instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2866>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2866>.
**Token:** <BB_2866> **SMILES:** Nc1cc(CC2CCCCC2)n[nH]1 **Molecular Formula:** C10H17N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2867>.
O=c1c2ccccc2oc2ncccc12
What is the building block token for the following molecule?
O=c1c2ccccc2oc2ncccc12
<BB_2867>
What is the molecular formula for <BB_2867>?
The molecular formula for <BB_2867> (O=c1c2ccccc2oc2ncccc12) is C12H7NO2.
Describe the ring structures in building block <BB_2867>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2867>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2867>.
**Token:** <BB_2867> **SMILES:** O=c1c2ccccc2oc2ncccc12 **Molecular Formula:** C12H7NO2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2868>.
O=C(CCl)NCc1ccccc1Cl
What is the building block token for the following molecule?
O=C(CCl)NCc1ccccc1Cl
<BB_2868>
What is the molecular formula for <BB_2868>?
The molecular formula for <BB_2868> (O=C(CCl)NCc1ccccc1Cl) is C9H9Cl2NO.
Describe the ring structures in building block <BB_2868>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2868>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2868>.
**Token:** <BB_2868> **SMILES:** O=C(CCl)NCc1ccccc1Cl **Molecular Formula:** C9H9Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2869>.
CCn1cc(CNc2ccccc2C(=O)O)cn1
What is the building block token for the following molecule?
CCn1cc(CNc2ccccc2C(=O)O)cn1
<BB_2869>
What is the molecular formula for <BB_2869>?
The molecular formula for <BB_2869> (CCn1cc(CNc2ccccc2C(=O)O)cn1) is C13H15N3O2.
Describe the ring structures in building block <BB_2869>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2869>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2869>.
**Token:** <BB_2869> **SMILES:** CCn1cc(CNc2ccccc2C(=O)O)cn1 **Molecular Formula:** C13H15N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine
Provide the SMILES representation for the building block token <BB_2870>.
CC(=O)c1nc2cc(Cl)ccc2n1C
What is the building block token for the following molecule?
CC(=O)c1nc2cc(Cl)ccc2n1C
<BB_2870>
What is the molecular formula for <BB_2870>?
The molecular formula for <BB_2870> (CC(=O)c1nc2cc(Cl)ccc2n1C) is C10H9ClN2O.
Describe the ring structures in building block <BB_2870>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2870>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2870>.
**Token:** <BB_2870> **SMILES:** CC(=O)c1nc2cc(Cl)ccc2n1C **Molecular Formula:** C10H9ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2871>.
CC(C)(C)OC(=O)C(N)Cc1ccc(C#N)nc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C(N)Cc1ccc(C#N)nc1
<BB_2871>
What is the molecular formula for <BB_2871>?
The molecular formula for <BB_2871> (CC(C)(C)OC(=O)C(N)Cc1ccc(C#N)nc1) is C13H17N3O2.
Describe the ring structures in building block <BB_2871>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2871>.
The molecule contains the following groups: Amine, Ester, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2871>.
**Token:** <BB_2871> **SMILES:** CC(C)(C)OC(=O)C(N)Cc1ccc(C#N)nc1 **Molecular Formula:** C13H17N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2872>.
Cl.Nc1cc(C=O)ccn1
What is the building block token for the following molecule?
Cl.Nc1cc(C=O)ccn1
<BB_2872>
What is the molecular formula for <BB_2872>?
The molecular formula for <BB_2872> (Cl.Nc1cc(C=O)ccn1) is C6H7ClN2O.
Describe the ring structures in building block <BB_2872>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2872>.
The molecule contains the following groups: Amine, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2872>.
**Token:** <BB_2872> **SMILES:** Cl.Nc1cc(C=O)ccn1 **Molecular Formula:** C6H7ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2873>.
Cc1cc2ncc(F)cc2[nH]1
What is the building block token for the following molecule?
Cc1cc2ncc(F)cc2[nH]1
<BB_2873>
What is the molecular formula for <BB_2873>?
The molecular formula for <BB_2873> (Cc1cc2ncc(F)cc2[nH]1) is C8H7FN2.
Describe the ring structures in building block <BB_2873>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2873>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2873>.
**Token:** <BB_2873> **SMILES:** Cc1cc2ncc(F)cc2[nH]1 **Molecular Formula:** C8H7FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2874>.
COc1nc(I)cs1
What is the building block token for the following molecule?
COc1nc(I)cs1
<BB_2874>
What is the molecular formula for <BB_2874>?
The molecular formula for <BB_2874> (COc1nc(I)cs1) is C4H4INOS.
Describe the ring structures in building block <BB_2874>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2874>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2874>.
**Token:** <BB_2874> **SMILES:** COc1nc(I)cs1 **Molecular Formula:** C4H4INOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2875>.
N#CC1(c2ccncc2)CCCCC1
What is the building block token for the following molecule?
N#CC1(c2ccncc2)CCCCC1
<BB_2875>
What is the molecular formula for <BB_2875>?
The molecular formula for <BB_2875> (N#CC1(c2ccncc2)CCCCC1) is C12H14N2.
Describe the ring structures in building block <BB_2875>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2875>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2875>.
**Token:** <BB_2875> **SMILES:** N#CC1(c2ccncc2)CCCCC1 **Molecular Formula:** C12H14N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_2876>.
COc1cccc(NN)n1.Cl
What is the building block token for the following molecule?
COc1cccc(NN)n1.Cl
<BB_2876>
What is the molecular formula for <BB_2876>?
The molecular formula for <BB_2876> (COc1cccc(NN)n1.Cl) is C6H10ClN3O.
Describe the ring structures in building block <BB_2876>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2876>.
The molecule contains the following groups: Amine, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2876>.
**Token:** <BB_2876> **SMILES:** COc1cccc(NN)n1.Cl **Molecular Formula:** C6H10ClN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2877>.
O=C1CC(Nc2ccccc2)=NN1
What is the building block token for the following molecule?
O=C1CC(Nc2ccccc2)=NN1
<BB_2877>
What is the molecular formula for <BB_2877>?
The molecular formula for <BB_2877> (O=C1CC(Nc2ccccc2)=NN1) is C9H9N3O.
Describe the ring structures in building block <BB_2877>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2877>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2877>.
**Token:** <BB_2877> **SMILES:** O=C1CC(Nc2ccccc2)=NN1 **Molecular Formula:** C9H9N3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_2878>.
Cl.O=C1CNc2ncc(Br)cc2N1
What is the building block token for the following molecule?
Cl.O=C1CNc2ncc(Br)cc2N1
<BB_2878>
What is the molecular formula for <BB_2878>?
The molecular formula for <BB_2878> (Cl.O=C1CNc2ncc(Br)cc2N1) is C7H7BrClN3O.
Describe the ring structures in building block <BB_2878>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2878>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2878>.
**Token:** <BB_2878> **SMILES:** Cl.O=C1CNc2ncc(Br)cc2N1 **Molecular Formula:** C7H7BrClN3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2879>.
COC(=O)/C=C/c1cccc(F)c1
What is the building block token for the following molecule?
COC(=O)/C=C/c1cccc(F)c1
<BB_2879>
What is the molecular formula for <BB_2879>?
The molecular formula for <BB_2879> (COC(=O)/C=C/c1cccc(F)c1) is C10H9FO2.
Describe the ring structures in building block <BB_2879>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2879>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2879>.
**Token:** <BB_2879> **SMILES:** COC(=O)/C=C/c1cccc(F)c1 **Molecular Formula:** C10H9FO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2880>.
N#Cc1ccc(-c2nc3cc(F)c(F)cc3[nH]2)cc1
What is the building block token for the following molecule?
N#Cc1ccc(-c2nc3cc(F)c(F)cc3[nH]2)cc1
<BB_2880>
What is the molecular formula for <BB_2880>?
The molecular formula for <BB_2880> (N#Cc1ccc(-c2nc3cc(F)c(F)cc3[nH]2)cc1) is C14H7F2N3.
Describe the ring structures in building block <BB_2880>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2880>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2880>.
**Token:** <BB_2880> **SMILES:** N#Cc1ccc(-c2nc3cc(F)c(F)cc3[nH]2)cc1 **Molecular Formula:** C14H7F2N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2881>.
COc1ccc2c(C)ccnc2c1
What is the building block token for the following molecule?
COc1ccc2c(C)ccnc2c1
<BB_2881>
What is the molecular formula for <BB_2881>?
The molecular formula for <BB_2881> (COc1ccc2c(C)ccnc2c1) is C11H11NO.
Describe the ring structures in building block <BB_2881>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2881>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2881>.
**Token:** <BB_2881> **SMILES:** COc1ccc2c(C)ccnc2c1 **Molecular Formula:** C11H11NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2882>.
Cl.NCCc1csnn1
What is the building block token for the following molecule?
Cl.NCCc1csnn1
<BB_2882>
What is the molecular formula for <BB_2882>?
The molecular formula for <BB_2882> (Cl.NCCc1csnn1) is C4H8ClN3S.
Describe the ring structures in building block <BB_2882>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2882>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2882>.
**Token:** <BB_2882> **SMILES:** Cl.NCCc1csnn1 **Molecular Formula:** C4H8ClN3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2883>.
CCC(C)(C)C(=O)C(=O)O
What is the building block token for the following molecule?
CCC(C)(C)C(=O)C(=O)O
<BB_2883>