instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2666>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2666>.
**Token:** <BB_2666> **SMILES:** CC(C)(C)C(C)(CBr)CBr **Molecular Formula:** C8H16Br2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2667>.
CC(C)(C)OC(=O)N1CCc2cnc(N)nc2C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCc2cnc(N)nc2C1
<BB_2667>
What is the molecular formula for <BB_2667>?
The molecular formula for <BB_2667> (CC(C)(C)OC(=O)N1CCc2cnc(N)nc2C1) is C12H18N4O2.
Describe the ring structures in building block <BB_2667>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2667>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2667>.
**Token:** <BB_2667> **SMILES:** CC(C)(C)OC(=O)N1CCc2cnc(N)nc2C1 **Molecular Formula:** C12H18N4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2668>.
COc1ccc(-c2ncccn2)cc1Br
What is the building block token for the following molecule?
COc1ccc(-c2ncccn2)cc1Br
<BB_2668>
What is the molecular formula for <BB_2668>?
The molecular formula for <BB_2668> (COc1ccc(-c2ncccn2)cc1Br) is C11H9BrN2O.
Describe the ring structures in building block <BB_2668>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2668>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2668>.
**Token:** <BB_2668> **SMILES:** COc1ccc(-c2ncccn2)cc1Br **Molecular Formula:** C11H9BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2669>.
CCC(CN)Oc1ccccc1C(F)(F)F.Cl
What is the building block token for the following molecule?
CCC(CN)Oc1ccccc1C(F)(F)F.Cl
<BB_2669>
What is the molecular formula for <BB_2669>?
The molecular formula for <BB_2669> (CCC(CN)Oc1ccccc1C(F)(F)F.Cl) is C11H15ClF3NO.
Describe the ring structures in building block <BB_2669>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2669>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2669>.
**Token:** <BB_2669> **SMILES:** CCC(CN)Oc1ccccc1C(F)(F)F.Cl **Molecular Formula:** C11H15ClF3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2670>.
CC(C)(C)c1ncc(I)o1
What is the building block token for the following molecule?
CC(C)(C)c1ncc(I)o1
<BB_2670>
What is the molecular formula for <BB_2670>?
The molecular formula for <BB_2670> (CC(C)(C)c1ncc(I)o1) is C7H10INO.
Describe the ring structures in building block <BB_2670>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2670>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2670>.
**Token:** <BB_2670> **SMILES:** CC(C)(C)c1ncc(I)o1 **Molecular Formula:** C7H10INO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2671>.
FCC(F)c1ccc(Br)cc1
What is the building block token for the following molecule?
FCC(F)c1ccc(Br)cc1
<BB_2671>
What is the molecular formula for <BB_2671>?
The molecular formula for <BB_2671> (FCC(F)c1ccc(Br)cc1) is C8H7BrF2.
Describe the ring structures in building block <BB_2671>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2671>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2671>.
**Token:** <BB_2671> **SMILES:** FCC(F)c1ccc(Br)cc1 **Molecular Formula:** C8H7BrF2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2672>.
O=C(O)c1ccc(S(=O)(=O)c2ccccc2)cc1
What is the building block token for the following molecule?
O=C(O)c1ccc(S(=O)(=O)c2ccccc2)cc1
<BB_2672>
What is the molecular formula for <BB_2672>?
The molecular formula for <BB_2672> (O=C(O)c1ccc(S(=O)(=O)c2ccccc2)cc1) is C13H10O4S.
Describe the ring structures in building block <BB_2672>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2672>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2672>.
**Token:** <BB_2672> **SMILES:** O=C(O)c1ccc(S(=O)(=O)c2ccccc2)cc1 **Molecular Formula:** C13H10O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2673>.
Cl.Cl.c1cnc2sc(C3CCNCC3)nc2c1
What is the building block token for the following molecule?
Cl.Cl.c1cnc2sc(C3CCNCC3)nc2c1
<BB_2673>
What is the molecular formula for <BB_2673>?
The molecular formula for <BB_2673> (Cl.Cl.c1cnc2sc(C3CCNCC3)nc2c1) is C11H15Cl2N3S.
Describe the ring structures in building block <BB_2673>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2673>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2673>.
**Token:** <BB_2673> **SMILES:** Cl.Cl.c1cnc2sc(C3CCNCC3)nc2c1 **Molecular Formula:** C11H15Cl2N3S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2674>.
CCOC(=O)c1nc2n(c1Br)CCNC2.Cl
What is the building block token for the following molecule?
CCOC(=O)c1nc2n(c1Br)CCNC2.Cl
<BB_2674>
What is the molecular formula for <BB_2674>?
The molecular formula for <BB_2674> (CCOC(=O)c1nc2n(c1Br)CCNC2.Cl) is C9H13BrClN3O2.
Describe the ring structures in building block <BB_2674>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2674>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2674>.
**Token:** <BB_2674> **SMILES:** CCOC(=O)c1nc2n(c1Br)CCNC2.Cl **Molecular Formula:** C9H13BrClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2675>.
Nc1oncc1-c1cccc(F)c1
What is the building block token for the following molecule?
Nc1oncc1-c1cccc(F)c1
<BB_2675>
What is the molecular formula for <BB_2675>?
The molecular formula for <BB_2675> (Nc1oncc1-c1cccc(F)c1) is C9H7FN2O.
Describe the ring structures in building block <BB_2675>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2675>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2675>.
**Token:** <BB_2675> **SMILES:** Nc1oncc1-c1cccc(F)c1 **Molecular Formula:** C9H7FN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2676>.
Cl.Cl.O=C1CNCCN1c1ccc(Br)cn1
What is the building block token for the following molecule?
Cl.Cl.O=C1CNCCN1c1ccc(Br)cn1
<BB_2676>
What is the molecular formula for <BB_2676>?
The molecular formula for <BB_2676> (Cl.Cl.O=C1CNCCN1c1ccc(Br)cn1) is C9H12BrCl2N3O.
Describe the ring structures in building block <BB_2676>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2676>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2676>.
**Token:** <BB_2676> **SMILES:** Cl.Cl.O=C1CNCCN1c1ccc(Br)cn1 **Molecular Formula:** C9H12BrCl2N3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2677>.
O=C(O)c1ccc2ccnc(O)c2n1
What is the building block token for the following molecule?
O=C(O)c1ccc2ccnc(O)c2n1
<BB_2677>
What is the molecular formula for <BB_2677>?
The molecular formula for <BB_2677> (O=C(O)c1ccc2ccnc(O)c2n1) is C9H6N2O3.
Describe the ring structures in building block <BB_2677>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2677>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2677>.
**Token:** <BB_2677> **SMILES:** O=C(O)c1ccc2ccnc(O)c2n1 **Molecular Formula:** C9H6N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2678>.
Nc1ccccc1N1CC2CCC1C2
What is the building block token for the following molecule?
Nc1ccccc1N1CC2CCC1C2
<BB_2678>
What is the molecular formula for <BB_2678>?
The molecular formula for <BB_2678> (Nc1ccccc1N1CC2CCC1C2) is C12H16N2.
Describe the ring structures in building block <BB_2678>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2678>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2678>.
**Token:** <BB_2678> **SMILES:** Nc1ccccc1N1CC2CCC1C2 **Molecular Formula:** C12H16N2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2679>.
CC(=O)NCC(=O)N(C)C
What is the building block token for the following molecule?
CC(=O)NCC(=O)N(C)C
<BB_2679>
What is the molecular formula for <BB_2679>?
The molecular formula for <BB_2679> (CC(=O)NCC(=O)N(C)C) is C6H12N2O2.
Describe the ring structures in building block <BB_2679>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2679>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2679>.
**Token:** <BB_2679> **SMILES:** CC(=O)NCC(=O)N(C)C **Molecular Formula:** C6H12N2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2680>.
CCOC(COCC(OCC)OCC)OCC
What is the building block token for the following molecule?
CCOC(COCC(OCC)OCC)OCC
<BB_2680>
What is the molecular formula for <BB_2680>?
The molecular formula for <BB_2680> (CCOC(COCC(OCC)OCC)OCC) is C12H26O5.
Describe the ring structures in building block <BB_2680>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2680>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2680>.
**Token:** <BB_2680> **SMILES:** CCOC(COCC(OCC)OCC)OCC **Molecular Formula:** C12H26O5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2681>.
Cc1ccc(C)c(C2CCNCC2)c1
What is the building block token for the following molecule?
Cc1ccc(C)c(C2CCNCC2)c1
<BB_2681>
What is the molecular formula for <BB_2681>?
The molecular formula for <BB_2681> (Cc1ccc(C)c(C2CCNCC2)c1) is C13H19N.
Describe the ring structures in building block <BB_2681>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2681>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2681>.
**Token:** <BB_2681> **SMILES:** Cc1ccc(C)c(C2CCNCC2)c1 **Molecular Formula:** C13H19N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2682>.
O=S(=O)(Cl)CCC1CCS(=O)(=O)C1
What is the building block token for the following molecule?
O=S(=O)(Cl)CCC1CCS(=O)(=O)C1
<BB_2682>
What is the molecular formula for <BB_2682>?
The molecular formula for <BB_2682> (O=S(=O)(Cl)CCC1CCS(=O)(=O)C1) is C6H11ClO4S2.
Describe the ring structures in building block <BB_2682>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2682>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2682>.
**Token:** <BB_2682> **SMILES:** O=S(=O)(Cl)CCC1CCS(=O)(=O)C1 **Molecular Formula:** C6H11ClO4S2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2683>.
Cc1cc2[nH]c(N)cc(=O)n2n1
What is the building block token for the following molecule?
Cc1cc2[nH]c(N)cc(=O)n2n1
<BB_2683>