instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2916>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2916>.
**Token:** <BB_2916> **SMILES:** Cl.F[C@@H]1CCNC[C@H]1F **Molecular Formula:** C5H10ClF2N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2917>.
CCC(CO)N1CCNCC1
What is the building block token for the following molecule?
CCC(CO)N1CCNCC1
<BB_2917>
What is the molecular formula for <BB_2917>?
The molecular formula for <BB_2917> (CCC(CO)N1CCNCC1) is C8H18N2O.
Describe the ring structures in building block <BB_2917>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2917>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2917>.
**Token:** <BB_2917> **SMILES:** CCC(CO)N1CCNCC1 **Molecular Formula:** C8H18N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2918>.
N#Cc1ccc(C(=O)NNC(=O)CCl)cc1
What is the building block token for the following molecule?
N#Cc1ccc(C(=O)NNC(=O)CCl)cc1
<BB_2918>
What is the molecular formula for <BB_2918>?
The molecular formula for <BB_2918> (N#Cc1ccc(C(=O)NNC(=O)CCl)cc1) is C10H8ClN3O2.
Describe the ring structures in building block <BB_2918>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2918>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2918>.
**Token:** <BB_2918> **SMILES:** N#Cc1ccc(C(=O)NNC(=O)CCl)cc1 **Molecular Formula:** C10H8ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2919>.
Cc1ncc(B2OC(C)(C)C(C)(C)O2)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
Cc1ncc(B2OC(C)(C)C(C)(C)O2)cc1[N+](=O)[O-]
<BB_2919>
What is the molecular formula for <BB_2919>?
The molecular formula for <BB_2919> (Cc1ncc(B2OC(C)(C)C(C)(C)O2)cc1[N+](=O)[O-]) is C12H17BN2O4.
Describe the ring structures in building block <BB_2919>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2919>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2919>.
**Token:** <BB_2919> **SMILES:** Cc1ncc(B2OC(C)(C)C(C)(C)O2)cc1[N+](=O)[O-] **Molecular Formula:** C12H17BN2O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_2920>.
CC(=O)N1CCCc2cc(Br)ccc21
What is the building block token for the following molecule?
CC(=O)N1CCCc2cc(Br)ccc21
<BB_2920>
What is the molecular formula for <BB_2920>?
The molecular formula for <BB_2920> (CC(=O)N1CCCc2cc(Br)ccc21) is C11H12BrNO.
Describe the ring structures in building block <BB_2920>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2920>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2920>.
**Token:** <BB_2920> **SMILES:** CC(=O)N1CCCc2cc(Br)ccc21 **Molecular Formula:** C11H12BrNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2921>.
O=C(O)c1c(Br)cc(F)c(Cl)c1F
What is the building block token for the following molecule?
O=C(O)c1c(Br)cc(F)c(Cl)c1F
<BB_2921>
What is the molecular formula for <BB_2921>?
The molecular formula for <BB_2921> (O=C(O)c1c(Br)cc(F)c(Cl)c1F) is C7H2BrClF2O2.
Describe the ring structures in building block <BB_2921>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2921>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2921>.
**Token:** <BB_2921> **SMILES:** O=C(O)c1c(Br)cc(F)c(Cl)c1F **Molecular Formula:** C7H2BrClF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2922>.
CCOC(=O)c1cc(C)c(Br)c(S(N)(=O)=O)c1
What is the building block token for the following molecule?
CCOC(=O)c1cc(C)c(Br)c(S(N)(=O)=O)c1
<BB_2922>
What is the molecular formula for <BB_2922>?
The molecular formula for <BB_2922> (CCOC(=O)c1cc(C)c(Br)c(S(N)(=O)=O)c1) is C10H12BrNO4S.
Describe the ring structures in building block <BB_2922>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2922>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2922>.
**Token:** <BB_2922> **SMILES:** CCOC(=O)c1cc(C)c(Br)c(S(N)(=O)=O)c1 **Molecular Formula:** C10H12BrNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2923>.
Nc1cc2ccccc2c2cccnc12
What is the building block token for the following molecule?
Nc1cc2ccccc2c2cccnc12
<BB_2923>
What is the molecular formula for <BB_2923>?
The molecular formula for <BB_2923> (Nc1cc2ccccc2c2cccnc12) is C13H10N2.
Describe the ring structures in building block <BB_2923>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2923>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2923>.
**Token:** <BB_2923> **SMILES:** Nc1cc2ccccc2c2cccnc12 **Molecular Formula:** C13H10N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2924>.
O=C=NC(c1ccccc1)c1ccccc1
What is the building block token for the following molecule?
O=C=NC(c1ccccc1)c1ccccc1
<BB_2924>
What is the molecular formula for <BB_2924>?
The molecular formula for <BB_2924> (O=C=NC(c1ccccc1)c1ccccc1) is C14H11NO.
Describe the ring structures in building block <BB_2924>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2924>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2924>.
**Token:** <BB_2924> **SMILES:** O=C=NC(c1ccccc1)c1ccccc1 **Molecular Formula:** C14H11NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2925>.
CCC(C(N)=O)N1CCCC1=O
What is the building block token for the following molecule?
CCC(C(N)=O)N1CCCC1=O
<BB_2925>
What is the molecular formula for <BB_2925>?
The molecular formula for <BB_2925> (CCC(C(N)=O)N1CCCC1=O) is C8H14N2O2.
Describe the ring structures in building block <BB_2925>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2925>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2925>.
**Token:** <BB_2925> **SMILES:** CCC(C(N)=O)N1CCCC1=O **Molecular Formula:** C8H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2926>.
Nc1ncc(CO)cn1
What is the building block token for the following molecule?
Nc1ncc(CO)cn1
<BB_2926>
What is the molecular formula for <BB_2926>?
The molecular formula for <BB_2926> (Nc1ncc(CO)cn1) is C5H7N3O.
Describe the ring structures in building block <BB_2926>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2926>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2926>.
**Token:** <BB_2926> **SMILES:** Nc1ncc(CO)cn1 **Molecular Formula:** C5H7N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2927>.
C[C@@H]1CNCC(C)(C)O1.Cl
What is the building block token for the following molecule?
C[C@@H]1CNCC(C)(C)O1.Cl
<BB_2927>
What is the molecular formula for <BB_2927>?
The molecular formula for <BB_2927> (C[C@@H]1CNCC(C)(C)O1.Cl) is C7H16ClNO.
Describe the ring structures in building block <BB_2927>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2927>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2927>.
**Token:** <BB_2927> **SMILES:** C[C@@H]1CNCC(C)(C)O1.Cl **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2928>.
CCOC(=O)N1CCC(S(=O)(=O)Cl)CC1
What is the building block token for the following molecule?
CCOC(=O)N1CCC(S(=O)(=O)Cl)CC1
<BB_2928>
What is the molecular formula for <BB_2928>?
The molecular formula for <BB_2928> (CCOC(=O)N1CCC(S(=O)(=O)Cl)CC1) is C8H14ClNO4S.
Describe the ring structures in building block <BB_2928>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2928>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2928>.
**Token:** <BB_2928> **SMILES:** CCOC(=O)N1CCC(S(=O)(=O)Cl)CC1 **Molecular Formula:** C8H14ClNO4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2929>.
NC(=O)NCC(F)(F)F
What is the building block token for the following molecule?
NC(=O)NCC(F)(F)F
<BB_2929>
What is the molecular formula for <BB_2929>?
The molecular formula for <BB_2929> (NC(=O)NCC(F)(F)F) is C3H5F3N2O.
Describe the ring structures in building block <BB_2929>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2929>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2929>.
**Token:** <BB_2929> **SMILES:** NC(=O)NCC(F)(F)F **Molecular Formula:** C3H5F3N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2930>.
Nc1nc(-c2cnccn2)cs1
What is the building block token for the following molecule?
Nc1nc(-c2cnccn2)cs1
<BB_2930>
What is the molecular formula for <BB_2930>?
The molecular formula for <BB_2930> (Nc1nc(-c2cnccn2)cs1) is C7H6N4S.
Describe the ring structures in building block <BB_2930>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2930>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2930>.
**Token:** <BB_2930> **SMILES:** Nc1nc(-c2cnccn2)cs1 **Molecular Formula:** C7H6N4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2931>.
CN(C)C1CCC2NCCOC2C1
What is the building block token for the following molecule?
CN(C)C1CCC2NCCOC2C1
<BB_2931>
What is the molecular formula for <BB_2931>?
The molecular formula for <BB_2931> (CN(C)C1CCC2NCCOC2C1) is C10H20N2O.
Describe the ring structures in building block <BB_2931>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2931>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2931>.
**Token:** <BB_2931> **SMILES:** CN(C)C1CCC2NCCOC2C1 **Molecular Formula:** C10H20N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2932>.
NCc1cnn(CC(F)(F)F)c1
What is the building block token for the following molecule?
NCc1cnn(CC(F)(F)F)c1
<BB_2932>
What is the molecular formula for <BB_2932>?
The molecular formula for <BB_2932> (NCc1cnn(CC(F)(F)F)c1) is C6H8F3N3.
Describe the ring structures in building block <BB_2932>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2932>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2932>.
**Token:** <BB_2932> **SMILES:** NCc1cnn(CC(F)(F)F)c1 **Molecular Formula:** C6H8F3N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2933>.
CC(C)(C)OC(=O)Nc1cccnc1C(F)(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1cccnc1C(F)(F)F
<BB_2933>