instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_316>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_316>.
**Token:** <BB_316> **SMILES:** O=S([O-])c1cc(F)ccc1Br.[Na+] **Molecular Formula:** C6H3BrFNaO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_317>.
c1ccc(-c2ccc(C3CCCCN3)cc2)cc1
What is the building block token for the following molecule?
c1ccc(-c2ccc(C3CCCCN3)cc2)cc1
<BB_317>
What is the molecular formula for <BB_317>?
The molecular formula for <BB_317> (c1ccc(-c2ccc(C3CCCCN3)cc2)cc1) is C17H19N.
Describe the ring structures in building block <BB_317>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_317>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_317>.
**Token:** <BB_317> **SMILES:** c1ccc(-c2ccc(C3CCCCN3)cc2)cc1 **Molecular Formula:** C17H19N **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_318>.
CC1(CCN)CCCCC1.Cl
What is the building block token for the following molecule?
CC1(CCN)CCCCC1.Cl
<BB_318>
What is the molecular formula for <BB_318>?
The molecular formula for <BB_318> (CC1(CCN)CCCCC1.Cl) is C9H20ClN.
Describe the ring structures in building block <BB_318>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_318>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_318>.
**Token:** <BB_318> **SMILES:** CC1(CCN)CCCCC1.Cl **Molecular Formula:** C9H20ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_319>.
CCc1ccc(C=O)c(OC)c1
What is the building block token for the following molecule?
CCc1ccc(C=O)c(OC)c1
<BB_319>
What is the molecular formula for <BB_319>?
The molecular formula for <BB_319> (CCc1ccc(C=O)c(OC)c1) is C10H12O2.
Describe the ring structures in building block <BB_319>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_319>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_319>.
**Token:** <BB_319> **SMILES:** CCc1ccc(C=O)c(OC)c1 **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_320>.
COCCOCCOc1cc(N)ccc1Br
What is the building block token for the following molecule?
COCCOCCOc1cc(N)ccc1Br
<BB_320>
What is the molecular formula for <BB_320>?
The molecular formula for <BB_320> (COCCOCCOc1cc(N)ccc1Br) is C11H16BrNO3.
Describe the ring structures in building block <BB_320>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_320>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_320>.
**Token:** <BB_320> **SMILES:** COCCOCCOc1cc(N)ccc1Br **Molecular Formula:** C11H16BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_321>.
O=C(O)Cc1csc(-c2cccc(Br)c2)n1
What is the building block token for the following molecule?
O=C(O)Cc1csc(-c2cccc(Br)c2)n1
<BB_321>
What is the molecular formula for <BB_321>?
The molecular formula for <BB_321> (O=C(O)Cc1csc(-c2cccc(Br)c2)n1) is C11H8BrNO2S.
Describe the ring structures in building block <BB_321>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_321>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_321>.
**Token:** <BB_321> **SMILES:** O=C(O)Cc1csc(-c2cccc(Br)c2)n1 **Molecular Formula:** C11H8BrNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_322>.
Oc1cccc(F)c1I
What is the building block token for the following molecule?
Oc1cccc(F)c1I
<BB_322>
What is the molecular formula for <BB_322>?
The molecular formula for <BB_322> (Oc1cccc(F)c1I) is C6H4FIO.
Describe the ring structures in building block <BB_322>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_322>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_322>.
**Token:** <BB_322> **SMILES:** Oc1cccc(F)c1I **Molecular Formula:** C6H4FIO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_323>.
Cl.OC1CCN(Cc2ccc3c(c2)CCC3)C1
What is the building block token for the following molecule?
Cl.OC1CCN(Cc2ccc3c(c2)CCC3)C1
<BB_323>
What is the molecular formula for <BB_323>?
The molecular formula for <BB_323> (Cl.OC1CCN(Cc2ccc3c(c2)CCC3)C1) is C14H20ClNO.
Describe the ring structures in building block <BB_323>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_323>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_323>.
**Token:** <BB_323> **SMILES:** Cl.OC1CCN(Cc2ccc3c(c2)CCC3)C1 **Molecular Formula:** C14H20ClNO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_324>.
C=C(CC#N)C(=O)OC
What is the building block token for the following molecule?
C=C(CC#N)C(=O)OC
<BB_324>
What is the molecular formula for <BB_324>?
The molecular formula for <BB_324> (C=C(CC#N)C(=O)OC) is C6H7NO2.
Describe the ring structures in building block <BB_324>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_324>.
The molecule contains the following groups: Ester, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_324>.
**Token:** <BB_324> **SMILES:** C=C(CC#N)C(=O)OC **Molecular Formula:** C6H7NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_325>.
Cl.NCc1cc2cc(Br)cnc2o1
What is the building block token for the following molecule?
Cl.NCc1cc2cc(Br)cnc2o1
<BB_325>
What is the molecular formula for <BB_325>?
The molecular formula for <BB_325> (Cl.NCc1cc2cc(Br)cnc2o1) is C8H8BrClN2O.
Describe the ring structures in building block <BB_325>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_325>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_325>.
**Token:** <BB_325> **SMILES:** Cl.NCc1cc2cc(Br)cnc2o1 **Molecular Formula:** C8H8BrClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_326>.
COC(=O)CC(C[N+](=O)[O-])C1CCOCC1
What is the building block token for the following molecule?
COC(=O)CC(C[N+](=O)[O-])C1CCOCC1
<BB_326>
What is the molecular formula for <BB_326>?
The molecular formula for <BB_326> (COC(=O)CC(C[N+](=O)[O-])C1CCOCC1) is C10H17NO5.
Describe the ring structures in building block <BB_326>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_326>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_326>.
**Token:** <BB_326> **SMILES:** COC(=O)CC(C[N+](=O)[O-])C1CCOCC1 **Molecular Formula:** C10H17NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_327>.
CNCC1COCCO1.Cl
What is the building block token for the following molecule?
CNCC1COCCO1.Cl
<BB_327>
What is the molecular formula for <BB_327>?
The molecular formula for <BB_327> (CNCC1COCCO1.Cl) is C6H14ClNO2.
Describe the ring structures in building block <BB_327>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_327>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_327>.
**Token:** <BB_327> **SMILES:** CNCC1COCCO1.Cl **Molecular Formula:** C6H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_328>.
Cc1cn(C2CCNCC2)nn1.Cl.Cl
What is the building block token for the following molecule?
Cc1cn(C2CCNCC2)nn1.Cl.Cl
<BB_328>
What is the molecular formula for <BB_328>?
The molecular formula for <BB_328> (Cc1cn(C2CCNCC2)nn1.Cl.Cl) is C8H16Cl2N4.
Describe the ring structures in building block <BB_328>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_328>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_328>.
**Token:** <BB_328> **SMILES:** Cc1cn(C2CCNCC2)nn1.Cl.Cl **Molecular Formula:** C8H16Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_329>.
C=CC(=O)NCc1ccc2c(c1)CCS2(=O)=O
What is the building block token for the following molecule?
C=CC(=O)NCc1ccc2c(c1)CCS2(=O)=O
<BB_329>
What is the molecular formula for <BB_329>?
The molecular formula for <BB_329> (C=CC(=O)NCc1ccc2c(c1)CCS2(=O)=O) is C12H13NO3S.
Describe the ring structures in building block <BB_329>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_329>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_329>.
**Token:** <BB_329> **SMILES:** C=CC(=O)NCc1ccc2c(c1)CCS2(=O)=O **Molecular Formula:** C12H13NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_330>.
CNC1CCCN(CC(C)C(=O)O)C1.Cl.Cl
What is the building block token for the following molecule?
CNC1CCCN(CC(C)C(=O)O)C1.Cl.Cl
<BB_330>
What is the molecular formula for <BB_330>?
The molecular formula for <BB_330> (CNC1CCCN(CC(C)C(=O)O)C1.Cl.Cl) is C10H22Cl2N2O2.
Describe the ring structures in building block <BB_330>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_330>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_330>.
**Token:** <BB_330> **SMILES:** CNC1CCCN(CC(C)C(=O)O)C1.Cl.Cl **Molecular Formula:** C10H22Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_331>.
CCOC(=O)c1noc(C(C)N)n1.Cl
What is the building block token for the following molecule?
CCOC(=O)c1noc(C(C)N)n1.Cl
<BB_331>
What is the molecular formula for <BB_331>?
The molecular formula for <BB_331> (CCOC(=O)c1noc(C(C)N)n1.Cl) is C7H12ClN3O3.
Describe the ring structures in building block <BB_331>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_331>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_331>.
**Token:** <BB_331> **SMILES:** CCOC(=O)c1noc(C(C)N)n1.Cl **Molecular Formula:** C7H12ClN3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_332>.
CC(=O)C1(C(F)(F)F)CC1
What is the building block token for the following molecule?
CC(=O)C1(C(F)(F)F)CC1
<BB_332>
What is the molecular formula for <BB_332>?
The molecular formula for <BB_332> (CC(=O)C1(C(F)(F)F)CC1) is C6H7F3O.
Describe the ring structures in building block <BB_332>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_332>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_332>.
**Token:** <BB_332> **SMILES:** CC(=O)C1(C(F)(F)F)CC1 **Molecular Formula:** C6H7F3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_333>.
C=CC1(CO)CCC1
What is the building block token for the following molecule?
C=CC1(CO)CCC1
<BB_333>