instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2850>.
FC(F)(F)c1cccc(Cl)c1I
What is the building block token for the following molecule?
FC(F)(F)c1cccc(Cl)c1I
<BB_2850>
What is the molecular formula for <BB_2850>?
The molecular formula for <BB_2850> (FC(F)(F)c1cccc(Cl)c1I) is C7H3ClF3I.
Describe the ring structures in building block <BB_2850>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2850>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2850>.
**Token:** <BB_2850> **SMILES:** FC(F)(F)c1cccc(Cl)c1I **Molecular Formula:** C7H3ClF3I **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2851>.
C=C1CC(F)(COS(C)(=O)=O)C1
What is the building block token for the following molecule?
C=C1CC(F)(COS(C)(=O)=O)C1
<BB_2851>
What is the molecular formula for <BB_2851>?
The molecular formula for <BB_2851> (C=C1CC(F)(COS(C)(=O)=O)C1) is C7H11FO3S.
Describe the ring structures in building block <BB_2851>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2851>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2851>.
**Token:** <BB_2851> **SMILES:** C=C1CC(F)(COS(C)(=O)=O)C1 **Molecular Formula:** C7H11FO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2852>.
OC1COC2CC1C2
What is the building block token for the following molecule?
OC1COC2CC1C2
<BB_2852>
What is the molecular formula for <BB_2852>?
The molecular formula for <BB_2852> (OC1COC2CC1C2) is C6H10O2.
Describe the ring structures in building block <BB_2852>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2852>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2852>.
**Token:** <BB_2852> **SMILES:** OC1COC2CC1C2 **Molecular Formula:** C6H10O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2853>.
CC(C)(C)OC(=O)NC1(C(=O)O)CCOC(C)(C)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1(C(=O)O)CCOC(C)(C)C1
<BB_2853>
What is the molecular formula for <BB_2853>?
The molecular formula for <BB_2853> (CC(C)(C)OC(=O)NC1(C(=O)O)CCOC(C)(C)C1) is C13H23NO5.
Describe the ring structures in building block <BB_2853>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2853>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2853>.
**Token:** <BB_2853> **SMILES:** CC(C)(C)OC(=O)NC1(C(=O)O)CCOC(C)(C)C1 **Molecular Formula:** C13H23NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2854>.
CC1CCC(C(=O)O)CC1N
What is the building block token for the following molecule?
CC1CCC(C(=O)O)CC1N
<BB_2854>
What is the molecular formula for <BB_2854>?
The molecular formula for <BB_2854> (CC1CCC(C(=O)O)CC1N) is C8H15NO2.
Describe the ring structures in building block <BB_2854>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2854>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_2854>.
**Token:** <BB_2854> **SMILES:** CC1CCC(C(=O)O)CC1N **Molecular Formula:** C8H15NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_2855>.
Fc1cccc2ccncc12
What is the building block token for the following molecule?
Fc1cccc2ccncc12
<BB_2855>
What is the molecular formula for <BB_2855>?
The molecular formula for <BB_2855> (Fc1cccc2ccncc12) is C9H6FN.
Describe the ring structures in building block <BB_2855>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2855>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2855>.
**Token:** <BB_2855> **SMILES:** Fc1cccc2ccncc12 **Molecular Formula:** C9H6FN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2856>.
Cc1ccc(CCCBr)cc1
What is the building block token for the following molecule?
Cc1ccc(CCCBr)cc1
<BB_2856>
What is the molecular formula for <BB_2856>?
The molecular formula for <BB_2856> (Cc1ccc(CCCBr)cc1) is C10H13Br.
Describe the ring structures in building block <BB_2856>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2856>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2856>.
**Token:** <BB_2856> **SMILES:** Cc1ccc(CCCBr)cc1 **Molecular Formula:** C10H13Br **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2857>.
CC(C)(C)OC(=O)NC(C)(C)C(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(C)(C)C(F)F
<BB_2857>
What is the molecular formula for <BB_2857>?
The molecular formula for <BB_2857> (CC(C)(C)OC(=O)NC(C)(C)C(F)F) is C9H17F2NO2.
Describe the ring structures in building block <BB_2857>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2857>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2857>.
**Token:** <BB_2857> **SMILES:** CC(C)(C)OC(=O)NC(C)(C)C(F)F **Molecular Formula:** C9H17F2NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2858>.
Cc1ccnc(C(=O)O)n1.Cl
What is the building block token for the following molecule?
Cc1ccnc(C(=O)O)n1.Cl
<BB_2858>
What is the molecular formula for <BB_2858>?
The molecular formula for <BB_2858> (Cc1ccnc(C(=O)O)n1.Cl) is C6H7ClN2O2.
Describe the ring structures in building block <BB_2858>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2858>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2858>.
**Token:** <BB_2858> **SMILES:** Cc1ccnc(C(=O)O)n1.Cl **Molecular Formula:** C6H7ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2859>.
Cl.N[C@@H](CC(=O)O)C1CCCCC1
What is the building block token for the following molecule?
Cl.N[C@@H](CC(=O)O)C1CCCCC1
<BB_2859>
What is the molecular formula for <BB_2859>?
The molecular formula for <BB_2859> (Cl.N[C@@H](CC(=O)O)C1CCCCC1) is C9H18ClNO2.
Describe the ring structures in building block <BB_2859>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2859>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2859>.
**Token:** <BB_2859> **SMILES:** Cl.N[C@@H](CC(=O)O)C1CCCCC1 **Molecular Formula:** C9H18ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2860>.
NNc1cccnc1C(F)(F)F
What is the building block token for the following molecule?
NNc1cccnc1C(F)(F)F
<BB_2860>
What is the molecular formula for <BB_2860>?
The molecular formula for <BB_2860> (NNc1cccnc1C(F)(F)F) is C6H6F3N3.
Describe the ring structures in building block <BB_2860>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2860>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2860>.
**Token:** <BB_2860> **SMILES:** NNc1cccnc1C(F)(F)F **Molecular Formula:** C6H6F3N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2861>.
OCc1cc(Cl)ncc1Br
What is the building block token for the following molecule?
OCc1cc(Cl)ncc1Br
<BB_2861>
What is the molecular formula for <BB_2861>?
The molecular formula for <BB_2861> (OCc1cc(Cl)ncc1Br) is C6H5BrClNO.
Describe the ring structures in building block <BB_2861>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2861>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2861>.
**Token:** <BB_2861> **SMILES:** OCc1cc(Cl)ncc1Br **Molecular Formula:** C6H5BrClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2862>.
Cl.Fc1ccc(F)c(OC2CCNCC2)c1
What is the building block token for the following molecule?
Cl.Fc1ccc(F)c(OC2CCNCC2)c1
<BB_2862>
What is the molecular formula for <BB_2862>?
The molecular formula for <BB_2862> (Cl.Fc1ccc(F)c(OC2CCNCC2)c1) is C11H14ClF2NO.
Describe the ring structures in building block <BB_2862>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2862>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2862>.
**Token:** <BB_2862> **SMILES:** Cl.Fc1ccc(F)c(OC2CCNCC2)c1 **Molecular Formula:** C11H14ClF2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2863>.
CC(C)OCC(=O)CCl
What is the building block token for the following molecule?
CC(C)OCC(=O)CCl
<BB_2863>
What is the molecular formula for <BB_2863>?
The molecular formula for <BB_2863> (CC(C)OCC(=O)CCl) is C6H11ClO2.
Describe the ring structures in building block <BB_2863>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2863>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2863>.
**Token:** <BB_2863> **SMILES:** CC(C)OCC(=O)CCl **Molecular Formula:** C6H11ClO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2864>.
COc1ccccc1Nc1ccc([N+](=O)[O-])cc1N
What is the building block token for the following molecule?
COc1ccccc1Nc1ccc([N+](=O)[O-])cc1N
<BB_2864>
What is the molecular formula for <BB_2864>?
The molecular formula for <BB_2864> (COc1ccccc1Nc1ccc([N+](=O)[O-])cc1N) is C13H13N3O3.
Describe the ring structures in building block <BB_2864>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2864>.
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2864>.
**Token:** <BB_2864> **SMILES:** COc1ccccc1Nc1ccc([N+](=O)[O-])cc1N **Molecular Formula:** C13H13N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Tertiary Amine, Ether, Nitro
Provide the SMILES representation for the building block token <BB_2865>.
CC(C)C(Oc1ccccc1Br)C(=O)O
What is the building block token for the following molecule?
CC(C)C(Oc1ccccc1Br)C(=O)O
<BB_2865>
What is the molecular formula for <BB_2865>?
The molecular formula for <BB_2865> (CC(C)C(Oc1ccccc1Br)C(=O)O) is C11H13BrO3.
Describe the ring structures in building block <BB_2865>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2865>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2865>.
**Token:** <BB_2865> **SMILES:** CC(C)C(Oc1ccccc1Br)C(=O)O **Molecular Formula:** C11H13BrO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2866>.
Nc1cc(CC2CCCCC2)n[nH]1
What is the building block token for the following molecule?
Nc1cc(CC2CCCCC2)n[nH]1
<BB_2866>
What is the molecular formula for <BB_2866>?
The molecular formula for <BB_2866> (Nc1cc(CC2CCCCC2)n[nH]1) is C10H17N3.
Describe the ring structures in building block <BB_2866>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.