instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2616>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2616>.
**Token:** <BB_2616> **SMILES:** CN1CCC2(CCN(C(N)=O)CC2)C1=O **Molecular Formula:** C10H17N3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2617>.
C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)O
What is the building block token for the following molecule?
C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)O
<BB_2617>
What is the molecular formula for <BB_2617>?
The molecular formula for <BB_2617> (C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)O) is C10H18N2O3.
Describe the ring structures in building block <BB_2617>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2617>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2617>.
**Token:** <BB_2617> **SMILES:** C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)O **Molecular Formula:** C10H18N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2618>.
CC(C)c1nccc(C2CCNCC2)n1.Cl.Cl
What is the building block token for the following molecule?
CC(C)c1nccc(C2CCNCC2)n1.Cl.Cl
<BB_2618>
What is the molecular formula for <BB_2618>?
The molecular formula for <BB_2618> (CC(C)c1nccc(C2CCNCC2)n1.Cl.Cl) is C12H21Cl2N3.
Describe the ring structures in building block <BB_2618>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2618>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2618>.
**Token:** <BB_2618> **SMILES:** CC(C)c1nccc(C2CCNCC2)n1.Cl.Cl **Molecular Formula:** C12H21Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2619>.
NC(CCl)=NO
What is the building block token for the following molecule?
NC(CCl)=NO
<BB_2619>
What is the molecular formula for <BB_2619>?
The molecular formula for <BB_2619> (NC(CCl)=NO) is C2H5ClN2O.
Describe the ring structures in building block <BB_2619>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2619>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2619>.
**Token:** <BB_2619> **SMILES:** NC(CCl)=NO **Molecular Formula:** C2H5ClN2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2620>.
Cl.Cl.NNCCc1csc(Cl)n1
What is the building block token for the following molecule?
Cl.Cl.NNCCc1csc(Cl)n1
<BB_2620>
What is the molecular formula for <BB_2620>?
The molecular formula for <BB_2620> (Cl.Cl.NNCCc1csc(Cl)n1) is C5H10Cl3N3S.
Describe the ring structures in building block <BB_2620>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2620>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2620>.
**Token:** <BB_2620> **SMILES:** Cl.Cl.NNCCc1csc(Cl)n1 **Molecular Formula:** C5H10Cl3N3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2621>.
Cc1cc2cccnc2n1CCN.Cl
What is the building block token for the following molecule?
Cc1cc2cccnc2n1CCN.Cl
<BB_2621>
What is the molecular formula for <BB_2621>?
The molecular formula for <BB_2621> (Cc1cc2cccnc2n1CCN.Cl) is C10H14ClN3.
Describe the ring structures in building block <BB_2621>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2621>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2621>.
**Token:** <BB_2621> **SMILES:** Cc1cc2cccnc2n1CCN.Cl **Molecular Formula:** C10H14ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2622>.
CC1(C)OB(C23CC(CN=[N+]=[N-])(C2)C3)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C23CC(CN=[N+]=[N-])(C2)C3)OC1(C)C
<BB_2622>
What is the molecular formula for <BB_2622>?
The molecular formula for <BB_2622> (CC1(C)OB(C23CC(CN=[N+]=[N-])(C2)C3)OC1(C)C) is C12H20BN3O2.
Describe the ring structures in building block <BB_2622>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2622>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2622>.
**Token:** <BB_2622> **SMILES:** CC1(C)OB(C23CC(CN=[N+]=[N-])(C2)C3)OC1(C)C **Molecular Formula:** C12H20BN3O2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2623>.
CS(=O)(=O)N1CCCc2cc(C(=O)CCl)ccc21
What is the building block token for the following molecule?
CS(=O)(=O)N1CCCc2cc(C(=O)CCl)ccc21
<BB_2623>
What is the molecular formula for <BB_2623>?
The molecular formula for <BB_2623> (CS(=O)(=O)N1CCCc2cc(C(=O)CCl)ccc21) is C12H14ClNO3S.
Describe the ring structures in building block <BB_2623>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2623>.
The molecule contains the following groups: Tertiary Amine, Ketone, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2623>.
**Token:** <BB_2623> **SMILES:** CS(=O)(=O)N1CCCc2cc(C(=O)CCl)ccc21 **Molecular Formula:** C12H14ClNO3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2624>.
CC(C)(C)OC(=O)Nc1ccc(CCCN)cc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1ccc(CCCN)cc1
<BB_2624>
What is the molecular formula for <BB_2624>?
The molecular formula for <BB_2624> (CC(C)(C)OC(=O)Nc1ccc(CCCN)cc1) is C14H22N2O2.
Describe the ring structures in building block <BB_2624>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2624>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2624>.
**Token:** <BB_2624> **SMILES:** CC(C)(C)OC(=O)Nc1ccc(CCCN)cc1 **Molecular Formula:** C14H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2625>.
CC(C)(C)OC(=O)Nc1ccc(N)c([N+](=O)[O-])c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1ccc(N)c([N+](=O)[O-])c1
<BB_2625>
What is the molecular formula for <BB_2625>?
The molecular formula for <BB_2625> (CC(C)(C)OC(=O)Nc1ccc(N)c([N+](=O)[O-])c1) is C11H15N3O4.
Describe the ring structures in building block <BB_2625>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2625>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2625>.
**Token:** <BB_2625> **SMILES:** CC(C)(C)OC(=O)Nc1ccc(N)c([N+](=O)[O-])c1 **Molecular Formula:** C11H15N3O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Amide, Ether, Nitro
Provide the SMILES representation for the building block token <BB_2626>.
N#CCC1CCCCO1
What is the building block token for the following molecule?
N#CCC1CCCCO1
<BB_2626>
What is the molecular formula for <BB_2626>?
The molecular formula for <BB_2626> (N#CCC1CCCCO1) is C7H11NO.
Describe the ring structures in building block <BB_2626>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2626>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2626>.
**Token:** <BB_2626> **SMILES:** N#CCC1CCCCO1 **Molecular Formula:** C7H11NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2627>.
N=S(=O)(c1ccc(C(=O)O)cc1)C(F)F
What is the building block token for the following molecule?
N=S(=O)(c1ccc(C(=O)O)cc1)C(F)F
<BB_2627>
What is the molecular formula for <BB_2627>?
The molecular formula for <BB_2627> (N=S(=O)(c1ccc(C(=O)O)cc1)C(F)F) is C8H7F2NO3S.
Describe the ring structures in building block <BB_2627>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2627>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2627>.
**Token:** <BB_2627> **SMILES:** N=S(=O)(c1ccc(C(=O)O)cc1)C(F)F **Molecular Formula:** C8H7F2NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2628>.
C[Si](Cl)(Cl)c1ccc(F)cc1
What is the building block token for the following molecule?
C[Si](Cl)(Cl)c1ccc(F)cc1
<BB_2628>
What is the molecular formula for <BB_2628>?
The molecular formula for <BB_2628> (C[Si](Cl)(Cl)c1ccc(F)cc1) is C7H7Cl2FSi.
Describe the ring structures in building block <BB_2628>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2628>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2628>.
**Token:** <BB_2628> **SMILES:** C[Si](Cl)(Cl)c1ccc(F)cc1 **Molecular Formula:** C7H7Cl2FSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2629>.
O=C(O)C(F)(F)F.c1cc(CNC2COC2)ccn1
What is the building block token for the following molecule?
O=C(O)C(F)(F)F.c1cc(CNC2COC2)ccn1
<BB_2629>
What is the molecular formula for <BB_2629>?
The molecular formula for <BB_2629> (O=C(O)C(F)(F)F.c1cc(CNC2COC2)ccn1) is C11H13F3N2O3.
Describe the ring structures in building block <BB_2629>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2629>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2629>.
**Token:** <BB_2629> **SMILES:** O=C(O)C(F)(F)F.c1cc(CNC2COC2)ccn1 **Molecular Formula:** C11H13F3N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2630>.
C(=C/C1CCCN1)\c1ccccc1
What is the building block token for the following molecule?
C(=C/C1CCCN1)\c1ccccc1
<BB_2630>
What is the molecular formula for <BB_2630>?
The molecular formula for <BB_2630> (C(=C/C1CCCN1)\c1ccccc1) is C12H15N.
Describe the ring structures in building block <BB_2630>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2630>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2630>.
**Token:** <BB_2630> **SMILES:** C(=C/C1CCCN1)\c1ccccc1 **Molecular Formula:** C12H15N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2631>.
CSc1nc(C#N)ncc1Cl
What is the building block token for the following molecule?
CSc1nc(C#N)ncc1Cl
<BB_2631>
What is the molecular formula for <BB_2631>?
The molecular formula for <BB_2631> (CSc1nc(C#N)ncc1Cl) is C6H4ClN3S.
Describe the ring structures in building block <BB_2631>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2631>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2631>.
**Token:** <BB_2631> **SMILES:** CSc1nc(C#N)ncc1Cl **Molecular Formula:** C6H4ClN3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2632>.
CCOC(=O)c1nc(=O)ss1
What is the building block token for the following molecule?
CCOC(=O)c1nc(=O)ss1
<BB_2632>
What is the molecular formula for <BB_2632>?
The molecular formula for <BB_2632> (CCOC(=O)c1nc(=O)ss1) is C5H5NO3S2.
Describe the ring structures in building block <BB_2632>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2632>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2632>.
**Token:** <BB_2632> **SMILES:** CCOC(=O)c1nc(=O)ss1 **Molecular Formula:** C5H5NO3S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2633>.
O=C([O-])Cc1nnc(-c2ccncc2)[nH]1.[Na+]
What is the building block token for the following molecule?
O=C([O-])Cc1nnc(-c2ccncc2)[nH]1.[Na+]
<BB_2633>