)c1 **Molecular Formula:** C7H6BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)