instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2883>?
The molecular formula for <BB_2883> (CCC(C)(C)C(=O)C(=O)O) is C7H12O3.
Describe the ring structures in building block <BB_2883>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2883>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_2883>.
**Token:** <BB_2883> **SMILES:** CCC(C)(C)C(=O)C(=O)O **Molecular Formula:** C7H12O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_2884>.
CS(=O)(=O)c1ccc(F)c(C(=O)O)c1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(F)c(C(=O)O)c1
<BB_2884>
What is the molecular formula for <BB_2884>?
The molecular formula for <BB_2884> (CS(=O)(=O)c1ccc(F)c(C(=O)O)c1) is C8H7FO4S.
Describe the ring structures in building block <BB_2884>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2884>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2884>.
**Token:** <BB_2884> **SMILES:** CS(=O)(=O)c1ccc(F)c(C(=O)O)c1 **Molecular Formula:** C8H7FO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2885>.
CC1Cc2nc(Cl)ncc2C(C)O1
What is the building block token for the following molecule?
CC1Cc2nc(Cl)ncc2C(C)O1
<BB_2885>
What is the molecular formula for <BB_2885>?
The molecular formula for <BB_2885> (CC1Cc2nc(Cl)ncc2C(C)O1) is C9H11ClN2O.
Describe the ring structures in building block <BB_2885>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2885>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2885>.
**Token:** <BB_2885> **SMILES:** CC1Cc2nc(Cl)ncc2C(C)O1 **Molecular Formula:** C9H11ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2886>.
CC(C)(C)OC(=O)NC(CC(=O)O)C1CC(F)(F)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CC(=O)O)C1CC(F)(F)C1
<BB_2886>
What is the molecular formula for <BB_2886>?
The molecular formula for <BB_2886> (CC(C)(C)OC(=O)NC(CC(=O)O)C1CC(F)(F)C1) is C12H19F2NO4.
Describe the ring structures in building block <BB_2886>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2886>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2886>.
**Token:** <BB_2886> **SMILES:** CC(C)(C)OC(=O)NC(CC(=O)O)C1CC(F)(F)C1 **Molecular Formula:** C12H19F2NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2887>.
BrCC1CN=C(c2ccccc2)O1
What is the building block token for the following molecule?
BrCC1CN=C(c2ccccc2)O1
<BB_2887>
What is the molecular formula for <BB_2887>?
The molecular formula for <BB_2887> (BrCC1CN=C(c2ccccc2)O1) is C10H10BrNO.
Describe the ring structures in building block <BB_2887>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2887>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2887>.
**Token:** <BB_2887> **SMILES:** BrCC1CN=C(c2ccccc2)O1 **Molecular Formula:** C10H10BrNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2888>.
COc1cc(N(C)C)ccc1C(=O)O
What is the building block token for the following molecule?
COc1cc(N(C)C)ccc1C(=O)O
<BB_2888>
What is the molecular formula for <BB_2888>?
The molecular formula for <BB_2888> (COc1cc(N(C)C)ccc1C(=O)O) is C10H13NO3.
Describe the ring structures in building block <BB_2888>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2888>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2888>.
**Token:** <BB_2888> **SMILES:** COc1cc(N(C)C)ccc1C(=O)O **Molecular Formula:** C10H13NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2889>.
CCN(CC)c1ccc(NCc2cccs2)cc1
What is the building block token for the following molecule?
CCN(CC)c1ccc(NCc2cccs2)cc1
<BB_2889>
What is the molecular formula for <BB_2889>?
The molecular formula for <BB_2889> (CCN(CC)c1ccc(NCc2cccs2)cc1) is C15H20N2S.
Describe the ring structures in building block <BB_2889>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2889>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2889>.
**Token:** <BB_2889> **SMILES:** CCN(CC)c1ccc(NCc2cccs2)cc1 **Molecular Formula:** C15H20N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2890>.
O=C(O)CCCS(=O)(=O)c1ccc(Cl)cc1
What is the building block token for the following molecule?
O=C(O)CCCS(=O)(=O)c1ccc(Cl)cc1
<BB_2890>
What is the molecular formula for <BB_2890>?
The molecular formula for <BB_2890> (O=C(O)CCCS(=O)(=O)c1ccc(Cl)cc1) is C10H11ClO4S.
Describe the ring structures in building block <BB_2890>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2890>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2890>.
**Token:** <BB_2890> **SMILES:** O=C(O)CCCS(=O)(=O)c1ccc(Cl)cc1 **Molecular Formula:** C10H11ClO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2891>.
O=C([O-])c1nnco1.[Li+]
What is the building block token for the following molecule?
O=C([O-])c1nnco1.[Li+]
<BB_2891>
What is the molecular formula for <BB_2891>?
The molecular formula for <BB_2891> (O=C([O-])c1nnco1.[Li+]) is C3HLiN2O3.
Describe the ring structures in building block <BB_2891>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2891>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2891>.
**Token:** <BB_2891> **SMILES:** O=C([O-])c1nnco1.[Li+] **Molecular Formula:** C3HLiN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2892>.
Cc1sc2nc(CN(C)C)nc(Cl)c2c1C
What is the building block token for the following molecule?
Cc1sc2nc(CN(C)C)nc(Cl)c2c1C
<BB_2892>
What is the molecular formula for <BB_2892>?
The molecular formula for <BB_2892> (Cc1sc2nc(CN(C)C)nc(Cl)c2c1C) is C11H14ClN3S.
Describe the ring structures in building block <BB_2892>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2892>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2892>.
**Token:** <BB_2892> **SMILES:** Cc1sc2nc(CN(C)C)nc(Cl)c2c1C **Molecular Formula:** C11H14ClN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2893>.
CC(C)NC(=O)N1CCC(C(=O)O)CC1
What is the building block token for the following molecule?
CC(C)NC(=O)N1CCC(C(=O)O)CC1
<BB_2893>
What is the molecular formula for <BB_2893>?
The molecular formula for <BB_2893> (CC(C)NC(=O)N1CCC(C(=O)O)CC1) is C10H18N2O3.
Describe the ring structures in building block <BB_2893>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2893>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2893>.
**Token:** <BB_2893> **SMILES:** CC(C)NC(=O)N1CCC(C(=O)O)CC1 **Molecular Formula:** C10H18N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2894>.
Cc1ccc([C@@H](C)N)cc1
What is the building block token for the following molecule?
Cc1ccc([C@@H](C)N)cc1
<BB_2894>
What is the molecular formula for <BB_2894>?
The molecular formula for <BB_2894> (Cc1ccc([C@@H](C)N)cc1) is C9H13N.
Describe the ring structures in building block <BB_2894>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2894>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2894>.
**Token:** <BB_2894> **SMILES:** Cc1ccc([C@@H](C)N)cc1 **Molecular Formula:** C9H13N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2895>.
Cc1c[nH]nc1C=O.Cl
What is the building block token for the following molecule?
Cc1c[nH]nc1C=O.Cl
<BB_2895>
What is the molecular formula for <BB_2895>?
The molecular formula for <BB_2895> (Cc1c[nH]nc1C=O.Cl) is C5H7ClN2O.
Describe the ring structures in building block <BB_2895>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2895>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2895>.
**Token:** <BB_2895> **SMILES:** Cc1c[nH]nc1C=O.Cl **Molecular Formula:** C5H7ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2896>.
Cl.FC1(F)CCNC1
What is the building block token for the following molecule?
Cl.FC1(F)CCNC1
<BB_2896>
What is the molecular formula for <BB_2896>?
The molecular formula for <BB_2896> (Cl.FC1(F)CCNC1) is C4H8ClF2N.
Describe the ring structures in building block <BB_2896>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2896>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2896>.
**Token:** <BB_2896> **SMILES:** Cl.FC1(F)CCNC1 **Molecular Formula:** C4H8ClF2N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2897>.
Cc1ccc(C)c(-c2cc(C(=O)O)no2)c1
What is the building block token for the following molecule?
Cc1ccc(C)c(-c2cc(C(=O)O)no2)c1
<BB_2897>
What is the molecular formula for <BB_2897>?
The molecular formula for <BB_2897> (Cc1ccc(C)c(-c2cc(C(=O)O)no2)c1) is C12H11NO3.
Describe the ring structures in building block <BB_2897>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2897>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2897>.
**Token:** <BB_2897> **SMILES:** Cc1ccc(C)c(-c2cc(C(=O)O)no2)c1 **Molecular Formula:** C12H11NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2898>.
O=C(O)CN(CCO)CCO
What is the building block token for the following molecule?
O=C(O)CN(CCO)CCO
<BB_2898>
What is the molecular formula for <BB_2898>?
The molecular formula for <BB_2898> (O=C(O)CN(CCO)CCO) is C6H13NO4.
Describe the ring structures in building block <BB_2898>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2898>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2898>.
**Token:** <BB_2898> **SMILES:** O=C(O)CN(CCO)CCO **Molecular Formula:** C6H13NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2899>.
COC(=O)[C@@H]1C[C@]1(C(=O)O)c1ccc(N)cc1
What is the building block token for the following molecule?
COC(=O)[C@@H]1C[C@]1(C(=O)O)c1ccc(N)cc1
<BB_2899>
What is the molecular formula for <BB_2899>?
The molecular formula for <BB_2899> (COC(=O)[C@@H]1C[C@]1(C(=O)O)c1ccc(N)cc1) is C12H13NO4.
Describe the ring structures in building block <BB_2899>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_2899>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2899>.
**Token:** <BB_2899> **SMILES:** COC(=O)[C@@H]1C[C@]1(C(=O)O)c1ccc(N)cc1 **Molecular Formula:** C12H13NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ester, Ether