instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2900>.
CCOC(=O)C1=CCCCC1
What is the building block token for the following molecule?
CCOC(=O)C1=CCCCC1
<BB_2900>
What is the molecular formula for <BB_2900>?
The molecular formula for <BB_2900> (CCOC(=O)C1=CCCCC1) is C9H14O2.
Describe the ring structures in building block <BB_2900>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2900>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2900>.
**Token:** <BB_2900> **SMILES:** CCOC(=O)C1=CCCCC1 **Molecular Formula:** C9H14O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2901>.
OCc1cnc(C(F)(F)F)s1
What is the building block token for the following molecule?
OCc1cnc(C(F)(F)F)s1
<BB_2901>
What is the molecular formula for <BB_2901>?
The molecular formula for <BB_2901> (OCc1cnc(C(F)(F)F)s1) is C5H4F3NOS.
Describe the ring structures in building block <BB_2901>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2901>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2901>.
**Token:** <BB_2901> **SMILES:** OCc1cnc(C(F)(F)F)s1 **Molecular Formula:** C5H4F3NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2902>.
O=C(O)C12CCCC1C(F)(F)C2
What is the building block token for the following molecule?
O=C(O)C12CCCC1C(F)(F)C2
<BB_2902>
What is the molecular formula for <BB_2902>?
The molecular formula for <BB_2902> (O=C(O)C12CCCC1C(F)(F)C2) is C8H10F2O2.
Describe the ring structures in building block <BB_2902>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2902>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2902>.
**Token:** <BB_2902> **SMILES:** O=C(O)C12CCCC1C(F)(F)C2 **Molecular Formula:** C8H10F2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2903>.
O=NN1CCS(=O)(=O)CC1
What is the building block token for the following molecule?
O=NN1CCS(=O)(=O)CC1
<BB_2903>
What is the molecular formula for <BB_2903>?
The molecular formula for <BB_2903> (O=NN1CCS(=O)(=O)CC1) is C4H8N2O3S.
Describe the ring structures in building block <BB_2903>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2903>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2903>.
**Token:** <BB_2903> **SMILES:** O=NN1CCS(=O)(=O)CC1 **Molecular Formula:** C4H8N2O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_2904>.
CC(=O)Nc1cccc2c1C(=O)CCC2
What is the building block token for the following molecule?
CC(=O)Nc1cccc2c1C(=O)CCC2
<BB_2904>
What is the molecular formula for <BB_2904>?
The molecular formula for <BB_2904> (CC(=O)Nc1cccc2c1C(=O)CCC2) is C12H13NO2.
Describe the ring structures in building block <BB_2904>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2904>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_2904>.
**Token:** <BB_2904> **SMILES:** CC(=O)Nc1cccc2c1C(=O)CCC2 **Molecular Formula:** C12H13NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_2905>.
COc1cc(Cl)ccc1Cl
What is the building block token for the following molecule?
COc1cc(Cl)ccc1Cl
<BB_2905>
What is the molecular formula for <BB_2905>?
The molecular formula for <BB_2905> (COc1cc(Cl)ccc1Cl) is C7H6Cl2O.
Describe the ring structures in building block <BB_2905>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2905>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2905>.
**Token:** <BB_2905> **SMILES:** COc1cc(Cl)ccc1Cl **Molecular Formula:** C7H6Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2906>.
O=[N+]([O-])c1ccc(F)c(-n2cnnn2)c1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc(F)c(-n2cnnn2)c1
<BB_2906>
What is the molecular formula for <BB_2906>?
The molecular formula for <BB_2906> (O=[N+]([O-])c1ccc(F)c(-n2cnnn2)c1) is C7H4FN5O2.
Describe the ring structures in building block <BB_2906>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2906>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2906>.
**Token:** <BB_2906> **SMILES:** O=[N+]([O-])c1ccc(F)c(-n2cnnn2)c1 **Molecular Formula:** C7H4FN5O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2907>.
O=C1NC(=O)C2(CC2)c2ccccc21
What is the building block token for the following molecule?
O=C1NC(=O)C2(CC2)c2ccccc21
<BB_2907>
What is the molecular formula for <BB_2907>?
The molecular formula for <BB_2907> (O=C1NC(=O)C2(CC2)c2ccccc21) is C11H9NO2.
Describe the ring structures in building block <BB_2907>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_2907>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2907>.
**Token:** <BB_2907> **SMILES:** O=C1NC(=O)C2(CC2)c2ccccc21 **Molecular Formula:** C11H9NO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2908>.
O=S(=O)(c1ccc(Cl)cc1)N1C2CCCCCCC21
What is the building block token for the following molecule?
O=S(=O)(c1ccc(Cl)cc1)N1C2CCCCCCC21
<BB_2908>
What is the molecular formula for <BB_2908>?
The molecular formula for <BB_2908> (O=S(=O)(c1ccc(Cl)cc1)N1C2CCCCCCC21) is C14H18ClNO2S.
Describe the ring structures in building block <BB_2908>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 8, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2908>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2908>.
**Token:** <BB_2908> **SMILES:** O=S(=O)(c1ccc(Cl)cc1)N1C2CCCCCCC21 **Molecular Formula:** C14H18ClNO2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 8, an aliphatic ring of size 3. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2909>.
C[C@@](N)(C(=O)O)c1ccccc1
What is the building block token for the following molecule?
C[C@@](N)(C(=O)O)c1ccccc1
<BB_2909>
What is the molecular formula for <BB_2909>?
The molecular formula for <BB_2909> (C[C@@](N)(C(=O)O)c1ccccc1) is C9H11NO2.
Describe the ring structures in building block <BB_2909>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2909>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_2909>.
**Token:** <BB_2909> **SMILES:** C[C@@](N)(C(=O)O)c1ccccc1 **Molecular Formula:** C9H11NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_2910>.
CN(Cc1nnc(C2CC2)n1C)C1CCNC1
What is the building block token for the following molecule?
CN(Cc1nnc(C2CC2)n1C)C1CCNC1
<BB_2910>
What is the molecular formula for <BB_2910>?
The molecular formula for <BB_2910> (CN(Cc1nnc(C2CC2)n1C)C1CCNC1) is C12H21N5.
Describe the ring structures in building block <BB_2910>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2910>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2910>.
**Token:** <BB_2910> **SMILES:** CN(Cc1nnc(C2CC2)n1C)C1CCNC1 **Molecular Formula:** C12H21N5 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2911>.
CCSc1nc2ccc(N)cc2s1
What is the building block token for the following molecule?
CCSc1nc2ccc(N)cc2s1
<BB_2911>
What is the molecular formula for <BB_2911>?
The molecular formula for <BB_2911> (CCSc1nc2ccc(N)cc2s1) is C9H10N2S2.
Describe the ring structures in building block <BB_2911>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2911>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2911>.
**Token:** <BB_2911> **SMILES:** CCSc1nc2ccc(N)cc2s1 **Molecular Formula:** C9H10N2S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_2912>.
Cc1nc(C(=O)O)ccc1C(F)(F)F
What is the building block token for the following molecule?
Cc1nc(C(=O)O)ccc1C(F)(F)F
<BB_2912>
What is the molecular formula for <BB_2912>?
The molecular formula for <BB_2912> (Cc1nc(C(=O)O)ccc1C(F)(F)F) is C8H6F3NO2.
Describe the ring structures in building block <BB_2912>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2912>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2912>.
**Token:** <BB_2912> **SMILES:** Cc1nc(C(=O)O)ccc1C(F)(F)F **Molecular Formula:** C8H6F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2913>.
N#Cc1ccc(CN2CCOCC2)cc1
What is the building block token for the following molecule?
N#Cc1ccc(CN2CCOCC2)cc1
<BB_2913>
What is the molecular formula for <BB_2913>?
The molecular formula for <BB_2913> (N#Cc1ccc(CN2CCOCC2)cc1) is C12H14N2O.
Describe the ring structures in building block <BB_2913>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2913>.
The molecule contains the following groups: Tertiary Amine, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2913>.
**Token:** <BB_2913> **SMILES:** N#Cc1ccc(CN2CCOCC2)cc1 **Molecular Formula:** C12H14N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2914>.
Cc1ccnc(CN)n1.Cl.Cl
What is the building block token for the following molecule?
Cc1ccnc(CN)n1.Cl.Cl
<BB_2914>
What is the molecular formula for <BB_2914>?
The molecular formula for <BB_2914> (Cc1ccnc(CN)n1.Cl.Cl) is C6H11Cl2N3.
Describe the ring structures in building block <BB_2914>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2914>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2914>.
**Token:** <BB_2914> **SMILES:** Cc1ccnc(CN)n1.Cl.Cl **Molecular Formula:** C6H11Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2915>.
CCn1cc(CCCN)cn1
What is the building block token for the following molecule?
CCn1cc(CCCN)cn1
<BB_2915>
What is the molecular formula for <BB_2915>?
The molecular formula for <BB_2915> (CCn1cc(CCCN)cn1) is C8H15N3.
Describe the ring structures in building block <BB_2915>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2915>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2915>.
**Token:** <BB_2915> **SMILES:** CCn1cc(CCCN)cn1 **Molecular Formula:** C8H15N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2916>.
Cl.F[C@@H]1CCNC[C@H]1F
What is the building block token for the following molecule?
Cl.F[C@@H]1CCNC[C@H]1F
<BB_2916>
What is the molecular formula for <BB_2916>?
The molecular formula for <BB_2916> (Cl.F[C@@H]1CCNC[C@H]1F) is C5H10ClF2N.
Describe the ring structures in building block <BB_2916>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.