instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2550>.
O=Cc1ccc(OCC(F)F)cc1
What is the building block token for the following molecule?
O=Cc1ccc(OCC(F)F)cc1
<BB_2550>
What is the molecular formula for <BB_2550>?
The molecular formula for <BB_2550> (O=Cc1ccc(OCC(F)F)cc1) is C9H8F2O2.
Describe the ring structures in building block <BB_2550>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2550>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2550>.
**Token:** <BB_2550> **SMILES:** O=Cc1ccc(OCC(F)F)cc1 **Molecular Formula:** C9H8F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2551>.
COC(=O)[C@@H]1CNC[C@H]1O.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1CNC[C@H]1O.Cl
<BB_2551>
What is the molecular formula for <BB_2551>?
The molecular formula for <BB_2551> (COC(=O)[C@@H]1CNC[C@H]1O.Cl) is C6H12ClNO3.
Describe the ring structures in building block <BB_2551>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2551>.
The molecule contains the following groups: Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2551>.
**Token:** <BB_2551> **SMILES:** COC(=O)[C@@H]1CNC[C@H]1O.Cl **Molecular Formula:** C6H12ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2552>.
COC(=O)c1ccc(F)c(C)n1
What is the building block token for the following molecule?
COC(=O)c1ccc(F)c(C)n1
<BB_2552>
What is the molecular formula for <BB_2552>?
The molecular formula for <BB_2552> (COC(=O)c1ccc(F)c(C)n1) is C8H8FNO2.
Describe the ring structures in building block <BB_2552>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2552>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2552>.
**Token:** <BB_2552> **SMILES:** COC(=O)c1ccc(F)c(C)n1 **Molecular Formula:** C8H8FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2553>.
OC1CCCC(O)CCC1
What is the building block token for the following molecule?
OC1CCCC(O)CCC1
<BB_2553>
What is the molecular formula for <BB_2553>?
The molecular formula for <BB_2553> (OC1CCCC(O)CCC1) is C8H16O2.
Describe the ring structures in building block <BB_2553>.
The molecule contains 1 ring(s): an aliphatic ring of size 8.
List the primary functional groups present in <BB_2553>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2553>.
**Token:** <BB_2553> **SMILES:** OC1CCCC(O)CCC1 **Molecular Formula:** C8H16O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 8. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2554>.
O=C1NC2CCCCCCC12
What is the building block token for the following molecule?
O=C1NC2CCCCCCC12
<BB_2554>
What is the molecular formula for <BB_2554>?
The molecular formula for <BB_2554> (O=C1NC2CCCCCCC12) is C9H15NO.
Describe the ring structures in building block <BB_2554>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 8.
List the primary functional groups present in <BB_2554>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2554>.
**Token:** <BB_2554> **SMILES:** O=C1NC2CCCCCCC12 **Molecular Formula:** C9H15NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 8. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2555>.
CC(C)(C)OC(=O)N1CCCC12CCNC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC12CCNC2
<BB_2555>
What is the molecular formula for <BB_2555>?
The molecular formula for <BB_2555> (CC(C)(C)OC(=O)N1CCCC12CCNC2) is C12H22N2O2.
Describe the ring structures in building block <BB_2555>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2555>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2555>.
**Token:** <BB_2555> **SMILES:** CC(C)(C)OC(=O)N1CCCC12CCNC2 **Molecular Formula:** C12H22N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2556>.
CCCC[C@H](N)CO
What is the building block token for the following molecule?
CCCC[C@H](N)CO
<BB_2556>
What is the molecular formula for <BB_2556>?
The molecular formula for <BB_2556> (CCCC[C@H](N)CO) is C6H15NO.
Describe the ring structures in building block <BB_2556>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2556>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2556>.
**Token:** <BB_2556> **SMILES:** CCCC[C@H](N)CO **Molecular Formula:** C6H15NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2557>.
Cc1cc(CCN)cc(C)c1O.Cl
What is the building block token for the following molecule?
Cc1cc(CCN)cc(C)c1O.Cl
<BB_2557>
What is the molecular formula for <BB_2557>?
The molecular formula for <BB_2557> (Cc1cc(CCN)cc(C)c1O.Cl) is C10H16ClNO.
Describe the ring structures in building block <BB_2557>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2557>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2557>.
**Token:** <BB_2557> **SMILES:** Cc1cc(CCN)cc(C)c1O.Cl **Molecular Formula:** C10H16ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2558>.
Cl.NC12CC(CC1CO)C2
What is the building block token for the following molecule?
Cl.NC12CC(CC1CO)C2
<BB_2558>
What is the molecular formula for <BB_2558>?
The molecular formula for <BB_2558> (Cl.NC12CC(CC1CO)C2) is C7H14ClNO.
Describe the ring structures in building block <BB_2558>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2558>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2558>.
**Token:** <BB_2558> **SMILES:** Cl.NC12CC(CC1CO)C2 **Molecular Formula:** C7H14ClNO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2559>.
BrCCCc1ccccc1Br
What is the building block token for the following molecule?
BrCCCc1ccccc1Br
<BB_2559>
What is the molecular formula for <BB_2559>?
The molecular formula for <BB_2559> (BrCCCc1ccccc1Br) is C9H10Br2.
Describe the ring structures in building block <BB_2559>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2559>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2559>.
**Token:** <BB_2559> **SMILES:** BrCCCc1ccccc1Br **Molecular Formula:** C9H10Br2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2560>.
Cl.NCCc1cc2c(s1)CCC2
What is the building block token for the following molecule?
Cl.NCCc1cc2c(s1)CCC2
<BB_2560>
What is the molecular formula for <BB_2560>?
The molecular formula for <BB_2560> (Cl.NCCc1cc2c(s1)CCC2) is C9H14ClNS.
Describe the ring structures in building block <BB_2560>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2560>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2560>.
**Token:** <BB_2560> **SMILES:** Cl.NCCc1cc2c(s1)CCC2 **Molecular Formula:** C9H14ClNS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2561>.
COCC1(CO)C=CCC1
What is the building block token for the following molecule?
COCC1(CO)C=CCC1
<BB_2561>
What is the molecular formula for <BB_2561>?
The molecular formula for <BB_2561> (COCC1(CO)C=CCC1) is C8H14O2.
Describe the ring structures in building block <BB_2561>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2561>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2561>.
**Token:** <BB_2561> **SMILES:** COCC1(CO)C=CCC1 **Molecular Formula:** C8H14O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2562>.
Cl.OC[C@@]12CN[C@@H](CO1)C2
What is the building block token for the following molecule?
Cl.OC[C@@]12CN[C@@H](CO1)C2
<BB_2562>
What is the molecular formula for <BB_2562>?
The molecular formula for <BB_2562> (Cl.OC[C@@]12CN[C@@H](CO1)C2) is C6H12ClNO2.
Describe the ring structures in building block <BB_2562>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2562>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2562>.
**Token:** <BB_2562> **SMILES:** Cl.OC[C@@]12CN[C@@H](CO1)C2 **Molecular Formula:** C6H12ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2563>.
Clc1cc(Cl)c(Cl)c(CBr)c1
What is the building block token for the following molecule?
Clc1cc(Cl)c(Cl)c(CBr)c1
<BB_2563>
What is the molecular formula for <BB_2563>?
The molecular formula for <BB_2563> (Clc1cc(Cl)c(Cl)c(CBr)c1) is C7H4BrCl3.
Describe the ring structures in building block <BB_2563>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2563>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2563>.
**Token:** <BB_2563> **SMILES:** Clc1cc(Cl)c(Cl)c(CBr)c1 **Molecular Formula:** C7H4BrCl3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2564>.
Cn1c(C=O)ccc1-c1ccccn1
What is the building block token for the following molecule?
Cn1c(C=O)ccc1-c1ccccn1
<BB_2564>
What is the molecular formula for <BB_2564>?
The molecular formula for <BB_2564> (Cn1c(C=O)ccc1-c1ccccn1) is C11H10N2O.
Describe the ring structures in building block <BB_2564>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2564>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2564>.
**Token:** <BB_2564> **SMILES:** Cn1c(C=O)ccc1-c1ccccn1 **Molecular Formula:** C11H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2565>.
CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1(C)C
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1(C)C
<BB_2565>
What is the molecular formula for <BB_2565>?
The molecular formula for <BB_2565> (CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1(C)C) is C13H23NO4.
Describe the ring structures in building block <BB_2565>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2565>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2565>.
**Token:** <BB_2565> **SMILES:** CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1(C)C **Molecular Formula:** C13H23NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2566>.
Cl.Cl.O=C1CCCN1CC1CCCCN1
What is the building block token for the following molecule?
Cl.Cl.O=C1CCCN1CC1CCCCN1
<BB_2566>
What is the molecular formula for <BB_2566>?
The molecular formula for <BB_2566> (Cl.Cl.O=C1CCCN1CC1CCCCN1) is C10H20Cl2N2O.
Describe the ring structures in building block <BB_2566>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.