instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2633>?
The molecular formula for <BB_2633> (O=C([O-])Cc1nnc(-c2ccncc2)[nH]1.[Na+]) is C9H7N4NaO2.
Describe the ring structures in building block <BB_2633>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2633>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2633>.
**Token:** <BB_2633> **SMILES:** O=C([O-])Cc1nnc(-c2ccncc2)[nH]1.[Na+] **Molecular Formula:** C9H7N4NaO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2634>.
O=S(=O)(Cl)c1cc2cc(F)ccc2s1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cc2cc(F)ccc2s1
<BB_2634>
What is the molecular formula for <BB_2634>?
The molecular formula for <BB_2634> (O=S(=O)(Cl)c1cc2cc(F)ccc2s1) is C8H4ClFO2S2.
Describe the ring structures in building block <BB_2634>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2634>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2634>.
**Token:** <BB_2634> **SMILES:** O=S(=O)(Cl)c1cc2cc(F)ccc2s1 **Molecular Formula:** C8H4ClFO2S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2635>.
Cl.Nc1ccccc1Nc1ccccc1
What is the building block token for the following molecule?
Cl.Nc1ccccc1Nc1ccccc1
<BB_2635>
What is the molecular formula for <BB_2635>?
The molecular formula for <BB_2635> (Cl.Nc1ccccc1Nc1ccccc1) is C12H13ClN2.
Describe the ring structures in building block <BB_2635>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2635>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2635>.
**Token:** <BB_2635> **SMILES:** Cl.Nc1ccccc1Nc1ccccc1 **Molecular Formula:** C12H13ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2636>.
Cc1ccc(C(F)F)cc1N
What is the building block token for the following molecule?
Cc1ccc(C(F)F)cc1N
<BB_2636>
What is the molecular formula for <BB_2636>?
The molecular formula for <BB_2636> (Cc1ccc(C(F)F)cc1N) is C8H9F2N.
Describe the ring structures in building block <BB_2636>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2636>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2636>.
**Token:** <BB_2636> **SMILES:** Cc1ccc(C(F)F)cc1N **Molecular Formula:** C8H9F2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2637>.
CC(C)(C)OC(=O)N1C[C@H](C(=O)O)C[C@H]2C[C@H]21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C[C@H](C(=O)O)C[C@H]2C[C@H]21
<BB_2637>
What is the molecular formula for <BB_2637>?
The molecular formula for <BB_2637> (CC(C)(C)OC(=O)N1C[C@H](C(=O)O)C[C@H]2C[C@H]21) is C12H19NO4.
Describe the ring structures in building block <BB_2637>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2637>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2637>.
**Token:** <BB_2637> **SMILES:** CC(C)(C)OC(=O)N1C[C@H](C(=O)O)C[C@H]2C[C@H]21 **Molecular Formula:** C12H19NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2638>.
C#CC1(C2CC2)CC1
What is the building block token for the following molecule?
C#CC1(C2CC2)CC1
<BB_2638>
What is the molecular formula for <BB_2638>?
The molecular formula for <BB_2638> (C#CC1(C2CC2)CC1) is C8H10.
Describe the ring structures in building block <BB_2638>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2638>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2638>.
**Token:** <BB_2638> **SMILES:** C#CC1(C2CC2)CC1 **Molecular Formula:** C8H10 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2639>.
Fc1ccc2c(CCCl)noc2c1
What is the building block token for the following molecule?
Fc1ccc2c(CCCl)noc2c1
<BB_2639>
What is the molecular formula for <BB_2639>?
The molecular formula for <BB_2639> (Fc1ccc2c(CCCl)noc2c1) is C9H7ClFNO.
Describe the ring structures in building block <BB_2639>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2639>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2639>.
**Token:** <BB_2639> **SMILES:** Fc1ccc2c(CCCl)noc2c1 **Molecular Formula:** C9H7ClFNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2640>.
CCC(C=O)=Cc1cccnc1
What is the building block token for the following molecule?
CCC(C=O)=Cc1cccnc1
<BB_2640>
What is the molecular formula for <BB_2640>?
The molecular formula for <BB_2640> (CCC(C=O)=Cc1cccnc1) is C10H11NO.
Describe the ring structures in building block <BB_2640>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2640>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2640>.
**Token:** <BB_2640> **SMILES:** CCC(C=O)=Cc1cccnc1 **Molecular Formula:** C10H11NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2641>.
COC(=O)C1(F)CCCCC1=O
What is the building block token for the following molecule?
COC(=O)C1(F)CCCCC1=O
<BB_2641>
What is the molecular formula for <BB_2641>?
The molecular formula for <BB_2641> (COC(=O)C1(F)CCCCC1=O) is C8H11FO3.
Describe the ring structures in building block <BB_2641>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2641>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2641>.
**Token:** <BB_2641> **SMILES:** COC(=O)C1(F)CCCCC1=O **Molecular Formula:** C8H11FO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2642>.
COc1ccc(N)cc1-n1cnnn1
What is the building block token for the following molecule?
COc1ccc(N)cc1-n1cnnn1
<BB_2642>
What is the molecular formula for <BB_2642>?
The molecular formula for <BB_2642> (COc1ccc(N)cc1-n1cnnn1) is C8H9N5O.
Describe the ring structures in building block <BB_2642>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2642>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2642>.
**Token:** <BB_2642> **SMILES:** COc1ccc(N)cc1-n1cnnn1 **Molecular Formula:** C8H9N5O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2643>.
Cl.Clc1ncco1
What is the building block token for the following molecule?
Cl.Clc1ncco1
<BB_2643>
What is the molecular formula for <BB_2643>?
The molecular formula for <BB_2643> (Cl.Clc1ncco1) is C3H3Cl2NO.
Describe the ring structures in building block <BB_2643>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2643>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2643>.
**Token:** <BB_2643> **SMILES:** Cl.Clc1ncco1 **Molecular Formula:** C3H3Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2644>.
CCn1c2ccccc2c2cc(N=C=S)ccc21
What is the building block token for the following molecule?
CCn1c2ccccc2c2cc(N=C=S)ccc21
<BB_2644>
What is the molecular formula for <BB_2644>?
The molecular formula for <BB_2644> (CCn1c2ccccc2c2cc(N=C=S)ccc21) is C15H12N2S.
Describe the ring structures in building block <BB_2644>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2644>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2644>.
**Token:** <BB_2644> **SMILES:** CCn1c2ccccc2c2cc(N=C=S)ccc21 **Molecular Formula:** C15H12N2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2645>.
CNC(=O)ON(C(C)=O)C(=O)NC
What is the building block token for the following molecule?
CNC(=O)ON(C(C)=O)C(=O)NC
<BB_2645>
What is the molecular formula for <BB_2645>?
The molecular formula for <BB_2645> (CNC(=O)ON(C(C)=O)C(=O)NC) is C6H11N3O4.
Describe the ring structures in building block <BB_2645>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2645>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2645>.
**Token:** <BB_2645> **SMILES:** CNC(=O)ON(C(C)=O)C(=O)NC **Molecular Formula:** C6H11N3O4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2646>.
CC(=O)OCC1CCNC1.Cl
What is the building block token for the following molecule?
CC(=O)OCC1CCNC1.Cl
<BB_2646>
What is the molecular formula for <BB_2646>?
The molecular formula for <BB_2646> (CC(=O)OCC1CCNC1.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_2646>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2646>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2646>.
**Token:** <BB_2646> **SMILES:** CC(=O)OCC1CCNC1.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2647>.
CC(Br)c1ccc(Cl)c(C(F)(F)F)c1
What is the building block token for the following molecule?
CC(Br)c1ccc(Cl)c(C(F)(F)F)c1
<BB_2647>
What is the molecular formula for <BB_2647>?
The molecular formula for <BB_2647> (CC(Br)c1ccc(Cl)c(C(F)(F)F)c1) is C9H7BrClF3.
Describe the ring structures in building block <BB_2647>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2647>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2647>.
**Token:** <BB_2647> **SMILES:** CC(Br)c1ccc(Cl)c(C(F)(F)F)c1 **Molecular Formula:** C9H7BrClF3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2648>.
COC(=O)c1nn(C)c(I)c1I
What is the building block token for the following molecule?
COC(=O)c1nn(C)c(I)c1I
<BB_2648>
What is the molecular formula for <BB_2648>?
The molecular formula for <BB_2648> (COC(=O)c1nn(C)c(I)c1I) is C6H6I2N2O2.
Describe the ring structures in building block <BB_2648>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2648>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2648>.
**Token:** <BB_2648> **SMILES:** COC(=O)c1nn(C)c(I)c1I **Molecular Formula:** C6H6I2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2649>.
CCc1sccc1B1OC(C)(C)C(C)(C)O1
What is the building block token for the following molecule?
CCc1sccc1B1OC(C)(C)C(C)(C)O1
<BB_2649>
What is the molecular formula for <BB_2649>?
The molecular formula for <BB_2649> (CCc1sccc1B1OC(C)(C)C(C)(C)O1) is C12H19BO2S.
Describe the ring structures in building block <BB_2649>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2649>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2649>.
**Token:** <BB_2649> **SMILES:** CCc1sccc1B1OC(C)(C)C(C)(C)O1 **Molecular Formula:** C12H19BO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** None specific