instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2600>.
C=C[C@@H]1C[C@H]1[B-](F)(F)F.[K+]
What is the building block token for the following molecule?
C=C[C@@H]1C[C@H]1[B-](F)(F)F.[K+]
<BB_2600>
What is the molecular formula for <BB_2600>?
The molecular formula for <BB_2600> (C=C[C@@H]1C[C@H]1[B-](F)(F)F.[K+]) is C5H7BF3K.
Describe the ring structures in building block <BB_2600>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2600>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2600>.
**Token:** <BB_2600> **SMILES:** C=C[C@@H]1C[C@H]1[B-](F)(F)F.[K+] **Molecular Formula:** C5H7BF3K **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2601>.
CC(=O)c1cc(O)c(F)cc1F
What is the building block token for the following molecule?
CC(=O)c1cc(O)c(F)cc1F
<BB_2601>
What is the molecular formula for <BB_2601>?
The molecular formula for <BB_2601> (CC(=O)c1cc(O)c(F)cc1F) is C8H6F2O2.
Describe the ring structures in building block <BB_2601>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2601>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2601>.
**Token:** <BB_2601> **SMILES:** CC(=O)c1cc(O)c(F)cc1F **Molecular Formula:** C8H6F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2602>.
[N-]=[N+]=Nc1cc(Cl)ccc1Cl
What is the building block token for the following molecule?
[N-]=[N+]=Nc1cc(Cl)ccc1Cl
<BB_2602>
What is the molecular formula for <BB_2602>?
The molecular formula for <BB_2602> ([N-]=[N+]=Nc1cc(Cl)ccc1Cl) is C6H3Cl2N3.
Describe the ring structures in building block <BB_2602>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2602>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2602>.
**Token:** <BB_2602> **SMILES:** [N-]=[N+]=Nc1cc(Cl)ccc1Cl **Molecular Formula:** C6H3Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2603>.
CC(C)c1nnc([C@]23CC[C@H]2CCN3)o1
What is the building block token for the following molecule?
CC(C)c1nnc([C@]23CC[C@H]2CCN3)o1
<BB_2603>
What is the molecular formula for <BB_2603>?
The molecular formula for <BB_2603> (CC(C)c1nnc([C@]23CC[C@H]2CCN3)o1) is C11H17N3O.
Describe the ring structures in building block <BB_2603>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2603>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2603>.
**Token:** <BB_2603> **SMILES:** CC(C)c1nnc([C@]23CC[C@H]2CCN3)o1 **Molecular Formula:** C11H17N3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2604>.
CC(C)(C)OC(=O)N1CCCC2(CC1)CC(N)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC2(CC1)CC(N)C2
<BB_2604>
What is the molecular formula for <BB_2604>?
The molecular formula for <BB_2604> (CC(C)(C)OC(=O)N1CCCC2(CC1)CC(N)C2) is C14H26N2O2.
Describe the ring structures in building block <BB_2604>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2604>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2604>.
**Token:** <BB_2604> **SMILES:** CC(C)(C)OC(=O)N1CCCC2(CC1)CC(N)C2 **Molecular Formula:** C14H26N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2605>.
CC(CO)c1cccc(Cl)c1
What is the building block token for the following molecule?
CC(CO)c1cccc(Cl)c1
<BB_2605>
What is the molecular formula for <BB_2605>?
The molecular formula for <BB_2605> (CC(CO)c1cccc(Cl)c1) is C9H11ClO.
Describe the ring structures in building block <BB_2605>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2605>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2605>.
**Token:** <BB_2605> **SMILES:** CC(CO)c1cccc(Cl)c1 **Molecular Formula:** C9H11ClO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2606>.
COC(=O)c1cccc2c1SCCC2
What is the building block token for the following molecule?
COC(=O)c1cccc2c1SCCC2
<BB_2606>
What is the molecular formula for <BB_2606>?
The molecular formula for <BB_2606> (COC(=O)c1cccc2c1SCCC2) is C11H12O2S.
Describe the ring structures in building block <BB_2606>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2606>.
The molecule contains the following groups: Ester, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2606>.
**Token:** <BB_2606> **SMILES:** COC(=O)c1cccc2c1SCCC2 **Molecular Formula:** C11H12O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ester, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_2607>.
COC(=O)C1CC(NC(=O)OC(C)(C)C)CN1.Cl
What is the building block token for the following molecule?
COC(=O)C1CC(NC(=O)OC(C)(C)C)CN1.Cl
<BB_2607>
What is the molecular formula for <BB_2607>?
The molecular formula for <BB_2607> (COC(=O)C1CC(NC(=O)OC(C)(C)C)CN1.Cl) is C11H21ClN2O4.
Describe the ring structures in building block <BB_2607>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2607>.
The molecule contains the following groups: Secondary Amine, Amide, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2607>.
**Token:** <BB_2607> **SMILES:** COC(=O)C1CC(NC(=O)OC(C)(C)C)CN1.Cl **Molecular Formula:** C11H21ClN2O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2608>.
O=C(O)c1cc2cc(Cl)cc(Cl)c2[nH]1
What is the building block token for the following molecule?
O=C(O)c1cc2cc(Cl)cc(Cl)c2[nH]1
<BB_2608>
What is the molecular formula for <BB_2608>?
The molecular formula for <BB_2608> (O=C(O)c1cc2cc(Cl)cc(Cl)c2[nH]1) is C9H5Cl2NO2.
Describe the ring structures in building block <BB_2608>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2608>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2608>.
**Token:** <BB_2608> **SMILES:** O=C(O)c1cc2cc(Cl)cc(Cl)c2[nH]1 **Molecular Formula:** C9H5Cl2NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2609>.
Cl.O=C(CCl)Nc1cccnn1
What is the building block token for the following molecule?
Cl.O=C(CCl)Nc1cccnn1
<BB_2609>
What is the molecular formula for <BB_2609>?
The molecular formula for <BB_2609> (Cl.O=C(CCl)Nc1cccnn1) is C6H7Cl2N3O.
Describe the ring structures in building block <BB_2609>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2609>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2609>.
**Token:** <BB_2609> **SMILES:** Cl.O=C(CCl)Nc1cccnn1 **Molecular Formula:** C6H7Cl2N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2610>.
Cc1cc(N2CCC(N)CC2)ncn1.Cl.Cl
What is the building block token for the following molecule?
Cc1cc(N2CCC(N)CC2)ncn1.Cl.Cl
<BB_2610>
What is the molecular formula for <BB_2610>?
The molecular formula for <BB_2610> (Cc1cc(N2CCC(N)CC2)ncn1.Cl.Cl) is C10H18Cl2N4.
Describe the ring structures in building block <BB_2610>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2610>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2610>.
**Token:** <BB_2610> **SMILES:** Cc1cc(N2CCC(N)CC2)ncn1.Cl.Cl **Molecular Formula:** C10H18Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2611>.
N#Cc1cccc2c1OC(F)(F)O2
What is the building block token for the following molecule?
N#Cc1cccc2c1OC(F)(F)O2
<BB_2611>
What is the molecular formula for <BB_2611>?
The molecular formula for <BB_2611> (N#Cc1cccc2c1OC(F)(F)O2) is C8H3F2NO2.
Describe the ring structures in building block <BB_2611>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2611>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2611>.
**Token:** <BB_2611> **SMILES:** N#Cc1cccc2c1OC(F)(F)O2 **Molecular Formula:** C8H3F2NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2612>.
O=C(O)CC12COCC(c3ccccc3)(C1)C2
What is the building block token for the following molecule?
O=C(O)CC12COCC(c3ccccc3)(C1)C2
<BB_2612>
What is the molecular formula for <BB_2612>?
The molecular formula for <BB_2612> (O=C(O)CC12COCC(c3ccccc3)(C1)C2) is C14H16O3.
Describe the ring structures in building block <BB_2612>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2612>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2612>.
**Token:** <BB_2612> **SMILES:** O=C(O)CC12COCC(c3ccccc3)(C1)C2 **Molecular Formula:** C14H16O3 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2613>.
F[B-](F)(F)C1COC1.[K+]
What is the building block token for the following molecule?
F[B-](F)(F)C1COC1.[K+]
<BB_2613>
What is the molecular formula for <BB_2613>?
The molecular formula for <BB_2613> (F[B-](F)(F)C1COC1.[K+]) is C3H5BF3KO.
Describe the ring structures in building block <BB_2613>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2613>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2613>.
**Token:** <BB_2613> **SMILES:** F[B-](F)(F)C1COC1.[K+] **Molecular Formula:** C3H5BF3KO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2614>.
COCC(O)CN1CCSC(C)(C)C1
What is the building block token for the following molecule?
COCC(O)CN1CCSC(C)(C)C1
<BB_2614>
What is the molecular formula for <BB_2614>?
The molecular formula for <BB_2614> (COCC(O)CN1CCSC(C)(C)C1) is C10H21NO2S.
Describe the ring structures in building block <BB_2614>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2614>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2614>.
**Token:** <BB_2614> **SMILES:** COCC(O)CN1CCSC(C)(C)C1 **Molecular Formula:** C10H21NO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_2615>.
Cc1cc(C(N)=O)sc1C(=O)O
What is the building block token for the following molecule?
Cc1cc(C(N)=O)sc1C(=O)O
<BB_2615>
What is the molecular formula for <BB_2615>?
The molecular formula for <BB_2615> (Cc1cc(C(N)=O)sc1C(=O)O) is C7H7NO3S.
Describe the ring structures in building block <BB_2615>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2615>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2615>.
**Token:** <BB_2615> **SMILES:** Cc1cc(C(N)=O)sc1C(=O)O **Molecular Formula:** C7H7NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2616>.
CN1CCC2(CCN(C(N)=O)CC2)C1=O
What is the building block token for the following molecule?
CN1CCC2(CCN(C(N)=O)CC2)C1=O
<BB_2616>
What is the molecular formula for <BB_2616>?
The molecular formula for <BB_2616> (CN1CCC2(CCN(C(N)=O)CC2)C1=O) is C10H17N3O2.
Describe the ring structures in building block <BB_2616>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.