instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2683>?
The molecular formula for <BB_2683> (Cc1cc2[nH]c(N)cc(=O)n2n1) is C7H8N4O.
Describe the ring structures in building block <BB_2683>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2683>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2683>.
**Token:** <BB_2683> **SMILES:** Cc1cc2[nH]c(N)cc(=O)n2n1 **Molecular Formula:** C7H8N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2684>.
Cn1nc(C(=O)O)c2c1CCC2
What is the building block token for the following molecule?
Cn1nc(C(=O)O)c2c1CCC2
<BB_2684>
What is the molecular formula for <BB_2684>?
The molecular formula for <BB_2684> (Cn1nc(C(=O)O)c2c1CCC2) is C8H10N2O2.
Describe the ring structures in building block <BB_2684>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2684>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2684>.
**Token:** <BB_2684> **SMILES:** Cn1nc(C(=O)O)c2c1CCC2 **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2685>.
Brc1ccc2cc[nH]c2n1
What is the building block token for the following molecule?
Brc1ccc2cc[nH]c2n1
<BB_2685>
What is the molecular formula for <BB_2685>?
The molecular formula for <BB_2685> (Brc1ccc2cc[nH]c2n1) is C7H5BrN2.
Describe the ring structures in building block <BB_2685>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2685>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2685>.
**Token:** <BB_2685> **SMILES:** Brc1ccc2cc[nH]c2n1 **Molecular Formula:** C7H5BrN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2686>.
O=C(O)C12COC(c3ccc(Br)cc3)(C1)C2
What is the building block token for the following molecule?
O=C(O)C12COC(c3ccc(Br)cc3)(C1)C2
<BB_2686>
What is the molecular formula for <BB_2686>?
The molecular formula for <BB_2686> (O=C(O)C12COC(c3ccc(Br)cc3)(C1)C2) is C12H11BrO3.
Describe the ring structures in building block <BB_2686>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2686>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2686>.
**Token:** <BB_2686> **SMILES:** O=C(O)C12COC(c3ccc(Br)cc3)(C1)C2 **Molecular Formula:** C12H11BrO3 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2687>.
Nc1nc(=O)cn[nH]1
What is the building block token for the following molecule?
Nc1nc(=O)cn[nH]1
<BB_2687>
What is the molecular formula for <BB_2687>?
The molecular formula for <BB_2687> (Nc1nc(=O)cn[nH]1) is C3H4N4O.
Describe the ring structures in building block <BB_2687>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2687>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2687>.
**Token:** <BB_2687> **SMILES:** Nc1nc(=O)cn[nH]1 **Molecular Formula:** C3H4N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2688>.
COc1cc(N=C=O)ccc1F
What is the building block token for the following molecule?
COc1cc(N=C=O)ccc1F
<BB_2688>
What is the molecular formula for <BB_2688>?
The molecular formula for <BB_2688> (COc1cc(N=C=O)ccc1F) is C8H6FNO2.
Describe the ring structures in building block <BB_2688>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2688>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2688>.
**Token:** <BB_2688> **SMILES:** COc1cc(N=C=O)ccc1F **Molecular Formula:** C8H6FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2689>.
FC(F)(F)c1ccccn1
What is the building block token for the following molecule?
FC(F)(F)c1ccccn1
<BB_2689>
What is the molecular formula for <BB_2689>?
The molecular formula for <BB_2689> (FC(F)(F)c1ccccn1) is C6H4F3N.
Describe the ring structures in building block <BB_2689>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2689>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2689>.
**Token:** <BB_2689> **SMILES:** FC(F)(F)c1ccccn1 **Molecular Formula:** C6H4F3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2690>.
COc1ccc(-c2csc(N)n2)c(Br)c1
What is the building block token for the following molecule?
COc1ccc(-c2csc(N)n2)c(Br)c1
<BB_2690>
What is the molecular formula for <BB_2690>?
The molecular formula for <BB_2690> (COc1ccc(-c2csc(N)n2)c(Br)c1) is C10H9BrN2OS.
Describe the ring structures in building block <BB_2690>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2690>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2690>.
**Token:** <BB_2690> **SMILES:** COc1ccc(-c2csc(N)n2)c(Br)c1 **Molecular Formula:** C10H9BrN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2691>.
Br.Br.Brc1ccc(N2CCNCC2)nn1
What is the building block token for the following molecule?
Br.Br.Brc1ccc(N2CCNCC2)nn1
<BB_2691>
What is the molecular formula for <BB_2691>?
The molecular formula for <BB_2691> (Br.Br.Brc1ccc(N2CCNCC2)nn1) is C8H13Br3N4.
Describe the ring structures in building block <BB_2691>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2691>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2691>.
**Token:** <BB_2691> **SMILES:** Br.Br.Brc1ccc(N2CCNCC2)nn1 **Molecular Formula:** C8H13Br3N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2692>.
COC(=O)c1ccc(Br)cc1C(=O)O
What is the building block token for the following molecule?
COC(=O)c1ccc(Br)cc1C(=O)O
<BB_2692>
What is the molecular formula for <BB_2692>?
The molecular formula for <BB_2692> (COC(=O)c1ccc(Br)cc1C(=O)O) is C9H7BrO4.
Describe the ring structures in building block <BB_2692>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2692>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2692>.
**Token:** <BB_2692> **SMILES:** COC(=O)c1ccc(Br)cc1C(=O)O **Molecular Formula:** C9H7BrO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2693>.
CN1NC=C2CN=C(Cl)N=C21
What is the building block token for the following molecule?
CN1NC=C2CN=C(Cl)N=C21
<BB_2693>
What is the molecular formula for <BB_2693>?
The molecular formula for <BB_2693> (CN1NC=C2CN=C(Cl)N=C21) is C6H7ClN4.
Describe the ring structures in building block <BB_2693>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2693>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2693>.
**Token:** <BB_2693> **SMILES:** CN1NC=C2CN=C(Cl)N=C21 **Molecular Formula:** C6H7ClN4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2694>.
CC12COC(CO)(C1)C2
What is the building block token for the following molecule?
CC12COC(CO)(C1)C2
<BB_2694>
What is the molecular formula for <BB_2694>?
The molecular formula for <BB_2694> (CC12COC(CO)(C1)C2) is C7H12O2.
Describe the ring structures in building block <BB_2694>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2694>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2694>.
**Token:** <BB_2694> **SMILES:** CC12COC(CO)(C1)C2 **Molecular Formula:** C7H12O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2695>.
O=C(O)c1ccnc(Br)c1Cl
What is the building block token for the following molecule?
O=C(O)c1ccnc(Br)c1Cl
<BB_2695>
What is the molecular formula for <BB_2695>?
The molecular formula for <BB_2695> (O=C(O)c1ccnc(Br)c1Cl) is C6H3BrClNO2.
Describe the ring structures in building block <BB_2695>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2695>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2695>.
**Token:** <BB_2695> **SMILES:** O=C(O)c1ccnc(Br)c1Cl **Molecular Formula:** C6H3BrClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2696>.
NCc1ccccc1-c1ccc(Cl)cc1Cl
What is the building block token for the following molecule?
NCc1ccccc1-c1ccc(Cl)cc1Cl
<BB_2696>
What is the molecular formula for <BB_2696>?
The molecular formula for <BB_2696> (NCc1ccccc1-c1ccc(Cl)cc1Cl) is C13H11Cl2N.
Describe the ring structures in building block <BB_2696>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2696>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2696>.
**Token:** <BB_2696> **SMILES:** NCc1ccccc1-c1ccc(Cl)cc1Cl **Molecular Formula:** C13H11Cl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2697>.
CCC1(C=O)CCC1
What is the building block token for the following molecule?
CCC1(C=O)CCC1
<BB_2697>
What is the molecular formula for <BB_2697>?
The molecular formula for <BB_2697> (CCC1(C=O)CCC1) is C7H12O.
Describe the ring structures in building block <BB_2697>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2697>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2697>.
**Token:** <BB_2697> **SMILES:** CCC1(C=O)CCC1 **Molecular Formula:** C7H12O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2698>.
CS(=O)(=O)Cc1ccon1
What is the building block token for the following molecule?
CS(=O)(=O)Cc1ccon1
<BB_2698>
What is the molecular formula for <BB_2698>?
The molecular formula for <BB_2698> (CS(=O)(=O)Cc1ccon1) is C5H7NO3S.
Describe the ring structures in building block <BB_2698>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2698>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2698>.
**Token:** <BB_2698> **SMILES:** CS(=O)(=O)Cc1ccon1 **Molecular Formula:** C5H7NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2699>.
COc1ccccc1CNC(=O)n1ccnc1
What is the building block token for the following molecule?
COc1ccccc1CNC(=O)n1ccnc1
<BB_2699>
What is the molecular formula for <BB_2699>?
The molecular formula for <BB_2699> (COc1ccccc1CNC(=O)n1ccnc1) is C12H13N3O2.
Describe the ring structures in building block <BB_2699>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2699>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2699>.
**Token:** <BB_2699> **SMILES:** COc1ccccc1CNC(=O)n1ccnc1 **Molecular Formula:** C12H13N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide, Ether