instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2583>?
The molecular formula for <BB_2583> (N#CCOc1ccc(F)c(Cl)c1) is C8H5ClFNO.
Describe the ring structures in building block <BB_2583>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2583>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2583>.
**Token:** <BB_2583> **SMILES:** N#CCOc1ccc(F)c(Cl)c1 **Molecular Formula:** C8H5ClFNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2584>.
COc1cccc(C(=O)CC#N)c1
What is the building block token for the following molecule?
COc1cccc(C(=O)CC#N)c1
<BB_2584>
What is the molecular formula for <BB_2584>?
The molecular formula for <BB_2584> (COc1cccc(C(=O)CC#N)c1) is C10H9NO2.
Describe the ring structures in building block <BB_2584>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2584>.
The molecule contains the following groups: Ketone, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2584>.
**Token:** <BB_2584> **SMILES:** COc1cccc(C(=O)CC#N)c1 **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2585>.
NC(=O)c1cnn(-c2ccccn2)c1N
What is the building block token for the following molecule?
NC(=O)c1cnn(-c2ccccn2)c1N
<BB_2585>
What is the molecular formula for <BB_2585>?
The molecular formula for <BB_2585> (NC(=O)c1cnn(-c2ccccn2)c1N) is C9H9N5O.
Describe the ring structures in building block <BB_2585>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2585>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2585>.
**Token:** <BB_2585> **SMILES:** NC(=O)c1cnn(-c2ccccn2)c1N **Molecular Formula:** C9H9N5O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_2586>.
c1ccc2c(CNC3CCCC3)cccc2c1
What is the building block token for the following molecule?
c1ccc2c(CNC3CCCC3)cccc2c1
<BB_2586>
What is the molecular formula for <BB_2586>?
The molecular formula for <BB_2586> (c1ccc2c(CNC3CCCC3)cccc2c1) is C16H19N.
Describe the ring structures in building block <BB_2586>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2586>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2586>.
**Token:** <BB_2586> **SMILES:** c1ccc2c(CNC3CCCC3)cccc2c1 **Molecular Formula:** C16H19N **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2587>.
O=C(O)C12CCOCC1CNC2
What is the building block token for the following molecule?
O=C(O)C12CCOCC1CNC2
<BB_2587>
What is the molecular formula for <BB_2587>?
The molecular formula for <BB_2587> (O=C(O)C12CCOCC1CNC2) is C8H13NO3.
Describe the ring structures in building block <BB_2587>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2587>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2587>.
**Token:** <BB_2587> **SMILES:** O=C(O)C12CCOCC1CNC2 **Molecular Formula:** C8H13NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2588>.
CCOC(=O)[C@H]1NC[C@H]2C[C@H]21.Cl
What is the building block token for the following molecule?
CCOC(=O)[C@H]1NC[C@H]2C[C@H]21.Cl
<BB_2588>
What is the molecular formula for <BB_2588>?
The molecular formula for <BB_2588> (CCOC(=O)[C@H]1NC[C@H]2C[C@H]21.Cl) is C8H14ClNO2.
Describe the ring structures in building block <BB_2588>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2588>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2588>.
**Token:** <BB_2588> **SMILES:** CCOC(=O)[C@H]1NC[C@H]2C[C@H]21.Cl **Molecular Formula:** C8H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2589>.
O=C1CCOC12CCCC2
What is the building block token for the following molecule?
O=C1CCOC12CCCC2
<BB_2589>
What is the molecular formula for <BB_2589>?
The molecular formula for <BB_2589> (O=C1CCOC12CCCC2) is C8H12O2.
Describe the ring structures in building block <BB_2589>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2589>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_2589>.
**Token:** <BB_2589> **SMILES:** O=C1CCOC12CCCC2 **Molecular Formula:** C8H12O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_2590>.
Cc1cc(Br)cc2cc(CN)oc12
What is the building block token for the following molecule?
Cc1cc(Br)cc2cc(CN)oc12
<BB_2590>
What is the molecular formula for <BB_2590>?
The molecular formula for <BB_2590> (Cc1cc(Br)cc2cc(CN)oc12) is C10H10BrNO.
Describe the ring structures in building block <BB_2590>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2590>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2590>.
**Token:** <BB_2590> **SMILES:** Cc1cc(Br)cc2cc(CN)oc12 **Molecular Formula:** C10H10BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2591>.
COC(=O)c1ccc2c(cnn2C)c1
What is the building block token for the following molecule?
COC(=O)c1ccc2c(cnn2C)c1
<BB_2591>
What is the molecular formula for <BB_2591>?
The molecular formula for <BB_2591> (COC(=O)c1ccc2c(cnn2C)c1) is C10H10N2O2.
Describe the ring structures in building block <BB_2591>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2591>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2591>.
**Token:** <BB_2591> **SMILES:** COC(=O)c1ccc2c(cnn2C)c1 **Molecular Formula:** C10H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2592>.
CC(C)c1nc(C(=O)O)cc(=O)[nH]1
What is the building block token for the following molecule?
CC(C)c1nc(C(=O)O)cc(=O)[nH]1
<BB_2592>
What is the molecular formula for <BB_2592>?
The molecular formula for <BB_2592> (CC(C)c1nc(C(=O)O)cc(=O)[nH]1) is C8H10N2O3.
Describe the ring structures in building block <BB_2592>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2592>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2592>.
**Token:** <BB_2592> **SMILES:** CC(C)c1nc(C(=O)O)cc(=O)[nH]1 **Molecular Formula:** C8H10N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2593>.
Cc1cc(C(F)(F)F)ccc1C(=O)O
What is the building block token for the following molecule?
Cc1cc(C(F)(F)F)ccc1C(=O)O
<BB_2593>
What is the molecular formula for <BB_2593>?
The molecular formula for <BB_2593> (Cc1cc(C(F)(F)F)ccc1C(=O)O) is C9H7F3O2.
Describe the ring structures in building block <BB_2593>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2593>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2593>.
**Token:** <BB_2593> **SMILES:** Cc1cc(C(F)(F)F)ccc1C(=O)O **Molecular Formula:** C9H7F3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2594>.
COC(=O)CS(=O)(=O)CC#N
What is the building block token for the following molecule?
COC(=O)CS(=O)(=O)CC#N
<BB_2594>
What is the molecular formula for <BB_2594>?
The molecular formula for <BB_2594> (COC(=O)CS(=O)(=O)CC#N) is C5H7NO4S.
Describe the ring structures in building block <BB_2594>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2594>.
The molecule contains the following groups: Ester, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2594>.
**Token:** <BB_2594> **SMILES:** COC(=O)CS(=O)(=O)CC#N **Molecular Formula:** C5H7NO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2595>.
CC1CC(N)CO1.Cl
What is the building block token for the following molecule?
CC1CC(N)CO1.Cl
<BB_2595>
What is the molecular formula for <BB_2595>?
The molecular formula for <BB_2595> (CC1CC(N)CO1.Cl) is C5H12ClNO.
Describe the ring structures in building block <BB_2595>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2595>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2595>.
**Token:** <BB_2595> **SMILES:** CC1CC(N)CO1.Cl **Molecular Formula:** C5H12ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2596>.
Cn1cnn(CC(=O)O)c1=O
What is the building block token for the following molecule?
Cn1cnn(CC(=O)O)c1=O
<BB_2596>
What is the molecular formula for <BB_2596>?
The molecular formula for <BB_2596> (Cn1cnn(CC(=O)O)c1=O) is C5H7N3O3.
Describe the ring structures in building block <BB_2596>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2596>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2596>.
**Token:** <BB_2596> **SMILES:** Cn1cnn(CC(=O)O)c1=O **Molecular Formula:** C5H7N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2597>.
Cn1nccc1C(N)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
Cn1nccc1C(N)C(=O)OC(C)(C)C
<BB_2597>
What is the molecular formula for <BB_2597>?
The molecular formula for <BB_2597> (Cn1nccc1C(N)C(=O)OC(C)(C)C) is C10H17N3O2.
Describe the ring structures in building block <BB_2597>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2597>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2597>.
**Token:** <BB_2597> **SMILES:** Cn1nccc1C(N)C(=O)OC(C)(C)C **Molecular Formula:** C10H17N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2598>.
Br.O=C1CN2C=CC=CC2=N1
What is the building block token for the following molecule?
Br.O=C1CN2C=CC=CC2=N1
<BB_2598>
What is the molecular formula for <BB_2598>?
The molecular formula for <BB_2598> (Br.O=C1CN2C=CC=CC2=N1) is C7H7BrN2O.
Describe the ring structures in building block <BB_2598>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2598>.
The molecule contains the following groups: Tertiary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2598>.
**Token:** <BB_2598> **SMILES:** Br.O=C1CN2C=CC=CC2=N1 **Molecular Formula:** C7H7BrN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2599>.
N#Cc1cnc2c(Br)cnn2c1
What is the building block token for the following molecule?
N#Cc1cnc2c(Br)cnn2c1
<BB_2599>
What is the molecular formula for <BB_2599>?
The molecular formula for <BB_2599> (N#Cc1cnc2c(Br)cnn2c1) is C7H3BrN4.
Describe the ring structures in building block <BB_2599>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2599>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2599>.
**Token:** <BB_2599> **SMILES:** N#Cc1cnc2c(Br)cnn2c1 **Molecular Formula:** C7H3BrN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile