instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2650>.
COC(=O)C1(S(C)(=O)=O)CNC1.Cl
What is the building block token for the following molecule?
COC(=O)C1(S(C)(=O)=O)CNC1.Cl
<BB_2650>
What is the molecular formula for <BB_2650>?
The molecular formula for <BB_2650> (COC(=O)C1(S(C)(=O)=O)CNC1.Cl) is C6H12ClNO4S.
Describe the ring structures in building block <BB_2650>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2650>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2650>.
**Token:** <BB_2650> **SMILES:** COC(=O)C1(S(C)(=O)=O)CNC1.Cl **Molecular Formula:** C6H12ClNO4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2651>.
C#CCCN(CC)CC.Cl
What is the building block token for the following molecule?
C#CCCN(CC)CC.Cl
<BB_2651>
What is the molecular formula for <BB_2651>?
The molecular formula for <BB_2651> (C#CCCN(CC)CC.Cl) is C8H16ClN.
Describe the ring structures in building block <BB_2651>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2651>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2651>.
**Token:** <BB_2651> **SMILES:** C#CCCN(CC)CC.Cl **Molecular Formula:** C8H16ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2652>.
CC(C)Cc1ccc(C=O)cn1
What is the building block token for the following molecule?
CC(C)Cc1ccc(C=O)cn1
<BB_2652>
What is the molecular formula for <BB_2652>?
The molecular formula for <BB_2652> (CC(C)Cc1ccc(C=O)cn1) is C10H13NO.
Describe the ring structures in building block <BB_2652>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2652>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2652>.
**Token:** <BB_2652> **SMILES:** CC(C)Cc1ccc(C=O)cn1 **Molecular Formula:** C10H13NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2653>.
O=Cc1cnc2c(c1)COC2
What is the building block token for the following molecule?
O=Cc1cnc2c(c1)COC2
<BB_2653>
What is the molecular formula for <BB_2653>?
The molecular formula for <BB_2653> (O=Cc1cnc2c(c1)COC2) is C8H7NO2.
Describe the ring structures in building block <BB_2653>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2653>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2653>.
**Token:** <BB_2653> **SMILES:** O=Cc1cnc2c(c1)COC2 **Molecular Formula:** C8H7NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2654>.
FC(F)(F)COc1cccc(Br)c1
What is the building block token for the following molecule?
FC(F)(F)COc1cccc(Br)c1
<BB_2654>
What is the molecular formula for <BB_2654>?
The molecular formula for <BB_2654> (FC(F)(F)COc1cccc(Br)c1) is C8H6BrF3O.
Describe the ring structures in building block <BB_2654>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2654>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2654>.
**Token:** <BB_2654> **SMILES:** FC(F)(F)COc1cccc(Br)c1 **Molecular Formula:** C8H6BrF3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2655>.
CC(=O)c1cc(I)ccc1Br
What is the building block token for the following molecule?
CC(=O)c1cc(I)ccc1Br
<BB_2655>
What is the molecular formula for <BB_2655>?
The molecular formula for <BB_2655> (CC(=O)c1cc(I)ccc1Br) is C8H6BrIO.
Describe the ring structures in building block <BB_2655>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2655>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2655>.
**Token:** <BB_2655> **SMILES:** CC(=O)c1cc(I)ccc1Br **Molecular Formula:** C8H6BrIO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2656>.
CC1(C)C(=O)C(C)(C)C1=O
What is the building block token for the following molecule?
CC1(C)C(=O)C(C)(C)C1=O
<BB_2656>
What is the molecular formula for <BB_2656>?
The molecular formula for <BB_2656> (CC1(C)C(=O)C(C)(C)C1=O) is C8H12O2.
Describe the ring structures in building block <BB_2656>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2656>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2656>.
**Token:** <BB_2656> **SMILES:** CC1(C)C(=O)C(C)(C)C1=O **Molecular Formula:** C8H12O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2657>.
CN1C(=O)CCc2cc(C(=O)O)ccc21
What is the building block token for the following molecule?
CN1C(=O)CCc2cc(C(=O)O)ccc21
<BB_2657>
What is the molecular formula for <BB_2657>?
The molecular formula for <BB_2657> (CN1C(=O)CCc2cc(C(=O)O)ccc21) is C11H11NO3.
Describe the ring structures in building block <BB_2657>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2657>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2657>.
**Token:** <BB_2657> **SMILES:** CN1C(=O)CCc2cc(C(=O)O)ccc21 **Molecular Formula:** C11H11NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2658>.
O=C1CC[C@@H](C2CCC2)N1
What is the building block token for the following molecule?
O=C1CC[C@@H](C2CCC2)N1
<BB_2658>
What is the molecular formula for <BB_2658>?
The molecular formula for <BB_2658> (O=C1CC[C@@H](C2CCC2)N1) is C8H13NO.
Describe the ring structures in building block <BB_2658>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2658>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2658>.
**Token:** <BB_2658> **SMILES:** O=C1CC[C@@H](C2CCC2)N1 **Molecular Formula:** C8H13NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2659>.
Cc1nc(-c2ccc(Br)cc2)sc1C(C)O
What is the building block token for the following molecule?
Cc1nc(-c2ccc(Br)cc2)sc1C(C)O
<BB_2659>
What is the molecular formula for <BB_2659>?
The molecular formula for <BB_2659> (Cc1nc(-c2ccc(Br)cc2)sc1C(C)O) is C12H12BrNOS.
Describe the ring structures in building block <BB_2659>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2659>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2659>.
**Token:** <BB_2659> **SMILES:** Cc1nc(-c2ccc(Br)cc2)sc1C(C)O **Molecular Formula:** C12H12BrNOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2660>.
FC1(F)CCC(CBr)C1
What is the building block token for the following molecule?
FC1(F)CCC(CBr)C1
<BB_2660>
What is the molecular formula for <BB_2660>?
The molecular formula for <BB_2660> (FC1(F)CCC(CBr)C1) is C6H9BrF2.
Describe the ring structures in building block <BB_2660>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2660>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2660>.
**Token:** <BB_2660> **SMILES:** FC1(F)CCC(CBr)C1 **Molecular Formula:** C6H9BrF2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2661>.
COC(=O)CCCC(=O)Cl
What is the building block token for the following molecule?
COC(=O)CCCC(=O)Cl
<BB_2661>
What is the molecular formula for <BB_2661>?
The molecular formula for <BB_2661> (COC(=O)CCCC(=O)Cl) is C6H9ClO3.
Describe the ring structures in building block <BB_2661>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2661>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2661>.
**Token:** <BB_2661> **SMILES:** COC(=O)CCCC(=O)Cl **Molecular Formula:** C6H9ClO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2662>.
CC(C)(C)c1ccc(CN)o1
What is the building block token for the following molecule?
CC(C)(C)c1ccc(CN)o1
<BB_2662>
What is the molecular formula for <BB_2662>?
The molecular formula for <BB_2662> (CC(C)(C)c1ccc(CN)o1) is C9H15NO.
Describe the ring structures in building block <BB_2662>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2662>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2662>.
**Token:** <BB_2662> **SMILES:** CC(C)(C)c1ccc(CN)o1 **Molecular Formula:** C9H15NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2663>.
CN(C)c1ccc([C@@H]2C[C@H]2C(=O)O)cc1
What is the building block token for the following molecule?
CN(C)c1ccc([C@@H]2C[C@H]2C(=O)O)cc1
<BB_2663>
What is the molecular formula for <BB_2663>?
The molecular formula for <BB_2663> (CN(C)c1ccc([C@@H]2C[C@H]2C(=O)O)cc1) is C12H15NO2.
Describe the ring structures in building block <BB_2663>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2663>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2663>.
**Token:** <BB_2663> **SMILES:** CN(C)c1ccc([C@@H]2C[C@H]2C(=O)O)cc1 **Molecular Formula:** C12H15NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2664>.
CC(C)(C)OC(=O)N1CCC(O)(C(C)(C)C(=O)O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(O)(C(C)(C)C(=O)O)C1
<BB_2664>
What is the molecular formula for <BB_2664>?
The molecular formula for <BB_2664> (CC(C)(C)OC(=O)N1CCC(O)(C(C)(C)C(=O)O)C1) is C13H23NO5.
Describe the ring structures in building block <BB_2664>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2664>.
The molecule contains the following groups: Carboxylic Acid, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2664>.
**Token:** <BB_2664> **SMILES:** CC(C)(C)OC(=O)N1CCC(O)(C(C)(C)C(=O)O)C1 **Molecular Formula:** C13H23NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2665>.
C/C=N/[S@](=O)C(C)(C)C
What is the building block token for the following molecule?
C/C=N/[S@](=O)C(C)(C)C
<BB_2665>
What is the molecular formula for <BB_2665>?
The molecular formula for <BB_2665> (C/C=N/[S@](=O)C(C)(C)C) is C6H13NOS.
Describe the ring structures in building block <BB_2665>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2665>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2665>.
**Token:** <BB_2665> **SMILES:** C/C=N/[S@](=O)C(C)(C)C **Molecular Formula:** C6H13NOS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2666>.
CC(C)(C)C(C)(CBr)CBr
What is the building block token for the following molecule?
CC(C)(C)C(C)(CBr)CBr
<BB_2666>
What is the molecular formula for <BB_2666>?
The molecular formula for <BB_2666> (CC(C)(C)C(C)(CBr)CBr) is C8H16Br2.
Describe the ring structures in building block <BB_2666>.
The molecule is acyclic (contains no rings).