instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_300>.
NC1CCN(Cc2ccsc2)CC1
What is the building block token for the following molecule?
NC1CCN(Cc2ccsc2)CC1
<BB_300>
What is the molecular formula for <BB_300>?
The molecular formula for <BB_300> (NC1CCN(Cc2ccsc2)CC1) is C10H16N2S.
Describe the ring structures in building block <BB_300>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_300>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_300>.
**Token:** <BB_300> **SMILES:** NC1CCN(Cc2ccsc2)CC1 **Molecular Formula:** C10H16N2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_301>.
N#CC(NC(=O)c1ccccc1)C1CC1
What is the building block token for the following molecule?
N#CC(NC(=O)c1ccccc1)C1CC1
<BB_301>
What is the molecular formula for <BB_301>?
The molecular formula for <BB_301> (N#CC(NC(=O)c1ccccc1)C1CC1) is C12H12N2O.
Describe the ring structures in building block <BB_301>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_301>.
The molecule contains the following groups: Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_301>.
**Token:** <BB_301> **SMILES:** N#CC(NC(=O)c1ccccc1)C1CC1 **Molecular Formula:** C12H12N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amide, Nitrile
Provide the SMILES representation for the building block token <BB_302>.
Cc1nn(-c2ccc(C(=O)O)cc2)c(C)c1Br
What is the building block token for the following molecule?
Cc1nn(-c2ccc(C(=O)O)cc2)c(C)c1Br
<BB_302>
What is the molecular formula for <BB_302>?
The molecular formula for <BB_302> (Cc1nn(-c2ccc(C(=O)O)cc2)c(C)c1Br) is C12H11BrN2O2.
Describe the ring structures in building block <BB_302>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_302>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_302>.
**Token:** <BB_302> **SMILES:** Cc1nn(-c2ccc(C(=O)O)cc2)c(C)c1Br **Molecular Formula:** C12H11BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_303>.
CC(C)N(C(=O)CCl)C1CCCCC1
What is the building block token for the following molecule?
CC(C)N(C(=O)CCl)C1CCCCC1
<BB_303>
What is the molecular formula for <BB_303>?
The molecular formula for <BB_303> (CC(C)N(C(=O)CCl)C1CCCCC1) is C11H20ClNO.
Describe the ring structures in building block <BB_303>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_303>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_303>.
**Token:** <BB_303> **SMILES:** CC(C)N(C(=O)CCl)C1CCCCC1 **Molecular Formula:** C11H20ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_304>.
Nc1cccc(CN2CCCCC2)c1
What is the building block token for the following molecule?
Nc1cccc(CN2CCCCC2)c1
<BB_304>
What is the molecular formula for <BB_304>?
The molecular formula for <BB_304> (Nc1cccc(CN2CCCCC2)c1) is C12H18N2.
Describe the ring structures in building block <BB_304>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_304>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_304>.
**Token:** <BB_304> **SMILES:** Nc1cccc(CN2CCCCC2)c1 **Molecular Formula:** C12H18N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_305>.
N#Cc1coc(C2CCC2)n1
What is the building block token for the following molecule?
N#Cc1coc(C2CCC2)n1
<BB_305>
What is the molecular formula for <BB_305>?
The molecular formula for <BB_305> (N#Cc1coc(C2CCC2)n1) is C8H8N2O.
Describe the ring structures in building block <BB_305>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_305>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_305>.
**Token:** <BB_305> **SMILES:** N#Cc1coc(C2CCC2)n1 **Molecular Formula:** C8H8N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_306>.
CCOCCc1c(C)nc2n(c1=O)CCCC2
What is the building block token for the following molecule?
CCOCCc1c(C)nc2n(c1=O)CCCC2
<BB_306>
What is the molecular formula for <BB_306>?
The molecular formula for <BB_306> (CCOCCc1c(C)nc2n(c1=O)CCCC2) is C13H20N2O2.
Describe the ring structures in building block <BB_306>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_306>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_306>.
**Token:** <BB_306> **SMILES:** CCOCCc1c(C)nc2n(c1=O)CCCC2 **Molecular Formula:** C13H20N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_307>.
N#CC(C#N)c1cncnc1
What is the building block token for the following molecule?
N#CC(C#N)c1cncnc1
<BB_307>
What is the molecular formula for <BB_307>?
The molecular formula for <BB_307> (N#CC(C#N)c1cncnc1) is C7H4N4.
Describe the ring structures in building block <BB_307>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_307>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_307>.
**Token:** <BB_307> **SMILES:** N#CC(C#N)c1cncnc1 **Molecular Formula:** C7H4N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_308>.
Cc1ccc(C2CCCCN2)cc1
What is the building block token for the following molecule?
Cc1ccc(C2CCCCN2)cc1
<BB_308>
What is the molecular formula for <BB_308>?
The molecular formula for <BB_308> (Cc1ccc(C2CCCCN2)cc1) is C12H17N.
Describe the ring structures in building block <BB_308>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_308>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_308>.
**Token:** <BB_308> **SMILES:** Cc1ccc(C2CCCCN2)cc1 **Molecular Formula:** C12H17N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_309>.
Cl.NC1(c2ccc(Cl)nc2)CC1
What is the building block token for the following molecule?
Cl.NC1(c2ccc(Cl)nc2)CC1
<BB_309>
What is the molecular formula for <BB_309>?
The molecular formula for <BB_309> (Cl.NC1(c2ccc(Cl)nc2)CC1) is C8H10Cl2N2.
Describe the ring structures in building block <BB_309>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_309>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_309>.
**Token:** <BB_309> **SMILES:** Cl.NC1(c2ccc(Cl)nc2)CC1 **Molecular Formula:** C8H10Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_310>.
N#Cc1ncsc1Br
What is the building block token for the following molecule?
N#Cc1ncsc1Br
<BB_310>
What is the molecular formula for <BB_310>?
The molecular formula for <BB_310> (N#Cc1ncsc1Br) is C4HBrN2S.
Describe the ring structures in building block <BB_310>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_310>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_310>.
**Token:** <BB_310> **SMILES:** N#Cc1ncsc1Br **Molecular Formula:** C4HBrN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_311>.
CC(Cl)C(=O)Nc1cc(Cl)ccc1Cl
What is the building block token for the following molecule?
CC(Cl)C(=O)Nc1cc(Cl)ccc1Cl
<BB_311>
What is the molecular formula for <BB_311>?
The molecular formula for <BB_311> (CC(Cl)C(=O)Nc1cc(Cl)ccc1Cl) is C9H8Cl3NO.
Describe the ring structures in building block <BB_311>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_311>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_311>.
**Token:** <BB_311> **SMILES:** CC(Cl)C(=O)Nc1cc(Cl)ccc1Cl **Molecular Formula:** C9H8Cl3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_312>.
Cc1ccc(-c2nc(CCl)no2)cc1
What is the building block token for the following molecule?
Cc1ccc(-c2nc(CCl)no2)cc1
<BB_312>
What is the molecular formula for <BB_312>?
The molecular formula for <BB_312> (Cc1ccc(-c2nc(CCl)no2)cc1) is C10H9ClN2O.
Describe the ring structures in building block <BB_312>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_312>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_312>.
**Token:** <BB_312> **SMILES:** Cc1ccc(-c2nc(CCl)no2)cc1 **Molecular Formula:** C10H9ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_313>.
O=Cc1cc2sccc2s1
What is the building block token for the following molecule?
O=Cc1cc2sccc2s1
<BB_313>
What is the molecular formula for <BB_313>?
The molecular formula for <BB_313> (O=Cc1cc2sccc2s1) is C7H4OS2.
Describe the ring structures in building block <BB_313>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_313>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_313>.
**Token:** <BB_313> **SMILES:** O=Cc1cc2sccc2s1 **Molecular Formula:** C7H4OS2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_314>.
COC(=O)C(F)(F)CC(=O)O
What is the building block token for the following molecule?
COC(=O)C(F)(F)CC(=O)O
<BB_314>
What is the molecular formula for <BB_314>?
The molecular formula for <BB_314> (COC(=O)C(F)(F)CC(=O)O) is C5H6F2O4.
Describe the ring structures in building block <BB_314>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_314>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_314>.
**Token:** <BB_314> **SMILES:** COC(=O)C(F)(F)CC(=O)O **Molecular Formula:** C5H6F2O4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_315>.
O=c1[nH][nH]c(=O)c2c([N+](=O)[O-])cccc12
What is the building block token for the following molecule?
O=c1[nH][nH]c(=O)c2c([N+](=O)[O-])cccc12
<BB_315>
What is the molecular formula for <BB_315>?
The molecular formula for <BB_315> (O=c1[nH][nH]c(=O)c2c([N+](=O)[O-])cccc12) is C8H5N3O4.
Describe the ring structures in building block <BB_315>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_315>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_315>.
**Token:** <BB_315> **SMILES:** O=c1[nH][nH]c(=O)c2c([N+](=O)[O-])cccc12 **Molecular Formula:** C8H5N3O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_316>.
O=S([O-])c1cc(F)ccc1Br.[Na+]
What is the building block token for the following molecule?
O=S([O-])c1cc(F)ccc1Br.[Na+]
<BB_316>
What is the molecular formula for <BB_316>?
The molecular formula for <BB_316> (O=S([O-])c1cc(F)ccc1Br.[Na+]) is C6H3BrFNaO2S.
Describe the ring structures in building block <BB_316>.
The molecule contains 1 ring(s): an aromatic ring of size 6.