instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2566>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2566>.
**Token:** <BB_2566> **SMILES:** Cl.Cl.O=C1CCCN1CC1CCCCN1 **Molecular Formula:** C10H20Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2567>.
Cc1cnc(NN)cn1.Cl.Cl
What is the building block token for the following molecule?
Cc1cnc(NN)cn1.Cl.Cl
<BB_2567>
What is the molecular formula for <BB_2567>?
The molecular formula for <BB_2567> (Cc1cnc(NN)cn1.Cl.Cl) is C5H10Cl2N4.
Describe the ring structures in building block <BB_2567>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2567>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2567>.
**Token:** <BB_2567> **SMILES:** Cc1cnc(NN)cn1.Cl.Cl **Molecular Formula:** C5H10Cl2N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2568>.
CNC1CCc2c(Cl)cccc21
What is the building block token for the following molecule?
CNC1CCc2c(Cl)cccc21
<BB_2568>
What is the molecular formula for <BB_2568>?
The molecular formula for <BB_2568> (CNC1CCc2c(Cl)cccc21) is C10H12ClN.
Describe the ring structures in building block <BB_2568>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2568>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2568>.
**Token:** <BB_2568> **SMILES:** CNC1CCc2c(Cl)cccc21 **Molecular Formula:** C10H12ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2569>.
COC(=O)C1CC([B-](F)(F)F)C1.[K+]
What is the building block token for the following molecule?
COC(=O)C1CC([B-](F)(F)F)C1.[K+]
<BB_2569>
What is the molecular formula for <BB_2569>?
The molecular formula for <BB_2569> (COC(=O)C1CC([B-](F)(F)F)C1.[K+]) is C6H9BF3KO2.
Describe the ring structures in building block <BB_2569>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2569>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2569>.
**Token:** <BB_2569> **SMILES:** COC(=O)C1CC([B-](F)(F)F)C1.[K+] **Molecular Formula:** C6H9BF3KO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2570>.
CN(C)C(=O)COc1cccc(N)c1
What is the building block token for the following molecule?
CN(C)C(=O)COc1cccc(N)c1
<BB_2570>
What is the molecular formula for <BB_2570>?
The molecular formula for <BB_2570> (CN(C)C(=O)COc1cccc(N)c1) is C10H14N2O2.
Describe the ring structures in building block <BB_2570>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2570>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2570>.
**Token:** <BB_2570> **SMILES:** CN(C)C(=O)COc1cccc(N)c1 **Molecular Formula:** C10H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2571>.
COc1ccc(NCc2ccccc2)cc1OC
What is the building block token for the following molecule?
COc1ccc(NCc2ccccc2)cc1OC
<BB_2571>
What is the molecular formula for <BB_2571>?
The molecular formula for <BB_2571> (COc1ccc(NCc2ccccc2)cc1OC) is C15H17NO2.
Describe the ring structures in building block <BB_2571>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2571>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2571>.
**Token:** <BB_2571> **SMILES:** COc1ccc(NCc2ccccc2)cc1OC **Molecular Formula:** C15H17NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2572>.
Cn1ccnc1C(=O)C(F)F
What is the building block token for the following molecule?
Cn1ccnc1C(=O)C(F)F
<BB_2572>
What is the molecular formula for <BB_2572>?
The molecular formula for <BB_2572> (Cn1ccnc1C(=O)C(F)F) is C6H6F2N2O.
Describe the ring structures in building block <BB_2572>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2572>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2572>.
**Token:** <BB_2572> **SMILES:** Cn1ccnc1C(=O)C(F)F **Molecular Formula:** C6H6F2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2573>.
C=CCNCCCCl.Cl
What is the building block token for the following molecule?
C=CCNCCCCl.Cl
<BB_2573>
What is the molecular formula for <BB_2573>?
The molecular formula for <BB_2573> (C=CCNCCCCl.Cl) is C6H13Cl2N.
Describe the ring structures in building block <BB_2573>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2573>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2573>.
**Token:** <BB_2573> **SMILES:** C=CCNCCCCl.Cl **Molecular Formula:** C6H13Cl2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2574>.
ClCc1nnnn1C1CC1
What is the building block token for the following molecule?
ClCc1nnnn1C1CC1
<BB_2574>
What is the molecular formula for <BB_2574>?
The molecular formula for <BB_2574> (ClCc1nnnn1C1CC1) is C5H7ClN4.
Describe the ring structures in building block <BB_2574>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2574>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2574>.
**Token:** <BB_2574> **SMILES:** ClCc1nnnn1C1CC1 **Molecular Formula:** C5H7ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2575>.
CC(C)[C@@H](N=[N+]=[N-])C(=O)O
What is the building block token for the following molecule?
CC(C)[C@@H](N=[N+]=[N-])C(=O)O
<BB_2575>
What is the molecular formula for <BB_2575>?
The molecular formula for <BB_2575> (CC(C)[C@@H](N=[N+]=[N-])C(=O)O) is C5H9N3O2.
Describe the ring structures in building block <BB_2575>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2575>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2575>.
**Token:** <BB_2575> **SMILES:** CC(C)[C@@H](N=[N+]=[N-])C(=O)O **Molecular Formula:** C5H9N3O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2576>.
CC(C)(C)c1nsc(Oc2ccc(N)cc2Cl)n1
What is the building block token for the following molecule?
CC(C)(C)c1nsc(Oc2ccc(N)cc2Cl)n1
<BB_2576>
What is the molecular formula for <BB_2576>?
The molecular formula for <BB_2576> (CC(C)(C)c1nsc(Oc2ccc(N)cc2Cl)n1) is C12H14ClN3OS.
Describe the ring structures in building block <BB_2576>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2576>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2576>.
**Token:** <BB_2576> **SMILES:** CC(C)(C)c1nsc(Oc2ccc(N)cc2Cl)n1 **Molecular Formula:** C12H14ClN3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2577>.
COC(=O)C12CC3CC1(CO)CC3C2
What is the building block token for the following molecule?
COC(=O)C12CC3CC1(CO)CC3C2
<BB_2577>
What is the molecular formula for <BB_2577>?
The molecular formula for <BB_2577> (COC(=O)C12CC3CC1(CO)CC3C2) is C11H16O3.
Describe the ring structures in building block <BB_2577>.
The molecule contains 4 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2577>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2577>.
**Token:** <BB_2577> **SMILES:** COC(=O)C12CC3CC1(CO)CC3C2 **Molecular Formula:** C11H16O3 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2578>.
NCc1nnn[nH]1
What is the building block token for the following molecule?
NCc1nnn[nH]1
<BB_2578>
What is the molecular formula for <BB_2578>?
The molecular formula for <BB_2578> (NCc1nnn[nH]1) is C2H5N5.
Describe the ring structures in building block <BB_2578>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2578>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2578>.
**Token:** <BB_2578> **SMILES:** NCc1nnn[nH]1 **Molecular Formula:** C2H5N5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2579>.
O=C(O)CSc1nnc(NC2CCCCC2)s1
What is the building block token for the following molecule?
O=C(O)CSc1nnc(NC2CCCCC2)s1
<BB_2579>
What is the molecular formula for <BB_2579>?
The molecular formula for <BB_2579> (O=C(O)CSc1nnc(NC2CCCCC2)s1) is C10H15N3O2S2.
Describe the ring structures in building block <BB_2579>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2579>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2579>.
**Token:** <BB_2579> **SMILES:** O=C(O)CSc1nnc(NC2CCCCC2)s1 **Molecular Formula:** C10H15N3O2S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfide
Provide the SMILES representation for the building block token <BB_2580>.
CN(Cc1cccc(N)c1)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CN(Cc1cccc(N)c1)C(=O)OC(C)(C)C
<BB_2580>
What is the molecular formula for <BB_2580>?
The molecular formula for <BB_2580> (CN(Cc1cccc(N)c1)C(=O)OC(C)(C)C) is C13H20N2O2.
Describe the ring structures in building block <BB_2580>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2580>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2580>.
**Token:** <BB_2580> **SMILES:** CN(Cc1cccc(N)c1)C(=O)OC(C)(C)C **Molecular Formula:** C13H20N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2581>.
Cl.Cl.NCCN1CCS(=O)CC1
What is the building block token for the following molecule?
Cl.Cl.NCCN1CCS(=O)CC1
<BB_2581>
What is the molecular formula for <BB_2581>?
The molecular formula for <BB_2581> (Cl.Cl.NCCN1CCS(=O)CC1) is C6H16Cl2N2OS.
Describe the ring structures in building block <BB_2581>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2581>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2581>.
**Token:** <BB_2581> **SMILES:** Cl.Cl.NCCN1CCS(=O)CC1 **Molecular Formula:** C6H16Cl2N2OS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2582>.
C#CCOC(C)C(OC)OC
What is the building block token for the following molecule?
C#CCOC(C)C(OC)OC
<BB_2582>
What is the molecular formula for <BB_2582>?
The molecular formula for <BB_2582> (C#CCOC(C)C(OC)OC) is C8H14O3.
Describe the ring structures in building block <BB_2582>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2582>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2582>.
**Token:** <BB_2582> **SMILES:** C#CCOC(C)C(OC)OC **Molecular Formula:** C8H14O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2583>.
N#CCOc1ccc(F)c(Cl)c1
What is the building block token for the following molecule?
N#CCOc1ccc(F)c(Cl)c1
<BB_2583>